From 76a583e2e406fc8f76d719aea3bd392c85456401 Mon Sep 17 00:00:00 2001 From: Khulekani Ngongoma Date: Tue, 26 Mar 2013 20:38:51 +0200 Subject: [PATCH 1/6] setup the development environment and adds a user interface --- deplist.txt | 17 + public/css/icons/Action_Icons.xls | Bin 0 -> 102912 bytes public/css/icons/ic_add.png | Bin 0 -> 439 bytes public/css/icons/ic_add_folder.png | Bin 0 -> 627 bytes public/css/icons/ic_add_to_contacts.png | Bin 0 -> 1369 bytes public/css/icons/ic_bbm.png | Bin 0 -> 836 bytes public/css/icons/ic_cancel.png | Bin 0 -> 1440 bytes public/css/icons/ic_cancel_selection.png | Bin 0 -> 1752 bytes public/css/icons/ic_check_spelling.png | Bin 0 -> 1422 bytes public/css/icons/ic_collapse.png | Bin 0 -> 487 bytes public/css/icons/ic_copy.png | Bin 0 -> 737 bytes public/css/icons/ic_copy_link.png | Bin 0 -> 940 bytes public/css/icons/ic_copy_link_image.png | Bin 0 -> 1370 bytes public/css/icons/ic_copy_password.png | Bin 0 -> 781 bytes public/css/icons/ic_cut.png | Bin 0 -> 1147 bytes public/css/icons/ic_delete.png | Bin 0 -> 896 bytes public/css/icons/ic_deselect.png | Bin 0 -> 1447 bytes public/css/icons/ic_disable.png | Bin 0 -> 971 bytes public/css/icons/ic_done.png | Bin 0 -> 943 bytes public/css/icons/ic_edit.png | Bin 0 -> 931 bytes public/css/icons/ic_edit_profile.png | Bin 0 -> 1841 bytes public/css/icons/ic_email.png | Bin 0 -> 952 bytes public/css/icons/ic_enable.png | Bin 0 -> 961 bytes public/css/icons/ic_expand.png | Bin 0 -> 540 bytes public/css/icons/ic_forward_as_bbm.png | Bin 0 -> 1131 bytes public/css/icons/ic_forward_as_email.png | Bin 0 -> 1145 bytes public/css/icons/ic_forward_as_text.png | Bin 0 -> 793 bytes public/css/icons/ic_help.png | Bin 0 -> 1685 bytes public/css/icons/ic_info.png | Bin 0 -> 1605 bytes public/css/icons/ic_lock.png | Bin 0 -> 759 bytes public/css/icons/ic_map.png | Bin 0 -> 1966 bytes public/css/icons/ic_move.png | Bin 0 -> 1075 bytes public/css/icons/ic_nav_to.png | Bin 0 -> 1429 bytes public/css/icons/ic_next.png | Bin 0 -> 930 bytes public/css/icons/ic_open.png | Bin 0 -> 669 bytes public/css/icons/ic_open_link.png | Bin 0 -> 722 bytes public/css/icons/ic_overflow_action.png | Bin 0 -> 509 bytes public/css/icons/ic_overflow_tab.png | Bin 0 -> 506 bytes public/css/icons/ic_paste.png | Bin 0 -> 769 bytes public/css/icons/ic_previous.png | Bin 0 -> 924 bytes public/css/icons/ic_rename.png | Bin 0 -> 1439 bytes public/css/icons/ic_rotate.png | Bin 0 -> 1269 bytes public/css/icons/ic_save.png | Bin 0 -> 871 bytes public/css/icons/ic_save_as.png | Bin 0 -> 1051 bytes public/css/icons/ic_search.png | Bin 0 -> 1425 bytes public/css/icons/ic_select.png | Bin 0 -> 797 bytes public/css/icons/ic_select_more.png | Bin 0 -> 804 bytes public/css/icons/ic_select_text.png | Bin 0 -> 1210 bytes public/css/icons/ic_select_text_all.png | Bin 0 -> 487 bytes public/css/icons/ic_settings.png | Bin 0 -> 1375 bytes public/css/icons/ic_share.png | Bin 0 -> 1217 bytes public/css/icons/ic_show_dialpad.png | Bin 0 -> 736 bytes public/css/icons/ic_show_vkb.png | Bin 0 -> 616 bytes public/css/icons/ic_textmessage.png | Bin 0 -> 477 bytes public/css/icons/ic_to_bottom.png | Bin 0 -> 959 bytes public/css/icons/ic_to_top.png | Bin 0 -> 908 bytes public/css/icons/ic_view_details.png | Bin 0 -> 315 bytes public/css/icons/ic_view_grid.png | Bin 0 -> 401 bytes public/css/icons/ic_view_list.png | Bin 0 -> 426 bytes public/css/icons/ic_zoom_in.png | Bin 0 -> 1507 bytes public/css/icons/ic_zoom_out.png | Bin 0 -> 1468 bytes public/css/images/ajax-loader.gif | Bin 0 -> 7825 bytes public/css/images/icons-18-black.png | Bin 0 -> 1767 bytes public/css/images/icons-18-white.png | Bin 0 -> 1806 bytes public/css/images/icons-36-black.png | Bin 0 -> 3611 bytes public/css/images/icons-36-white.png | Bin 0 -> 3648 bytes public/css/jquery.mobile-1.2.0.css | 2332 +++++ public/css/mainstyle.css | 189 + public/css/mobile-s.css | 909 ++ public/css/themes/mobile-super-white.css | 909 ++ .../background/watermelon-duck-outline.png | Bin 0 -> 5919 bytes public/images/color-swatch-brown.png | Bin 0 -> 153 bytes public/images/color-swatch-erase.png | Bin 0 -> 240 bytes public/images/color-swatch-green.png | Bin 0 -> 153 bytes public/images/color-swatch-purple.png | Bin 0 -> 153 bytes public/images/color-swatch-yellow.png | Bin 0 -> 153 bytes public/images/crayon-background.png | Bin 0 -> 5688 bytes public/images/crayon-outline.png | Bin 0 -> 1312 bytes public/images/crayon-texture.png | Bin 0 -> 7361 bytes public/images/eraser-background.png | Bin 0 -> 5632 bytes public/images/eraser-outline.png | Bin 0 -> 815 bytes public/images/marker-background.png | Bin 0 -> 5938 bytes public/images/marker-outline.png | Bin 0 -> 1341 bytes public/index.html | 206 + public/js/drawingApp.js | 452 + public/js/excanvas.js | 924 ++ public/js/jquery-1.8.0.js | 9227 +++++++++++++++++ public/js/jquery.mobile-1.2.0.js | 9162 ++++++++++++++++ public/js/logic.js | 1 + server.js | 37 + 90 files changed, 24365 insertions(+) create mode 100644 deplist.txt create mode 100644 public/css/icons/Action_Icons.xls create mode 100644 public/css/icons/ic_add.png create mode 100644 public/css/icons/ic_add_folder.png create mode 100644 public/css/icons/ic_add_to_contacts.png create mode 100644 public/css/icons/ic_bbm.png create mode 100644 public/css/icons/ic_cancel.png create mode 100644 public/css/icons/ic_cancel_selection.png create mode 100644 public/css/icons/ic_check_spelling.png create mode 100644 public/css/icons/ic_collapse.png create mode 100644 public/css/icons/ic_copy.png create mode 100644 public/css/icons/ic_copy_link.png create mode 100644 public/css/icons/ic_copy_link_image.png create mode 100644 public/css/icons/ic_copy_password.png create mode 100644 public/css/icons/ic_cut.png create mode 100644 public/css/icons/ic_delete.png create mode 100644 public/css/icons/ic_deselect.png create mode 100644 public/css/icons/ic_disable.png create mode 100644 public/css/icons/ic_done.png create mode 100644 public/css/icons/ic_edit.png create mode 100644 public/css/icons/ic_edit_profile.png create mode 100644 public/css/icons/ic_email.png create mode 100644 public/css/icons/ic_enable.png create mode 100644 public/css/icons/ic_expand.png create mode 100644 public/css/icons/ic_forward_as_bbm.png create mode 100644 public/css/icons/ic_forward_as_email.png create mode 100644 public/css/icons/ic_forward_as_text.png create mode 100644 public/css/icons/ic_help.png create mode 100644 public/css/icons/ic_info.png create mode 100644 public/css/icons/ic_lock.png create mode 100644 public/css/icons/ic_map.png create mode 100644 public/css/icons/ic_move.png create mode 100644 public/css/icons/ic_nav_to.png create mode 100644 public/css/icons/ic_next.png create mode 100644 public/css/icons/ic_open.png create mode 100644 public/css/icons/ic_open_link.png create mode 100644 public/css/icons/ic_overflow_action.png create mode 100644 public/css/icons/ic_overflow_tab.png create mode 100644 public/css/icons/ic_paste.png create mode 100644 public/css/icons/ic_previous.png create mode 100644 public/css/icons/ic_rename.png create mode 100644 public/css/icons/ic_rotate.png create mode 100644 public/css/icons/ic_save.png create mode 100644 public/css/icons/ic_save_as.png create mode 100644 public/css/icons/ic_search.png create mode 100644 public/css/icons/ic_select.png create mode 100644 public/css/icons/ic_select_more.png create mode 100644 public/css/icons/ic_select_text.png create mode 100644 public/css/icons/ic_select_text_all.png create mode 100644 public/css/icons/ic_settings.png create mode 100644 public/css/icons/ic_share.png create mode 100644 public/css/icons/ic_show_dialpad.png create mode 100644 public/css/icons/ic_show_vkb.png create mode 100644 public/css/icons/ic_textmessage.png create mode 100644 public/css/icons/ic_to_bottom.png create mode 100644 public/css/icons/ic_to_top.png create mode 100644 public/css/icons/ic_view_details.png create mode 100644 public/css/icons/ic_view_grid.png create mode 100644 public/css/icons/ic_view_list.png create mode 100644 public/css/icons/ic_zoom_in.png create mode 100644 public/css/icons/ic_zoom_out.png create mode 100644 public/css/images/ajax-loader.gif create mode 100644 public/css/images/icons-18-black.png create mode 100644 public/css/images/icons-18-white.png create mode 100644 public/css/images/icons-36-black.png create mode 100644 public/css/images/icons-36-white.png create mode 100644 public/css/jquery.mobile-1.2.0.css create mode 100644 public/css/mainstyle.css create mode 100644 public/css/mobile-s.css create mode 100644 public/css/themes/mobile-super-white.css create mode 100644 public/images/background/watermelon-duck-outline.png create mode 100644 public/images/color-swatch-brown.png create mode 100644 public/images/color-swatch-erase.png create mode 100644 public/images/color-swatch-green.png create mode 100644 public/images/color-swatch-purple.png create mode 100644 public/images/color-swatch-yellow.png create mode 100644 public/images/crayon-background.png create mode 100644 public/images/crayon-outline.png create mode 100644 public/images/crayon-texture.png create mode 100644 public/images/eraser-background.png create mode 100644 public/images/eraser-outline.png create mode 100644 public/images/marker-background.png create mode 100644 public/images/marker-outline.png create mode 100644 public/index.html create mode 100644 public/js/drawingApp.js create mode 100644 public/js/excanvas.js create mode 100644 public/js/jquery-1.8.0.js create mode 100644 public/js/jquery.mobile-1.2.0.js create mode 100644 public/js/logic.js create mode 100644 server.js diff --git a/deplist.txt b/deplist.txt new file mode 100644 index 0000000..72c4013 --- /dev/null +++ b/deplist.txt @@ -0,0 +1,17 @@ +# +# This file contains a list of Node modules and optionally version +# (one per line) of the form: @ +# to install alongside your app ("locally") on the OpenShift environment. +# + +# Any blank lines or lines starting with a hash (#) are ignored. +# E.g. uncomment the next line to install sqlite3 +#sqlite3 + +# +# For a list of globally installed modules - see file: npm_global_module_list. +# +# Note: You can override a globally available module by specifying it in this +# file or packaging it in the node_modules/ directory. Node will give +# preference to the "locally" installed version of that module. +# diff --git a/public/css/icons/Action_Icons.xls b/public/css/icons/Action_Icons.xls new file mode 100644 index 0000000000000000000000000000000000000000..4dffe42736b1a5ff3769e8396f743e8c7f2a77e7 GIT binary patch literal 102912 zcmeFZ2{@J87eD@PTSDpL|d6d5xl z^AwVh-#(-(sc-lB-{=4Q|IhP#-OuTL*V%im^{%z{+T*z`&E);p@6ioFJ1!Xr3;MQB z0O4+lpz-HQ%4Vt*@_dkKTD|4%Hi2K0OZe1-*p4S)lH@i`s+z&-$806qYI00Dsg0D=HQ0KxzV07L)|0*C?}0uTcb2ao`e1dsxd z29N=e1waAF0muU=04M?|0Vo3;22cS|1vmn56hI9?9Y6y>6F>_<8$bu(7=SLoaexy5 zdI0(W1^_1kP5~GKoCYugFa|IIFa-3&1%5R{%EvcK{CnPXI4~^8nre7XW+!d;u;3paFCMCr3~d3EtcR{Oht&1AOt9 z7d42Otx$)9I!JuXCj?b&d~TQ$nk7e3-+K27R&mw!vrXqK*mKPHo5g^g9Dz(*$ZSIo z%v=7uivohfutAkA9sZ^^MzoS2Y@;X+@SGd4sy*-o=G|3+6|6RN!cbg+{T(;#{X4$g zKt6^O763+v-<8`*fAgJy1ES6mL;ywy%MB0wJAK4}{H=HYTlpA!F>Jm*M1T)kF)j{t zoB0*qOOV}h!IuLN94f@F1fLKz2w(^z4cx07LH@sY$#3Xj3d8770d$py;R5a8z|JY) z69MuH<{RLB@JYGxS+G&IeB)CZd~+FQ17V*~;KXDBOuwZMM{Sgg*!X1K_#_3NFzCTX zovsav5XeqFpgcYliLnqIx`YQ)0Fht^BEbwqhz-a%|KBP>@IN)B`X41=Aaj;u4Efu) zg@JzH&n4g>{Zr_U@0{uDYv5hgR>_cv8 z_WjY2dxK!eBl(@c%Fhb)Hs(ed11SPvH~e3>^nNZqOJ0 zFa5u;1ICIl2)SiUkjZw~x#as-*y%sp{|EifZ|JvvL%;hQdh&1R1;3%^|AwCW8+zDp z=)cqFcl?Vt_}~JwY}o&Y9nyY7-_+;V@|*hnO3(TYpL@Tdm;8qQ^f&a--_RfZhW>B$ zxxc{&?-%=Q#tCL-v|+bca`FVC1R@AKexp3W54x4rGv;T^5cY!&Iu6Jo8|A-%0vp#> zeDeH;&i5PozFp~<8QN~`h-i!c!@ryHjG4)8lz+1^iD3p~tPMRev%76{P<@k*nelz6 zBf%}0{OzDG0P4oINe2Zs%m1*?X8eP(<`y3la7(wvhkT3vL(kja?e@KV3OPA75jC)L z(gvMkt32SpY3EJ*hMqg@jG3Ko(0AxbwMBn}nTW~!umffmyIXlc26+a&1?ELC z*Y`Ywx!s^^VeY_%D~r5&K1udL@MC^ml5BdB=#}t5rnKjkMECMs^#B{2l zJK9GIdJ6cj6*fnv|DwX?;O<{kz)WZUl}ea7#lNb6=>q>%1x$|lR~7L7Z3T=|{*?qw zbN^QrFzxhTRlqdhe^mj~vj0^DOq2gt6)?HrUsb>)gFjY~+tD5{jSK7d?E!nEp;%gB zLT+V0>>V(l+r|Vu{M?spwjJREfA$WT@BIyvKYNGi@0k4AJD^AY8%_S~9pv9J`LlOe z{*K9?y#uDm|NC_|7vg{40NMVI$)CN${&!6N>>ZB3WAbP3aQ+>WKYNGk@0k4AJKR5* zV8%-+5bpX<<1kFy!F;j)qG|mf??mnBym&wfyp7HaQ}(M5v^$eepFaIyg7=;A#ful$ zk>4-;U1$W`Xn^;|MYs#i2Y;th`#{-Er7#0K%(d&AWoKvqqLi$x>@P}fr)?>Pp>49p zEJ|%!YCG-MQ7kVg{>O2_&T%r|zpcRkZz~A=+Y0-CRKR!} z*70+Ntr)AF*&bs%$2MR&YFiq?xb!EfnApJ(|D5E(8r=V8vM&2)CI|k8$1Io*?X+K05Lg=C7J0u|>emXGZRFpF zD$ED}_>S&C3RJ-U{aglP_nl33d-L7u4t~`{`iCYPeG=%Fe#!yAR*?BoVb`emH5O$- zh5tDoJwS=E+E#ZM1E&B>BVbA?EXaZ6N6ML-TRON3MdPbO(U|`G`vt>hS|7&vW!hiz%qJv_ILgSp3u0WZmcSrNgAA>S!R_*XHke-N{o z{x-zmSXzDR?b%%n#ZEB?eig&{2QixoazhNRrPcUc@9ttKcZw1DRm{FWh{2>#EYQ?} zq3|rNhWjUX7elpE%)wv92>d||Ch>k3gAaT&J-@q{Jv+sS{whZJ4`Mb`>Bid-SX!-( zb?z>P8Y4#J&ymIq#EASwq&2ENZ2Yjhn7up2>=J2ge-N`h(i+u1K6<#j7@D18c8N5u zKZw~LX^mJ9qHA|CbUVfD5^4MYAZB}{HL8{Nj_xjo zey5mSBJIE*#B7hWMzz(qCA*7Zz=#q3bEF}G7}39oG~okr#T}bsFbNG@KXMx5PBFVg z8v7r_Y>zbI1Dy$RyNhAkDQ1^QGmiB8#G$#yEA3~hbf4kolH4)Fx?(A z5R_bIusc(Zf0%-3*~ye=2h;5l0zqht%-xxC{=*c+#!jaEJD6^d2XO8$zjk+~T>mfy zk+74g&<>{Cy$?Z4@yfd~#Rn%I!PrdR)FK*R{AbU@=-08pIYm>*;ztjR0|wxjr3lRE z2y>5FulSxx5a5&q*f~%zwKI3KGj+9bbcn|H`A@Drze7+o?_r+;Oqz315r3*X>N;Du(Y#_ z#=p2juf6MpK(8}kFlY{r1tP({CD0CY^zk39FzXZ>gTn2NbW1DDh#&WdR+~>-T5UdU zX|?$j1ILDV(OB!z_{g7C!NCGT6u{}c&C`KE7KACwhsFhExp$Ps1!txIDT@T>Jq0(; zdT!R?M`MFJoIC1Zuj7L{Zs1gz%f{H({QKEUj1&Ph9;hL(qXynO@h>%gmbC|*j0O8A zN}f)3rVggAjxJtET}w~bX#B%Jvw|O7M}Q-rp5SO7#`g{z{>L1}^a3{51?qT$c)-kc zw!DvV_V@520PhBt1r9qpfHjn|%nHhu z(=f{{{|}o#0t}EqUQ)Ahu(h=K-u{p7P=*HNCAAGl+XAOs{FDK(enjJsT(p&aFv}{q zz;MLiXFNHw7%dd=GdK zQfLS?#{)m>3WI=14G`%r8^?z+tiD?x25$eEtP+4TiGYQMqpM{!zS++_;Dn&PV0gF! zr7*|uF|(cxRlw@ZR!YOHto)N`H=njr+UC<%O51#jffIp)?_lj-)6I3m;~qPN?g6Yd zH*D~$&$p+1Oosf)=NQ62nruF8X|nmWrODVSW>F~A3fp<7pvV1{S3u1fl@#~iI( zJxpCJAvp_2GfSkZy{WaO4(OY_oL^c3O>v@C73Fk2yCzdk=?sZcU7osYfKJa*HJe^& zRFLFF=9`${q~;?FFA1E03}B`>etRI^3aLhv0Q<+*wMj3~o82Qv5 zq;{Sa@KQgDl>>dsZAGLT8`(c}GT|gU&2T=Ur8A5n4>mt0+tS5+sS=L@8*i~IR8Kq@ zLR6mi>8ExzAWMa(&U?KO=xJcpnBnYkB%2;Sfon#Ha_xC7+*AjnY`8)BiC*?VT`Nir z8m08~QE)+D7WK2Sgc%S9Yc}s64LJ3Mv%xR*G8}!5|8+G(1Z(_d|xveua5o%eAkM=cE9EoN8=zev7UnR z9P2pb={E|tioMxre8H~pyq>_*1+N&-92#friV`b1eu@43=%uGh3wx()1a8L~j4BeK zC{8aFe$(czp@qGePFmt@spA-(NjV|FJHSH8PiIQTzO<@}-e;W(Zf>>_(f` zQzu?WMY5T91c|$Rl+JTzA3yb`hu=l4t?l-=TfHi&MAZiyuit^QzwXc+3!)2d%dK8$ z{2;7gEs_7p`c`dJiALDSQz?y}9G5UM69M7JgQu@tIG1G?nM=7?yEy-Fj_9z%vc_BcV2So4jlUorXXD(4K@$y4_e#dU=1l4HNs1=VreKm68u8EG)w ze1knQH=)&7MMH!}NmMWYVt?I>F*RHj<2Pi3FGIrAQ31#?1|F;|)LM3ra?#V$dcKRC zE(``Klvv7?B+Vy%xGxsgo&{ z;_>s49Ua$(o3CMI)lo!Pi?ubJE)x!FAayZM9jnvEja1BuYh_+WTt6W2gn~jbIgEG@P%#mQeLPDq zqfk~UPHdsgR^c$;9^?ZTiRe+=Fc%it8sw@MKfjuKMWVS!t;I?C5pT~jL}xfIVL1Ib`_sTd!v}lk_#O5)iLVjW2D@AE z5TPp=x~i297rBR~&i5JD-4(n{FC@|O=;@Jbs#gML20EH^A2goUFQJ^9evyCLgzUz> z8$D6s3Q+crE2X{II`treU7GO%nk=}eXeWxu?#O%_aK~LOcKT?R>XRZ5_yRd zL6CqucFY5~i`gV2)P*<5KNol-v(`Q{u(Go9K-yebS~~S$d~O&=Qnf}c1y?nN`OVhG zMm4rC^PfMvUk+nDPGhO?g7rU&{L-DqJ>_k;Q|Lr@Ptm zb)?+4$>ye}Zvu|xPoL`CxUIcMOXf40)ZqAKMBM0b9822_n?ID6yWjnqdw6#$z0eHD zkdk+mdlQbWtK*AJCqvqvtpNz^UO&y^hw3)4*FE?u$eMq8gE&GO8Ts>P~I_qp0 z4Da!Lok;kq{7qZRb;&x}ZxO04v7Ma{_->QC!V_e%JaZ2_h55%GuH!NKUK2QCyyRIiXRPrZn+e>P9f0iXvOg^>HzzPlXjNz zt)w=ApV|5FZ|XQ%+7KueF@1&Akz5&wzBxoQbXMR1jEAS@abdg9^YdZO)u{;ydy~&; zYDFYyRRx;0#J4xdxWq;FxLHnLFp?QLF0Zw&d#51lKoeu#*Zx(aPSZ%4aViz-Ys9Oc z*}B98*E<@X-rdvG+m~!?I2swsU6Fb*>%Hb@#Kv z@vWw#BaQpfNf6UuU&7uB`(AVLWo|4}J=w!+*QtqoJe<#D=y9oYe<`WS$;sJg_SG7_?e<>0;@j-8Hl{=HE*YQ(W1IM*T=L{dvX0w%YR9*T|J)IoX?|Zk$ zjV$*49>$5tqeDieSBLe@o|Nxpd&e2pNs=FEnWFeG|An)yScZ9ptBSi6jybu z$+S7O4e=92HBG!0pXVXn*0kOtpgRb(fQP8F$tyRadIzd8G4s@u3hcJrM292^49Gj{ z>123Rm>=a|vPhllp&e>aY`fs;DOP`>*U8?Aj|RoRfB*gtoz`q$krjf@!zUFKbNEQj zUCfC2W+%_bi>iz^-0LY1Cq{O+eIAmY@jQA+MltBZ2gs`MY+m2{_mVfp**atk$`5YlAcFtAnzeu*T*mJAI4FY2t3;TSU&c4@aK%G+qZAq zoXUEWxK4U_qFgMn3f0%wCt)-ChLlypfn#k{5qZ2r1FrM7fU)NO{ezA*Uu{liwbLUK zRpEKI!ED8GR9UX}AI4w3il999Ec?D>n43$ado-bevGL5kx@*Ynrue&v)24ga?7ag0 zKxT2r)z5r0Ha^}oVrEs^GPatFd}|;{$UfaoE0b5dYab8L=+$ZUBsLxao;a#$;cW`j{%2Rhj_QGqfOUj%U$Ed$9 z^u}h_^0up_N@}ROUsbX?|IAwNA<6lR=BBr8>YHBQ9BXesAKtjo3=0>xFb*ZS9>n{x@I`%!mTAwCb!ZVBCfGTnngX<6O8!@! zBiwguM%8U!B}jF7Vjq?(Y#J+)d=%eKOW7nq1EP;5k$~H^1bZL}h+9Zn%@x@R^=mrB z<}R{_1?{U`{(A8v1Cxo8c6r9a_#S+S904Q82}X|^DBapCT$@!O&UDpr;gh zB{Gt!8n@0-zIAVQqp*iQEXqxAHP1i1!Y+LL>ps=2ppxFs_15z z%5+zEm{wjCr*+u0*t9o=3Ob%Pu_^pH#||d zlMlbJ6qPh6{-n{e;D*7&Tng-zkTl(_8^z7TE*G`y2rf0X&`Ky+j}oU|Kj5k?_xT`232HR&((cw*0MSha`dt|b!Vy4L0tGp{I6 zz{mkBDx|#i`_I<-odQAUN5fr6o!c@-dOY(Eq>5iK@mMStcnsx;zDEzdsCVXsvm!G$ zVg#X0Hm-?=K`AK(?{ACQ-q_hd#x@#=;o5_z_9=V&wEE^vn7Ht-uS3rPeP;uC0%*UK z{I41amd5u6a(cpfP!LgjhzE@e&3}2`#(^T}sMMCbOz5;vCAYt|G8?N^4(&HUMutW5 z5X)hzt%qGExi~+LFRYg~;-Y8C8Cjnd8_R%ucROrD)Eb|XV`H=WsUV}*?g!;F@;3}l zpL=9j@3f3#AI$KAw?s8tXU_6cTnYYdt4v}DYXxTC#Hsqoz~E>KpPE#9bJ0W|PKoyY zlZ)zBnRe&k%2gI|GnYduXpV|Nv&%8r#jeV94T{j&M(TJm<*r&G?VG6@IbzDVY7B4B z-p3IV3WRAnhZC1LlR}cZcDAGzA6>0@Gx8tLq|4JmpXN2}7hG|J_Cdr%Hed1|jd)pV zD+|kB5mgK5Jh6rp<~wEAt?^0);){yvw~mseoZpw_MMHq%ILpq-_WBw=mU4j?vgNi$ zxJX`&Gu&R1>1ruATOzZmaws34aZ*0XMMLwvwMr}$#J=DY@rB^nDXKcwj*uSc&BUT& z1Qo1k^tmW!Wb;zFIl=uYC$V6-xGt$#S`y8CCkvaGUrlIb){_H=BK1FOp$etiqwNS$ zSLh=yYa;t{Pw1C%U{$aA%AOTXCfb7~EKeCDLV`_LJnDMLbHo3L4Jz@Jc5Ya)tW9sF_XNKgi6g=B@))UXQPt1Inw&~6L9rh?4u zqUYyh7z%r|L~5^=M03x*%--_R;W4!&mFJ?N_M-HA1+Hexay|0o7c-KYaFw{b?^%~n z6pq9znlmAb$-=U&YvV~x$Jk}BhOW}x39)?Zd;fJ!?lXr6$&ZN*3Oe-O`bONQbc9u7 zot%E|-equ%F{7PBBMq1GBP&0RreKtV!*kIyugXUK7INLQr2|Npa`1x&6lB-i#zf31 z3{syJM@UZT7r9R^o*xL~cA;CMJR$M^4rdiMuEa;`w2*fj>-?)B-9P;TLYQt4*NvGABI&^Gcsn}*w;?1xNZT>@f zGEF>xKi&pMiWAgpalr;j`uZ#U6;P|oRTB!rLBE|1J^?H`-dxJL|J3b_ci1(uE$AzlNrmGq4bSgRb@Z}-1E?ol? zMU`B%mS3-26^Sew!m*R6Yof7CH@7=lI(%wA&4`qT?N!1f5uMD&k#np(Om~WKxkFj) ziV6w}=%ftgjuBmMBR+Y~-u~66aYI!vAtmg{mV?I2Zg(vTuVqFP#%C!DTSw`-u9rQ1 zD$~HAcvXqV3wLUMK4#*SF-x>r47N}NRnC!*^lyWXs>gmbM4bEf<%>Rh(tV2htCEo) zYin!yv=Np2WA~ushvk>YRaa_GzPuw;dZCreDr)dd(oL$;@EcHV6Ng>|aF+g>)jB|=hD(F~~_76X)cOsLNnMB419XLOHQn#duI zjg9TqZ(L1!LBsgfHRz(Ss)i;}A~N%wTWRi<9)B`;NXF{t@f`DSS{d5s+{kSS*eGWn z@*QJ{_*zMKI57LvEqH***_CTWZCPMK9;aFARWbI`LQ;lo;3PK@qBVshIGR29Eh%4> zDlWB66Gct=>yooF&hj-0h55IZYZ|aUKi{@$QmFiRsH?9pO_xv+@$Q=t$?`XCbwhck zJMuX3g@G+#1bKiNseNv|!u+FN!0;J-lT=@x>mRSO9*bA%6u{5KfgTY|v6>+}iG|H2 z9LI5b*h7mxzdDJ?eOg>RuV6mv%{VH{^*(OO_(R#HDG%REBX51aq&zP~Kac3s9}%pu zPU8tCC8=?(UBGIEeGELtdm8@6pyClEqN>d0C;y5zz+KsdzHVg1`XK9m0m$!J8U?!e z4LrGnflQ@>I)i`3o!;Kw>$$3E=Cmg% zAw4gVm2`1xuM(q;7Z}j}Sg`)Q7Byzb|Kon$BF2*Ek~mPU_8PkzkvYYM6F!NOi0ZG3 zf=uxZ86lfTvcD_d`Xk2E4r(el^SB-md>QScC@8}s`ogV82T%l9Q;`R zyi;;!YRW)F)rw;n3v3`m!KnE!t>mc>ba8^I4-YGI!7gga!9I2dsulAcVaH`XgX1`S z6W4^+cg3mdDa^E4VTAYao)ML_|&O9b99oG4`NI$*ss>;93?KdntH8a!A zA$VE&7Sr1Vfgs#=o^>^zxXgU4I;0={bV_to%Lp9B9+=(KU+_@?#k!87P!p*qYtbHZ zD)WqJo`)OeJ}Iv2CW6rRm!O-l3tpi)3QF1%3+EnXt2L#0N0Wpl+-F$=59ESc>3txY6UXGD>Rat5>cN_Z^H=ri7v5 zg3IJ7La&O9WIC)wBL!vE!W2{Q1q>FSGm{EB2nWHzQq_{%HSTi@A3oHm zgwDu<2}{;W zg00oOZs%ka)#c7`A}4|j+TL^>xhx7@zdIBy4y^M9;D`M+*09nbJsbr_1<(*u`drvm*TP6|ohOaPnaMU{pT(&4A7| zom+^ZUWY@GuVP}m>E_#XYP02f93I%txlAwxR%yPE9i1_Hd8wd5`X1C9OY_l{ug+OC zIbw|AmCu?+JrwL!W_ky!vj;mbpYa`Fxv0)9n!BImWP- zXJHJ!aYgB;p1vE(n%_5}cSItrXV}H&o8{qe+Wc;0rBjs*$>+PL+iPY{%iMc3fA)TT ztF-r>6SnKw@J{A#pANMH&51XRGSdy0N@ch^E-Sh7-NcR}qdP2hDO_gnRDw7~j0*kz z?x~*J_rspE=7+w&_dd4+Y z*4+>E;B!1Q(P>AmC{=6ij=guxfpm?qx`-ETh=B?)yr>6Iw$D@Zhs4sYg;Z~7!> z(`vAEUb=ZwE$7&Qk6))&eO4M8@nw!Cm)cwLeLT^t*`#Ng&n2V$`J&jmQF__^7pf!2 zJNKV@5iLxy)NFB)C;KT!Nuus@^l;}Q$4Y8w4UHm!^9f6`H#18|Rjn7a55(U#=u}o@ zjlx%KO>`BIpx`ojSo3x~lB zr!yop!Smw5k2_n`W3btZi@WzZTb(^i(5Q4s-58Aujtl!?GZ(+L@7Sgb2nKxqLzjJ(Du{B%#(m!91ipPCLzPw=xQA z8a*kT6Cj?>PO4GRHr+_Vq{_w5yi)M_gp03m;)lBUVmJ#j7&{6XO|E!J1wp_{E5{y; zt!;gZ+`e&SK5tEaXzm^QDzjixj{tq`+wt*R_Zyd$o?I?>GACrYqI`q(OYbFFO*rZO z0mb ziVF&X%z1J1PGSpK@3<2hO8dV^(!?dcN^t72;T+~8LXeaWJmqzmca9&vz>gKldoDAN zGRE%8P>O#RF?q$2Y%@HSd(q2#h#$Ksq&iLPYaV@qa;4u87nUBsB6 z*CA;OhZDDtAN8XvLBF%$rKUXw*P;(TGcz;8{nqQ0!N;#(9}5%MwxLb53ZJ-9a-i&8 zGLif4C7a{BpN1;t5&Hrb4k4|kz_^b8jIx@ZFj%A;(O%Y8Ie@w!Z(U~8>Ac!eU-<~xtD8CZ~{-YSRZyiUW~ZkO`u!U zXUf9Xw&CQN=WqlbPjE#pG0}NS6Nw^TYWSD;f_U$rl$Yyfxv;J!yxn`w@$5nV1Rqv! zU*FpO(se%eA*Q}7fy)lw-Yae9cPnE(IkmE0j;N%vm@&Te@KS@URlgxtZMj5I`8LIq zL}w`8JbD2?Bn-V4)G_VD@kkp|+}o|GshK&t%vGJ5%9waEGGSnfRi^SF|158zqd^NI z=4pc|7y8biH}304(hdCwLr%5uU8Z(voh&Q zOG)*gB1oe+0Yi{9oeLQOi&>KuE-%y+H5Adlbr@> zn;xe7(Rg@xCm~{f3i1qN>~U;Cs$c`GT*IbbhYr0eFmUOD>C%PZx9o?z;p7sV#l!YR z&9ALJDF^@~i4xq0uI#L+XZVfqifkkW>R^^vkS z?(yAjSHQu&~LY`7qJg{zT`vA5lnmO zRt*8APEH#^21mR#J4COYLZo#-C@C;KQ%Froc%eDEk{XQg2haP-`SSO zIe`793X6sfCp;t>DSwOd-bsE^ocHh(#iH#zpSzIi))Eb6P3CKoBUy|Z1Hke) zOrE$x9z?psCD(^zlYA=y&g~jtnK3@@oyXY9S79V>hv>3@WyNb}1QL36cOh9<9;ctB z9_PUswIE`m1?{ufeRw-*vs0ezBRWkoS1ExG{xHP*bhRtISw0($KlDMMX zbayZ*%Y5A~XCZ+@Cenoz{jyV8Z;-vys#s{*B>j2}=onnpVrg$(ERX$?t07{*7GK0! z+phHa^yS$0;*}KJL2&%$0E%TKmiU^k72iSYk!*RdA+t;P&&AxuU)Z0`tf>?jd4D{C zmgln*hd}fJD&C__X$$R>p>Omx9u7M>GiyS(nrK(t*V~(>Wg_PC0P#Y{E)y< zdmq~K1Zqu3lR^&dvnG4@1vF4=(#kX5NX|sDi+&U%p?HCQ&s6QU24~% zl>Dz6FEyfi!*&Eo$$`X|B`4Sf&SAF5wi(ou}}lI?j$tO-`Lj z;FGOEuMMxtG{JNc*p4ciGe`)G=C=*ZN(>^bae1;S3Qh|o+;k|tNrPrqPIP*IENx%UX{1$#+PhA2&i6y)|g@U|gSnyv3-?u*h7R4KVGe76jj zHL6PcwlOcdUVj9>sw!qQ*pyXzgwOiTg<4Tf; zLLVLzR<%dJ>oh|vSy?};N2EW@ zybL*#ds-KfS5%r5HkzduwKh4URmnZE^vfpsh%V|=y_<563XIcfhw;@ku~ZzUW+Dx0 z$iK?i&fq)<#jwsYRm3h$(9nl~^?#ldjh{4So1xWHC9{_0)-GlS0T;i%=0_Ty(hv5e z@e}4WD#7=DvB0KrlU$50g6X7wZ5B2E_-f53Dim+=xf6*lQcS1t3TL_EZ-vgJPFRgR z6irq~ryecUN;_H5F>t-Fx@kQ@GEq&6ZPM^Kx|P9vlF#E*r#zEna!RT_MbsI(nzv`) z<{eNx6xMhsRpUvQe0lq4!w9;}WNYa{JDzCV5HJK+1T!~`r>|Z0#i4=LDW2Y4Gweq0 z?54;zx+zO9VikEq*LSa+)^2x*(1)x;6T3wC5TN~1@;{4k*R5`9!rotyD$w~YjK=Td zb#~b@7`;d$dp))vL8e^`Nwh-+?o_j)S1|cIw9!7j>|7qvcUOc)RHz98Ppys_uGB^r zN;OO8rZS-+u;GSaL166*+9B>kk4%YO-3XVFfTB=-6^ znrWt^Nl_x`inX;$C$)*19nX=GlDTW|W|@obDzJ^*KdBo?sXeH#KNwv1yqmy&1)GaC z^}B>vF>Yt%rX-cQNxsa9MY`8ky|WA9UG9Q3iZ=)8Jj}F7V^1AVXyC|Pn;3Vdc(uQ2 z|KPP?-qsxNta+VdDcP1CIeRh-c&<2hE{-u$Hqem;yy*@zJB2rt-*|% zD9Uu64nq0oAKv78Xn@_0r>y9-Dlw}ReZ9jk-x%DCf2(U$d>oTMpK}H4Yd?H=OhcEr zh~@=r!BExY;Xl`=;9Y>}%FaHx>d3wyg#!!v^B^ z##CXct5~A~HukVMNROnP4}LKul=13v*Q)n>3t`jQWTYbLY;W6ai)MPO7aLJz#nLxD zzT1=ytGKxc-(!-JTvraLy2@SPd153+EIhCl(^_CTd$IPx;J2DKSBY0&qcbHO$S$ny zYa4K?$nUKRu{``#$9rf-*3c~{oYIn|kE+r_#TuUoAu88%D7+Z2Cf(UYi9hB-X||Xz zPOxEdCtvof;(+4Np|oW$;43vg^gA~nFnSZ$+S9$ylcaWMv*_Pw7S6`y(JM=`1c?P1 zm-fXx?OBJ)cNx8v0NO7l|Ep$!rS!d7^n^GkYawt=K4`YC{I#Smsvh&-MtMz{DCCCkzB5fD^jF_rhy;znT8eOcX4Cg?uuB&MSKdE5^lKMFw* z6$$$^rTH@=w~S6T)srMfzAY2;m3uQQV{-P4qnpWj;VSl; zn64>z@^?+|XLV$jbBR{gXu_WB%9q3Ni;tq$SxhDTO9sj7{GMZHWcid{wzQ;6)jV6) ztBh2C09{>lG|)fHS<}3D3H>hKiZh_*O_v`rgP9c5MgK&Xk+b;A0wRM}#UT|7H~sBS zp=0N~0~Fu5GhFpE9#|}6qUbs<)ZOmxJF$#FR1D4KX9uaVQ!KF;VKv;AX94R+H?$w( zr1uhqjD%~(@Aq5tEQ&yLHetnC2zR#M@h{}R5#ykLV$Vm5ZuWiy)`MEZbQuU$u!&;@ zljRVOJ96Lcy|bFd-p>QXf-N0Q)UXJoamiB6BbX`WENhlF4u$h0!y-tk-Bu#?TPD%1=g%5lZ6JSyI5XJ|BfYQp+S2tRfVQ zd6}!>c<4~@{IX&DNwKP1fxXa&o2le2R|!7gz9y)!6TSWT5m{R4yq&0dUzG#a`6NZ` z1#h^tk}F&=p&`!*r)tqXO(RF`6b)>Cx!f9kmx~-`z|~@l(j)gL96c$i$w~Q<-;kT? zA>_&tf?p@-$JhrkYOQTZ+&KHKOfXETvPxVJUDku5oHxzJy2*fuRnSU zWi>^7XVng`P$%yTHKO5jv6z1)MEQk_8*L;V)<$*Eud%ChFgIWK_FELxogKiKuE9kJLG5l!S zEfdocg6kDq2~t{a@{sqy_S%Pi_$M+L18h-3FV`3)`mHP~ z-HOZdnQ4ZSy&Rbci6*~&wDow~G~dJ8scyG1+LdEx!K^k>C{p~7$1fzvr%%@<4O%r; zdit`Sgm)wkq<(OqTb9GeAJnevWJ(_vPjwGvrY>+4VEEW&_{QewIr5%~>g&&+4vx^f zi$u}55+}Kg6z%{o$;nGS1>?n*sZ)@}rp^q#2A=O&RKE zA*U*@N&d7p+VP+Pq#IqCT?XGpe!Rz0cpb4z1T3uD%yG7{s%hF@_zx4wMvPDj*Heik zE=}Z0f9W~4h;{cte@=${dLG~f*_U*`!HDrP;8B9eyj*Bf`Ywo%5@^M5Y)j+=`&I%8DHi@w_y z(w_gp)r>&jNFeFjV9o5HaI6I<`9P;T2YD;Z(q0zcxoM)GZ>E90hKBVPS@*||QHaDz zvmH9dh&l?572}6wFsG6B-wm{El>0&?fe<-xr!~n>_NE=m$g~jVk-T3ypb6{Ad9+Jp zTJp5@6yGVjF88<2p4z(fpFb(u7rkvC?8=tUW)Q9*$coK#-mXH!}#a!CR}!5Tu{E6O7yPm#@VzGulCXjDMWP&jk=jQA~pAZw+)AOC)7hdTSjW`>`KueGI)E2}QjH`UWDY-sY<9)(2 zr8#gWuridr#!a$fIv&>+-mftrwa(D=g8Oa2Lshh}QO+m&qc~1YrNyKJek*;QGIZ!{ zypOoh6KP0hhZQC__n8WE*`)--@9v^rw@}nHa6%idHk<98?Qj1ls zlGqiT?#@?K9i9^Qs|L*HzYEY>>t-!pBA(T)UVc!u;?&h<--@MalUAo^(KEMfevkPP z>03WX5@%6Oh0=)2w)0#ur$?0)=Vts5N}B~w3(aP(+cDpgh(T{x;`oDgU50l8}Ihm?puM>7+c zV`SeW>$3rrN8|ar?H7E$BJa((esz6Q|A}+>Y@@x*2c}`;n3$MeR#bkSTB#)qT#WMDq(UDpoS%n97rPUl z(RUGNZgKHoK!>jWUOZC`b#<@oKzx&y7+?9j3CQqAk0a}jOU=?|yELs|(-u#@L6uQS0_-=fy4u~ev)F^oMZEN4%y{}}R=6wRk{T1aQFVuOhK9l7-SV%OM3B?Vgk+(@nPPf`U( zC?}TmlWvk18n(R6G!ZfR@YN9<+ttQ1wXRP*zJC{+{a7i85ue{`H*!{5w?3z@vm zn;A+u@A1B(a-;p2=V0M^F!)POO?_o)9(yRt$0!QvP@{ICA@V%IVhdpuSiqUXmzI%n zu#&?aq%Y_z4mdyRkFVU3hylHy`*P@~v)je%=rcGiUYIi;6*YI4-EtaiymheqOVN%~jn8*up}Ue{L{ z&9;hufDOBw;!;B)Wqm<}(uJHu>ea1lYtm(GeOWWYVIem&R--cY-@(vNQI9yA$(C6v zu6fI%Q?wZT1CZeCzjx?IyUcqnYSCBcP@+%#Q?w9479ANy{%Tk0*sdPD2(#?AI-v7(3WI86R?!-J~KU?^ya8tQ)K}UJ*Br=zF=kWEt7;==Bp{O_YhCC&N#8I zR9zcIN%H;b;3pgz6hoCtC5MR}I_n40=Mc-vXjmU5q9>RfIQcZDFXs6r$|DdQ2j z0Qey8<*C@mc79$==hJb7ZQ`$X6F?-e$Xsj9=Ti3?T;~`=l$ZVHrG>>v5x&m?FXvzf zk8u#rf*+W?;qJ+ra7MnTm;XvbKy^v(YwRP7{Q?3m9-1wFD`>{ZF`@U*WYcgvdT7K0 z`YeaB>xZSQ22r%`inaK%ynZU7D~&x3f%1GX^!u0dd`w8BzX=&WRB!K>l0aUei7Y<( z`CePNgqOCC(s=Frb0YX3*;TJVX^K$)h3$Wey#YJ#@G(%ct#UC88fiTHT1B2%CnFR>mak)kC^t3)fmFh@1BuK2*j zJ{gjuD<@HVQKwfzRysO5V95!;}pB`Us_txy8Y@DggX&rjK%gV+}K>MZSf7R<^o&4VGCQsQ9g5CAGF~SU3 zf-D~#gkbx30N$sp=F*yVkH*?H>MO1KrN-&i?yCV3HkcEO3{1>>n+98kmCP0Oyra7|U<{>-L zWL6ob>%9!0W-~gnb!=>12+tCelQr{JT>5l$b;Zgh#{B&B>bGy-WEphz5D_xAgLqkn z0xO&yT&mVOR_sG7BcKUsZ9ml1I zF%KR*xO>UVt#%gs(R%b<##A%Ic2>1aP{nciEzd7xFd6X(`VB% zu-;87**$&!qSxVG&CHdzNx?9Gwu6>hx8L6UnlQ2WILG8Mt?KD}&J_3N&Zxg|0|h)4 zv0K@QljKgnLily5whCwQk?Ak_k^wd-RJ13&=K3E?=XIj?ldIjd3E+hC6>C+#O)%?ySbmi=%jm6}JlOUgtAsY&zJohvb?sfitiIuEF*1h*I5xp~w#;0g4~+1$|yU67i5ecF^GU$oss7 zgA`I+F$j)*)$zHVc1$ITPNla~ra0AleMMT0jf|?|ab72Ix86|*Xp^HmNF(pv=T!P-6>rHB1niz zOG}5+N_Pm-{kz@I^Stl-?7hG5ug$D=bKfV|S~F|7&f_}sIOhlD=c{umn*!b3mK-3< z#fxx_j@ErC8JQ+z3ZQ@*pFH3sB5pDArI`PCmz z^V_{Qz~m-^o{;9}x$Z80=(ZTs8B2fBWJSwJQ|BuUX@DcPZuU^x>sm#6&)F7!*9e@J zu%p;vXjzs~2kC|G|ERUvUJG|)?nul+0jYJg>t~;bG5hUl(L?)~%sWz5^uz z@;{s1QGo0(EB`3~K%@Q-0N`qG106O4wB+p=G|?^!wyu~TQRjmyVMgG0K-PY(3g!j# zhEAP{N^i&Dnqi(0VmMQCCe)YMi`ue=gb0gW{K{KpE(bJ^yVmD40`i9=@&$|W55FYl zwgl)WTsdvEtT(ft9o5sSqNcEOp|n$bQ80mT!B?``F2+0hiP>99N?PCIhMTTcyOgs_MHLNmE||li zxsHQ<%|RiS!SoFH*uW4 zEiJIGe`wp(-}DAL6U+CIi%L8U;a|fwuU~MX`;`A2vS!%!>g@oXfcs@@(0y1^4%wrh zL{K-fyICAK)T11UCBL2L4n2_@=F}myE&F`_s$ytJgB__Lf4TSk+Y1n%zQ+nHY!_rC zp@#V@;ODNhlhgY;FUFs$%`|rh*Vlg5Kt$*H^Yg^BDdpz&k&_s|vJLTU0PQiw&lPwd z5OsAmWYNj$evntku6##9*f@~2+;uqceP)IVZGEZ-s3*2&H_|J+KPChZdkn+f>ju9s zC{!jx_J$*@K-J*ddlXicdOIGqy}iAn6n4Ep*JG7do}i1}#P;>uKI!~01bBNsiWzw~ z1nzSuOF-jy9Eym*R3a~C--y)F$!=+B(I*i@#r}9#`Ll^uyRgC>IxVCS0`0+^iB_Yn0+J1+9E6*EAIDLXc}AWOi2YTkzVK{%l0Af3;NI0PK9a)bx04D=c$8wW|u7yu@)htj$V+HrGJ z8@}T88rU@cghQI>y^I*o`$u+q@?vZ~a+E5tL0Qvv< z)BQIK_NL@GVe=BL`dof5u*-5DIXvRLXPox6=WF=aj*yTLAJc{*9j35)OJ?8j^V{3u zcIUG9BG(fM20srDT)8mZr1L&(UbXf6E)do67$3uCc$01%UcB6D=ZT+1PS2;Rme|=M zcO_dsKEK6WZ(oH(az2e zQ;Rr#*s4|LLV|y8ADuBJ3kF-Ns-i?|T zMWLKV&(-#kbj?pMe5LqG()K17nRp%;)3x@nHdBb$GKi`%XVuCoaM#Jib1gi zrY-k{prHViaK{giSE6oPN_1^``)hM^bLr6N4rst^fc>UI(OHlZu@^J~WPiV^4A46H zF8fY?y^CG0M4Y9z0Pnm7S89)_Ki-hsQQAq{0TK2U!;IrLG{^aeP7{+)q7(c1N?f8kYjRFp;;2TVgkq9>1`U2tg|aQ3 zU7^E;nMdi|Q9nrv8iq zSbx|s;T+m<1qbHiIL>{kttBP0JJ9OipujvJ`^(CI3=@c;WQiOW)r4S9&?*d^?FIgEBQzGQrpY%R|tov9`at#kjB z?L9Qw!7Ev;-~wYtcdMJ>Gus0#^4ES5CnO}?H4Pv zrci@suO;SB1fSWQPX}$$f-oAD5as#mH)S%4Hp|c6KSLi9C7Xz$SGk&H2&DCg?&OKz z%dcr|WBGWezP86Mva$C3Q{fvTk}`S1>u%`;mmEKt2eB~=IAI+#N=~XcoZ0@Qb4Anf zszaHw=1hFd&9e~ef8evM+EUYY1^y+RFGggcOkAyoKvwu#YLu)gPHT(}u zKP$gYiJbX}NfE8UwqKA{N+Z63tZ@|JaFAEgu;v9lGE^rcSAjL}IPs+ZGMC{8Gmum> zlic8@47IV2K1z0yaqf`F8_^h^`X)Lio$-dBWT#-dl><(dA-*B;5!4l=h%~h(qx_b= zK;|VzP|G_ST;G*FWb^d%_NK8AiPKY7&DRq*m+y5sd~t47vW6_4^>a&!TL(XE$y^5k9$VakwfD$2Q- zecWYSPQKF^Ye~Agy#T=~mkM2up-zflcgo*44nfKC)=tRvxLRKeop+!+7qzJNLs}R4 z<-j-3QOV1T1QYEa++(NB1gfmlkJ_4;bT}3^;?#YKXaqB6-@PHq%@#~}Z!olW?Q(mN zyBoVGR$H?8)Rc*eAcCz$u|uz4sQUE?PGZOxfhioX&rGIvg&(gdvaoW!hwLlRh*Zr` zQT_`7g8ovn^S_(_QQj>!ABY!Ufy5h8_VLenFb>eVl)iKO!4Ru8lMf@a{S7MFyDv8=x=jR7BYej7|XasP~ zLe#ND)UlvVm_Dqq?Cou4AX)JUS(SXfurUA!xupPCqYdJhT z{93G8afL0kMt}kHd-+m+akhPjS{i?vHi(w(JUb&p`OXeP<(FG>@ zL;9LmOoMFmH}*mpj19j)RwE9k2NK#&Qm4{!ERvY<*MoEqVTUJuGQ zs|1;}ANJB3@`6IrYWVhc~}FjmFvL$0VEQhWMa};z2!mZ;opd{l~*KGrR#i8yg!n1{}?Z zbmS=gng%$&zAPI_mN{as6eZb!?pww5%jTNqw(a4`5vhpxBh#w3pZ3m>o#6A>kubjC zidWdW{K%k(lfoI8cRy`>yrG=gTd(}g(`kRFILe47W@7EJqL6rzKX6Gs7f+l8uPR?! zBxAj{jNKyocALCQjdl4tN}PtozM%ZsKn9pl)yCG=5?@*hdjz6@vgKCsV)3e-cj;V6 zmq`t?OQSH0gM@PQ*Rh?5r9rVgKjw1ji7TtzR$-ZOCg1`I_sx-n{;DB(_%+Y;Gif3T z>X1bOMSH^ZCZ!4cmh*>`=j5-)L={m$x5+j2offr1A|mN&B?}qhR}>YCot>!8nxRjd zM30V+8ZSnXQmm5v@3EldiF`#+$5rsV2M&Sdxzrd0p6IuOjly>ASJMzB1l`eSmphs_S~X3J{c45Bn8~E_Tuk z-S%0|4DFpRtOv!*aH7BiREg#n7O2sQ&lA}#+}vtx^$9#Bc^l}4zX}k_SxEF^Ah0U4 zoIWVFM0R3H?c`!%ER*}E*gCYzeO(u(XRNO-`*MnnY2@ndJ!N8GAmH@_a(?0Xe!0$Q z8vV9h_LhOD-yjT#08~)w*ZXbtBRu3UhvA!Lr-r7>qB_?wqLV zSt+UR2^=6qiTFj`?JN=wzA6ZAd`MM%!W9uJvL6)8IytV|@L+ znt;sxj9=u@@b6Zl7N?|bUf~eYE;2j{@+H7u&PaA)Jja1fB@v#;-T36%DcMs)I5|1< zlp@Q=Fv5;VgW{Gq1VF-QkH*ct?2;3cYxAML+T;efq%rQ4EuC_NzBJ%!W=!5+#astm zcg4Gis_N>INY72S1c1Y*WKTN8gb`#p>L8z>8HH;bS61Ybmmb`n@QxWI57dcIOkq*A z^d|9dD~l%XwQs&gN1UxmrB!a;pCFMc)mPIpuHncvH8y^FqPiOY9LXVBw%;=mo!aDY zhWz@y_5J(zeNZ25?<<(i$;9KOC6(vGjO`C@{{^b! zy|Nd6EG|EQ5M-LyQGma{|FO#t3OpO014R@#f%>3jPe5$f)u)1cYhagR7|rh_zm%mG^FV+d*w3@x=3qa=)p1|EoYL_>Yq< z!q#ya-L@1LKbgOL;)Aru9mwQwPPQk2>@O?-sgn(TF$*8p@<(B-cyc2BMT5%mF zy`#%h!EgFGS~o-*^HT)YF!bY{B_k@+Pb`{44>I}9HZX4l_RU@BZOFVFUgtZMyu5Ba zI;`OwW@1uAeK~=MPYA)ekvk1rA1xe&3^#RU1QmQTtG6xTGSdk$o6SbfqrSr6fL0it z=5&K9t-+A6%eRTNrqYZrkLtX_Ie)C1BooML4GoGXE`a!(Ch8Xv1h5;& zL9&4%rTj$?B*86GU@5XFY2o*Q!O}8ySyuY0iLc{su=B&??aU0-isF3 z2g6vUaN4Y)Vz{1Lmj}!ilHA|6c%)Tpl+7nTmiHoS>pFyXDJ?zS|64hx_?hc_`9~8) z64F9G3p)98MTufxc%^h`a4r@G=VnsfU;D&=ez6p`baHy?qp% z(+OFD&SXx=SQ(11bjhw7iIW(&J5z~`BI*S=2BdDY@M2buwxpN<2@Mbjfqc2L?Ke#c zov+nK%KHtIvR2IBT8;vRavrNm6~yO;N88vEMegFYRrD7CAwD*SoR>hzR-AP%mH&1t z0!y#9l8+l<83&^Iugm>(GXjPukX z)6C!B_@YnUOQKc~M1*WcifS!t37I#pIz)A#l7&otg)lI>$|sBz!;EE}Dp-r3n_|ko z7$n;3Rk|C`Vyjj7@u{gP8U0hjI`gYtPhC8dLWuwH^XhW9l0x~c?6o&}_qt+Z@zu9@ zUK-wB%bimhp-}?9sG}|6cQ_Ph#Th?WIM(^-MO8}mI6%S(0d zVM;5RBF4KDD<8BFyb-~60$jcmkGTGmlanyAx-}qlpJ+KgJ0g&vuUVd*{)xS+ro!A*6Lhllt(Jq;H_F zZ|2OGD}e1{Ij{L4RVit+9L&n>*@X+UzyS_AKgUgg>E+#W%D|e%jVTRN7Ter^05_Hr zz~0}0%MVHIrw1aho@a!*s#^}{e?EzJ{wUY7!28TD&s>upGfI#?OGm?S2kQNsa;-K% z_Lr6a)JcS?^&cNA_VJuDB<<)vOb-TIO<$noK>iNAJ|%Ol0yP04*IiviIj98X)ip|x zJ`6nexP9ncvDtbi^;9WI*cSrmJ0!5(4}JC@1~ z^lJ2`RPreVjPQAIY^ozTXpozMprAX4IuHtdp3irQ7pfooR|ZmDEx13aU=c@`Pm z(T?yE7?X^x2`tMm=O2F5z7@ZdO{WXk&0c*^ZOT{rS)S=W`HUWDi3*<3 z;O(ip;3ttYEKpbm3ceHJ(Yo$^eCSI)XGgOhQCmXa>+1^=4Ik6d*Cr*bza-8hZ&prr zrfQ%KN9Kpq2KUiUcBqEw4dTR7LM>!dp}!)pnUc{Er+to3^A(v9v8M7rEH&!($0@(c zNy4(Co~J$=_KUXekn61VOTR?-Xj-J7qeMUVA|1Lng}5DQ`uH*9$IZZ(Ia|GlgM}h4 zKRoi6f@;-YuSjEg=z?~%WZyg$Y$z8VB8OuPQX0f}<$J5cZ5$q zi`5Q(d;xJ9LZHbD-uVXvNC!Q1q&&A!*#lL@=D#QPJ%O(YG%Hf4Rb9Ar3(WgDFtYi< zKY2mj4*XGcx@Ug6+2o80{iy79FN#zM!|=0X1|KoUf0_H>LNa_7<`Mg|=#@q)&hker z$m3wc$0Vo;;iQ@;n@xDTPWYcv>^^Jx1c)r`{1TOrkYA+6fnJPy!>NT%N&s)j@^_5@ zwz3oYJIh73E3qnV5}BFxY!JM%W|JF7!!?%)RB*r-wpp(VVY=;zrW86mN1Zno*lK-+*QH3>rDO*A+$|9Bv8pJiyTVv6nLwdF zcJ)u8lDeOtFIk7v(1gOx|0%PrdYZT4B%)qgMu~vCHejC8>&ZFg&)L~oeR&C1G4R!c zSk&Ca5^`ZQDlHVhyK($|T#c&?1BSV{R{yJY2OyO5No~3T9WupK&SJ0-^&Z0w@R^{< zYOOby_au9QgJl`m*yNQ^oZ`*)e+wnbrHI7|9;^?kV-~!}qGWF324oxm&pf%OG@b=GTH*mLF?s5?8VOdL3|L zsO|-)OM7zm?=-c4u+$Oa=*)f%$0Z4aX6VJk-Zjg0XMkOMQDE7&%wSh2s_Ue5BDz4z zd~ur}QoXN6uj6Ig8DdrPPT0#r2ss&p zkoOs*kSIit;G{$f@ZV3h3jB6ToqXDCXTN?~EV~9x>Khy96#L)hv+#SXNy^oY#)&0A z2(HL!V2SIsBz8I8(zSGQ+N;*L5cTkvRx>-S>0l+e5`6tiw2hY$!@G#*Q1xgl2hM%=l%Ju`*k|fTc?pMc&@dz}Mo49Ubsl~>9N7a>x zH0!5v`pb8sxHEaNLbVX0C(7k&f~(dVM&8igw037EdQh+`&YTP@{|@*S4I5YT(8X zC6%LpyEpEc?^V9$(9_Y~Pn6arTvD24T)eH`?wtTC1Crj5Vy>2x?*~-D`LLK!iCzn` zSYS$CHg2pH+Ke;LJ`L>-eE^#e2q_A&q_$|RL>T~BHX;@G1uQrgZ6R$$hb%w1;An}c zEI-_|gV-b6wR}wDY1nUPkjPgeV>~HW>jIY?KWrZm+=zH(E+C-?gk1j%(?-8ZMmN^m~MC^~n-RD7cp6+{q=O z-rn-VJpSsFoJnH7O_ruairPE0&>OuW zgr!WsWD{{`)TP}6+i6)gvvBAS;aJNj?YhZM^Vjep`VBFXgmYoiKxtfvx3{+j+06R- zfWh0eMv0L4sl_s{hR?lYslxWgDJ&Lt+#CnrBs;OYUTa(jV`W^Tghpg+^mogw4^*xX z#=j(q4__{!b^M@yq>Enjy{xgNC5KwJ#l-f4*}6y-z6zf4CRbYxQZG6J!fOdGxM(Vt z{f35y$(79vN2D8$X)x5t+($cVyaE!tf(g`cXFKcmsgt%84G9+xt~g~ zgWaE=8XFtmu!kCQ0~H2d1~lVbn(UeqR)L1Ux~SSK<{=%~z~*3l(e#keX<3kP{HK#< z^V7(WO-*XDg)8af`FWgV(S$s_yju$3YTmde$h+)9+tm+V7#G7Rdi$=c1KM3JEmAo5 z>I^dohR+nbTsOPagWz!e9JNRKpWNc5qmg5yIwv(lnZ*ouwl6QZf2$ZeW8uFQj-R?2 zNa;Mu&%X<(llwgy{J#QU<3P6^1_s?owup>cLYkzMlqJ3h)+3$mA59B6lCqUW5@+%tj0H~i zRO{u=6%xw=V(~Qr;r*X2?vasSK)XyJmSNQ#n~l}+Xt6*|C~Lx1?`slKJAN6?gC<32 z6@g}m-UP>a4r|(!{`o=KLA_0C+0cy?+g#0?kuFA6OU*ZQ)ST#yuI7u}@v==QJ(;fc zW4``wcTf_fGAKp*JcWyU#bgw3-vL9MSC9RoikRdubg4e;iuDSl6zy;7cHS=h-Jix`{{mmX6N{)+nB~b^3bbV4USa zNV;o=ke?=%eeU*|=Z?Bt=6#+DT3K+uU7ym+xT46-T*CfQ@z$nddsvul&VREpW;wft zF(A(M8cl4@m{lCtNYF#Kq=fb3Px=S1np_v=ax8&Zn%Y=aLE?dzUk=`-s+zYd>R7ZU z7FTJe%0BvJ=Jn;&@i*$O%sMl?uUd|EAR6yjSw1ZzAXYZJ&o_27{HV2ewmVBa9ECO{ z2jnK~4ev(Xfj!RlJZ?W>Je!hj(|!pF;y$i%(gc#n4IENsgj z+b~SbtKg{Ho@=7S8ucvDMzN9Ui+AF;964C?t6_bb-Ic7Rv7l|M0{Y{321Q{Gv8~@5 z5u1^w9I*nz?hNk?l^q9LqTD5Nmi)ujcTbl-PgT-mINor#%pb4*WJWdQOizAXy}XIl zE~!sx_&pJ)OlY0Z!XsxFBseIk9%S-rOX>85A^!5JbHDaI^b-0aqh34KfT=FpeTad()nf+{5<9B(+gwlcf zjX7GP`Q}i)+r@=R;E@NTg1Ad_8G?*$&13 zjL&JVdnU~{5_0tOBsLfp8$I$OV@;u{E}9iF(5?Wk7f656dJrTipWn|gMQDrTY`?Fb zq(c?~V`hM0!%+Yp=zskV1qh+vF#n!^^W>eDg%}vG{?EuR4$z2TU|^P^8|u9$Hf6t> zHOd}GJGldq{|)5`0U-O!%6|&k!Fm6-C|}7&0hA-Kol(?5^e!$^W29{+O?R?S%CNZ+ zRwI^A(5IkeQ%CHO1_o|D%VGcCQ9u=|s(*K*jUw+M zFDae$)$b31LY(-oDXFTJqeq|?oCtPX_UlL_Xo5qs&5Y`ztovnI=by^_S+NUb-M1?=ss46XVG2O zY)l^3wS_VMey4w34;W|Z)E3TONu@Pbi6IWie0J#692r0L{)%U*Xs2{2Os>`4U^7Fp zRQ6b;8z_39QTH-l!NSq)+yV@Ib&<+wf4=e#{_bIs)1QaFaH5#|^9~aEV+XOA_802p z1QG@fNKhvSZspy9Nd9IA;R3S1to+AzQ1-uf&|F(Au!DNtM6D5qAUL>C_MIwamn5_4mHTxamrC+h?)vijj9jq5sX72PJO12FP7hhNGkyU30wuynP-3 z6@eHSH}QPyX{35HaOVw#d(W#ccOb~$R1abSvcIhSr?wAD=D)X3_82f@1QMPc1s(?@ zpoi_2!uK6v!gg$S5@2hTO*Cs%v*1$d0|bOn8J`bU2X5hfqEL>Fov|o-$D5%Ep zpJSOc`NL6|+#}Z+@!w@syhTaRA{w0XzPhxSNF2L8^irB+c4sz??n9|1td;#_6sJk0 zcEU6CWS@@(V3k_a%F6|1JVDL6a|akfaBver4O=UFu&*p+sD99dA_v)K0}W;bjen;g z*r4z(;kt$NnK=>Lb@8;5l2OKBs;@XNKr4!Dm&f^H@`d%=Gok6N-so7RQ|0xZ?gfryL zr{h6S%n`};mXF{s9^9RwQmjvUe($SSmh_;XmO{@*D(_Eeh?!LBZAd&tXxAT)xN%%Y zVD}D)z*P%Mi+zjxZtgGne2RxhIE>}Sk{Rb8wz{B;9G;W)p3@G*v1VP2wX)vU8N4Mg zKNt$Ix=kEb-moZ7u@>K$kzxEjvPB4ZC1N3clYY@#Q$%-rlTOKEcb%hM9ch`hH||7t_rSQg(0ecHVm-n^L|ZY+aPb`ufb`sOjw0P}r~l!x zfQD@t$S_uM#XBCT6ZBme;N|u0Q7YUWTf?6Gj^4Ly>8!WZc7Kbe#8F8jrB7uh&Ld6V zR`}HoxTkkM&O?*uAs1uQ`140&H{`t%&tqt#RU{a8^#S6g*u+U8H}M>2Et16H1h)^O z062#x3Na8OrfviT8)`zK=-$M3Mz2iu(2&dhw1<(Xl## z`M|)>{~cZ@@P}JA73{;53~_ys$Knm4cji(LKJ#h~ZmwWm zG7-be;SYB+dbOXbt9e7XbKmlzg!e(H7^&s0ka&pdaC9`$ zRTBC(u_Nf`qF5$A=_4)bz746Ud{rsrA%j3W2M%_{( z5qjNg#NDc*Pbf;j8GAqzzfVf-6nlH}=SpyC%L7P6X90VPHxZ)`^%?EB(4qv(c{+vv zW@V3Ek^sQ@^I;T77NN8dg(!@|WVfbd-)WL6xw$mjqL+wULknN#cB7Z$6=Ky=K%nT~ z7~gl{Yu(S$4UjIWsw;~vrYYQMoB)mAH>l&{94p7(exQ(NNPrS4o)d<+A55hT(uR7X zC7o|>y~!KD;>f@4kc>@d@A_W2mHJx|^ujek)XgJy<;2zGw>iX*#@?^4G;$!U z3in?qn||A0Zf+4Yy#T?@L!%=+j%OlZLR|;FY*(6n!txIX8O1k)u9bUF&uQ*011W9X1cTsU)B4X^ zu?IKyR^`!`HzX5cUxvago~aIU2(7C>y(gKJ1#hw^1o&HwRY>CSQ_rFrcisKe%9;t# zfKZI%`FI-FVIeu@*|XPg;YvCztR+1!$d9@V7ZxT52Gky51_Rwb&gu!m`{u6+62)Cr zaCAKq8U5^4bI-%L-G2@$1p^$qN~qCyE$!PtBU?Etd}%@Qnd8a_XI4mu*=6jmZ!%RG`5G5Kg5P73J9q@GXls6$b}vi30k7;WARh=L+NN}rjvB@ z>-V=%v^^wDl1O$Qc)8t6dK?q^WFMdazKDk*5kc`<7j`nwtaC+J(c#JJ0x$BA=wbnPwsu*ON>qb=v z@s_7AZ*I>=Me(IqLRONQE~}H1NnF?&YS}kQ{uUeX5@Q(z;4Qn=0CEnu8rfDTPyK~z zs`wA9<2g!j<1FujS=yV@QZ9Ed)H@L3Z>$aQFimogPlQq zXF{DH(KbQi?JUK?-wC`VkP_1#AeP+&3K0w(1i|#fxExQo<4UyIMGI9dRGRT-U1}gn zAQ7NlBZw-Mgn)i`EB&cG320Tyz$XjN=2A&|ny2}i=y6-weg1k`Uh-&zdrLD8HQEUZ zPcaUCB;(3%N!%@uwabgGv6rP;F@J~(I6>uQfi_m%91=&p3fS!KFLNICcj^QYoer}W zw4%dbzbNfGZmm6kN-`Nqs9iyG;plct>eR_+5*8!qslFP!O_f?xc%Oo3`P%rN7WOrP z5f;e?9^zUX7)n;I%Ym^z%m6=N)gAsxe`d>3q@M$HGndrM1EhAtnm2248f7EH;5ZG@ z=`#`0LkE6@JR1y`k~cH%3t|%`A<6R)+~-j<(%Js2?ICNs!CRZ)8Rrjvp}zK%`pzfV z`4OlZ2#kJsV*XbzylQvS$y(>7Taun#S!&*GkMbP zfk)fb>QcKAGa}OyXqEUy17}ugq&B;cdG|0*}wQhkO` zv+x*2uo-hz3bZBtViZH+2i{h{w8mXY(VKdHfzy3#4#QUzY=~cpGDM zBxw*QvwK`r4@DB0Q1166=Ibc?4)N4SVy3l6$TPF=MQs^ z?EQNe)*;th8?Z*gpD-cym)aX}Hf3HV?Te*#7#r-(LmdYM&bQaPgj_kAy#tA@1gp8P z3sNt~#GuNt!&58H^3PTVLynQBN}=CDihId?xDbGqdmu4VRIBeX4Q}y~RFVd|(B-Gx z)t_XH!!*jLbWaNetWKmrMW^KnBw8&dBk!L0&@t}TbU}AdyGPkXi8Mn=!ib>K^4S|l z7i4bX&hQ?sq;OG^?4`WuJj+DL9aP`VVy|1VP}0 z0P0NPzGHJN`LCYe)4#IhXfD7yY|+S>&u5+o_ZieQUo0A>2RBioSD-^IbUyBe1oim$ z-*ljjiy3_H$dtQ2m?7j&{(@G@G4u1xTdQ5<@%`+A5ItRNV^=?jR)GdU+iqfqR!q#S zppD>8mivNo72A4)-Wr$5(0UMQ=KW!gea7*$Ex3541%zhGlZX}IxzsFXFzXrzqU%MW zltx?S)X7of@d*R!1F4`i7{Z)qlp@x5LGRYvxj+}|U09NfZ3F1lpbv9zg+hM{%jZMJ zGJbWH-2-pt!$K+^2fpweUVC1FmN4vPkB190<1??)XEgJ+AGE1kLZRFe8_VulJ@W0u z8?|Z1Xz}VWmKdml{jL$#Uz@o| z+VKQYER%K^t{n-ugS)wQ!ZNpLNgxj$=&`*CJcE?-@*5S#cT~|;>nVa&iyFJ~irGc9 zvI7vFf2{@#<-StFgDxj<+Q3@mrjLA{BWh@_nq3o0s3}~&3zMCLoFX9(v~eV+bC2o! zwj(C7--P3ng{H^TIHUJ|HLs*rcvb0gz!Ux1&^v^lp!X=q=r!VFA>ggoGwvwo>i0+@ zT^kV0=HG*aiy55J%Zy02lq{ENUDOl5R(#ur5OnJKkxQ3#xRO`2kxjbh4%yi27G}hn zKN}?~1i|cR%N=aTTpIw#ujd4xP?xc4_%k1#tuAA@pd6eeo8O1Ir>o5`i2h;bDkB|G?cx)V7yE)NYkO6k$6iHvSEy*knTCee=bwELVRr|g1jUQpR*-RBYAJ|b{}h+p*{ZH z*7W1IPH^)>|3J(H6UEOs0-5TF4&ow!nglc9oAxQO5;`||G%akP)=~D!ry0kF=pA^_ z`q4!d(iI~LwEkR-HmV+0@O{h>dcS;+P~Ys6^!eGZ0Ll ziM}$4?zZ@ed1C<{pFd|p%s$!pV%0&>=4ZPXxlG^Uk~jVE6JCmM6nK)!d@4aD?>F%P6xl9c|Hve?$*lhHaG-V4TrqOna}4+=LCFp`Ve~Y}w0ZtlgLP3dT^;pYz%5z^4*vgpxmL zX#VY4suTC1^0>PZQNgXMRsJzP5(tFgYNI7wvZHH7G19Uh9A%oiu zb)jrfkMB4-3LhV#OLPwZ&%X`}Vs1N4`?%Nf*r)KS(_|-tdzY>xyVi9oFbhR8I=%mr}nPet~s@!L>p%34~CPR^uP$AR7hl{ z0>!5!6^+5me#3Bb#cS-iShxe^(_2f{L(Huh-@6A^;fAU_%mlFaOyLM@5{g$lB{)dRMfDBupFDS;MFWPesg#B7u|4!1QTk z|KQIKDxq~o7lKb3ZqMG&;_i26EJJg~YM?m`#e(BvPbyM(>|c_TM8+KJR!`j!jzqlq z_RO+~>Z3T@E|os%Vv|c7!SR^m3)>x{X}br0oi9IplwbpWG~$u!9k&6gK(1I3(cN-j zzb;ZXlYqJzzbMpPW+8$Ux73$Mjs2x zQK%^68{!nY84)3kPs|8kPc9kk{x+=QUg;L$SwYP`bs-d>N!Nuv`+zqv(}OE4TU(6d zz1cy;?s{j2Nz-?_Oi(Fp(6OMr%GR~iCCX>*(S4!jd9bSbM#PrK_8z!g_|a)fCaB^l zsq`JY0$~ikC{LIaF$4e!zY6bTKPz$BkPk#bLBqsekXWb_m|4b1Md*;E?~B!PH~#3) zx~d@IXBPE5RI;t8gRbrq3Ma#NK`E4ga9KLx8OtT_)67Bl(Ed}DP<_{=v<}eW8!QPZ zBocx22>;`%$Sh|six(O&i6H4})k0=o_)oTZ0Mj&F76d%4{1h}4%-ZJma+_%{^o4nx zNk7&A?%aPfPmsRR14_dk9gyif3*UbIS<%k^FqhwUSxU$#mq@cTrajO-!z8%_P5h0y zJOIf4vhtr&G&G}sE844_-=rM9hmk1H@excvpbVzy8901o%;g|pI4Qs=hE0~OBYXez zGO7!yJnBc(qddD1^1POS2%$k`rn#A^T^HNaC1yp+a9pmnRSG7vKVpG=|B40T{yQ}I zKabgYTouIloufUY0Ee6Ot{AtrFkWX}Nl8gS(DTe+R24CeFtm1Z9vACv5WI*7Ni!^C ztr<#zPMWkzg?>`0d3BFyn8VlC_u^~N+S*!w%)0BOwWo9N=0S_tOU9Rlbh%}rqM7RT z*Rd*1-zT4Sueestk-R#vWZUb!kmv_uKVfQ^s(K`As%Na=|=b49$uK zo3)~e{Me^7pLzwQp$bW&6CL9av^kqRPoT`~)amV}Qmi6A`c^uP`hTi<63%V=mC zlra3fp3mG+^6lh;3zp{5C@KWq?*0Hs+&J~$#}4j&mA>WSmDX8EqT*ib>0 z|B~1-(U_xvV4G|fg-pbKUs!m>PjVNe8<4WBU|I10xO?k>sF(GBe0S+|>Bgm7L{J)+ zP`VqDF6mB%C1vR@X=wrJE(N3;L_)edM3MZy^`3k0=bm$Z|DC^n3$I;wnB8^XGxN;M zGtcvS5lxa{zY26mlQ~&?WnI1W@kCbDL7q(c>gXeoCv(?Y>YIuji}E0q#N-$lFQ$kg zl+&b_)@^GS4z=Ab=N(Yh0*vhT(9aQNn<9hGjfggVBuP#ao#) zJa`W~VkJU!c%r8}Hzxv}#z`UUE5y#;zHS>``;ON&r-PZyGEm3mm89qGR zL|dWWVNI6Y{6&#lFpp}9L0%Sb#L8w$p0Jk^HWui#<)hrmQ^=Hhy479^D;BZ2T<~cR zwwH^`YMvV|!zDq$S}Z6R_r>H3xouR3_a#%r`*)sP2I5Zif6M2b(eHczakL`Iu*%lK zfr{|zJ{y;D1*^gxR0Vm6w2*`se~*Uh&fdHZIL{bqr_F>D?*8#H!%ybiZ(V@WSs=kR zLNK;7RWug(sg!sz=uiiU3SZ)6wI>ZRSOVVE>!uc9EeNjocB=!5z3s`Z=7Z3;6gA$O z8ZS?!0^Ylj-j9Ie9~j)6faCvx6zOlrzoeP*ud(kd?L}q;dUn(vC>xy5@MrV4_j{e8 zd;1OpdJT>#z|p%Z@JAoJ1@->TI->(9`%BG#%KV|I{$c(Aj+|K)VsxXvRfs44rP7I% zPzTKynrwVWKmZh~26i>_fXf}Jn|%K|va@udPe;B260&LyxE-92mCoKj71Y)aFT zX=<%2)h%E28_zp?;XY8{^qpY^?)hbZ}-TRd}yX;z`StTwIo1d9-Oc2PEHmgN&0 zDJm;9h;2}T9VvDUTXLS74BEQib}?`!`#tVb3TIRh#oU#5JAuv*&V11QvT`k<0xhK$ zEP0ou1mDU$+eOQ*I<;om&4-^1r?(G&7sOqzoIXT`H(N=Iao+>=sN_-#QaZ7gs`~N0 z{d2H({exc)<9cVA1Pd_3?Xh<0z@Mxu zL^BnLYR1@59G~v{j4>^BgYXfD*`-@#eBwwjKdE;HcJd!kP z&|EJ+qK=EDQoh-7@t9xz9Fx48M1HmR>cWxlpaGpalAmdCu*10vu>duny=#;9*%d`F z1~Eq{R_jZrU@Zso=Gsh^EPjY#3AYC~GU?wVNd$e<8&0Qsvk7-6XX0GV$%SUKND0M| zv9opN?3vkofBiN-=JTe+Jnv`oQFp(0kCM(_&Pan4BYzqd>D{Bi0JE7=3{cg)V0^l`(Pyk2(VF1DbL;#2c5CtF_Kn#Fb0C51~0VDuO1ds$E z89)kvQ~+rJ-T+7kkO3eQKo)>(067410lWo}2Ou9n0f0gPMF5HclmK`KpcFtEfN}uu z0aO5}1W*N_8o;j*s9FGZ0O|oW0B8iz1fUr}3xHMtZ2;NPl)%KbSp`b=ARdiDdj-uS{wjgZ(tF5YMO!?|#?^cWBIh0~lRv`0{wO zY=leuUK;D_>LhlNOq=75{Kj+|{KnyZE`T$CS zt80dZ{%LqXP<&M-kQSi&os&*4_N%(Tt$ z9P&T@_PfHr@4BSd89G4ZN+KLBKcCqBx}g6z4q^EB^$$C@F?5ov8_LcJ*X{PTTD=98 z{LS^x12JgHD%SL z{dxVtM;rQ3*Me$A4mIA>`%*s_;I zDNw^28u=gV{h!gi>vo*C36?eDEpdy+KTZS=KDn^DL$rvC- zC@aGIo{fcT;DpprY{f}Yu)U<@=*P9lNd6V#aCNME_j10fFea_b%s<%Wy0yNCg~wN3 z7mc(ozUJpb1d=(4B~!Fe|nvU<<-*TBwWb|#u8rStq+nnYPI~K>;xa( z=H~jw%?0C_$y|z+2^jfFN>;i_53`NNDH74>JN%P%qZXv43#iQ?BDlTB> ziYCf_SM~$1c_flC4)|~U=X-ZapE7lTntb9T_=T=H{@mO!^j}6)S?s`@Az{aLNbJjm(W3{zVY+FxVnmsGO%GJOB&ER zK!EAdGq4gGRR}+>Q8r@t8Q4eZY3i|cG|^0ztz9nfTPz}5QL*dIEn~sNkrCyAl=N#; z=)V%|2jP5BJSmhha$}cVGA(wJ?T=z&V%A5huQh^${DiTRpT?kbp3$KJ1VyU4G0a>t z?719CrBE<+fRM!zHL~s->>8AEGYEg_=O>+?@xaqd53{(nqGCyzOA2Ah>&X%}7gD|e zN%^25j*57FG)Ce&7sC{E?6-G`BJ(IbmEIj4_DmgoyuUvbY|}(kB|eqD%EBi?yhV(Q zW~d`m(Zfe5ykh0##B*Uo2Z0A|Mm5r`YEw~CSlD5@6XFmJlmF0ys0nsqfmFQ|DLkdT zXajZ0W%8k^LUH;HXpw^I%LXd;k%{u%L*Sb2UZ?aT*3eXKPGfRfiH+x+2zi1>5+rcG zULQJrsm{0HpGVDw=p$i-=4Xr&sO|o_rb}vW=nOmK{AwY9OIzv_U+i zrKsIp++Ejl7XuJLsYSo%BGI7A5eZp6X3iX^M42%%X3R{+D}MWqkgXO~US8f(OBNmG z^vyxd9xvm-3N2PMH0>(z{w2r5vfa z_fI05A4e+JYint>1U(dSSa0U#sr8a?I7n#F(i9>oeV2biy-_39!p%2Xg!po=;>Pa7 zdD-N~cmuB`#-tmNm`?syWb7pn#N#{QX=kT+QS@X?x@dxxhn-zz(`ZtLdJE*FGMPY! z@eVucOTMI(cBu{aakM#Y5K?>_N;mus`6BS!N3p{fy{oGX2Q9+-ZT|hV@^7U|=-rBH z>?@Bsj=$dFf&uJHrV85xf#Hwt4GB#$-AqkbWMbMoDV0&u($d<}%%_UNs~bgpUY9Iuh`Lh~h?#i8<^68^5=aSr z9)~R&zR-Hl3@h!$e#D&}d7kj3{u*l_SZl6&%4NJ6G&7iMR%8JA}`UsB^7z<#P&RAYJ!uMgIN zdI<(ytWvTF4I;VL^*OG;&%x?^CSF&G+R=T2yK`1nb7R(wC|#>pzC&NvoT)Kav+Wko z`#`)?qGGwsjq-J2;WH6)8#}J%*V%=IsBC=#2l54!Y5v-fUU-S`J8N=F@Kbogr8>N| z7@l+yz{uB+Y}BRg@2b7zr=`{2@XJMsX6+qcd=S|zIM+pjbZIZf@Beh&LCfd8Vm~-E zG-MNYb)Ausv0;c3YqPcWRg@*?Ls1PTr9f|t2a7p*DyEuzD0`$^OfQH5S8b+BSsR6X z)nGv80ojsAb&{Z)9QDlEnH%$ygM))dmIg=$6!KJJtRr;}=Muk2M)U_NSkBg8Q|o~) zCVOahyFBaT<1>`%Zn;1n!}sRyJ(S0D2kAsIBk%+aFC!Q;q6FKNkPG;J$RL_rwA13x^TbcU_M@YFl0Fx?dl7l3!?w<91du-eo+mnwe3@uKBrzI}|C%S@N@zSJ)LGb$>@eKJdVffi zGTQv}rqiP$LP+=$iN#2;Io!cQ_ZN%3&vc6PUavi z&8@;Q*2y|t3(;3DFNN9nbvmdD(Ntz#TwD&iBv3sI5FQCGbN45ofhMw8LqU#r#G1m4 zsX_zp-{4X&2AhPX7n{(4X3{W20gjVL=@T?g6dFTpz7m}%!Ac)A9ARn!f_brD2rhvs zYPmib6GV_Hy0)9rK0DeAvy-fdmrAP$3G%oHb9pTQfw8|&MWa>CVlW~_f1n*IK~n{_ z7dI913L=|)Ms%j;Rei^9ww{xN6We5mLLQ3h<9K{e3(7(Fh@Kl^<+#tSl7fT0AlQ?Q zUG3G7Lq(*ljUcarTBF&w$d+4T8YHx@PL*Pw{ijs~*!aT)waBy&xY8+Um<&q!iH#53T$`SgJ&idXw zr;i}E&=`?qNdt|uI{kVK4jv{h?dO8YUTpfc6rot0IR#KI<*TEf=*>?6{e}=u=n`ga z=*}-mAXQ_t!mdh`dvc{5Li#1*g-u<{qNGqd&XQx5B*v3*yqBjYZF&G16*C6YCrdPN zr%KeG#D`lo*r!uEZA6F}dM70JI1;ADAeXmVnn`zjVps>1~uH7HfxbCr|fo53|;V!Q&BfVD%TX4cYuj& zP*tfg#YYDWmmiP^0KAxT(i5?sq zmgN%@jBm4Ls~K>6PvwbWJDrz z1)N54I)Va5wS|=fDhOS+AdEU`bCjScsmDbakIfAUtnv%8h+3Rhm?95)619qiGLjULr5NC&ppd2H{8N6G~r7Rkd%YG7NO#9ZqSMsyAv#*k7t zdY_-JB`u|Y=IO~Msl>Hz95Nx zkxAY20XRTL<<{51e@9ZY9*9+zDAH!4Y->Z=6$pDetA-Rr=wB(TXzbTsg3w0>k`Tbr+<<0}sr zm+GH(uuqhft<9FQlo4_`IsVtg(_*qIPoD;uVeu#v(d0P?s-maP4Z!vBjBtH`oV7Szv+&eWWtx>;iwXNA4-!)F#?~c ze`23Z;yQ)Qba$gYy!v@z9uLd`N?##T=rO|`il~wefgsIKNRn&exf#V<%=~|uIzA~p zRlxYws($|!lP867o#C$DMD*uLVBq&8pky##mse5aapOTra0@E@n@J!GDEmvz ze{2%C|L;j)PIFZR+CzkYm{kvUY-nR9`9=K?5d8*YyBEV$#1+t}*kKw7!^Tge9Ze|T zAM1KWkMTDNL{*2U3QD8ezF@rNHh+N;aCo ziDMGq*5U!b@{guk?LGw$ zv{(?ljgFGM#S(j}sT4Pnp$O>^mG)^mbQRptOhhH}03udY?iI;j0_LWov9a%apbwC+ zq<8dlj&+(fqaRlCWu@sZ*Qi6l%ENoWjK_#XEuM}J}!|=sfjFek99r= zA(5S1V}s`^k60WI<=fZYmaup7bzt^M_>g)UZUJq&=Jg443ZvQ7BKg3YNVbj4vm2!< zI~}*hMrZpF76r~7l9wQeAK+As0e_KRES64>z&pE{tvmE9zp`9wH~tiLaStnjXfRULHP1bF93gzXKw;Hz zd9hpSr3<`SsVHbAwkJw0GwS)POtscI;Z>7o`{duQ?mx6m{pRn1d4HlZb5%hR>H<6K z<`93QRX!Yne5=7!OrCu}vYnRc!&4cuVw%hbR{!yZpLrG)Hk|q>r@*Cu@>uCAD=P~p z-@NEC;)Z9!vSPz=J$L+>u}+go`K!*(I#EOn#&aTaLj>N9!dWX*u1S4|Zn~^QeqjRq zwaWv5k&iiqYo!)1ugT+GrrTP;0Z8V7e*Ky^8~R1}sI(G&zpAQd zTgZgkg2r9xS%b$auiQw{Wa1m`1%=bkbvh>|)JwST=UHxj5q@n|csKZ3T9&`tNYcYH zt~Yyd8S~q)Y4)}lsVRi~TGnYayQj29JM&uc+YHkyfF+|&7Bf|}N|Aocbb?C% zZf^S%<#>|=SOCad$0(0wPI_>OITK~s9a}nby-(1;N>k;BGLHSV)qB6tx)-X5i=c7} zttnam4+`u$`Gx(jo{?8*L!!M=^Ye|AxRN|Fx1XbTG}<(`?O$@9oSzGTUVjAHNgHS3 z!*sLFiSEzO%pk*PgI@_D9^ur0ua1&1LH@I*ui2wTx={+>p`I_Bu5@;Ga(!ADUVnR< zVD90;e`d8C;V%Yy%qIoE-EDL1tOU?R#$=bq#fw!OEVT6A;s8q2E4{kcJkP0_=wC50s2Nu$+xt-n9p@vau zf=e~4@Sv`k1Z9*)`|g}*;`h*u?C!vToq>M2D8N%3oit_0^bmT!(5Q5Qbo%6#6@T6$SB4>~u(02j3oSSFx8?djPxUjd2#r9|F9|JC z$xVM9!~BmEH|e)Y2kG85xx@C_LI8t5>2Td8>=xwwHzwU0DEmvzf6AnzUjAXyf6=zf zKog5_I;cRJ4{nt|cryqHLVOrHq$+kXaS1>KOOYT4)Xz^G#j?)>pAdlhJ1)K7JsI+{ z+e?i#>vPq1LsAYEo=tw8_-eY0kB%bU8%2r=0jt7^p~0w9|K~B?(peE5kSa-V6hyg1 zdvySs*VotIi`>mtSHC~iMUS#ou_rC7_&vD~*23h6UwXgN5}L&d+Xz$`(v2Zfyo%4v z0!Xl>m*NmsN~jAS@z3Wb(;4)I%6D%9ZHll1d>-oWa%vdMIH}?t`R>31`ZG75m>#%& zyl=arXAHC9OflnpgsOrys*e7MAN7eN2?d6A^YF%t5~Nc5;t%6tpBiS2@&vhHovRA{ zd#@!weutSQhL8*ms*gz_w2e1+m3tLwz9%apD38CO+nC+MbZ+c-!JGVEi&xqm#;_W zt&sqa;f`+G`TLZ>N5$59<;&aKee!5sK)Oy`zEL6pRrDipN9cQS!=S%YoY8oTv0j=^ zC12J!>qI4wIC^#DcWz=mRc7-S!)wfK7IEL12>e(CXHHHYyx0VnuBUXq5BWg-2`Qa~ zhB-BIC1VPP5GiatuXCa(Mw90c>vA>U71ssp)S2&VyLJ~=RHO;2k2Ru45S{Yu$QwWsc{4|IWj_7U9NMce*E~M z&Q;OWBs8|iL-un~Jwv^(bO%WjZuDl0QGEJ{){~26^&%fX^s;oP?Sqh}Rm@Iu8xyX9 zZP=p4vQOcH4hVu)#exoY&VzV*ct~4pFp=1rwjEj>20kMmC8P7ew|z-R+hA{FozfY; z3Hc!yl=>n^8>j0RmvweR{>4W<$O8{BZFi|9x_M*jWmiht9$BH+We@14o*4-2h%25V ziV-APvdz7-UvnpWR8WqDTIom-)kvLU)_LRTWw(HbfuUhx8q6H>I$=2S$Y1l@3;f#X zoj39UQ&umU-P^ofTuv{Id`(T?mT^*M@%#W8bX~7hybWvazvXd%BY)3{IpL=gPAXyXiUKOYciBX26SdovNDxlrU~m5@vF$6*HRfK{ z)*QuYfNL09H;4c+Ny3#XWrzQ&Nj=4?w{ioJdzCJo>t#oLy66iG#W*5aa=lCcfLyXI zp=6$hL(-t3;mOampVKmu*i z;bwZ@T2CT<@8^LXra4j=yC8~c;^t!>OWq3~)`G!yL12;H>_u{KAUf(n8H3S8If}ccKhf;*d2{0ETXNS?)VpY@F1~nYM^>^(MdkcHQ zVf5&GSLN!hY*H#g=-R1|(oyXBx-&AiD*=Xz8Ve(oA{76Zbop5XJO-#vQ4+{Dj~%h)*UyPCZ#aiZ=fK~(838eSgs-#oD6h(>+Ck@1~jemUFFwUMRXZWZke?Nek zKWRQn|6Ve~#Oh0ud1Bp|@o5%Fh)m7mz`CF=R@|8Bi z(edq&3l6UYgR4fEi&bD1=tVdpePpvAf%|Ickx{6^s0T-4n7LVcD+G0)rg-oGEG}I) zM&2ITB=i_arn@`{`1WpB6cG8Wjf|+)Ms&<~oe~{3foLP4{TFuYNwJ{3d@31p4-Lga zb@vZT8PWFB)(_`;1$@vjC8DGlY9c&V$OIn*esYX(%bkuDIKGJ&^@;9x%Qk(G${6Xf zqKKg5n*oC7X-qRbiC`5sV=L!dXUt+U($=+a!~BEdIiswqX)xcTj%mIfTXHjthJ^*@ z2`r*)^UtClw_Q};W}Q1@uFyPuqxhINv@<)3fl!$N2-eLK{nUYeM7DZJ^w@=QsYZ1{ zguR;4)koB$Uv>G>JuN=%0@do^$@n1xp{ zv8{n%s>b+NbUZnbl?wdg0z?kLFZ#da^H2b7t*(}tw|f{sLMai=LZ2b$8V|EaSoezR zMsuM+suiIBOFrFvqL9b(&E)4^0_|OEdP@1HR5)#W(#-TkvB5J zr@~!@77CB50fm`)4Njtnjt?%wqTqH0KRKu$|0!*nTIGI*NXV%Tyi3uCBS<#jyt%1( z!i$gzOxU%V%j_G{+Bmn5-k#n2X){+idc@GSe$G;LM8xl{3qIi|VL$-SmGrP%6lc^= z6D8T6GXag+I{kq-ZfOprNP{TXg=eZ+pn#$sT?Higw6wC3bS@tAN2#mOZogEaUfF}i zx0rUw^HF9XMJ9nir-!d9xP$t7Lp+cgZIUzfJe;}4;JsfO)O0U03T0J`lMi#|=b%lk zo**Xz{YLe?or0ap&*SYb)wE72>1-3sccGV^Ee8;O!Kr+uTCMdiF=4cg;Ba#HY)rRQ zE0(62S&ca*3kM}+}9yVBizE4`6m?urr)mT2s)6SpnASEV>4RXApKe=$CEZ{4}L z3`~)TWQ^jj3Wwi>+6FwxwJ{`_3GZIf>U>aGIclV#x;A9Nt6@gOnomE+-xNLgC}|LB zOH}A$75Qdl6Xkj2$4NZQ7ph95_pH;SB2lSezR(5*Y^^KEM~Mu8uj8SDrCBcJn;{FP zDQHg;FLk{hSGl*4FxtRvK+enkLGo~7{tPAa@WMI!`qu@cgDbN$tcXvgI*gflbK9;V zy5-;(mL?nE0=zM7#0w?M`ni2Q@clA{8f+uV)UEH{qVGUE!%`gJoggbN`16UG{U4W~ zAsX1Rdv|{(3+UP5UIxw>0zvfu?RQoMuYg1q&fAGI@E5vY;bQ+Y5GetUB6M`kowLM7 zZ^xCQ1Vh;{Ubw<7=sPgY{&}W701Ez6^Pd`sV84G4#IJS$pV3obAU1*2g1d0qIn071 zVj_hgRAy*N2n=Y^9o$icr3*TgB`vZyZ(JC|S@Imu#pb}qrL|aB(fq`)zaw?}7tPcA zPtAu|b9Jv8I=@DSOWbXxng;lZUM`4UGa>cRm`8S-!db??=7gWPdmG+$p~o4JB_lQX z9xoLqLl}!WnaW5XE2M5ohxF;K8tn4^u-l}!qma?baD4e>r-gGsUNL<#RVW@H!E%f8 za~nPtnH~BrGGbd-%=>2lT4BOWmL3Pkg`TjOR~D5~%`z@jDtnlbM-7mUPDuK~;qis+ z$uZaSO`F^+BHYFJh(l`2!M4q^&im&|na_2T>UC`8{CeocH6Y#Emj1#snwoCHr_@j( zWFZ;3UM{vj-R}I9TbYDW5n~Ao-syy+1JwT6Uo4}>_gB#1|MZab-#cX%bx80aPtzw8N0}Td z6y)43$n$S@%8o$UUuynSJp>K>@3j~p0|SS`Gl( zb{V12VptpYy({sTRsN9SU$UnGoC#gc3t!C?Ef~Y2MOSC)d7D?yn1g@(@Q8k*?E44v z%KxNSv{!Q$u>I4g6rF#_m_ZXTVPe&B-AVc=@E3L6YruitO%n zA0D7Djw^lFcmLzq>&0elyqL&}FbQejbN`!c!>z3CM`Ri{xw3A#&|HP1Fa{-QN4}Sf z(ac*nnvUyG+p|w!Bzn(yDk>L5Xba!uEAinG_=s=?SL%obKE)hoQ$x-Cm_x{fnS=b^ zp`}pwGC*5?j3is#8K3^lSNnqo6>roM$-^o(=9B@#qc~@gdmI|6oaEG$K`TQxAqUU$ zw$$;^m*=}Awkg)lhG3NVEcb?oBh%r0JB4FNG$2_dpW|7;AUie?O%V0mu=~ZJInx;c>#l1bnZ=I|C0t0g?C&~QIahY2O83PLS8k+u8VP2&?e_qRD6oM@LbW<-a&tvQ z|C!B((DCxJ_&cTfFJJD9$pj`B zNvv4*%*vcZlxhWf99(5`AT@H-(2VJ1gm&=d_jH49I*d1j$?mv|dId7}d0^M#E-WVI ztdp-_Gh+8U%?jxSzpuYl3R?JtHfqs-L2IBlfhK!VTjP`Scq^I6EjNHu-rzONNdyOQ zr3OJnveX((zT7phJn=?Qei>O(rs`2g%)BvrwrOW5TkzIGO!)2m!a|)$E1vwv>eB^5 z;7PgA9RiSvx0|TPIywBQQnG+Sh@HJU>FNzdBp^ybHU0L8mlB|&q1R@pJXn|9QF=-* zW&D}KOG_=likO*xOeX`AUn}F`+$bH&=)^)bo_j@w_Sfotb&{peDZsG<*J%M>Pp*-N zhjz@cqou_2%9rA==55FW%2I4|ZXCF;X~ID?Kg2}gkuulRI0APSM>Q{~alY(CR%#xr ziS;~Cnnnr{7$b(1=u7BFDR8*ifUR}aVMI6J!rW=L3Bqb)G{!#47sATsRpvy^lZZ^D z^?+ljA14obV!NZDHGkm|+md=PEsVkw4mWk;jMud+g+Of#O=E0AQBMr}ZD~+Cp1cuT zyAg(EgN^%}jJDE7?zOc%o)&rR=5#MZ6*%MS$#(@Ph}s2$ZF^ranlLzCI$kkF9v^l* z@x!_5Zdr6u_(cE}{5vlMs!RT_ypXY!D>5U{(l?Il)B<7rKilYUz|4$}zLDiOj`Cu9 zhF;%O@|1X%{uVU)H?w#zQ1+La|CEge>;7S*=T%DrfZ#>r&2h*9dXPa^{pTf8{TI(1 z@mkr$Q0=m5QVd?k$cwWwurK=4@da#eUPV1r-DhR zWEJl%Lfd}bS$ns8&2=jJf#QUv0?egtYSxTXUNc_Uu;>q0=j11Ee>@&5*& z<}zF7{wEw&JdZbHk!3K$ajx#L?%|KLlDpvB){7JSB!w??B1J0J0K+aQ)>ZA1)`rNGEN}yEBsLmQV3!{ z+T_nbPDJO+z5{YY@wQx&v||Y9Xk{z$~byObz%xcgc{!(p$t+;k&Run z#!5k}y4xqk51x@Kb1-C{9QC(i^{K##-$O)^927c}ct0TWqgqqR+`mUQLwR8Knu#Ll4 zeiYrof){)rzk2)*hyOkQYD zNrsA<--0^+W^LI3l>MdVKh<~9WdFVU2nUF%pdmww*xCMO=|6=10S2mUz|of%5Q9y~ zj?jR5I0C2Z3y0@%==0+C(+rC*f@~R|eF?R)u$>9`OpG4_Ye>1k~mvEl3)%80o@_m+l+ts+M)8NmMw z#p;m9dorm4b{2o4yd;tSA`SWFa1yFM-30{p2(*-Zh+D9L3&<^y z9P4O*pX-!3Gck?)BP$Z3|NQwn1eYXbT7!d|sSYGVLFFZNIsv(QF*1w~+J60b=@N#% zHi)8uPB0;p>$Ue2RShrd=j7rO$jeu+@T_4qxn_Hn1@8#ofO5#u;)=LQv*plEF6eFK z7KA0G%`#9sfaTs5rVJ^yIu>*)+I;oS&l;Hs|1g|bvMvx~S2>Uji_^O0?d8QL&PjpT zBC|O}I}9k|V}cqZWHV61(oqS)a;(r-ZaEp@2C%PmN~mmDP!HZ39m6G*`bLdxP1BA1 zd$MPA>4#hBJcN0uaFIju;Y0P!*`u*fRJs9_lt}^i&c8kIKfk&vH7SQ8fTbEHJU}_f zkqH95K#(mNehqXHMm3rhc2J?rR;GCl3-K7kIceo8f}Ju#0HCC8Ewb=<;$8J;#$F;?M4ftn|oZnDnG@l zou@vDt<@4I6`VA}w0b2y{lzzA2p*(p!Pj=Wg`LZJVWv;r=ogz;X_gd->!3bylN3}T*0hJGL zw#h9cPG^HKgs8G8f*Gma!mra#rh4YFTO-f(!wfx|wiWANK9^ z(+tY8IG9UAF&8KDcXhkRlzL!``Q^zzbHGKMf_?_D#6(MU|R;`Zl)LeHAP_x4gWZGugCd z2rxA$;QpYx9BcjdXIozcurHvaPporn`hc?4N=Z%dR&7532{u7M`JdM*FM+bZ)cmJx zJu2RRZT&3ZM{uJcgJU0&&zz%t;dRDvNAm{^eqjJ3i9k8X4MdZIA8?C!97;ik;DGtW z$1}V*-(t+Lzq3C)5BlybBzk!G-Rx1;2v?lzNiY;D6(9qZ{lg0$1f25x=V^Bg*9&;&UFLWs!wSXSMWbOYx$6SE zxmJYOvx5x$QhTnRx&HKY4FFqMIe zY7FS!!_Urk*A5~5JC^r8UZ{3U&7|auelm_ga+rSJ-F>H#(+Xc~F%h=Q!GnJ8=A^jZ z0Jdh_*>7xOGX$6=L_TV)egTa=GpQVZQpbJ2aMt9Fr1XOpa}Zi6#TIVdU}UXQ*C@q< zwl7i76SUb$Hlq2SdY{l_tL}k*>YAY>805X7k%I%X=&q2cCn3&!1bf)R z&CN|eJr$gdtLl}%8~I!}Psy7|l9eG!4qM~kP&VcelX*{(B&5?-v$hB$H8u5`FM^4N z=mUMlLt;O0L)O|bTd6jGN6YtN_Vs>0UdqTO75axK1|U!8k#DR1M&O0fn!1p&gO{G3 zp(|{d-s}qM$ccKW*m>s1M2y@B_RSZ_AuC18iga2Un&S`kZ|v>efM7En@6KhF&wTm~ zsqW)cvW~4{`iCM9qZ&nuhp}&X%SOqo(4TgVC_!RCz{vgha1X4%sAL&o*$$OcHrW-2}MUoC#%Ld z=|6kT)Ksg77l?K*4hJ-YbptP*>YhZ5LZIb+YQF7wj$RYzY90z*w*F4=o4T6}A?t8t zKiI;HydAIPk3FP-}qW6avMHl#y zvm$3j%pp1@)!|mq_X!|y;mUBSoWc}8X|I%z*#dlYe(p(%+Kb~vK3wv%n2ic0o9#KZ zDL76T2f@O^k_7@HcpG-zS0MAOp;%^hnAsKZ;zFD7ygnM?_1D=zd52}2g?3Z^PjR;kmi5etDkl&aNNIhm-~STLLn#~n6?D2ZJks;QxpD2T<#)clwwQEwTk{F`=db>wdCgKdeW?`gSP-N%8E)t0ZeRB2l5X%x?o?fGUX$q_Q$WW&N zVlVZG$ihA1_IDi-KgrbC7%!7*AG7-QuzaL%EfSu|DA&lci0<(j@5m|&)$1-<-aQW` zn(Pu`Lo0wM-$w|8qPy0Ob8)nv{I8mq!_f^3ByDaNUI|jI(I^)YWWyjmGBUujx zK3#uR_)SjvdtPP>{G)JZX090OyBI1;l9mnfX*pqpbd*oU%kqufQJVUvG0BfMehw3c=)6G zrxP0$IGd|p;4>shSRRp~w289hDPl2wmJ1mq=^}S;KviKMRZT7GJ!p|fF&d+50?6O| zF(y44BakRDT-Ap<<#wnNbIQCi8Q?M8P8L$u<1PcYvP(k*7_@bI0iF45_>1b`e@+z` ze|s%VbvDq3^!XM@6lLx(SCuUSOoe~rwKxZs2Y;#gPmL}x@{iFqGY1GE03IuS9ymrX zq_Kpm=IxTKoU{?-OP=uBO;R%MD4rUJGY37Yntl21m2?KC9QksDCC0~Exud&;`Dsvn;MOCb6MP9K;61~VRBQRABf)2lpcxWtG%>oE; zq&m6Vr&-_>T2`{tKX%d?hB`@gPjv&`r zo~TBEuYxBJO$C)vsX6!W$pG;`2Sp;UuoG`zZ5y#7Xc4f{F9=pqD*g)wYBfJ{9yNSJW0*RQp?|AC=UqtANgq2|>$_NMk&+FC>OKZ_f zN_M8mtEb7|y-2GT5&7BXXQ0P)!2OPa^0gU956=Ez`j^zelg8r6!bdD}Z$t+=UsFe8 zcjk*jsY$hw&T3i7eFjl)Axq5`eeWFZq$?FhMhMD1>9?dp9sRlQPr#wp3Sns#dTlJg zXU2Xgh_%GHKd+>l^agzI(F@`yfskSAdS#_HhbQ>>0t4K0qOc55dP~L}TiC~f+6jRu zX_WN+jn?d|dU|QJ^lOJrQZusgGr?(4hV|xR-|3azSv8>xnnK)K5l>w$a)6)jmE-{* z*g?F-yiDmKq;ZON;&afm-6U7HOqbtj{J;7OCjEBUS({6e`H!PbFi%x-TdB~Ak>GcOVlmopvUia zc72ApZb7quvo#q9%KlRGpXy+!rhjy>^j+0efODB91Tqg=ITnEft2W}pb_*Vn@g%06k}IIl#aHo$wMnl+;re*5H2hQ3T+jR z+FrlirdHdm9@F@!6nvKm?ae6f9mzLw68bX6rPy!{oN*WfOFHXpkQa0Ab8mFgEjCR= z&MY@KcVWV}>=s|SHvIibkZ62jbwt3(Z%1b|L6D>9UT`S2_=9U%T*I2UlsdmEE~NU2NSa!* z_7#b|>PXRP9Y-T;Ft1E->VH=KlET4V?FFk9&e-&YSVWPVepmnO@AulFkX=hg^ zc^!b!%*-CYe)Jsk(ZkyP6}b7A)7N3#-%dF}zIt*c_{^`H3Iv>BuVuASf#tUax`BX7 z1TKcCN{zH^v3s2)n0O$@p}Pmjuv>XQWZLDUj7UrV*&shQugWTLu8dB&(KS-@KZJHtLRh2t_Jm?v-J^>8a+ zzkaPjhxd~wLYXOk+?+=OYG(Y>HGK>K9G(^2rV?i}G2qi#!-M z{ZwL%+ZV<*5_oYD@^rfeye#8xM+vOmk(79gw^X0vdT1o8YsBa0=hG=Zg9?rn5xkw` zJI8W3st5&|&quBPoDn%!ZLxtT4Wo>ByMVhT)pG2J`cB{M6D(7%_*<~5YYIR;ZCe#!W58hKlN#{_;bpyhOCsdl1Ru1>}CVBNrhF`N_ zBMNeS5f0)v{;Ht$SC+#2B(3V8nG(*f-CY|hZfOE)C;XB=fe>}FyH8^hqSCAQM%--zeP~M_l6aSuvKeP&2=wsgW=(NZoBR$NTbUYX0uAN;Fv6jE(s5UR#g%9}S zp{Sr&My*3g#=w`0HfL<4CLP!~{Z6f23x0X$bASBR%1gIfXl!BV{a$|is;rt$`%;wI zZSsc`V_a2J`ZPOt&--%hnbPtXPTIFko>Mlz?^u6!#Z}uI-f)F!oaEpw=NDH756T>C zwQ-!mo()^y>zr{f(GcAlTj;W&#o7JC0+(A<)TWQCoL}3ru({s0hZg&Xuk6qhzd>Q6(@XD^K;}K4(K=(TS-qV`741 z9>ngdz8mO~+5Lq5sht9U6SX00Vam>#wK8*u>Hdgq7z_e-^m7-Q+G9}?)R0xvn5@I#s`{hW+GQw=Y`uP<1@^^$5MtEf+x zESgebE`|qhZT<9dx*q~FBpH1koHdWJyaD$WCRMnvIUd#T)J>m~OyiiS%GbC1bnD(` zOiDpJ-_G|;W(={rAN$Zu`Wqt!gYbg7kx?ssmh)arY#2rK#Ab|SkW~?urCq8sLt!Gf%_CcX-I8^=fu5ha|FlYvZxE>@|~jlfw`Z|LjIiUHFxz6H`}gyowkfLs4BWIIJ4bwnws6v zzTpG3kG+0zV=31pHAN-Kw&Gmov%5(zYgT@a(bk#g75lEDpHb0oDK8I%7*w@r?^OC( z*KTjTW0GY^VYG{7MUr{m&=t$qX7@bV%I@M0^S8^JzFP6@z}nHa6{R^{I2mr173&68 zS@%-)yLne%!%h@hn(3u)w`|qMjc?9$xw2z(&4$fmTBe^HSo5pfr-;RCKKLwl4<2$d z;AFuDr!y5pPEJmwWx?~)8F04uyG~%Z5cn0Yf>ta4c7N~UJh?lG-60vbs*|~AdttoB zmg@a3%T**xYpH_@GVU(0$szwOUr`B^W?cN5gVA)A0*QNZMvb~lD?#t2O#{@NT5WIs zyl>ZwB?%e=4MU5UH6u8!wx6>fQFO5bd%0KYmkDL3N7#YuZ>FbfT6SXP$x6^Y8DTpBAe=@y)6x`9-jz9eGJ@ zMnA`(slQ1$daO!~FV_wy&D0pbJt86^eW1nk)>Zebug#dduUD1OojqE!D#y$A_Mne* z#S7KjvhNiQU#Mp4Q`$c23xD^jCe3DaQ@8lGt*4#ty;IGo>pe1R-G`gAr*D)P=~s;& zaeK-R+q2deZom2%|H2~H)zlzvR;Ok=eZo?+0v3-?(r6oVJOHwucj9(aJA23FXUFCq zoAsBPrsVvjDQBJr{jL???!GxY=+|dnf80pexA}tY(+48&!DqbwU~86UcRsPiH_=e= zVnvYm{NltwFW1zNLi1jnhPrlYby7+rSp~4)WhrtNy9tnKKAu}%XV6FX4T>N(7(LS zRlUvYq~Ek<{=0czR912Hn8Q|;5sr&aM?7Pz+W9|olMJ1cx$FAu7WsBNkF*`aaxHzy z-ad58*n*ne*$Y%wQ}&lj+0+rWQTO_?rY9AJm5%XQF@K+FZB+W_U$+c;Tkw2hn7Ty0 zCZe|n^)2%+v-vYsl6gU4F-a@?*e(gx-p<~9^;sA-yF62sGf#!bHYt0qOKJW7+W=}& z-inj=ca-VhjaYpl>-40fD}pF9^Kn+x>$c;pP8)M#SnJsTDStF4EB_AYV9 ztyK2__xsv?V{+TDuZ`TZkY#@{^W#f#RzSeHzI_TfO<$^xn4~lQGDmw{i20lzkrS*k z?Ipd116cWkf0wj5pZ?VC?1b08Hm&T-Gkr9VJkqwX44j$~01ggsjL_3vuKWd8(Uw{n zS~zw1rE|k>;R^}%CK@Hb_BAu@5)!fSgKJ>=^IGbff>1vXHaXzvZAu9BmZc2;8EmBiDJg(e14fGf&+kxaIJtdO4{F zSA=Abx;k=?f7YcL#{N%_X)TSqc*|Eub8o=IbA!iL>xHQ-y>ZlFjn#41hTpbbtxbB6 zdhlV^*QQgtJ?_XdpFX=pHzTTY=!O@Q-cb%$R;S-B7&phJb)mPO6?NV4YAI!=mCfIE zeZBFqh~ADW0(Y~EYZhedd31d=Uv-3gU^DCYEqsG!_A|||*2}r_EG2ht%-brsCg^j| zD%%s?X6su=UeKx>@UcgZz@>UkFK0 zwDv98p(Ti-+=kp+x;8YsVu&G!U0^!@TbIS~^CHbBTr8W}+;W1k&J#fopJSQ&mooJ( zn&OEP3;c~4)j&=9%ROv-?>`mJq3qgv1SVMF6SsNaTG02mhB=^&$!J=2g>fbOlm6{jgS8fJZ&j%s;KONU z-MrFZ?-YSn?DUT{8fw3*d^l~@sdcC=N6VB|RX##DGka^7yeUqCXK9_*ay-7W*-{A< zsdLEjtMS+3yNPL^YP8^2btW4IkG4z@lw=N#$@Dq1bMuTDmZw!i0&`i_W8$i;_uP3k zV>kbg(E~azDEpLHke_<+R#xTv^?RPYXi>C})lZKTKQ_CIX_Je;|C0M6wWWs1qMlpe zyEc1z)NE~^R6*&s>Q!?+<88+q0?#UHI;X5{Ei+(TOMlf)_QBo;xQ*ZUrMu`Xkm zx}-7@!*I-LD?WLbZl zdj9bq*PxB-CJs&-q!#YHq^Qkbi-*MJJqWuqw>s&HR#s-WM4L0usuv93Y8baG$I1VS zu*$snT6pidn+G_|O$r&nIu+YjU(&~X@@}ioy*k82t(qJ$fHKf)YhwPOW=mIxlhFI# zFwZYf$?d;o&~KNgmEGP>!gH$QlSOaol7DmU#vM1J{jve^uKNJAkHA^+aZoY z*V*gSqFa~8?0G$6T$jtiHBEMR6L>D4;uh!b^=x-uQs~|{%MPR$y*PRCeMs#q>jSB+ z=k!qV>whylAl%4r=$6Gh=BY<6^(@j`^&l>egl+@BWg^_ZpcVq!%W2g6F}?bgH4Nwq za`|F$U{Tem-G>uWix<2{^X~Zz6Hx;ij*(=`4yp z^W(9@n&*3LzpXiFX5}G$iPiR2EL(OTRZsoRV~%L+Wl5abAD$ImSR8tJXV0DPX3w8& zY&)=QXY8Ynksmu1_IvX6>n&H$oUdHj`-ql4*%j*AVo~ok!(1nh8|Qex@0{GGj~+cz zKQPJ6W2JMM?%rJzd&%Xj530XEU3%nGkm_5b4LaMul?T8jep~L=-cc>?C6MfFefL^U zUS6|Uwq@mhujf|RO|Q{{OjIi_iz;g)R*yHojw2|}pdO|Lj``W^S-Fm~C zjs^R^wmR0g?9#}te)prCZq+~-@rp^A-|B-sqR2>a=gmc$6 zpXZy+i#BWTzrr~FX4Bm>9@k9x?cLGMW_>gNjB91zZJ1TltlB$6y9M6u#p)78#crLv zkkius)w9gD*duGzU85{kJpw8 z%lCUa=!K6pxw_QD{qPpG(sk?XTDqLbEHyVl;1)I_wI@#P+C3>a zdS|7@ldjYJ|BS9^#aBNcuzLEYZpQ{qvsE?+V4N?7J3o**h? zZ%N1FdTn&ZOF8n3q7WV z_w!yB-rifO(qG83D=P)>VrrG`A(~HtJj!m&%lhkDSvyBJcOD|u(?Cj>5eE!XW z_ZR={{UOt{oB8kEmn1zI|J&nRw{CftciZi+>AyV5a^IJiVRt?5p6Yx$ew4?x2>1aO zF1zD?AvF*M||@4%_!_K*6Vm_4_J@gyVZ>I zrqCp(hmX7?OyUUuh)mQOo*Yk|*!_6FL)TS9m>;c%nW4LeV^H8RXt z=stb^(IU7-=iyTa?Nkh|j=K?HK6!}Y4##uHwZbBG{3i!lJ!0?N-emszg`;=}kF?jj zo6pjm&}U`mUZFv%J6~@(5RemTegD^C=4&2qe!2aP?bM**KKKJHGbCOD_+AWm9rxES z%VQTWZSwV(&JGUOL(?Yayhy6;U#J_jh4Uz0V&Afb;iU3to#}hkO^)oH9A4JC&;Edt zrQZ=T;0MMqkPm0RD<5>%)ED)($y(vNr2OP*yN++Y2gqEB z?KSN~e>fXBA#D7(2(Kf;hFN_LIo%xiGWRljM-%<2M-M$%lr#T9Ej3BO>E$Y4Fvl$L^lbn%B&9NQ^++^pDtG zW0H$(?oGAtqGwh7Ky>!ejXUEzRSYQ&9r@^C(xYj124}?9#)B;N@>HTS{dnatsZXd8 z9k~{E3Inp`%BiQ_{bx7 z+N6vwlJa0F@Gvr?I_%EG@clI;UeWQIl;69+wJsP*H)Uril`h(kra|VCx zbU7Zbvk~p>A3OI1lv#Q9W7ghtf)i&Rx|%kfF|l-|)DiS4DGe)Yl%5s(uu0vn;@U)Zi&N}P@oV3wP+1Rw0?ayMdtuN`DSoAUC6~s)PE%Dc6v9+Tl0{`~y z+6**UHe4ewy2x(G=jthMj~za^B;RY_&0uO|+7wl?W=L6*1w5Xk!EwB-)CuC2j{}~>bE=9ru!Y-(5duni_+1_EsV3ZIqCBaa!R-H z@`7f~eOA70qmSdn{ZHc(-}YO4=?R$*qj1q}Y6b;Q@Dw&YuTXdaQS-a&M&G&o4u5;+`}G}el+J4d*gisO z!rvrTSBlasX8FT^f2wsgUiH}o-s{4%1w21el-?JLtvd$n_=Jl+dUXp8(WIyzz4~+y z=^ET!2NHhw{@ucQ^&QYFG(?-C_|cJ3QSr`+32{&nY(#StqIm+`)`!d1$cC81P2g~& zllj5~*vWTHq?jk*5i6qYDT*5tBj)fEVuhl3E`m8+Qj(XDEE)rLPB&pfGE^gOQ&(|x zibw>X3&wEh%6KuHWL{b_93}2Xm^cQj2A0fLq=26=3Qb0JrbMn-JX$DU1nnCj5{?%0MD)ISF?_-e{1V@y{~#9=W)q7haN~JIZ2BWZaxe&vOcV)Y`2xZb ztaN!!3e?SEK7m@{zt4FV2#*C05fgel)!hW5yKE;($P1O_tJ=_W0V2PY6l)1i%F0{$Em1L|VE zvaS%!O%&60#0yhNJHm0|TTqH_ZTh$qxT%rJWFNlLeTd+g_z7`PVO~u^iFipVd|<}mrU2`NWIoNB zK5UUNnM;SDIpjP6?D9J=OfykD4vmPRcO>T08ngtC@U|WnC8bjm?QRGF55{A+`wr(| z9+U|c&S-w}2=KWC-e?je7fW-gP!z{a;Ex5J(a132Cjb{N2TMYH@kT?=t-}#3 zooX2zDTz3`RmKX1@sWIzOtmNqw}{8naZEl0uSGS!e+t{piPX^}c+sOG#fdxtbRuzx zp_3PM3bYHkQxtg*Zc*1OF?|nU^rN~X6_4Q3ZUQ|Z6TKW57NDDBTBQ$A1jh&6ZbEWv z%($^U=+mR|c;H|H0)jc*#6$rTLbMm5`@}=yfMdfwfp;`0H2^6D(+H5Jt~`@GdC8b2 zh-bhq>vA4#rkkD+OW+CU_(&E)t|93Sh|s=>hX*zcEqqH_9o`dH01v4HMG2FWg`kuI z9Gy5J4>F38F%Y8@bg=X$301n2r4NRemdH(z=?tQU0s$mVA_kPAKSq}j(*rDs2`NOz zO6NVy4y3b=Bx4Xf4qBub==Y>K0Xh-sCS3u3fKdn@Kzpi8|H+I8t$x~7V&l>WAyZnK z8k~M!9HAV>4}c=m+2R38`%`ciY2#w2ip|B3_LLg2)#z*wwIrl)NKf&-9YK3O4nv_Y zr9omiB)T@z^4uszrJ$4G2otfK7(|mMQZ6S^C?aE8bOJbR@Vf7x2?WH%!El8m5=V=8 zyadSK`~=uPBtJ2SBmfRc28iNvqJ%LdrDIie9s~cR-3%L$78MA9&%!X69yZr~K<_yc z3r9i+gdZ?n6O2gWi5JyUlVQG~W6Po-;ZUpKwE$iV>{!%l_&Q3cJ&WqghMQ@$Wl=gR z@N=8+idX1Nb6`=^VbUc2W)ofl9Uz|sHfJ@;;0w6waMU_%==zvPCwQ%OgF1a#ly3kFW=U*7 z>B9dQsu_8&5C37h1S);mP<=5ts&AJ_Vs{{RNAiC%u}AGNWm>IU~jU?cv!Mqy#DTlY*)Vn*;vmxGY^YU393){m8!Ffk2l-yk25C>u1_@HmhW^*E zKJ>?iHjKN5HkdZa*)V<@;vfsk*_^-eSWRdLE0dPOM#s9lhR<8qT2LtRif285E*v6lMoM3U$J|Ff#n8CDwRR05ES|$?h$>NMyV1MmcqJJ2`ZdHp?A|LHG;xYh*Bdc{1od#f2UE%#E)zv zN}Zt4%MpcprcoLM6$;yk(jcg028C!ErAbgR3`&!rVi^=h360VsDBQ-nvE|P8!vWphhq#><|1XK7+zN&?r5EvSd(t z1eL&`aL+VKpP;%iDC|}Is6YmV$3deE2nu5fkIR6dFpBWF@c3wyAwgl(Aj*)SFkTRa zu}-6m2nu5cQAPyCVNe+TG^#m4Suv>Q1ZB;j(9dapez^^GN)0d1SMclrUVtwpimJSWkygo49bk4gbWHZ4UK9^ zP|gghB|$kcC{&R~nG=*JgEA+mjtmObrBSU2svU!BMNsV-6lzVQS`$yiuYzX;Lf8t}4wUVG@P~ad2kL8>t5NNSHuT?yHuQ>yHuQ~#Hq^hN z%~pZUPJzu{fvv3qn}Y(IqXHYYYr|u~)@o=&Z)j-4c5G zLKMzL{NO)b7sdgNav~@k4+9j0_spj-dP*R6By|%Ahb-Xp}QS1u!UQf)X(( zj2;@*o}flEsP+UUW>6SUG^ztZ{mP&^5Y#XRg%L)hTnK6qgK{CL!3+vxjz+l>6t*jJ zbR{U%996|Aq)~1Jh3$$cH-f_ULlk-)jdCZbAq>i$poTIi^g0^lK~O0S%7dUH85G7Y zjq)U@-x!o9K}9eqjAk0uk)V1osE!2Hok5{L(I_v1>dBzI2&xx@LO-KX-UJoIpu7pH zH-kd2qftHt^$UaYA*enK3cZm=`4UtxgYqS)5ZJm3^Sy9&iZW+6u6KG)>B0<<{rUhn z1I(;nYeJpq>w9%57=5X{E&zKoO7%5q8%pc79(>mD!KSoHIUG={!H0<74X-;@X?r@< z1&vJYqI6!5g|`za301>70&w{2$^wg8NmKaW1>UMtN8rCcRm;+Y@kkdH{4Y6X1fNbi zW(@z2sNfwt_*66%38VceDjsZo$#yc_JWE9JC=T&5S%fo{NF`8lfCP@@+$@{CSHlCQ zDpk~|8hF)zjmF=gk8cj6JxwZILw`70{GFe{J}ELrudT%~IQ@7|y(UZ_!={w!cp0W! z!Cs#!mQ*W2C4a^gM6bs*8sR+&2BRPd-& zQKvq_YeRL$GwS3kRi~J!^E;H4sxv`Goe5yCuMUc=R)YTZGj&V=BkKpzpg|%zd*09! zFk+=D&=_TGwE&51wG^_Qz_6v-EAxd*gl#$0A!R#JhV6W?*Jq2Kr&eMH|9{5T5-^I` zMuIQ!q3uV(=M8yd4yw<)4y{Z9ZL-2use*?s-`*1$1%@kC;3ZMu5tNlGAdyjEGuZ1Z zfSE$A#1{T5R{$e^(lKZF|6>Irfo(j*NE}3lyc#YP#*;EVWXmekMu*Wx7wVDMMk4i& z*B_K*ibq77+fY`j%_JFZ3c+4q8;m`*5^VXOX@esU#o8o-9%A?#4bdTjHB?2qVBg+Q zmxkq(X`;(yPhExCa}uLTu~JPA6HWHQ5lA(eETc&}*z0Se0hXWj6STiH>?fk3XGn(9 z4WquJLEDAXb4Iz@(S2H5L!)dY)L3HEwFYkzaV z$hLnB(>Ek5i3E4R(=9HGRK^>7W#rvdA@3;+Z%(x`zduTNAAmZfyr;_WmVmuJZ_L6! z>jUUEZrBH4cIPSV30){0Dbk#!C}n&t0Ev7p6!M+Q@Rca#dxh|=fI6gnr^)bL2=@AX zVNe8of7}bud>i%xQYLkIU6Fs+^?&ksWg6g~Py&2o59+Nlzc@kkI1F`2^~jXbV=CC|>w&petpvUCXL?}1sILc(eNY2M-rx#WI{Wd+ z7zuI8IAf24oQ)K6&SW?bSIYSf;rtZpkaC_W!+AT{>vL`fmY>at==|4kMifg%HKTzy zj%^~zSSJ#E;73Z}>I1FB&q^!P2YVgV$3&q%GZ}q~mFgou4wxmQkNh|QXG4t}2Vh@_ zIYL=n)QtmVk;-^CXLvVP$a@yUoAXXtEL0G`I03at{bIHZ@7Z9l?-%-nH@5uGVxcu) zWMct)1o01<*Nq11W0i5oHo!L5Q^aNcnGeG0|!x5xMNQCkY zN4l<*Cs=9Um!g#M#q5H7%@p#T!|<*A2Yl!LkT2%h#_`43FGjLFUpJXPP>NExW;WcbR@V=%`yZXScVO;PK*$@FqGMj2N;cZOVBDdakj;hL|M ztGq8~$#9iG-SvGL^G4&^HXhnFRbij*25ZVvUzVbj@x|@J}7Hj`Fx!% z!&g3EW5#M+zQ$~w3jJ8J5`V7iyJV5dc;k6ZuZB!hQ^I^<+VvBJ)5F@SC`+Fl~Se$&N5IBYlV6&VD#X8R2C!hIborU9ula# zz8~FPQbYh zwz%T895f1lEc>ArIOg~_w7_ha202fWH`I-S>T4k_qf84tgM?Z*E7W2cqlN!B zW$_@N`w#dnHqeaV<8U+p71}thNIQ#io-^c-sY~NVNN2uh?t%uBrs3BSzf4r6o`THv5pU?0wR?7b= z;eQY6kn&$8!+$;4>+{DRU#$c^;Ai}C)FR72n!+_Yoax}TK6qYJ0DtHQcnwoSPw+6E&nHtwua3LGwT0dUzlR)|k zTq#i0S9p+X2LDK|t7Y_%j}x4iH7-u@ zJQfdTN_Y)eiV_{_)&&}(74xUy`Zs)3s@N*@ht&-KN~Qee*Fy_s_{*<{;ykT!>!Hf7 z|MQTU8PgbLT)k!aDF{sG7S$?!*KL`CuMDbqhR zL@Va62PNpZ#~G)5+^=Q$Q!2`QL4MA>PKJL5)LB0dV%BfmoEg`M>6KzdX9GNCu4Rjm;QHn*UgXq4sSvSc(WDqUeE9z zuC%@7V}FATZ~55AIcVczU-4X5ek9;2llK&tQRV}99v*$5nL;f#Fj^EV)k6Nf|3(=t zwnN?ZeILJ{@IQ6l-%}xskWALf%^#-u`OJ;z9n}sI4-*r$XKJ^98Q^HSXFdG0dg#8X-k% zs~$4zD0MhxIg%b1RI0crZsVi$|`8o4;8P4mW?)vSFJ$U2h%=P;_E}1b)$G`F_xXa8Be^gSLF4%ve zF6|ZSvYpX|qoGU}`Ss)-GP+2h?)ti5bT)218P}2(ucmv*oJp6Wl=0=j{*f<7A>SPg zUx`w_^7(zI3}5;Dj#>D>ljrKL9r-(X4*d~%dnn|+li}^JsjQvldGGomZ(P&-@9@U# zMX!ha9p30~$lFsP?_CV<{C~iE_YZmFoV9VhF?un-~18+x# zymvFaDJ^B~Ek6g|Bg0#M4vcHEja&P{{))a{CKc8RqoAIK>w>QJW&`!n%J^eHi~QXb z^4}x%_cgzfg%kO?p!`}Oevef8-Oqe@TR*Sinr!3N0_*tWRh*dbu{Vo>`s8(}8`CK( zrA!aZ7O01-LOu2}dQ=uF*29l&K8vOAeJSqz*Y8KoFYZg6lq>a?Q!d9@htb(__ z!Ra{pW97ifhnt#laFgIT88F=RrWPJ5fj_#ZmL5|t{qoDi|4sMOLW0tJXh~lwxR2I9 zyO$Ql+zYEt2+|g0)4$HBpe@)GX$u-dFO9&h82|HDxFGqzR)9M}VMP3wT0y2+|F^wG zKf~oHJnQ%k!dneqF>m0h84P~3X)~`F{{Q#*|4V^ywa^W+&;#l}&@U>d<-PeFIzn$# zwkG9hx9d7C4M8tLd;>rCho>q$gW!q2G8~=;@D#vP7oJn$iC?wC!G|F{abXho^Z*Ls zg-h634CW`q;60HC!Y#XDlh{d}z3VW+{AiI-ER0R&bWelZ&6E8~!ZeRHzj~JC4`n26 zx_#hZKg&WN{-=*0@n>H?dpXy+rQU)iz~AZfR^Q!2^HJ@Vm+`jo*_Ru2={4uku!l6!IYO5g+w$xTH2B*!?D_{36J zKR%SbwuT*}4j8}vNAP&bE_H8R>)yIix&XwTV?$tNgN33|Vk{sg<^QghEXWXeGf#{P zjwV(}QN`px)dNrG)wNw{Y%JbQpEM!IwL=Ft&i7rCj1$0*jrAfoXCn}2a`et#)I0B; zNpyw(_y6BlfJJqK!F)UnVMAdkKk^^%0B=qwn-Tv`1sFdh*#8drZ(#oE{{Kdm{|NHG HdH??pgxQAH literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_add.png b/public/css/icons/ic_add.png new file mode 100644 index 0000000000000000000000000000000000000000..5e908c29f7c430822079d785e1c0e9f330d0a91c GIT binary patch literal 439 zcmeAS@N?(olHy`uVBq!ia0vp^fgsGm1|(PYdzk?#$r9IylHmNblJdl&R0hYC{G?O` z&)mfH)S%SFl*+=BsWuD@jFFx$jv*Dd-rNaX)#Sj?n)v(@(>u17xFg%IJrIk@j4t5a zt7*rQyFhkET+IY;M-64I`;CewO)sDS=`#&{u}g1a>d!_77Xe2R0Y?@=7e+xaGx@p6 z_g2N0jLB6ta{K=t-YS3eNy*iIBj3yEJ_^PAuHMQL{?F`l?D6Y`vm|!%9&KOFb=`%# z`;Bk9?~=_IB86Z2q+4Y#Qp;M@-~knJTw*-;zWSND1-G}o-)8!K)++hbX{qP8ZujYD zGVm13J3dcLqgd$PKOwLy3&RxwMEBs$~r Qz?fk0boFyt=akR{0C>o=9RL6T literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_add_folder.png b/public/css/icons/ic_add_folder.png new file mode 100644 index 0000000000000000000000000000000000000000..8d32f5e3c26517b5ddb3be259ae021f3ca444673 GIT binary patch literal 627 zcmV-(0*w8MP)0bA$}_A0CfX;XW&C^BZ9}j7U*G3}7fun!aSuJG z7Z3muh(JU@1R@ZDh=2%0AOaBq5r{zShFAnU%dEM=wpU9fW%U$R75(h zJO3x!wnf_)9Ys-GDMS-9QTLj#GZ2B;of`|8NF`!t?2Mfe5P?W0l8Fe2KqM2%L(U__s;wN}Xf)bl=i<@^u(Oqz0z4cJY6Gh;gs`N=mA$?3c>Jlo5^pyj z878&&$4b^^CFj^Vr>u-~Ao7UQqRxd%1R@a0L^6>|#Llg=^R2=#Y?{BXFB2w{$+oc& z8=i^Res?;Z76PbiZI4vqrl(W76IEQrEmDL3C>XspfNyv9qoSa2zN1qPzN`infookG2mxQ;FCa zh-4y}NF`$Ds^b2drco{9rl+^fEw}G25V$42y(f~a}Ct?v~%Za@@Aj8!Tn?5 z+Cv-B$BPqLlRVuVmB+npJRcfF3SUUg4Y;Pv@xySAm;+|VmWM-}QSE7%bKUS|y^UL1 zTIyN8_^+6QHmPb_uHotF$x8*q$H&K#rC^m28;>>tz=*E_xXgiZl3>!jVOpA4u{593 zDATbqK?bvp_AeA#Q6^<+&g3S(W|HWLkTV4LV9LD%pecr7R6`lSwt`>g7|!8%oFkm{GdB@A9{ir;48 zd#B!500ITFCk6p>qyl(%cSmOCB^7LAzVB%7gIg5P7a?~JYuI@24%UK`^1=<>=&nb`^NzOwYGb~ z)o5wEcD{OZbMyOPeq&>!tt=X!G4}vo#Qoy1ql3OZ?pJq|GnZKtWObEii0wH*do{Hq zQveg6AD8gA69dVbsrDlPyBt*4SZk?Y2lqbl4!!5(=p33sBP-IbC%T#-c87xPeN`hz z0QhFg=yx#YrR;Ggl=)5znG&huOa$@z`nnWrj_bOW5sMvfZf-V}zTGkX2<)He+ZpqM zbczMV01<%H6)l-WZ4Q09Q34s@xqF zPzLfeOAxWMF0tZpgdGJZFz=3j8SW&eP6q>jR9v=drRU#+=5$I zS62s$Ih~}v=9mJ6c5c4_!96EG-=w_d)>~U!h55P3f|IY0dMbFSCCjQ&_5}#2@8_J! z*X2!0^;K0Vlc<%9PI4ugjswvKCeV^X<>e!m^*^@8E>%isqP2ZSOmnp)A{+i zH%kzMIlwU3-Q7(jBQo`gw1XA?|KcPynJb%w_(TCwKok-X1w;W+Kok-X1w;W+KookH behDxD8ia7GE$OdK00000NkvXXu0mjf6NQ1S literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_bbm.png b/public/css/icons/ic_bbm.png new file mode 100644 index 0000000000000000000000000000000000000000..21c2444e84bae338a74d2870b965716430877c4a GIT binary patch literal 836 zcmV-K1H1f*P)+Y7$5>7AOa!`5CIVo0TBj>fCz|y2m?ew1jM}AqwEI`hr<&c-pOAq z zonHSTe97Tc2u_pEd} z>&ir@TCFnQqX=z@_|PV_*=&?Ip~p0`g}@yB=0SrT1=K8=_=_gAUaxGtq;bjwF;F84ps{v(=$yF`+x!|p0YbURwn1#CF0xI{M5obc zFyE7i?B#N)tpOR8i6o9MvWr0eh-`u~qHA9j*^9;ER>LxtQRK~LGgM>~D5WCX zH@c6^HkQnZY!jz*XpNiC=L21h!qg22X;DtlE^3^PjRYGYeh|1!3Re6A!a|)0hCEv|YxI|a-Cf}wov%ovLlH=Rypi>KRew}+V#-5 zKwZ<>?f3iE0#pi->>v4;I9hEC`-9nEu>c|r5CIVo0TBj>fM}+D3ormI|I_sW*deR{ O0000`wfUxhx zsen)cp9%;SkW|1>L7)Oc1waLX3UJtW3^d>l`1dh_@fR=Hv1Qo?y%|jg;#gNF_gM=P zrMI^?%S5smFbE7p1JOVt=95%8#!*bhlvO1(og_Ml%4xIaBlS5WF9DZYyPdxe9D1`@bV54VuZ zc2LMEe$w1UT~tRyJZpQ^w~V^n!a(#q?;Rkn;TlAaYesQK44CBnmgw9ItGk4+!HcP2Xk#tx(jB$wKB9~}fq7wMDq){@pgpxA{J+uwa)Y;25mq%M#>^lfAbQJ!A4 z0V#AYoFz!1uN~43JrM8j?;Vkj!PGeHqcLo1(|ywhNjfFnc9MDr6uQtKA0O{)ISbdb zj!YY*(CMpkV-koJ>1Q`)gE9fh=&fjnh!iMGDRG>@8Ek6b-Q77Uru4C-znp~=9TiUe zh>3{_){!ZKbVJ&c$tq6b6>7~OeN{I~lFr;pjimx4m)f_tw~pd;R;E9f+ejuSCs{|T z2AQj+u-^_ccj+vH1?O*El*8Nv5r&#(#}IVD;pwY1X9@$ElE0iQaUW9 z`P?CpTxwrmUpq1NFG>2nES%WY<;0Jeo}OkM855)v(jF}k<;4aYjrm&ykV2;&(w_7o zqA@OQ&5%-JMaPhWKys;lb#>)LOyw0xw@>ZKs&|&Zy*e6V>i{`3Gs8ME45ZLkSLH$# z5Ot3NF zT(|r&0MBZ$y~hkfK_f~C+k%l60yn*zzOQf`T4ol)MmDed=9Kh zr^>pNLWJ8WeV47Tf4`uiMF$}3Isl4#I?P+|9gWbbEK)f=AY9k$_ywKAYc4D-C?7|j zot>4Ti#!Q-z5;lW&at4b;+$g%I>U;1q6!T>hygG1iK-~h&-K|p zG`1CCPW^ed51M+O?L)nh&-MwY7yE2qFiuZTX-1>-lxcHuaj~!Et-_pl224u5wUl5I zygk5+HQg-S$$P+bL`R_Hpr~fB^tg=6K6|l<%GZ0000rU0 zrfU=bJIFu&jY)Ep+1a-&s}Xbpmp=n|s7G*%gOo?eCm=RtyIjT#DRU?RGPs-~kH*tu zJl~=BMeP|E$f=ZEd7nFPrR~xrSGB?bFsI`I6Nkeucp^ibim<4nyrPrAjF}{LA$2+( zvaW-uAq3C!{UU)$54OFzxw)3;h{a|1kpB`c-EU?k*pV|Nq*R!i8ecme$KY za+Q$Wb!F~+UOwklLQwxyt*@jr&K=15;QR~OVURxR6i8>74E**Z+Bh)(*UP@H70%Dk zQ}_`%uHktDK>Q)yj>=Y1&n5ZDK7Lo&y@TPy4H+K?Ee)w`dx$#Yn^>~h>`=2VWKj7Z z3F1()a*xYNm);XEsrCH)>_*JcpAiDuTc>i9G$yv#`Vv|0kSS_XvH{Lg0&icb_mf70 zg@uK~aRW@^&RrnrNRb!zp&<}DFh@UdC2R3w?#Oi4#Z)gM0tjaAl8|5EfSLdv;@+1R zz-`@QIr%69VOKv#{h<~MeRpwapjRhNDEPF*r>CbXT*c|*#=DD)i!JWNap2OZKh*9C z^bq_ebmbKJWyr4$s7Haiqt=Zv1OyS(1Ubc_rSYo}r z7bDmvi`fmVg=L&XxU9!#j9_1o-4PKb*amX?-ULqUYVNrqTPhiVd_5|2`64^bvjTnL#qPhffV#i<~5{ZQ2q z0Id*!E_XI@V9j+4%5D_tIAfh!LnLb`3pYCnSrOUF8a^pVAGxf8WS#Nc8RN@D(|mY% zILdt8aBXlb7(gvAFE7_p(xrYh`w7`cT0=yqEDmFGVhk+s?0S|qNa)M4+`NnoAluXS z<2~u{Vb3PV%F4=EEK<>xqqadJd^B?4ffp-dRaySuxQK(a1RwnbNW zwuLJ<26Vc|wMPX>I)zKyxdnoK6H~vXwL6P- za*%eC3Rz!Y@3F|3Af?Wht`J>e6(enVg@L@jzIFy!qSWc?>dxn4X137j{HP$+Svv|O z?%NqYsmA$SONbjA8|sO(gA`=OwMcn@%cr*JJUdt9j?UH9l|2rSklO{xIvlkP+HT6C zLo_S*Y|3tKZu%+6RzG~vCxS*MWK$OU^xc%D#w*rHojXoRc8^77dcS8^xD9%LV_~al z%FfZI>DJa(IVIU)pJG3)9sqa0&58xkO7gHLjaiqMmsR9k3bN^NsjCF{q^tC;mVK}~ zPjS5r5B_HWnRv3{x@3hiCj9((&pQ9{Sl!)ObUM`a_>gIRdwbiBBj@7cg5d3koOlZW z4tI=1Cx{Hd%8c%G0R{kjPO<(c#i=&{0000yxs z8Yw`Ls>u#Lb)Tc0`RFbM5d)){{Ap?b#q$Bn zyk-%jkB&qC2|h+uPLk7|O#;9@M|-;ObUEf#l>`%asnt19E~rcU<>h6txw*;qgL@}v zJ6iDh+bGv4oys7p*y6e$Ezoa*+5gS}Ay>R*V%Y)L59+rK7D$$LK_Lh5<6K>u^sk!! z((Y_rozZE)#KJS(5>>sW2p*V%{V8+H6z4_;7wtgT_Y9!Y9n&@Z+ER7qlZn!=3?gK} z3@-AhS5^{(W$BaLW!#_Y_0?pUCW`7Ds#UtL{%%y_&WJO|+NH}d3=>GKVo4^)YNaa@ z6K!?5xOn3+K9UO>qld+3AgfEZ0V>o$%~P5TrXHMC{qiQ5BxKd!7|Y~5ple85{!X%O zSasjIa&CqvOf2dZd;kJ}&BVQs0oX_1sYjfQ4fX!ow(ozg{Ac99VaAU7E(w$+bCkFN6fsXn!{#l!_l4+UyxC!RWQ{-pzmuNGI< z~;$}4h@4lQHx7H z{~X}@4cbJG5U~n)1GOdu_zFDFIXW*f%EH1R&0tHle0-%GB{r{GXqn3#DbK zKY;!*(`T^eaOI-XTVYtbVy=C|!?rzukOy587+-)5{!I0~C8A=tz*(G0LZzpaK!XN+rhl@sTj+_D zwWhi2N7`OLP^WwrNp-`h>0-R@F&? z!AvSxrKie$TNtoc0*`tGrKMm_EtYql>0JiExof+=?fWe9`1m*ghr$4DM`521AX%Vg z6ENJ_*@=oCg?&1JHVd=?{P30t0D;)tWB~FKx50^nLu7P>~D|v?RG2$K`sSgZ4V&s?(ST!J>1{lkCxS6E%(j)zQ6P#4M1d#}1)_*R6o>**Ac_b?fhZ6KqKH6T co%|AD0FQhUX9O5ylmGw#07*qoM6N<$f{V17jQ{`u literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_collapse.png b/public/css/icons/ic_collapse.png new file mode 100644 index 0000000000000000000000000000000000000000..5db0407dac213e140594f2f8fc04ece6682c2d21 GIT binary patch literal 487 zcmeAS@N?(olHy`uVBq!ia0vp^fgsGm1|(PYdzk?#$r9IylHmNblJdl&R0hYC{G?O` z&)mfH)S%SFl*+=BsWuD@jGdk?jv*Dd-rT&Md&q#HH8IA}f&B#2&Q;P|7C-Rxa!+8o zvBdhxziHEXF7O6v7ilZ81m&%J{l~pa=g84Vmp3{$z1WrK{_H6ylYk@3#0Czf4h10~ zOVEW0$ZGO%Fq!`MhWVD<*MHU)od3+?yJc_ZA9ZKp%tdPjlLK1>&ModSO|;ys-o&9a zv#>00RvP#6^o?3d_JtAW6pD@>66Frp(MkX2BH*Z^094Y!;v$eAeEq9*$7hD~SwF5Q zcL+1`|9W^Z%|koiAtbbvw_KKB)|y@r?UG@JPeavS8Q4_uPOi- Oa}1uYelF{r5}E+boyGJ3 literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_copy.png b/public/css/icons/ic_copy.png new file mode 100644 index 0000000000000000000000000000000000000000..a5482ecf6ce0f6a110cca5311597fba5cdf96ff4 GIT binary patch literal 737 zcmV<70v`Q|P)HK1Z_hfa2I6=Q#KB04s{(15(o` z5C9?|0wM&6fasWlrZ+Oir0+SO&mmoYX-qZmV?`tB^?JF=Bu&db+fFnAkn5Yq`gA&l zZ8(uNrQgJfv`N#IeM;l2-|y$|>_pRw+i+y7P9(=L)eX>`KV_Wn9d&i&U@*wv&WU`H z_d|#1if?(=x{xMNm5$`|=yaquC+aAiYqp8fj?A)5=*ZD%l(yzX6NU4uXOtu6XPZnR zO`wF1B*4m!>}rX_H~vQ;V;4YnxlRnr)=moKV;xE3`qtjkE8#5aNtDBhH93;*2;W&WJOFI3v!8GvbUmBhH9(X9S2i6V=v-I3v!8bLZo{ z-EIrS8F6-28^l>+eHEW^fHQO~5}HgVOs6prXS|)=SRb4Sh=?=d3;`nI?ArRY72CI_ z9&v`OL)>&|pBpFROlJ;n*lqo-iz>jG$p1R{Y*Ad>yHhpZhf%i`{Hxm?O{`2}r=9LFoPNu^TpWrCHo2&-nI z3;+ZB0d3AENx4~BOPnlBJfF|9>!}5_QMFq2O=hBOa{@-fWR>rRiNF|3Gyw4VlclqC zMjFdR0BXz@mN-V*#xYT*old7XMg~kA)oQf`F)@V!P;rb5v~dmqJ5+3I4rJzZW-Fkq zy6>Mt8UXV1PHpsb28SvD3=3)athwiTWl=^lKaMs`gxOa8ATlglY}-!FNB}I6k>F>M zI}`INqyvgpM&CXmnfykiNq?Ql4V0y$I;VxF29 z^VuOId4a@=!KA%2H;`ENP(ZLe){<-rK#m)YhEE{gs8(3JB?H6#em`n9n+p{KGC~uR zG!lSxRK#HNm-nfF%$11*WN|=zK?3qwOAu9PA}kCO@coii8$Y$7%owy^om;Ke1TGWa ze!JaH*+XMG6-FTHVVToe_p{z<#)lOHF_Azd5J?kB6N!nG&IBT9B55Kqk04DA~3PYw%u+~(}ZA_XNv39#{Ww}S`Oqxi= zHi~UF8y7B*r9UURcr7?yJnM8it}4IUF_8s2%@}Bj^_wz3(*5e1&Ql~mkBa;nt%+sT zeznoWsK0Kvo4O2Huh&=AevPXWZvn#tTJFVm+F4T_pw=Z$o(2=Gm z9c)s;CKW8HAf$qr3PLJKsDMy`-9f?)KY#!QY&yu!7-gShY)iJ~Tl1b?4k;tem$@`j zqRi)WA}JoNvIZ!MB5bm+udf`E{;ju$ZEf z3YMfsGG~!gbpN})zCOzwM2|%&c?RwC^ONgaUm=oWlLRr16sJn&8`XzPO_b(b5OeOmB5Wz2$6+lAeLiy@R`@~wwtueNI(kEt-;%J(t6kX`)bSiZJ zDK#+-O)O*4mRBa3Y|CU@f+&4r5JzU3Bomq* zFs27hr>(~T+<^ACispZPgh;C%lS-m7_OE3`2@?UEdw*JR-n2OdE7d^FQ- z?(bAnWne)dUteEsO{0&R#~2;@bccU3Nls4-nINKbb+)LE+=CASiJ<)U>ZfD=P@qwB zbrEX`BNOkqEK?kf`oS7Ug{51n0)${{`t z{!vX_LLRL`1(vXd(3h8&Gan#PbLzlj=2wK}Xb51Pekq~mk0Mi+McFP0q6GlC3GE_c zAlVEuV>)l@1>7Wxvi8kd5U9Shv-3k^=zAULKPTUn?O)`(g6(&Hg6GwJ_?*SCfW?j8 zSm!XnXPzmD4h_U~#`FWy0p^8MD_sKAS-`mfG)YD$fkMq0gmy+?8_4J9XEh=(E&zeQ zo)Unw)B=lZJPP(s1r7CCP5|-z#l(4HtTC`}5zwGD)AWfJSw6u-O&o*3t=-+-p{PlK zAD+FOiQLH`!5WoJ&6$#4^c;ZT0|DTv&`ciygXS+(vK_R=I|Ts7QT-%!3u6*|R(+W} z5X1UJFoy|@vjP%k^k3%F(~}m)C&Ks|eh!)zz}v$4Maz`cw(p$LZ)+3)!xeB~T!Thn zHRim<**ov;?O8NQW+mkV07zv3h(PoB(h;4vR0W6@N99H*0e?_I0p{6-OtUOXBnBdA z1#ji124ER}`*6a(0b$QW=PO4Q#|0z?8J@~b`|E0Dx_R0Hy(ad5Wh)MNvBRbGfBV&Yb}igClYe4-O7mc?U45 zDh?L`K%<9;hbc{@bq^EnEMCAkgG4X;Bdj)5ZX-nt? zQY7EJUL(17_~f<-hHgG0`SJu7i=_W&8csi`3JPxSt)no$JU+2WQvP3@!^6W#Kp%IC zb$@?94>4zCzD%De^6yZikbA*lgiUKr@_u5GQ=Blx0$#eiyAu|1kB*KE-Zhm*69GV# zh`T}(ijOqsqHg<=ATU2ni$tBVgyOSWCXJwe%#eX4MqtTmO{LOAH{IUeE=hZQe5~;F zl}-~`z~q5%5dzCBAwI(R<{m`wKm8bYyq&F|6yMzMosn*CZZP7uNwllPcJcJ&_+s0HjtoBy_af-T(jq07*qoM6N<$f@c(ao&W#< literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_copy_password.png b/public/css/icons/ic_copy_password.png new file mode 100644 index 0000000000000000000000000000000000000000..ef90af6a3fd67ed9e78128e78eb32101d8a7e3be GIT binary patch literal 781 zcmV+o1M>WdP)YA_5{1fe1tdL?8kYhzN*4tbo+vQkYVz5aZo$H;~Pfl-nBf(^AHz zLELV)Yw>dH9)-eB-<0U@Ude*5%RR9G-IN&SbS%hmHk*y<9L;_GPRam?dAnh)1KHdI zF+a$kNf8;lC$86PGp>6Qn1gGFCIL2)&B*h-7hCn13Zfk#4|pE^s{MpvxE~XyN@odK z=*1<$=xLj&;mJrO0^@2l8u~px47SS{Y!ivuClN$q0RkfFOgh&$oek-fWg^8t(&pRt zTKJvfb8aO1&1Q2b<-6=ZAGAH2ded&stBGIn9gEPviyVHHvY%VN*yE)0D(hEDI*Z)p za%ui$NB&VQbq}`f!5o`<+wRuH?_EBzx$|nZ%F;c1tyXLQr2^R>+kMweGtZf$UZS5| z_qIML*M>!QET#mJ4;n{2f{Z>F?Uy+clSmu2+wI(|wTs0ftcu^U-=1{Ne;sTW?fnsc z47N*BES-;q^bt)uozC#Eaz39YK8vWTpLnRqwS{*qZ#V1NY!*a3#%Fc}7wLC`kIs|M zez)7z_6wRZ*S+03w%)IqUy_W^D3;FhL21%i_j*0g>`bRqGv@m3{C)e&%m_Y9o3?Fc zEaq0-PtI3mtS3H3_J274UZ18!( literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_cut.png b/public/css/icons/ic_cut.png new file mode 100644 index 0000000000000000000000000000000000000000..c4a256b487295d7a337a14f5d4b4abd577973d3b GIT binary patch literal 1147 zcmV->1cdvEP)-<*TfkBqOeb!9xVO<(b5>SZ(wccR#mQusCeaeF z#ncU93Gnj#n5>$^0HCdVQi)6Z0MJ14l*MYyC3o+dhnustwKZFVHy8o2#xoWbX#r>q zL{zWWLsy-)l*QK9*R{E@F$D+?17BQ!#1i{Pm_|S?I zKwpS3X$)$clI$RES|~uz5QhW2$fR52Z6~Et$(|`=0f>VHSYTAbfSv(NS2bfHfd7SS z@XhP%Yf))Ur2n$|qR)p~#mKZzrk9r&{L+KW*OC~nZ@+N8+uGV1dGxioC)On%$;36% zWQZ6?id7y4;B3VoLfm%Z0K|$hXp zx3^VdLD3DbXPFb+(}sBk)-7`e0@OLLd?E@EPft%_0CYw7o^e^I#UA1(K=HLEZ!=pU z^t~2dlUi`E6UDjV`qvcZbQ!A#^OcQwY&4(-JP!s@9*y$ z2T-deB0xV2G!>vWh-n6>#hq_&Z+%_(;NZY$fOA_S0`#-MGyt3nA_3H6iFE=vCq!5W zEBGo>sJS)L1`w5{Eh8~6KoCR{K_rL-ksy)?B0(gG1d&7#7p=bn3;-9^w4j>rZ;=21 N002ovPDHLkV1hwt^#cF^ literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_delete.png b/public/css/icons/ic_delete.png new file mode 100644 index 0000000000000000000000000000000000000000..067fdbc9414e8ad484c9caf25626250084c22e71 GIT binary patch literal 896 zcmV-`1AqL9P)i7BrfW<@N z1CQLGaD(z=1YIXWR?G%ay!DRG1(rbr=9X(j@Rn;=4}6R}z? z4j}4a1QFT+#NlxGi0@j2RNi{M-b;ett9beGZwuD#cIPSm{nwiCu@uJqDg0h#pZ$LS zES8-34kdL=<16+3*)5htWOajAzsXc-EPMLLJYt{?DzX_f^@j)>@53)an?@G z+wGQ>*mvps`Z6E}*Eacs!NAdR5Fh}}uJoH!LIvO<$_2M*Oot2$^igV|eJj}+rJTJg z3tbKI!8(A5ml-Mca3wC1GZZUJ&Ytwv?26P_PPwv- zpL>{QqDrt;?451Q5O2zwCCT~Xso#3Np2<=z^YMTf&rW#qh^I~*jYa{03Bsz1t7-D4 z>SCpR-FUTHeKcVG!pa$s$MZZzKP48diG_-7eHnTQOwLQ1i8m@|57@nW7$JuLAtV3< z@Esk*$z&4#s(qgD738X0IQ~-@59m6P)uHBh|6rPou7{Vxt0$g2PMDx=E{Ath54gl$gKj8Zy2IR~GR0a{#NTPY{`2Uw;9w4oHWImhX_W)uD{Eyz&$KC^Pw#y;e=6qcs-LluToAm;cfK9AE&YKlO* z#5cW!RwNU7?UZ;ytBkFITU%S_(C8&KWr{@K^a>DlA+>_&5kQ#Ab^%WqL+8Qj60|pLPOgCOx( zD@kxIH+gbW%9gy~yv+j5ySuxdKx}&|>74VO8m*EbbGWH30FsU6>I!jeu9n2f?(S|9 zkYjUHT_Lh_H5&$ApEgJmgDo9HEg{0d9j2aHoMka7ki6;7?d@%kUH)QX`q&qp|9ha% zrWp+SD5M27|)1V&AOrQPU=$#QZNL-IXYyngOQX!NGyhBkA?^bsffZV)5T11~r#e_*_6F zgU@6e30#cnY$KT!1CR*d(wfqSCIHA?rJ5^<6wHpLaBCgF>%=mcM~I;+$x}=-0ZiQU zh!g34l=^-IMA}B9k;r!A0ZH58;o+gwy69g41^`S9_Z$1sz4QP8002ovPDHLkV1k~X BkE8$q literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_disable.png b/public/css/icons/ic_disable.png new file mode 100644 index 0000000000000000000000000000000000000000..6a06e4e8c01f395aeb7f7d120aa6b3f6f98e322c GIT binary patch literal 971 zcmeAS@N?(olHy`uVBq!ia0vp^fgsGm1|(PYdzk?#$r9IylHmNblJdl&R0hYC{G?O` z&)mfH)S%SFl*+=BsWuD@%(Pmb@8(T! z^1Cdqz~JJ*;=&=oCSS@wmaO4UlMC#O2= z+0FDeQ`lU*b58l$3y1V=mbm6SsIV4pzG;x~mf?Znrju6u{QU1?9b?vCSG)V)QQp_c zd4ebJz6&fLrt0aN-*SrdF6cNLZ8yK%ug&8_#O2?zlYOfjM9w_@^PlDHH@PEGM~$bR z|1aWl{&Pr!3Gd+z{U7$bZe+;}u&fnyx%uMGbcUC*3~amH8&)px`Mbj2E$va()-2Yu z7NVDXP`KWXm7}sKu< z+Ra#PDExZijeS}!k~6HHTkl{v(&*L^pDHSGbvGG1Ad zuU&nw+oAANrt6oV=bG4j(&#!@*+J#_j72+si_hYiSAI5g6^o!(0y7gz+HPdPOyMvE ef%E@y8ZhYdx(b&!tk?m}oeZ9?elF{r5}E*PZ=M?f literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_done.png b/public/css/icons/ic_done.png new file mode 100644 index 0000000000000000000000000000000000000000..8c64adec1da30fed5b12ba5c795ef94769faaa07 GIT binary patch literal 943 zcmV;g15o^lP)Rce4*O2> zL^{A7*d3q_a0MAx5K;kjV0S=D@Ka*;-OuXa`dlFx;s82my@LPD+>uA1?ejTTSBtF+ zAvA=yxB&qWfe1td5P=9pAR>SWL?8kY0Yo4I5r_yN0uhMU7PoE})O9_!2fbRqw`lT% zTEd>yruLLdelguVbGp5@tXZz#f6}D&X?Dw|dvujhZlCtWF%y@ob(1EYW1pu}Nmm|M z(-76d3904dB&Dv3VvAmDP<)P(3TzWU4cN%oTaL<`V417&nG>69UV zKql_Re6i$|umza40Ye`rst#ynpmSDrvzfHvb$d4#3&_bp9{?||Pn^vc4cf6D2QYU8 z@T&Vn0<6>InNh;8Zm&!(x}2vQz~0`q@F~E%TsC7WaRWjbz}dV`+1C@g&H~K)3>bSv z3vio(r^|Q)n9G_$>_=?Nc|w5Vj1mqCFt(XEna*|@C>Vf+00Co(xC0b|m4StP&J22= zVud&+KyC@^Apyo}usxnk6SUDO18_#|d(kD}#SXSDKwb$;xQAjPZ-%*l$|H^l&@SOR z1Msd?$iIfYkDd`n<4I$C5T#kq3mR9_J^aBkk;oy+%wi?&~|^THkS2#*+&3Pjrm}xS}qv} z0V!h{%Nw+OH)xPZ-o>#GjPum&zl>B3F!CD^{lSp^u)J0&8*hUl3s9GUm2zl+ZajRw zi$gHn(w28xa-0mTg$Sqw;+c@j0V;zi<8Oc971H=xtwhoXD)W-34Pe9#Fp9x;5RmP- z0R~pi`|;e(zaEfKw1ZF7te4B} z)~5ET#XNNU*E)sI&Ok%}5r{wpA_9m&1R@X-Km;NX5kLeY5P^sQVj%G$zyNxl_&Tem R%|`$L002ovPDHLkV1fbhpEm#i literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_edit.png b/public/css/icons/ic_edit.png new file mode 100644 index 0000000000000000000000000000000000000000..91fed78e7a89c5a654791eb3a8ea7edb4012175f GIT binary patch literal 931 zcmV;U16=%xP)VXIdkq`-yiVz8r5DAfr5DAeG36bh*g{`g_3Wa>Nqx=0ng7auJs$N^p$_<&2 z)w?);LDcX*U}|V@bzpij!X(6#+U<4`*v{YZQa<^p3;X>Ti^Wtzya5QaOMw3&VLF4f z;t|M!#RQWWg4ANYP;P=AWgRbkM(a^SVtzr&-H?U*p_A{gv8X^feajCJRX08 znR4f92>C8F;%2jn!1ShrY+Hbo@q2_s)OH+?fnVYEyB-qSRWaMvc7E&m5D>uQ@vNnX zOe7NbB(ej`t3n~J*K4CuxCNix3yJ59PnIu%{dlsCfF{lZm1Hv6)~$oEEu)ieSXLG0 zWZNX*St2!1DGJWEb|~3^35w&K3cUAYZii#JK@s6YwIW zQ3Volxm>aUJl1PEo&Lrek?VnlF<{riRgAw89RPfU6sk^aYnVsC#bR;K?W~)CI0`!j z$Yl}%Q1(j#xlE!CFv1EjlgX$~Z#OrH^Z8uXS~$Y0h1~$;rkxScj|t=k(Fwq8Hmkb1 z51zL3Y&K)w!fpe4nnVQjdjdU0bOJD!%c))k!u58ZPNz&;7y=vq5ZCKKi@TqqQ{0CXjZ2*@yj9o_&PPat^8~Uuu`e`77)w!vp9pn02BBpD1cr)i_;V}fy~<3 z;;5`ttJOdN+HU85zmMmI>pNCcHNaP1L9BS#O`_Qpc3}Dec#0Ij3fugtT{|9b5Dt@9 ztJOAAfXgysuh(lBT;^fgegWK1NstQLNa3^Yk>jo|b*dy-*=gqn{_Pyhzt`*at|V}U z=-;98bpwJBsR)q}36Y8r36T&9k%|xrkq`-y>SFyBU;wgh>(HhI+&KUM002ovPDHLk FV1k#xp!Wa( literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_edit_profile.png b/public/css/icons/ic_edit_profile.png new file mode 100644 index 0000000000000000000000000000000000000000..1d978a77625dace78fd5858687fb4311e11e0ffc GIT binary patch literal 1841 zcmV-12hRA3P)B1h>NH z;10)qtX(GApSvfrt?AFq%1~x;G9JU=wL4*S028QjFx@>`Y9(tbzGHI5N+X(;-0g$L?PsKd3 z%XIM_iAMQ>^F1;+4iJ97g@&gDi0LH?@b>n0)F|Af>v1688$$XR2^4}s`jok3FD@=} zcTdoP`+yyg=`r8GKb{8H+!#58-eu(k%H=)6;y@X8M8*g|D}hLg`^?--T z5~33`{n;HQaC380rRPsR>;l1eCva_ZgbV^?uh-!kS1gA6(w;(dhJ`3)hdjZ!I7Qad z(vr(m0s(|iLRCksgiy8@1xOyanJ~z8K(4DAAm|)=OfYMRJt%xDat}hN3oI!EkemRc z$pg8X4uCqg!ZyM9ACb=@`+Wg8@>~&s!R$a6KwbNZ``6dk0RZaSwjjt;QGn49k~Ki3 z-5Ed)61rw>d3o8Vdz+#oDlb4N!-?3G8X)N5ZfspU+d1^bC8Z{-D0XLtTEVndns%F0SFB8wH?H^g?vafQ-~!pj4oQixYqR|CQBw+A3U z00130{rO7MpkWULq30cgtjoxXPJ=!G1budD4mm-Lc183`Po_WT2~c-Tj7#WoeSpv= zFVqe2P!^zSPZU{=jOylHJZ54Hc^e6oiJlXT>X(<7Rrs71pv{Jpv`N{seNgdlhWu+? zstJR_UKAjDV9FoI?A6s(M^)W(c|#KbFb(lHGzAlOsJtHnOzVLv0p=DHp%NZsj76h< z3iz}`g8=FOpG5(fn^tR)Tjg4+m>?=!mo;LoxAjkoD fg?k$7w*UhGt$&04>hG3=00000NkvXXu0mjf78+OR literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_email.png b/public/css/icons/ic_email.png new file mode 100644 index 0000000000000000000000000000000000000000..df56b4f74f1b04083f2837e64ed4b8052decf921 GIT binary patch literal 952 zcmV;p14sOcP)imOCTHzU-*sKzv}`4U zxRbZHx2}SDb;j@nTE9}Mcu8x&aZP-EecktnGBC6wMnJb`22boARsM*l`DYvuNfwqF z1{yanpv~luYPC9yMCz4F@ht9Yo}dHR z>_u$8#mC)lvBd9=)tZO_gCjL%P^;CZ`j_kVx~E{e8A)BSaT2ldXidj;j@6oYLJ}~AWec*(o&)9N``)cfIWbD}GB`Xkjy;fMr8;yn+ zacF31*CVClLC=Eaav3gkh|1Utopp!+kmL=7MC1rCea*QvcRf=zS<&a;sq{4xJSUS7 zB`U*~sM%~Dv_x>WtDNm7Ox=Do(qCR)!j=WmmnhP$Lxj^o8Z`?rrxC|*RAk0+{OE+> z8L4bT@!ZTq+^?P(yMJ+U;cF1$q~JtN!oKc3KR>&Oy3|&G>k#2++HYmUmIyEppr}>6 z8+pqj*Lm7?v04^W!5C);F-%X`F=(|~2Q3jG^%S6=aO~i>#bVJ@(U*F=WE~g9%UB*KwXom7P@u&S9i`db#; za(Q`aH=R!i@zcZ3_L`EVb@eE`>pUb}8w;73E&KY{` zcH6fdiPwdk|9imnCWi|J7ZyS!L<%7iA|VnYg%Amm5DAe&h=fRpgh(MoLL@{&q!`O@ a0R{jpQ$V{haz%sy0000KkqQnfK&gOqK&Swx0-Oqn5+Z&94rw4Aa5HEvEgM^#FLuo7eWg{t7R~ta zj(2u;DSUiE|1!X*xZ#$rD$h} z>^!}=a{dcIx`2V^!-EQ2*9w&{%dH^BaV+Kh!1w*Gun)TU5zrx@mT3@ev-7Qh^BhW7 zIRfY@`}Z5o&aAh$w}6NT0uJ}e<#KYzuN?s7XI@YHTvRjuh0(7~OfJZ`!Aj(2h4bs{ z>m$87ABE&(nct9op2!|u7$pWLl}cr74kB~(QNNh_mDdVqz5pHp+}Ux{N5qXQyK3V6 zBD$9$`(yO;6&pK54r2j;$xP_IyuA4Ix$V$)z&2A*^y#;y*>~M#->JZ}FrrXN(g=xX z@rq65Ph?}0H4=S+kvP)qp9$DM%V04w`nA>_iN3%{7#k^tL>goB%S&0Kr>8hV|CXVz z2#Nysi`%lu6U5xu-_#e>6ThpTh>`ezjKt+nvY9m!V}TjEo#bR>f9!2ublqomptES% zVCMO^=4L8tN-c!3Hc#&->_~VX|OeT|^j*-w!kvm3`Lzo;5fvQMn z9%!O#`8?1>@Zvp2h#exdnNUvzL_h>Y2oM1g5CIVaL_h>YK!gAh5CIVoAwUE~KmQV`d9CKYgXJKN=lgZ!N<~m+BIotK+G&74r6NeI` zpo@T`3W(Lg0%Yy!Uy~ajaQ*8eaRuA+#vzMdPd(vfF_mM{YQt@BGkYR!y4G?|^{{S6 z(f8#2nyqZBR=v6^vH7~h>daZ2ZESw-tB;FPeW$-#S*krn`#AU8GjndtZ2q)!W$$t` zb+6gBrw_Nw^m83v>L?&17T#GDG=KWZxW2_q4|b=WT%FH9$8ULWkENIEsdQq`gXTq58xF>b3pDEMMt8$mGwM4(3R#G~z*ntHYTAUrA(0bYR zbzkwc)bAgj+Zk&q)lXP5*D>bI91rVqp9KppoKtA>KvK&nctrAvcLO5>OSp2nuFtG? QV01Hhy85}Sb4q9e06a_IcK`qY literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_forward_as_bbm.png b/public/css/icons/ic_forward_as_bbm.png new file mode 100644 index 0000000000000000000000000000000000000000..d9cc1c61fa902fafc85fbe3e225bb4f59b2f348b GIT binary patch literal 1131 zcmV-x1eE)UP)?W;=a1dEpa}dpKZ8zO5Y#FL`p0KvAEfpP6x>njfdFW+1X+K zfX`oHoWp3t@G{WXCQQ~nr_*U7e`bu?0K;1{X9?CZfw!fk`dLc3TxJ+8(OU+D3;d4n z5C$pq3*pXjZn&I6zYq{_R+_2jwIWbt^$Str^n)KJlZhkZ86V$Z&Q?nOrfu83fIioA z1n3{CflDVAumX&QA~3WU#!vxNDha_{C=-j)q_qs70HQnzZNiRa5M#|s-8nByZ0_#v zGJnJ=v?cUcCZV^tH|0raONX@pn39!U-v0jn$|4&; zDJ`;nfpr+$#WAXzjTPd}8Y^sJg@`F8hGN`!JeG-Z{JU2?Bpe(Zx!j%W2j4J18iOpzDXRw?e9Ubw(x0`Nmbs}WISbD?ZP}VeDxS4j+8%c1z zK3wlSGDpWsa5{)3CZ+9WYTdcuF15u)roC&}L-D?i;4}f%{Ao-eP=F)A6 zZnau%YrH;BCf5KmlqkiTToc?`H$Y!X0%R*GNL}unIlv4KzB-SOkC#!9aa>!6CAzg* z4TA+Pk_!OY3I0H=)y33+&;k&y$x?p54RCqW_)>RF#B70aK>oJ=ojPiZiOKvrM-+$e|%WVQ&Put2G&Ym4m8UKRk04$-;2y}jUX;Ps4`F;>F=#Ppy=knju6hfBI5xnnahTN{!}B;iSG59Zhzy)<+o1+M z&pY8TOF4qarld>sr7iTOith$#&xw6B30>x6SMV`% zPRHLZ9Aap7g9Bc`Nj9?MQO?TP6w`rU!+>8lhgXk!AWMkKPN$f%F!c>02K98>BA7Zv zIO5M6K5J`hKf(v?IVp#@hcxWR^z!!hHuv-bzqNoEn#kdlD|DzmOARr08y9GA7-&m+ zq0PXbW{DvJFMO+CvPbL~z&(K$s^4yL=Faf#(uk z{qqDdloCZiafA>baCoi&eP+s{9Yi>u#;NQmCED27=n8Gs;om9dx4-CE=yxwKFRAT_ z;72YYhSY{m{CX?}c&YErWg+Tz$HD;h0m?zK1$ZTt@hOW|ha0*naboamv;y-vldaq> zg!MwsD^m|=sKNM~s?E(!DTqZw`t5SndH^t3bmJyK>;POlO9%3P@9b`EZMCy@BJWDP z9RKkA{Cs6C_Pla(_>uS5NW8$$^^AO|=Q^CXx3>p6_(d-?5yZr{njS$^w?j+`tgsgk zy33m4#PQ4B+1VKc=GVs4)01T>Tvwl@B6_5lmY|V#<2S*m9 zDd&k(Q=GlMy;u`D0|~hQtna%WQlhG1AlNlUgCNES*^Nr?mLi;!vitjcC+dG2i_4%O zbYALpz)GcZC_K;7AhzJtjb2z1GPajKiU8QRro1FY;T!;n-PjRSIC&@N?(VLHdZz-U zg+)-H2ym7H38DaSe}7*IAVG`(czb(WohO88PW(0o?&#p)AOw&ruq0F8GAq&h4WMjA z%M7s!a7_-drV5amF^94@H#eDG{?O`75cM$Hv5*o&*2}8hF98Ms-3$|yI1g%g00000 LNkvXXu0mjfQ*{cd literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_forward_as_text.png b/public/css/icons/ic_forward_as_text.png new file mode 100644 index 0000000000000000000000000000000000000000..be249072c46ad1eba618a4922701168af70cd69f GIT binary patch literal 793 zcmV+!1LpjRP)y)He!q99d!g3NA&&vI zyHcri$Xbbc1$ZOR^^&;~gCOYU+&h)ehnR@O0*J-U&iHl^N(4l>Gn5DeL_kDL1jM*j zE|-O=2i|VC0o)nxtlzTOe|Ci-j4ig;>vf;ol^rkKd(MAx)~B#70lX8uRSk83LNPS$04 zu-kgQ&aF&iKkg(#^&J!<+I{O{u~3zUPlxHpJxGl82DIMKvpGEK?rn{Ui2%lQe|J8g zJK@*l9(-dUvce;_Q~)ZhcZ{D5@GpUM&q4B@ROZsHM8DB!^fj)}$>fbdo+L`SC*KBl z)(!Azjs$rh7o;wCP931CJ6~wtY&Ls32N}h+btutqHk&3W@RB_cNH6??+^e5zv27zj zT2mx^zE5!f(eO!kOf*@6Q9%BouCFsDW)AR+awaX193KZdVxr$_wX9WO*rwB|cj?|B z%b3XWf0w=P!>h<~NN@V>+4EcmF~Htc6ANwR(L%BDjn2vE>B(f`kjuUaAzV|kbEYvd z4S?--`w#}mg*Y|$v-xo;8v&p#w>Z`UggZ-solfTi;CMV{*Y%l;1|*d2i#C-|J0m`ML< z5E*#8&~~8t79tA)Jc4$Z2h2)>SO9oN!K@sJ03e3z!54XMkn1qVU0|Necn|Yuo#jv& zo*e)(8d(ruUtbTH2WAZmkMH%Bn{?) zRPjLIIzbSmo@D|(e3pkpLD6Y}9&zPBWQv~?9*{Edx?aHqI)w~OpYX^H(SWLAVshDc zDgdxm27pLRZj0&h%fFbuM#zXK_WOOR3a9XHX4p^!ynI$|>qKE1Oo5`Qsi{=KBO72R zm1YisPp9;72BX`oko@L>pkS;3Ucd@MC^?x%FWZ*|6Znhr^%n4mN&}I34V4GKgJN9; z07bb=22AO}Vsd^^`EhtK3eAZiY!_O9LWf#c1;Ce=mk|2=faY_2WE%E41s)98?|!c^Yb$b?Ze;0AokE;Sw6s{3H?tq z089nmPvu|?%V=h1W=kOoPKTF>&>!VZ0gtq(oQM^f&tXT3JhlaSt|Rhh{2czjPxbQ@ zH+NBAuD|bTZV>B&_>IqnFoLR^2~;tNflt;pmo!tb1aU2&ZF>=@Hfblk6J^`lpII9204wscOrZ0S`)MXJ=y# zK0OJ~5Jdv%ajJUY`@k>Z_%&1`O9#YFqM9lb7|`X*CPL|=s9l-I z$Hz9v+Y^NHu?|nvpI^ZgkrM;WVvrZWkl5%LUMcBrxAk%sr_ne@0s#J#v9!ZtvNbn1 zmzJg9n1=fos^G)J18z=)S-Uv%^Ygm-(1<-IJTbKhAQq7@qabYL0kAYr6zrnd01)}^ zWo=LZfT>pjs%$v35T*tw#;+Yr0a%rAwnd_K>{eAgFb|0QqP=NJH)?I&U07I149jVL zVV{+7=9fuzOW{m~@`(jG^}HbJc;cCa$JnB@0FOT_0z`gF5!~P38wC>hktt$vaj|Du z4s|>)wjR#ZG7myxJI4lq2&|fIw?@5*!w5a=o(Klw7JZawYraC%<~AQ9w6Cbi_6Y}E zaCdjtURqi*cHR*9`E0e~vs~B({;5I!ArZ=2g-dsy7!gT+$CQD$x3`$9`rgm4RQK4k z&ptOr+kDZ2LFyI;B6Z5gyC7#SKe@PIfGF*tK*Vvz9EMKkBOl}1)9hlDrofr2L1 z(oMzBRRE;c^;myrWn3HcJ z_zED`k`MJl{dk^eM`;@nD=RCXM~SJ?28Ht!fsW$mG5|INQPN>{Xp@nXvY;S&QWjbZ z6pV8iy~9Eec^m<+BnL0@q%80(|D^1IuCK4piFN2FkgKb!rR_e0ULpWv&}&1GPKpa> zj;Nz=pO=Ebkgy~GLjiyZ)7JPR?|?ZD`#1%UVEJ(jHKDAN-?rdUf*U9l>j zUtL{U^-AQAa)>HCsP4woi<53;G}Pv z0{_vvWy*U9$S`%^*=OD@ecu`M?WlTuC2!teUS5`V^L~AOee`eM7Yt@D@J0ee4ou8r z#(s^&`?;YSI*{V%`(zt4{n+>t_T00000NkvXXu0mjf=l=;w literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_info.png b/public/css/icons/ic_info.png new file mode 100644 index 0000000000000000000000000000000000000000..4798e8609ad7e2074d3ca675b5c90e9711795a29 GIT binary patch literal 1605 zcmV-L2D5d+acG!P9$BL<>@XdoJhMiOOq+8>lkC8Y*@e0fET-VU6o!olE#0 z*3UB4&`ET<0Maik#J9J%HhjM|#z}PW1RM;P+fHrpmY`%7TiKX1bCRTXA~_w z!AR?ZW4@~Vg+A+4E~+tK!HZObJ_osn2+kn5|6?KpBku?t@pKhK=)VCkhY9`vg#Lrv zLJY&O0-vA73?2y1og@+zfV8O&H+X{%_*`=wC&(Q{0EmWPa3TPqxnQ(sr7U1mgJ9a6 zh};941}Y$`T=t#C0IX#J5QX}!ksV(?B75_*c7`k7<_sbufPs~vQ2#uT6|!4eq|^EJ z^|ej|$v1$Di;L0#L4Sj$F{3m*0lhr|Jr#;RHno3(K0mXX2!_Sg!CzpQrvTt_%-|rT zpDxHTuRemlK~^=f#R2Fk0@#QFh;j^{JJaeUyF5;PY-LgtUtV5pxMEGbYLON~b5+zC z&~w1(W?NNIuS<4Dbv4nSEC!Yqr@kC5EiGxE2g(T9cf`DH%S7XhXcW>C>&sFO3{*Ll zIUVzPPXeUJ`Mq#7&IqPN9h%LgL|1XdbU-2T5Yn10UF zh{SI*{QLWRRUqR^!(e@VUHQmNb~~~&01=41h&WK-P&Hw?CBT7!giZi4RN;03SPkJLsaw3Aaly69Kh%f1dL8V|uh zTTzMlvWkIr0lINcbtW^dBKrE%pBY=$g{Xq)w63?-W%Z@A~ z(IUfYoSmrHaDsbrb#EXT#kKsIP6XgdLA0_X%~17L!t8}NV-4@eC#K(hh8D^^9R2??0sIR7u5P%M0QzTBN- zlGfgAHWqZAZh!y~0TB=(Km)Nj3BJM?i+c1PAEb0lAj$O5tt zvO&3Aj!qd%^)Ag;?l2|9)oSHXpPm4iRs)*(AYGDy4{G`}zM_ic9m3cZZm&>+@z(WejUdblaYBkvD$BT_e z_DJT&^!KUX$k>`lAUO3tV^-cS0q7qagZyw5cVhh1$WLTyP3*;-cq<7&miS&v^pn-d zo{{Msh9RHamkc2FVStmgV^KtUH2?Pl7v|P=-N>{^Jaiw}Jq4hMNbc87IbN<;=Q~+| zQnd8XaVq+U3CGJfL`tEiqYx@9R zHw9#VyneVN z=UdwsmwfBWPxLZPXN3S;jYi{lk2{~wdEd(~FL}mCqU_P-3D(^O$l_yeSK+@X=^UkO zM@^K-N!gBcmRM&toBaXC$J~x|PA*R@BD>OZQPKSt$2)S29g9gjA?#QH5fF`$)-`cD zoo-MQkXGIK!lLah(tg{I-ilwfu;AGVL=`u(Z9q*6$12CJGJqTc~KJq5fC9j p1VlgtLzQqy8@gF>{NiM0Hp$(`~rbkKmpNJz|HtZyk*&y_D7OU-p+gbY~+Y4nzl{1JQx#$bslUbRho8v|uu*R;$g$;%{$n zTkx?9tpUyFevY9<&^|tY{yb9UX;Mq584a2-hyY#_J`SM;ibD{@t_qk>7Q~yIn+9pq zd(x;a=I6oU;$lesd;+g!I8_&Tb^aI-0gxt{VpCv>DUG4+fZz#@8F2uc(EX-7Sr7pT z)S?4LQ$zqG8rPR-AObvuc1(WIBi>mXB-O~d2J!m(S_izTA6r^l+M%&%>L;Q;u$B-2 zi6tB6gM57g^U($Y|ELHM7rc@Q06@_CsE*W=cO;CX-3W0Klp92Th5*CrZx>1Q7kpfr0;Pvj74gpLpFndcK)bk-Q4mL=ZX+ zV@&7}fy0o6%iM!y}uFWvf8fP^>0WKx^t>(tP+g?gt8rCpsIQ@cn=N`lao2 zX$-%{>$w1t7S}K^V`)Pmfv-;+6bXJmNPkycqc3qa(Y$ElfmaSqP58x&7h@(T_L$uG zP{(Bm0_~W1&lbe1tE-kqF031huv#({^l8ETC(we7^##~R5-|*!epaE5RoVxW^Qlx~ z;TsbI54EoS^5x5f1%v#hw7f-CoP_bSyE)<3GRzSZfG6;MyYeayOx~oE^g&g{pwKWS z5Tcf&^+g2n_n^akA!AL*dk?M+tInNwb1E;oT9`-O0^LPd;L~?2_lbhSz<_o#(L9Z@ zf2g3TG0suI>5uE29#of?mo4}^uq{Ryfe4c~1itT>K6ex~E2W)RuU-um`?fWCi!{D1 zi7b4Qt1?Y|G+7D+e2z2BdH}zp@7rch$5?ez7@Js{b(eUcB6I|iMRg#8>esV^R*Bgq zAV8P`4Q&te=2R#RAbT)wY+%MXXAgP&{P`12cwf+`UZp1TJNSwHMK$?njm1@p> zi)F$>!?Jvr`UP~m;2+x<1^9Lp%^KH${?EI(xR~Dk%gNhkS5M5MH*el_py7eCOsC^M z2y|2c>rg?fSu?h&Hq9192Fw^*kHVk;HG?z+zxSb?K}?IXlxV?Fcz!qE>+(1|J44_b3LyE=cSIXC^`$E-D`N>rZ3VDn;3xYzu2K^} z+2))8M69vsEecI=o+ALE@Gynwv`P>o{=$zRKTN_0l{oK_|HYHMBoL#@Km;v{_`0EI zP}D@TlsssZnSpr!-wrS)Nl28STveaWyz_2?Hfo#M>gwvi6W@rE=D{!~DM1T|rUPw2 zJmwDoXr?)_&TWMv{9&RXPx&B%HsGy*m@|p}@87@s2Ii&H0vq&jeUuqJD4?J`vkJDm z0xdDQnZK{tFShlEv_3ya4lS~N+!%IN_!#fn+S*t{J0>{+`!tOMo{^;%HUt?^0(}3{ z4ekp~`TjnpkR~=oJvYXfaz5K}bBMLxHKZzJC4MSJg&| zDSxn88_rL)N}g|s>n=k6Lf>P71$QK;Gn!+#v9Xcl2z$$k3g`zLdBQ?aK{2boM$8fa3BM4);^I1GL+oB$HKwMmoHxqq4^Rm zNKHBcKH9ZC<2cl*%%k3qm8jY*$FT!w400{^^+Ij6og<*$;0&J~CxXh3flG!(i= zl-eOEZSQfpJ}u6^SLKJV^5$*E+=H0X=g*&8p5FV;HiV#c-@SXMoo7FZH}6XZ(-^!b z1tJ5c%Kv~+&2*;!z5u|pP7j~#eio}U|^U^)t zJrgvh(`i8v4=W;ph$te8hyoE&L=+K4M1hDXBCXh*{^QYZKF@?zp}f!0`EU7e(T z|DYu?cS}4%v(Sz?lQe>=owg;8$72$2^yyS%ZEfwZSYkMIeLhQI@v*`t4*N5wn>fEO zA_jM(F1eCN>pnj}n%?yN8ZROAhBDYhZ$d=ZxLaI=7P#3RHMHmDUJu8o}T82t*@`AN@7{o6LSF( zQ3HxxiRI~SHL*lpPdrGAgU825bD6bC)SVw59w?DMR1e`t+9Kfoujul<)UWNB-&Yo#e_6K+W!el>6o~`YPUMG!7b1YJmke zvsBQCy$8Ipv7s&4fR_$)r=ZgTFE^3EG8_)+sU30KB+^{rkYVg&tTv9l!u!sm*64gu zh`xB5H;|$HLM!W@6C3L3dRt5t1t;$Se);m;1n+1}jT3^gZ4 zu2?{Nt}01OumpttSIvN9KgvA262pr6Xf$WoK__5_Al^2OV^+XalWpAmM9m-PITMih zHWYt83lMjAcTE-9=H|;@I8 z=YRkrC(@(Ooqq z5K{N(o3DF%T0_J0Jc%To{6-KEhy)^mNJ1bIhy)^mNJ1bIhy-G-g{_@8ZF$S%(|>=`tfM>kLjVTfD=C#_;=|(;W1$i{s|D)^lyme*ML z@Tl;#W|gST{XHk!v8&I-B1&UUs~#IG1tM@^;4P0qy8_0UaJ12ReR2OF6NpFvls@>B zEG^?+&#JoUtN)j&S@0Ion+(ItyGg zbX29KCb;h(G@H9{-`kyIA^@RF(VC%=@OFHi4Ejn-cS-}%i%tkErkP3Z1=gAT`q%W; z8^oEjU<}kyY_k9yca1?XP+U9#z1r?D(eutxzQ@|dnmUF89fO?!aW;2E#RKa=Rh)J7 z!1W^c*FnEhdk}#yXMz;P*ie@tSS}8B!JYAX*8x`9n)ty2>yqnHg9PHzo;n9KWWT7AQuv(*qYmL6$x`613Un-3d1uj1$kz&uzOTiuZgs5RyfVsxGC z05i-yOo3jT=|}c@TMgpmZpu;`1*IROT*nMzBTjdqAN_4+qNrv#%-Nb8%pA`t|8wiK;34z>cs@#Hr9n&IZLF;Z*v z`&V@k*-kAKi`Y&ss|*agoi>Y$4(iW&r9r%z+=~7_VIFtdu2i1j*r-51wJI}logH39 z$uMC*%dg^Gk0)%0*RKc*yPeZbbb~&Pv$_TC2ehmA-HyGHhm0qpon$KLbF!%7yvcAt z&b(x4h6pg0zp+s8g&(z;>m)woUNTVGX8>Y#nQK{V#1jgOji*&(;xCjNGUj}a0V4qF z6F;U&f*lU*4-V>8jLq+8aQs?hFbJhH5jq%~TwmXeWuIM*h8AL4mhXj?Fw3AXE@$Z_ zAY=Q3dE5=w(_s*UofyMPF!ATj81EMh0=gzRzm5ceq@7KJm;AUu>wGxws%e>+8bkn) zJ>d6@SmlIc9z5W)Yl59DLqJ&m06SLM?wlrFu%BHIK7UxcolrQSVNerIMhW|GmFCWT zR-LcmnqijNQpUo)BFxsLvG;S_gp@lIJ@zhnbsX|%&5!SooxHPZJ}}RN^Y8VIfIClJg$;xOZXq+$qZ^zF- z;(R_EC_W_-0YXHG2oZ%45h6lFh$w`J5D{XWl?wYGBoc|s@pL-%;n0O<27mIQ4WPZJ z(`jGS1&2{9NQ7O0AP@oI2mIK+af%0huwGtXd{rTa9_Qon*oTg{N#}1g0(S`KnK&li zR`-r`lm;mR;=N#$1sOWTFJk;@w4n_TheHM-{;x+T4C2TS0NF-}|1@A60*0!96cOil zXx@XdCe0+#-tYHq?IC6|84_oUJP)!uQg)C+mVI#tDP+Y$Yq#4uaIhICC@Y)IdYr?H z`UMDp(1C-?>PWZ=Z7t&*0!UlyIMdp0x2(}7>f~}cSIaol0tm#BJ;s+ia1(6pok%&7 zz;Hx3GIma+97!N_SRJ|9Y;5hFcvS#{*^&8t-qqHLR|OE>7>X8=I#RlgDggOASlzIK z>}wroTI==tQlvHRFY3~A3xz^Q%Q({l2p)$cZMX@JwsF1zaxXJTY2!?5wOW}$v{}~8 zZn0SGXc=c(0D-5JX2VTzw2iYWAeD$St>tq0v}kMR#H&iBlF#TygAsiEAc7NF%V*b_ z{^?4o1aPrfI57M$0fb@2A}-c;cD@4SabPeE=sP>}0xXxyp}uWT`Z&+$^PfBs4jZ8K zk2nC3z+-v7Bj8>umC9c00t6>O>ob5_jfu0_j2ECMvcD-=0W!qy0&O0F2Cu1R#$CWdaz<> literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_open.png b/public/css/icons/ic_open.png new file mode 100644 index 0000000000000000000000000000000000000000..931936bf79e8e050524920ec51f56ec15bcbc028 GIT binary patch literal 669 zcmV;O0%HA%P)q1aC-B?;rpo z5P^t*2t*(P5djg1K(twnX9g*y60cn@m!@$vBxYC?ftL48^Q^+C`Z2|apUB@Dq zNKBL5vAJdLe0e?WiAC*+uc+N_E7KsH&u6WoDv?-)NVK6cuDb>zk;682#?A zVt_?vXTQoIP07xVOf>qXl}@uZ5}#48*K?)&NVjdk2t0SEd7b)a5&85 z^`!$e_K76~m=b|LcGd^@Su2RIX3+h9pJw3*V87pA7HwypQ$VB0$%X)L5qM{^5x~J< zu*_ngveM3RfJqT}16aH4EDL{F6xi){k%g5~)&VTU&LO}@79I|V%dC$b)*Nx-0Fxr{ z9>A3M>lhn}+wHa~R?PBGKhFUCTeR?Hyk~M^S%iQ3(JdfcTUdyA7=bb-UbF~%$Mhpk zrV%(AjUHN9#-tW4>iop=6hJGpb5@yhJRVyIu<$3As*3NO>t^S;Hk(a=olCY*o?5Th z;i2Bc&i|J?nM^z*>|9lV(i~&#EO%SkLLNJtoSkhFk!Tvk)oRtLGekFw%r~7*z1l*& z*7jVD8lszLJ+N#kk_L$dh(JU@1R@ZDh=7=negzl+{}R5g{ao8100000NkvXXu0mjf D-nJ_( literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_open_link.png b/public/css/icons/ic_open_link.png new file mode 100644 index 0000000000000000000000000000000000000000..f9aee365f9830bbaf5d31b3fb9967eeea272d0e3 GIT binary patch literal 722 zcmV;@0xkWCP)Hk5usqK_ zsGS~w01yEY5FtPWL_h>Y2oM1g5M9<|`3+;N_JlM|ecJ4(g%0vas4apZ$Yj@1?|^%~J;-SG5`+IBD)M5f{zcVbZvlv`Do%O#@y z>*{e5%`eU`;+Tjl(x-c*^HNisrDfNr6{4>xj&IrZ=^Ycx8V-lT_h2a1@_Wa%5~3>L zGSE=spu~|ApDEW0LdE3NsCQ00pU=J`fS$rQW}H}8N6FM#rk2%IUb9tB9F0cBCx}>4 zxVTeJR1C5h$0D!e!tCr?ok){SUU4cD`J3|)tDUz!t}W@DX^N9sc74qu)-4;+zHN); zs&dc^vI=Rfv_zi+p?FbUNjg&UOAt*}wXv``ZH$AOa#F z;uDMEl^2u315HS0K!gAh5CIV-4oaMQh{xkGpv{Kb{CnSIGGXwWAVd!E-P7>UPoL6x zBMXqg_x@Kbs}sxo2B;8zQ#(5+jx$MgL3}B_UN{Ug;r)}+uVwIm#<$}B#M5*-&H9p} zI&Keq{VLPpaKNnH!ii-^zEXSR?>}61r;HP2A>I_hWJqTS3lKIz+&7G~2gILoU_~vH ze72=Heg%kJv)L@A&9j8FisPR7c_?upOe}!db$tpj069<<+bVbs#sB~S07*qoM6N<$ Ef?+j8#{d8T literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_overflow_action.png b/public/css/icons/ic_overflow_action.png new file mode 100644 index 0000000000000000000000000000000000000000..884f1d2c71f2a3ca2a0e62f709dba19d82a43eeb GIT binary patch literal 509 zcmeAS@N?(olHy`uVBq!ia0vp^fgsGm1|(PYdzk?#$r9IylHmNblJdl&R0hYC{G?O` z&)mfH)S%SFl*+=BsWuD@jPpHR978H@y_xOU)odW*@cIJt8P+2@BC#FmGi8oWu9$Kz zF@|FoM@8e##>w$HoXy)5b)D0G$+0Y{7moY;({R4Z=}j^Z4DSUrxTq)zPUt`-_pu$9 zP@k%DGI8E>{@*ulF1$9sS2lOnviTe5HmVuQo$7MX{8bg=d#Wzp$Pz&^vi6#79<_dfV+8-Ut`fMZb zRQ^1!^8K6U^7QDPGmBgbe@jIC%PcWF<$ET+!X>o)ZSQ%9qMAm5_k$i`~Pqm ZFnFHpvQ;XWTMmp&22WQ%mvv4FO#ns^)zJU| literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_paste.png b/public/css/icons/ic_paste.png new file mode 100644 index 0000000000000000000000000000000000000000..8913b8752df6ee78feb98c8fb9c233edf63a1d79 GIT binary patch literal 769 zcmV+c1OEJpP)T%9x~b9)|4}Imx*+up7J}xfKD>@y+$p$B0TWNcAauWuClWX<4S9BF8MhV((N+Tp!1e(AJ zKq6}&?k!kU)8%raNr?X{PKZ_Rm8^)W0D-!yhTs1u7ir8r&(r!HI1EEiW~5K!Nj|sd zBMyc9y@^AD_QrWK1a(Xg&*C}NX3NCP?JNr380-KgxUs0so!2JXIcT+7XMnriF74J= zR*8Bes(TW(sjl@4%QV3Ua@~5QF_Ra~xm-k>AAHwujL`RV4g5HO$?vL zY`fjEf~;~DYq#6lx3CCU6z53#d!Oo^Y;ET}=mOFMM0Jp#1k$%I6K}o7gzjWyO=RR| zv+?0XHHk&WD9EyGKo|vCrd=FkAd8-fu^G8uuYEXCgCli`BGYlola+@31lzpM5DhubN$vKL5|YSTP~Mc4iK3Lh=5oa z6(SQ&o&%hSb_PUbA~F$9L^}f_G7*^wC!(DJ5t)cggcH%ufCwQIk%i56sH;PBo|Lq#8X zb)qdhJ>nRLStsLWfZ#C?O9 z4we$O1E_$Zf@L}wDj*$f39}t+gt+gcfpow=qaZ~qU^e!|vE%)6jS)9u5a~_2mU< zqr4mKL2Y4K*SrzFj>HrS1t+GU5;6gDI#6kV(jZ0|pp-bTRx658Y14JncngAo|4)OE2(khioUpBm@?SdvZmfVh9E|(+I<9rp| z6j_kc*CzsoNVMO}<#J!OIES*xbFo;YQT>VWO+s}6(lV}3{8xZ*aHGw03o}9^bX1CS zXoIovqSui)@&1!NdymR>pkp$bB#n3CO@JXZ*;TLC9b=t% z6Ckku(c<{%^(H<@M{2dBih+caERJZi9SE-k(N&|-;B{n=Ac}*eINt;5H`)a8zWTBM zpZIbJ;vF@cO+Pb;!=R2M5>F!;kH?=q#=r*f7vt{}KXWADv{Bwr98W*UUccP{YU@N3 yM31>5hy;-!k_aL}B!~o&L=XugL5#Hi3NQf9aW2w?aKlLe0000tmqCgagA_7q$3Pgb@A`k_lKop1~0#P6eM1d$G5Cx(@6o?`M zQ6LILfhZyn1!C=GDyi}H^>t!@V=^-{(h3zwDk8JEh_nF7J3dZH9JHq%Wtm9%-%qd?Mr0IZ8Hgt=TAKWGZf;Iz%p&4pd4~oXp=k?2 zyPZ@C6cF;;Pw5jzWECZjKR-Y3u@kXW-|x_W^^#7>tOVPbAz{~2QD#N_;8EyQc~?aj zAM?5@8to*IRYW3Rt~?T&kB^Vx1c2OASGK4eXUL}0B_b{q_-jMo=Yij0CZ-jUv|6f2 zEM3;871^+xyxd7jEO6dYI#N{QWcJYi8`Lw|NJ)Igga~ytKoxbr@O__yq&{(TtG~Hr zBhg=2Sn!k+R!rFM#_eAQ=_?(;)==r2J|WDbqry*%s2maKlK%{#j^;K8$>#PV5$LM6 zQjyqY6A{oxME6*GPhI&uB@S)e?T3d4OP>smPgpxIf6nqmpauxrrZR@+9RaDLFBV|Y zNbHQczZT1|2YuIH78e)2NTNxNKmwRj#>9d&0W1R1gX4bAG2OD8e?*-7`+E-fN6NAe zArNqkvsHPLmXO-$yU#9GKw8yPoOd9Yq^a&LWB1LarKLF?E$HjVJ&{Q$PdXUyv3^cW z=H6rWT~$!?Z0;+6$(Bz5bp&QCiwIQzc59-K3>RPBRcRZsa}|?Ws>vRMbTa z?j}VF#&?t*PeYB&t8Jt$VN)5CWvj@QSUkF-{4OPBBX6<3-L!kwIJvvKGbMm9384LF z%!ToC*f42W#=usl?4KtRPncuP3|IAi2`(=$dl=&%cF(UvmzRO z2*AuQs_F!gB9O|Mya3nM)`GJ0f1MP7MIx{YfVGdrtE;O*NrcLnssPqH5((f(M_{cX zUS3`n2DrYy9#rj5U6=DwktDLQu@Q{Jnc9^&h(dz*_R#=qUE=6>+j#(PZf*wS^r?<} z;^AikSi9wXadBbcW019s87IIxKgBuxOc7X1h$;J_5B-M#Zf$J^|D|8GNi65*=gybW z-{p{Wpr_m0+r5wStxnmw6@e^KH9OV8ZBibOAY`4002ovPDHLkV1hbLpoahe literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_rotate.png b/public/css/icons/ic_rotate.png new file mode 100644 index 0000000000000000000000000000000000000000..f97092a25edfb67db6adeb2c379fb6013dcec883 GIT binary patch literal 1269 zcmV3t+2ZznIJA5~=X>^V7to zgmQ{f6vYhqx`*PR+={EcwzlS_4JGRKU@q(r;zIoR_$cF2!F|dx1MK3`Szll8{uqdW zSHLem zM~-I&kc{f0Iz`=+z7)kwAyu1OiBMrlwEi~*qUAFK=<_K^k>r!Dof1*ewdCWvDu867 z?s`aH)$ZcFzrRywZuwHDiy+#DVj~~Omr38qSK+fh5GDN#rEyK8-Km=JX`0XKAill5 zmC?F>6}C1uHauMjk}u?w&qs@V*F}jHi3*#Be%6$zv7#IzTGEuP5ZarYo1Sh2g-`xI zx-4Q)2N5Yz@}&rsj-jcMZxVk?s?*uOGI6)Iwj5m{3g6rrF=P($)c3b-=x_Fn7-HLM z#PsmDVqbTH@Oh}462C3*7f^|&YKUxc()soE)mp^k8d>-p8shf$whNG2f`VVP!BCCx z{b^*Wi~9W&(>ck_g<@(-%qlhJOj#N{lA1)jX%8&^#UsQza&)#(Ea>#9QCr*2~LFQ3ry%ySr{okT&jNrw)-ia7hYO zbde%_X-b~>g)MXM%twN_x3@htrnsRKme-#lt;GX&@F)2}F@HHA!k*Jw84bHBqB8V*>67F&N4q9vmFll2o9y z?&$(jbUR*>6YDf~aT=0UjEPq6Jv=-p2Z@HJE~h2=S67HYJw!O-$zEw2D-s};_mKe; z@OqMU#NJOlJUkq|PA5s5(TEL@Hz>-cKf=FBXbpVkCRs;fFTPXyQW_gGUVJ|~I#Tks z#QpvKA6n}pj)DL?O}%O$3P(q2Y=k(10hmt45NXG$h43Ui? fGDN-XuK)u8&c0k{sz}#400000NkvXXu0mjfby-RU literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_save.png b/public/css/icons/ic_save.png new file mode 100644 index 0000000000000000000000000000000000000000..2e5d4749649f85c0d51580ad745efe99e8db9340 GIT binary patch literal 871 zcmV-t1DO1YP)05Qg53^wJBT~jbO0sn@E11*3V;sSPmY~+L~P@WVEMfnjUYZE{pLN(k}{F5 z*J}=nraTY;A|L`H1c-nLh=2$IA|L`HAVPo$h=7<46@r{BNs?KgPNxx7zo;lNv_UTx zi&`4t*=w;J|+j=I5KS@LqVh%%T%2cY*(s4+U)XS zE=;gY4u`{Q+F~6z&eX|A>}=`fa#<7Bi4Rh$9QkZ<{uFJ)FkXd>Gj&Yljp`Ydv7#s! z5#sz^8c+%R4qONm=L~@SQv3a0sZ=Tk=FTBR@FrBw?;rPPDx+APSgls2v_snMcFs=y z<&I6L&&~mkO*q*1H#qTYF@QrSKnoZznU2YT=mL-D-G%iLL1fPM~i0|^*O`qVm#gHZMT{ z#^u1&Ld?Cd_YEB1RRS}-2jo2f={|bU21VW;_=YLkfNO(FWx8B0Wv}b#xEW!O?TAnS zMH*OCDh#CR2GGxetyW97&XuzO@wXSq#bTj`1xVL2fK%b)OdWn-2g`IlQ0Vq-EP;*k%>4^$W0wN$ncj})20|07|`iv=D)^Y#<002ovPDHLkV1j9;gAD)x literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_save_as.png b/public/css/icons/ic_save_as.png new file mode 100644 index 0000000000000000000000000000000000000000..1c035bd07fa91aa82cd3d8da9d79beda6efcc444 GIT binary patch literal 1051 zcmV+$1mydPP)R=Fc8P>4BtZoyx%ax zPy%!S6$C0ssN|9ga0j6S=->z+cs~pjaPEMth+vEl+Y+*gE$_}~3_e?|e)nH#SLRMV zpU(=Kn0-M62oWJ7L^Onm5D}t$7IV8mRaLGIPp4BG4sX!X9{8sv5{X`r0g^mhbxXE+ zAX0$8J@zxuAU%h8JRbKRDex0WX#Hd|X-Ewb0LJ0);iJD3XdM8lORYo>#Wvya9a@|7 zRs;O)q*AGIEeaij91kyQL-NKnd z{P5WiEtAOvrYhO*_jgdhH&rN{p@Uac30-h}5Ky5_gf}2wXauAZBt=qyEt5jY0{e}= z{RO^`nIXRLiC}lP+bP*>_P>IpTW&eS&=D;if`R2q3Jm9~}1+M_N+pRT(?>0lA5Yd?O#Hbnp=%7G@ zs#Sk_b>qcWKOKv*7|5={eDy#^m#P!wk@7yav5?!d*Md zu0Sh5Cj~wN7vYFr%!d8H!KbG-^Qi-Kf ziR_+eHb4FZk^pp5AoOWoM3@v9`qdc*-2*t}W!DbmVzFqcs@mWLsPF&`eX>nJ0w_n2 zG{kKImdoXd=y*e)Yy*UzOK7_SgkMBM#0M!V78j6?0O#{LQyL@P>TCxReA8@J-@8@V z3eXzzyyKOscCJ(^M3H?b1;RB}1;#}`SGo-dfJDCh*>eK;Od1o3aJGOXVcmf?q#h-29+lX|_b`yI}t z^dWzy(2Qzn=VU7W|3sV<5h6lFLx>0wAtFRHgoqFkB0@w%hzJoOB1ANV_&WP5zyJ@2 V%-`@9=KlZy002ovPDHLkV1hC$$MgUI literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_search.png b/public/css/icons/ic_search.png new file mode 100644 index 0000000000000000000000000000000000000000..e083b2ab91049aace0cb4ccab3fe44ca1afa0a78 GIT binary patch literal 1425 zcmV;C1#bF@P)tGJkt}E8|d&oDSyZ z<_5Zf8a19S$qcr$fGB{~koE+)>X^UyNCfi~sSB|F%tCy9eXZgD-vq!(Y=E*J;n?7G3*M|VMkyq32H8TS-%?<{iu z&!LzpbDyq&8GLw%FE1~LIJjdj>)>7|IQC^KO{zxu!gy+rX%KH=VPWtgAp#z$r8lCt z{T;(l$<%5=KI396-TQN1AoGU!V+6piP)KI3hWti_jNCxx262Q72LfI$K_B^&8joWd zFF>6ZZQBmChv@r$UG&1N8c>PcXB{X*Tq6#U|KD0eMBzyRKVkr8u7Z>x8z{$t3W#YJ zAPz?;Q0Z&}`FYgaGe7N%#@25Y=lS{BMXS)z!-^zNg$u{nSLE+AWol{(QS^*aYb`D= zb_)V%3H5u-PYxR0(F!7|kQt{@1sX*!RiP2dr8~?||LCT~Z_K$iDiBzD7}uCJG`_6` z#HXhx8!^U-#2gxvwKM@pYNWW>VPa!V7bS89=`1ZR>7v5lo+0T$g+Sb6&K+q6&_bhz zt3$(9g(sB@hse3ID6n>hvh^94t`-XM@$s?DO!&0~DD0FuS1nqJRmp@=4UqWo%-Iw!t^W5FZ{MY{||>X-wo?cR^!u*i1}( zDO8CoD=Pz)YKh1--hg;-HJnn*J3>#JTJNn`i-_hl+qbc!0|P0E#c zs(N)KrEv|L>#Dmn#MRZ+E;BZC(DJ(V(%ee+i8ezVxJ8$7>3v=3-QC?e%tN$52tb>0 zBDehRQsFh>$UVw!Yc<$jTU(=H0ynvD0%W;h6&_gpL$sDw5QTX$W5#BYZfx<7a@%P5 zKs$(}MtV5K#76h__O`AXAo8Rbc+8Z?SM?Ar?cBK$Gk9&HQm#sX)_?Cta-qaqUtbTj zg(wQ=S^RR?Au88Y0MHo$uz@o6RW)YnRU8zOwnTW08&Rs?+}!k#av4M7z6Z#ohg6Qq zU+Ln=#Ba)?LT=2^BJ3U88yg!38NqWz2PU)l(LugmR-kf!@qG-)a0R6;Di)-GR}(Xl zq~lQs|Ofy`qIhPDP6zqW!{$sSC(Lczt% zSah|^%ga=X+}_^yW?qS*0Y)lC0)ApePW2~URDqoO@8YBdd2w+e4RUH@V$=X7RgB!( z+3{vJCPob~(kik!^X{Ah$hvW7#?H^rle+d_q5+H&L)+cmO`^y^TyNZY0+8QLOq>j) zhif_pq6A3v3!jOr?m!^N+pn;JD1GI$|pDTIaCADKr|4I8Hfg= ffjEWsQ-A>geo}pVUO2yR00000NkvXXu0mjf&sCD- literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_select.png b/public/css/icons/ic_select.png new file mode 100644 index 0000000000000000000000000000000000000000..c0d885d2cbc64bfc437fc178db41931496f41c0c GIT binary patch literal 797 zcmV+&1LFLNP)2%uCZSd>$I+P00gxd<28UySMh?>ud zuro3dc7~l{XMMEUY;5K2%)jDcD0BgRM*!dH`L2j?28saYayc)FF=&~I9{{;%2u^YH`Mjt6iba-Yv)QpZ&@B`S zUXtHQik+v^>0fF%n_i2>V($n2Vgb_J_#=SYR_DoN!WX}MXYGmNAH8p%*iX3(lzEBs z_-(1xIR%stcY9!pw?Sq)oPV(EzC&Lb6gRj{z_z^^bLqwtriPX1d#eE1yG8e4^^+%8Dxth zI0Yb`e^G$O>})q04S%1JaUfkfPq_?K1|qB3Z1(n5JBX^nbX-}0((N1tlEOc%!q)_N zsWB+Ei{m&BgUsr-vxFxgblnP5MYvG~JHyVfGcpl&hMi$&2oPas*co<)lC*Qb-w$DD zh!Y``G{ml947-lw_(|KDALBLZKOoNSY~k-vF((2dAVPo$h=2%)5Fi2~AOa!;h=8bp b{tGYwh1=-FZ`Dy(00000NkvXXu0mjf>3m=)l4p<}wu|5tU%#|YY=x?9u3 z7&i<<2TGjEEZpm zZHaA0B1eFZ_GxfZaGkOMk!B=rw_DaLAEi>sl@N)nMHjh}Nlnc9%3FpOM*InmjYMk@ zxvgU+@dxRQd7{91Vwx(K%P!Ix0z~WSyxDAis98NtzAM~6Af;(QhkmtMeP$Dh8lY;~ zDyoifH|3}DSNk1X6C>wkn$82ESvO!2iR<278CVqHyKlb^^wDg3 zXX_EzXf%Aod$+hdCjhuyEFl>!t-S!}^SMWUqzX_%I;(Zap*|)C$Rz^vgg7Fr5|kdDGfwSHH3FQ?W^XB+@GpOvbS#COQaLKMVDN|R=EIm?yWJj{0Hz&*^fNHIzV0>M(y?lrvJ0ZL5ghv{_c?E$GaQTCLX0IKtnrm!hR4~z{sE`>c35U11We5!Z! zd}KO7gSQcZfzA?k5RD*h0VF?MNj32k$jM~l#SPH!v#xePyt*82^E}EK`6oE18)>V1Goe8pJ;;?pS^yEHOxpO+u7IbZ)f)5 zBt{s93oPa27b9SZ43QzSFhqvP5E&v1Lu7~yks-1$M25%^86pcqoS!VJ5)H%9#?aT- z*FNkyEmAfN!?UHOrG9~OnerK`jJiMsz!olVW$FM#qb`UX&Oc>Ngck)AlH?f$^{h_& z8WGMad3kyH)Pd#Y<;slaaMopYZi49Wy*Ya#d!inmsDwC~Otk!sNxR+FYQ^JluGHW?y({ z?F);W@v}k#uss2^usl6Inef&zv=uo|(|P<#s2542yyJO=^GGt*SzTRq(eVKH1k%aS z!MFxI)bmHOLFw5UY#hXRAia>dKs$j98<&5=6K8p9-{J%WO&CB8pT@y0AQtMAq4_1e z(25y=9_;SR07>xdi@~El4RL=_3B;7wORki!1GOF>A5HP>CY8%tzm&(yQ%5AN6G^`U zoMB3zd(e}4ZMOeP_l|sBTU(=19u}Lb{t`aN_X|_0ocHZWxAHlpuMr{EWIPTlA_3XW1BA3MB`fZwWxI zSOF8mEk(|$zPwXHnwRNxc9z4U6G?NjZg&9O7W$vJt*@^i;_^G|UQOE<5D8xBql43q z-QVAvF%$oRRDP7=MPs28)D;SSgLVZ-^5lJLv*5z=Nl|Z07f<}~!i|j$A8JJOP)a9H z%o{?~(E$yRs3V9hV!0M6MU;Fg#9__(XJRT~6oN=wp0omYcXut)I>Xr`@5{MDUKZIW z(xOx(WFu*#NSX~m$0~s0j6KfN$Hk(dj0PQXOp4tCZEkM1=>}I1dHpPJWMuE9a*F+4 zCP5u;Oxx!I)&IXjp!hEvqH=>CwhS5=a{5Bc}@xm0Q0=UO7cbm)l-~k z?3gGC6lF?<^T!H#b93XQbqpi>5rX8A0HO?O)M-lT1aGgZ)fDXyMf-yc)5`RvEZJPi zufouLsJZ`RVd2%8Au>dU$ifgAB12?|EDVt$GDH@J$PgJKLu6ry43QyzM|l@u Y09)|CgGq&@BLDyZ07*qoM6N<$f<<2`SpWb4 literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_select_text_all.png b/public/css/icons/ic_select_text_all.png new file mode 100644 index 0000000000000000000000000000000000000000..df4bc3d3e0f5ee0fb678a0bd4535a96c40350fab GIT binary patch literal 487 zcmeAS@N?(olHy`uVBq!ia0vp^fgsGm1|(PYdzk?#$r9IylHmNblJdl&R0hYC{G?O` z&)mfH)S%SFl*+=BsWuD@jGdk?jv*Dd-pr28YIYE5HD1d7g6WT=i-61ah`WpIR;=jQ z)lkA7{5fKV$4M98w0+D6+gBXvFWz&n!rent-@{*Cfk8>2v7>>*MS)3>QLw{-MTrS0 zz~RDjP&`dr16#qRb)L3Z^b|0A6ig6gvtu3Gi!wEeY>Yksd> zQz>0@KJ<6A@sGG^OTSr7Gx3c)?sR<7N}bc^B9Au}K!ODnP8}Rb;RF=8=<=7#fPwYQ WzsK9A&CdnK9D}E;pUXO@geCxeV#~b% literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_settings.png b/public/css/icons/ic_settings.png new file mode 100644 index 0000000000000000000000000000000000000000..935df08bb38a8889d1867bdfa1aab298b851b444 GIT binary patch literal 1375 zcmV-l1)%zgP)wA#rGir`NIHnAAifGN{6T!OfdbAQa5HFvER@8%-rZzPW+aP`J>%K8 zGrQyUCWZI+caKF+elP-t$PgJK3qxdx43QzSFhqvP5Wll5s45f+1?x_|y}g~lj}{!o z#J^)Wf~BRU(DwaR*ArZg#IFE7`n$#HEFrJ2uO|=*MT~|KM-k66#B}+od7dGHoM@h( zZ-|4zU{Wf7rZiqR7Z9PL6*zoFwIf3*|J4^C{mBhPaJCFbAAaq^(TCr=3Js8ru!=%Q ze)xg@pkL^p={6TsYobYYq7b4?@QNc&M{qQJ-;XBf{#9`05N!3v*h0wlF|e`TJRYZ; zrA{;r5qmr>g|S#ZgGLC_DN+QU!l4o+2%(Agz*bDQe1ca?(G{RmathVEOW=u-^_;oQVR=^5o@%^(^MCoay;jhsL< z>Zj3(1?A=Cr7K&4%qj|3R#uK(U&U$6QxsZ>M2g0a<})AOe zXBi=4+0%rE_9k>tnaZLpvwL8pu~s4x<@x!!rO;4>R$X0Pm7X!dK1O6mp+IkgeJO}8 zt!xhz8h5Ay5CyMCJ&InF{mDt7-da>%JpmJI`QG*L90&O*w`>WOM_2Zbt3pQ zojP&U6H5YUMW#lBd$u<>H;q5B+~41~z(3h1mM95sCQmFA8d9cOD=n=`08$tPh@ID$ zfLDe4_MBeDAqSfhmv#)_TBb;DqycoP#0e!PpYq+^ossRsWTzrI_T{5agxP|)?L}At$c~(+_XcQ(Q(O8`bH&&fB+t48c z(9_KF2an*NHk2VSvp}BB~ER$JhtO5{gUt^GKhy?Oq%4{72z(t!r1-uBw{0Q`*8dvjq&fmMSlzY#k}8hOk{`*k%b{LM25%^Sr{Ti hWQZ&b(U|-fU;yCsEB%?KI}QK<002ovPDHLkV1hx`YUBU_ literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_share.png b/public/css/icons/ic_share.png new file mode 100644 index 0000000000000000000000000000000000000000..c2b0b95e027f6f6dd56c14b8fb09902904193f65 GIT binary patch literal 1217 zcmV;y1U~zTP)R5Lpb7Au>dU$YO|DYca`}YqeVJ=WlOs7X0Wz zvLRWK#~!2$NW-P2r9fB1giR;HrbdiSQ%EDQ$&cnuy0cYFk|7H5_4U<+&j#>o`y1H< zVRT;uz`p3z?`Q}NoaN=^Ks!VLh`l?G>E-|F98%}A(Nw}tg&z|Io6s{4Lz|L9Tu5Q8 z3P4l~(jX%zoG99ac_yM=dIlEgDOG@>+Al9JrX^BK0Ie_ZLLH7f(N@MDwE~#T?jTcwe8|SW!UqFiZAr@EC7C5 zN~#Vfhq|UXaUh3DR|Jobk7fp5I8clX2R%@OP0 z(HyZS0qD!>&U@LX(nvfA@}rYl46%oYhg2aA`7w-7C6neK(1}4QAZ~1IU_)f1aSuQ= z6aj|kJhAUwsMj+zNz36qG-xV3GR|Yhs$mStiYd>7`uc`O>AV5qNOo-+_xJaS8V%q7 z8^)5y9YeFULEPNjoEg>trtwXHGs76_@k$F(fJ`0M@V$X7jG_F#k%RKM&?F7(ySuxY zXVLH+56Rj^31cmj?HMp+D+~+5S9 zFGmp^aSp2Ni6=zmSkNJ@szM}dIPulG#9GXw(yOa0oA?rvRaH-K zL)_or#{mIvmZ{uSa3O!kD1dUG;s6NTRIMinZ3Nye3P4ouo3fvEd3lK|k7Kc}j_ziE z{00BP!9kGmYi52SMt~wj+-nQ~n${zLOd+z$z3gL%43WhU86rbuh%AQ45E&vvWHCgB f$Pmk|KLQK@!+1w9I5gJa00000NkvXXu0mjfjJ_)$ literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_show_dialpad.png b/public/css/icons/ic_show_dialpad.png new file mode 100644 index 0000000000000000000000000000000000000000..4c5e035002fb5271e94e0c6ee0258afe371be760 GIT binary patch literal 736 zcmV<60w4W}P)KnMW>3Sxk4KrbyHRT7$D2cKiTCt3ONgY(0_yO*Fix7$qsYIuVL z5D_9mL;xZ}M2H9x0f-0@AtFQsAmXd>E=#;#uMN5cG-ej)5Yd=7o6T6}u9nJ9v_(L1 zUq_&QC(&&mJIxBy<>Su8CQJrD?EDs~qhr`$Ufd6P->cEC{}FcL$zfeEoeQ1!LX+PrBVMZ=Z;q2pH2RE*!`4 z=|~hhhvV^>B=wB+cgO80)!0@LGTZ~FEd|%pGd)2=bgvnF}yRX zGpchX`0>7z$)wPEtk>&Gy{}C>v6O%b?(=*c=X_yUyst6dS#?N=9&^Wl!h-6I>RcI2 zdC!?KJ8`vIxv!jW?f5MM@p+9{CH@h5WC` zD7tHOEK<0|&i{b-&6*zCXV3Ad+0OOjT(w+WfI+as!Nq|^ zNuaT#fx|_CNstjJz@o$i6yR`S0SR<)bo^f(e!b=J!wVDo`6VM$a=0Wfr){n**{k}f zMZ;b|`M{H+v(IkbueCWBdBi{K+0(*jt?ELji&ezJlmzB8Cw1DTo{3%?miN18|9$@_ z$!f_mE7orcy6!bu;kug7?YCud&+fi0o9sPPV9|S>k5-Z^g}YxLsS{b__-jvEda-!U zVxAee`LT<-%WijS=b_&!|*fdRbC*+S63;>OY-?`TLJ3H7;6Lxa;n_ zze3!LZY(QLQ)T*CZasC`%RSd$M|R&lo0fcvEn7P5*<~;3^+%rTTYFDfog2UZzCP>5 zxb)$E?={m4hYwSR0AZ0#g?K5^Z1dJI&3{#o^`BTC{0HBas>=?(vGb2ayV z*4CnJ!D)TRfO_Vg{XSva`J7{?pBhQ>wb#puTh`?*KO=MViuUgrhEl!zved;co4Ni93RX-#f5p4A`Gzns^c9pq kp^qFpC<0zzbPq7Rbd>l$?P2O6VA5gmboFyt=akR{0F22DDF6Tf literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_textmessage.png b/public/css/icons/ic_textmessage.png new file mode 100644 index 0000000000000000000000000000000000000000..384d4f123fd61c9810668caace3e7a3730a88c72 GIT binary patch literal 477 zcmeAS@N?(olHy`uVBq!ia0vp^fgsGm1|(PYdzk?#$r9IylHmNblJdl&R0hYC{G?O` z&)mfH)S%SFl*+=BsWuD@jP;%_jv*Dd-psz6+iW1>R(O?h7ei3%5$^rkDXl#ddaanG zQ&^`punVl<=egkX;FluvgD~;gvx`-_)t40fu)EEexMnNopMG-@1;I`a78NCINX?%DoT?TlhoJO6rDxBA7q3%fs+RmIB}D{-Ip6c>y8 zHrZv8htNchD>GG;CRzojD|S|&*mUMd)xp=hqF(vTJ*@okx9h7tI;XvT=Uka-HQ7al zskE=Y^xS8gTW7!7oX^>|(s=gUzdn~!Je9b)i(VP)F^FcgK!Y73wN5bx)o zp@ej>+rgv)b}JY<7^VW~gzaFE5brlMkPg^u%aK^LnZ$M;&dfQIl^;NS{pDQy+QVSo zZnqqyr*A+2h=2%)5Fi2~AOa!;h=2%)fCvF1AOa#FLV%c@zRP~VvMheRUateX^r_{= zOD?rHYQsXI;AR<$>}kIx{Q-h_xm@1q`s5S9lrDC$STqtO#m*l3FJ=H5Ltezp4L~su z5`icj_!96oBS8v)6KYR>aZ}7aStcrTVn4)tSdf$R`J6WeporxofIMyjJ&1i_p{JB* zPbx%X!Hx_8$R8?;DMZ};*da>l2Mu6k0>A(V-YcJk6Wx$b^xE_3bV>yz^~;<$k;tB$ z%HQEtocN~jnZ!XdfWm>Y&T^B0I25a|u^^AfqbfiplSo4>l}ap~ZB`FTrZrD(8sKZp z0H5jdE}O!lu`vy$Hy|p-wg@&%$>1laTrQ7e0;uYCUfWV!ZX!DtPlv-n3uL8Ii3}vg zq79JZaaDFKS|yI?)K;7$M`GY<103H2RFRew?*>s~^N`9!PW?O8YE{{h`~7}EF}wapZQp<&gajgG1;y0UU;m z!3>CE;99Bef%E_>)}wskqI-=c9;7)CBLLYG*TeuC36W{D*{Bx7UP>ziY&06urIV2m zH9_W*1ZXrw4;J! z6Ftr6^Zz+=$`+9%0A|{Wp1R%cqa%%UpwUiza3njyu?cKq05e(Qn5IvW&RG*60-_m` z{y&!4Z1xp?(#eVyB7PPN>1;+i!-)~pi4f8m5CIVoAwUE~Km;Pt4r z>FpQ2w*gTQAZ>b)KN$_uxJ#Vvb{hv6l}D|c&1SVm`>ro>&HxM@N&DG|^EcXTHs=6_ zAjv6TwEqj@EC(l26K!rBcbgTPLajWY>Na z$33;+wTdID4y}&V25~;0D*+_;gwW`KD%j@xzV6GEqvzaVF)^Fz=z}Q$yj;vHFj&V*@0mx=h5r9k_g0v&~Nib((p@Lpi z01^->7#!sLtwAcsc{-ii9H7i~oKvk!eIVaaDj(kaRpsAZxXnpUA|b0+95f10WOc*OB~qFfsCD(+hDt9@`3QS(ncA zo6aQ|_0K?d_;sf+NIJH@c8H`tA1o!<7(geLfM^_#J-~)xw(;-Sy6!Hfc5Fr3-!(_E-qghwF??1sLGvx zHoxbaAODj%#wq&xECPy7A|2?2{M7HS*pqu+-xv1MT-mwY{NmwhYFUp~o(!FGW{+Iz z)gu1BS~}S&Ncn`jP(^$QvEHHix$o;8bE_fk~%Zi z?rgZ=lAdlYxTq$6fu6#*@M&sN=^X;BN-iCJwSrs2#06$mI0(l&WGqsX+wHJW0xAbq g03(jLKUF@!AmL}Dz2~QEF3_V4p00i_>zopr0AFx&3;+NC literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_view_grid.png b/public/css/icons/ic_view_grid.png new file mode 100644 index 0000000000000000000000000000000000000000..4f054e1ec4662799eb912466cd1c6816f8626067 GIT binary patch literal 401 zcmeAS@N?(olHy`uVBq!ia0vp^fgsGm1|(PYdzk?#$r9IylHmNblJdl&R0hYC{G?O` z&)mfH)S%SFl*+=BsWuD@jK-cWjv*Dd-rRBIYI2Zhd#JXn?ZUaa6)o#73EFtNztECZ zyt9-0i=3HmQ&{7%p49W~Lb^w){@$xk;y7&4C;d|=n!|xb(1lUZMZi%+z!Au-oPBrB zr_uG{*S`0^uk2R6ULo_ibbYW{+B36{bEF$Q}|1l~mH0|iSy7Toeozp3i(;iB%TisdmE%|nTF5|>=KvNLy@Ch4@O1TaS?83{1OQKtr)>ZL literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_view_list.png b/public/css/icons/ic_view_list.png new file mode 100644 index 0000000000000000000000000000000000000000..7750c8f9dcfd8a92c7fc85f2a453839283befe7a GIT binary patch literal 426 zcmeAS@N?(olHy`uVBq!ia0vp^fgsGm1|(PYdzk?#$r9IylHmNblJdl&R0hYC{G?O` z&)mfH)S%SFl*+=BsWuD@j6R+&jv*Dd-rRA_YIa~~edzO&v5IlwgLAFvCq!*B*FTVq z*&)nS)o|~CpSQTG_3=)hH{Y9Eba;L}-#hap3(xCaaU1%@xja-Rx=ip;>QrfR5%RP# zUazUHd-{`DyxpThU(5ZgR(<&X*XI1vKMn66Up)Hy_nl44C(JsM(%4%3cklM&>V|dR zk*s3dCU5z9ucuROn)pRnTGq!s4^(mi#iPngssaOmYxnT_)~ zfR-G8W8-^y-ODZOUQhV^xv03lcACX2pGAg&bJ6sLr2lzfKaIz^M`e|9=l|+X^$b;8IrzYvkK6*S2~?HCEFhU<>>s|Df=z=_PxFp z#pNe|xJ+t#^+&cZ@3rSaEXC4}*R?E3>qHj9}eb_O6@Qvvbq z?ahU2x)ZWN)tuueG&~gO6buDlSV*wPG!i@FXmN2d`fDKqK!oRxxgFzI8yXpAZ3uP} z3lq*5_f`T@Im8J7QF%=nctm*~gIO3zr4X4ql3ch2jX6`{UQlk0l}p9V0krAJah#|q zh?!R`VHh4l=3Oj+OA$6g6+kq|dk6|+AyGbp?P$O31Aumd07`d7}3* zr5!OB=FNq?>RLk_6W|-rxIu=zsJ~@Fc3EfZ2l4gwwFWM8Lby>YjRNEGCZ5t71KD6< zB%YTIsiUhBDYXPkOG{@~Nd_Qs^lwsb4V~_21(8*ViZ#u$x1*pFdu&R@+p%s+q$=b? z142s=Yg1~}3L?aqIuQ%ovU4z*n8>LyfII>|Hom;P)U|*J6`?j!gXQIAT~s)-bK<)% zx+t+OSm9C)I@Kq>KGXstxJ8w4y+F1CdAf5f&mNbr^Zfj5>!3t_of>NB$|JiJsDCLC z`FN-+Kr3MdqYUDl#Jwa$a2qe}@{PMcjZe2%R#v=(H9T+SyE8Ghc}uwNl(<$^Iu)#| zrScr+v_8BqG}Neo*e}mZB6>9MbSs7 z(6 z<0J08J6yhj${tIjM5-cnsI+de@hkD&4=o_BudicF=@EmAHZILN)FuAa(`KFsZgEbn z8Xg`VY#rR0JwUU$JbNI3P#cIF8yh`hHGmV_ld@F^9f|dz9$$RZam7Nd5>Sn0PkFk; z+%h13O$S7y)I-4nrZEf59*27i0*We79>9Cl6mL_<+%wv zM}841M9X|C3@YDAh=s%BZJV2$%1`?vK#M*TgmL@dyy~FrR2WpSl`wa#F-1Cx0eV*Q zvA#wTohS{F^-v?}cpIdjcXxNW&mkdC2hzoa&EI3IK$AWx3k|{;crj)}0@d2y+S&>v z;n^&F91HFs`A}xF2zSoq%(ei?5zKRFn4c0}jV=-UHV+ zwT8$*s(!0#7-s=SK$QDaK)tCzmimGuG|Gv&Ssu#7wfi?79#`gnq63d8$kN|3jk`J9 z#1)Bizo`z&#{Iw^GTLUjvbA=;+-&C!xWpvG0J`kFaWR3UXK_(!)5>g002ov JPDHLkV1i`vsYn0- literal 0 HcmV?d00001 diff --git a/public/css/icons/ic_zoom_out.png b/public/css/icons/ic_zoom_out.png new file mode 100644 index 0000000000000000000000000000000000000000..e24428b369be58185d661f4b9bc1572f8b812505 GIT binary patch literal 1468 zcmV;t1w;CYP)}2kW_G;3Lq8WR6tGzF%=x23UDeQ4DYvr0*+4w++9YV$@N(!vK`w?qMgx%F^;wR z^zT}d>rIlL(~v8L~RgR7o`WqpPiiz%Yrm&LQ+wkv806v;1JZIfM;cBiwETwz;veu;`{qMD(zUn8>azKdV(8wTdL$H%X zny`k1cP=1vhd2TtDzBLZ9#NkoU={{4SBOF#vJh@TV>)?+7t~u5^-_7W4{h4FEGsMu zV(J-75CnU0@h(;nD>`9U1$W%%MfSBaZiTs4Uk1FUF;k@wU zOrppJ_~CI@qAbBTiUNoxLUv!|!nkz>WPS?}udlB)=$RuTj9Snr-zeAw$c9KGgZ`LM zPFO;e+!_6ag@uk$k^xA(`!|Vy+0f}0D~Q4&YA)O?dpQa^(Gx?exE*p+BIS?^4G0V# z)~3|R3L@l~I*|+8OaP)9eelPR=f;Mt%Xa#3Mqr^K-XE=sH`I$Wwj zr@F-9Jr)olEUNKPmL&4h4Se%rzFN=E&n5>Y#%Bcq!%&XwLc#x1Ajb0{SAd3O2EziP z@r@u-D>%7@v+^TTViNvFo%i(g}U&0b#L( zNX%4rCFiw?bMq=~MPG9b@tFkYhOy*KChFzoWz11d$x5W|#6E{`?iV#=7=u+6@7Se7 zG#(!x>r5f;5fRca9U|nE9+77bxY2ufc)*o+E9Pge)6*nMq#UV((H{}RW3v4FU; zvVu9qBW3}0Mk+*qY~o)Y7bRj?oDv~@e1Ct>LXF}9ni=!Y0|5kVAg->idcjQan;z8d zu!T4P^2AWv`+`7wV%I;FyJ}EhRSa83CC5 zLa0|I8os^*=QmkH6d?0{tLiJy0t}z1_gq1}i9nY6f+RG`8VIv-C==)IKjQFWb^cbp z@u-3<{VmhMFc*usDtYdIs)M?5J@20JD;*=QK)zwuhMQ&|v zHK$&QkpYZUiUjzH6*&lBXthI8C5FE2;Ell@m{Z*Olmr#hVDCV(Va{ICW1 z=?>>Hfpj#)>>zhFLP8cy8;LU zCKwYc2!y}>`s>xJSC1Y&>gwvcefxGnK|xANN=QhEr>EzUBS&`b+-YlTD-Z}c9FCfr z8i7Dy|3!9K@3h0l%5gp4*aRT{{nzgx1}L9~%AfM3#smWRmumaQ@4U>9pSbO+0$LIPtr>H><{{!d^!|HwbAIt1{-+7Ta2>x>}r<$279U7FR%5w|JIQ-7uka zgOwiqlR{u=9DeWlvEEZ6R_mcX_D>?!>0WF)7j`|0NDVG9f412Pc!v4~*d&C+3h)FQ zDA^3X0!Y&NfeCKe#@31Xe6SRh6&ou`vnqJkFWuC?6;s23t|!&A5d{Rda8R%jf~qf2v__<&*>hT?j;)XK+f ztS03*6|qPPs?5Z>TZh$I&;Xj@2w}WgW3jm-&%UQ8qdt6vFQ-g#l zFP9MgVXC(Igxa%BYo*{KhHakWKByrg(VSRs#f^bSS2cz>%S1mlM=i0srSS8cvWrsR zVQ?VjptL(mXJ^iv7-~=@^G`=&?Z~k_rh}cO`KG&P^m@>5mnBP;LPi5$_HRPN9j(Mn zRSmjPkNp9LUEM%Fd(cV`wV7PRgvA{i0*m6PUHK9}Lt~5neh@}b6xp}K^n3aq>r3D- zY?OqWg>w)9JOd!YQx`91fbr?PP%R`AOuJ@@7q}E#q6M;YL4HPAl^F~{AXHQ%sB68^ zY}8uU-ofkq;U2#e?(SpXfgfZK^MW4uJ<`V}5MjJ+XQR_ zk-wpCJ#mr%Na(wvfPh_G6!d|eP1#7I4PuNCW#3qA{4qpHBef0 zHC9{WUT>+Wt!uS}J8pKG!F_!#J%aweLqo&;$b*O1LP7>7^e3NA^TR{Jo*QG6VdPi( zdqPoc>Vp;*_6d7G+ucZ*`iTTl#iY7V5)7Y=|?9n=^KTrBx}O>hwOGVyhkcFV0;y-JHswxK=BXRjL+Xuw<04-vi60w zKUJ|*RhxIJ?>XlQLI{Fk2z`;+ab{N2QCIi`2dHM=88f`vr%Kj+s6k!&2i0A zTrxuQiS%@BE~3cFF++R^pk-+mj0m?2RWSJ8y>h`#bF2I9og?A*LPkb|gL@wd#)JDO z`QzxuXO_V)Ue1}lelhdb<3;GlUrRn=IOUJMhW1li8~h~e-WfR)R1c`A0Sg$1>g7ah zM^!4nXqLrlRi&(7xP5A*cRx#wt#9f&A=kaVnrm0$c9fnIl3=(mUEqH($H8s4W966X zh)^4*UG%R#?v+8=7ag|Vi8xlFwKH8<@>!;~>ML338V{xRws)Bdn@g}584&Z?7Hl<?dh(AhJ@%{ zT!Mw77j%hnkWLhqjO)U2aVNEsGcIwFG-8lE1*hnuIYb@2yu658l2eA0Z(q05yiKMw z-eESjQkyl~s8m|VA}Xb;``-P9{j^b)p#`)7m5GOA>JOewJ|)b&n0@|oj{fTP{JRey zfBo&#@1Otp@>%VhMpb_qVj~stG-!XD;CAhZ9=7|jzXb(ZGtw?#{tbT%DmBQ%=`&RY z9pX>>)$UBz{Bw!wl5KWm)bFe-iUt1+iGc_oUpf!- z^G8q@rRzsr0h6>%*?36YMSbMt6#$OrP=ZSn1!#W6HEjuA9h`22R2B*-eKJLe-R(dcD5Il71~>?fJm?#P2SEY#`HL|XbP$+*PNUN1UJVLppa1xEkn}s_ zle?uV>qo0|a}>~-LC~?*0T?jhH&uibN-Wt~!zOSmBDq#5$=QAd$dhT&A}SMz^t-a6 z{gcV8Gp$!IZ#p^Yv-0O4IaWC<}6I4|E`d1!o7Wj;gu7GO?hlH@Ylnq1am9ZvNH# zs_xcuOnTM|^^>C8y~EsBnsRWNUtk0igTsD-;x*|%%3`o9Y%~l25MK_3Ttt?U1=%?j z7ngG>Hw(!WbEF~%HltQo3!yq7lSA$5qELlcJ1U?Jbt{q9HSmYVl>-U`q#4kBViKL1 z0Y;yU&drl1Un*x)`2N*rA^f4|_oi(n`=nAcRZt#`XG9RmkfGCzW0RD?SfS&zO|7XV zf?<2y{nS(sfgpQi?eXFhp`nA&@kM5ci6reY-~E_r0 z?(RFiLS&$IScpCV#w@Y%C$|Pj6Vrmnr1|GBjN$ot@C_e)PlA3m!hR>^eafg$Qb`d} zkw52mG^jMJBUYM^IC`=~5}zT~mZ=<(q$QeY4Kun_^~VUZMchsC1eN*?#QT57PubN^ z6B54D&+9jf)lE6Q=FHvIvjVJF$AUIAl6UfX*KvnnyYSC($j&A9iFRLI;QyS}`pd(> zgZ7)-*BZel4Z1q%TLUs7=BoI5u{v=LDj8Q3H-RpF3x@*V_kDVwL*&dvNjnCnA5jq#qY=j7Iu^NUBks0Ly~FC<7rs1FXna z+)#llE268+uv;KnD=eynn=FxAP`fz_fIv_8oxY)g{Gq;)G9^`G@w zxlY$o+O4>yRI&QPmpsd=IDPZY%(yF>0cS6sPFjsw$WIx@*g)QEmq3A1e=Q^^FhnaN zI8qbV*cFqg2NJ-Pq(xV*rY*dBB_mUQZISF+L7qBLT3YO_C@Zc6%5M@B(=@AjtMAG|x<5(5tQ+>IL;t9@ANQ#nav%#pF6 zJi7A<0S|7qCB=wxM4d-e3uK%-JDq-R^`M16eoZ{EbK9xI>@v&s+OLAo&0cglHofnd z*LkkGkW1d-4+oqK=3(J58fY5Li9z5i@CD7pq~uf>LNbJxvmq!w*9a>ti!U)ND9ou8 zpk)wTeX9^Gtm7-dMzGl!YwNyigm$;x*GKxG0Up$MXOxWreHD+H5b)$l@hI|a{*m`x zbbcO-s+)Tc-1L@bbdd-T)f|Uy8l(0fpJOlx3U=)#*qwrkVh%Qili&e=hC3_?V^}Vy zkIc^4mPIeL!Dn@kL{NweTuco`u~{7p@vbeDQzZngMQdvs+IM9wDb5Uv;!LX_%l}@- z!JlOGjgA&-8D-~h6@T%Zi0z)?Xt-Pc)2Vi`0o}nVI4OI#`oy!@W~ya`UV- zB-aehhTtLr23=Q_^DA#aH;r%Is5L@wfHe&~qy+@a+PH9MXW>0I*4vppz=Vdus}DMc z``La)CqK_hAj3UUnGsN%P8qzeofN{8$@TL+IcQYxJ4Rn zyY6n$y_5B31yA?8u4k3DMcYn~W43z_XZ_6ZI)CA`uNL_T8j9iufowcX*_opR=VN0d z5{zWYFm}ZlO^(Yj!eZgr9Q{1F6fWXniqdj!Whqov#m1oe+qG=8p|Obxw<7JDb*=H; zDliBQLYLc7aBQqAGIKoh(b$NOvTPG4dC1h`fMUW6A|U6~0k3C#F0v8&Y(7`MDO#5V z&|kbfw>*HUhJ)x=oPmt$RUV&uh6xuIuC+P1*;&kuROf1F5H#O$T7gmXR@a^K!|MaD zUN+xI%ojC=gNv%)xRZm5n15=s)8rmU+qe#;UqUu{@cO>(mecY6>UgV_n>0Z4U{=fv z)~ZcG8fPyYjHf>Luq|5~5_Qd^Ongf3abdF6E?(Y^58Tdk%N`fpOs!QcTWD}vi{gu7 zetcZHd`C(`^vMyCsF#cv7oVgbfuy5XczAkt1~)4k$>HQ(E7Vdp>576gIQjE zU6^QwLCr7}ECc`{(tNLh4-kmNIzD=@c}SZ}8W@-JF>n;>S}o3V`sy-!N6JTu=q~37EM1>=63A*i<<{4_C&tB%kytaHclxM z=k;7(oOlD5eY=V8ZAVMmExi5B;wIE+}z(S+e!Z=`x|q^^1F| zE8edPezO6yVA@aGdfA%Bf4|HHhqQA?3<#ahhLt-?7tQTVUK7wD5%E@Z%>*nH<#uj} z2-yExZ2&-Y$=*JTflIJ1jz*xK+R!CEEHa8s@{MLi5K@=;CX=`*a!s0)k;%exu5t1? zp~YMUpab88OLPn9H<-EAw+xOEpfn8_>TIiSK2}F?JJH%j57qB!>FZbTYBPL5?;jXK zjYpn7qED=Ab8AB`@BXJ3ulu$*{!bCv;M?=|lJp#MjE<#l|7ECf==sgXXh@#RSi%C5 zq@MMK8?9AgCDt)PJ0ibq7O5!C)6P>V6v0JbYyW_Npff&~EW-lG-b9iQVof2Zrn)C4 zom)r2$#|{+N=gE)b4zgnQkaAZ$yjxDJRh$l6$8 z(f&~rt^|N~eGHkJzQ=at;2>%I74%GNaC#aYeejThz4`(`L)D3z40G9j!v*S&b1yf@ z4>XZf+4Pm7SFFYWE?srvS`4EFz7=)GY}n1S zB)ny}fM)LW(O4qft8G^`;5vEec_+sqcvt9M>!AK`_q(ri`Cmv6h2+RHY+0ui1$Kc( zEXkW&8V@}h#w@a{4x1XJ>a_3hmxxsJ9&hmR-n)$^@D6qt(!wKxf=Qv45i}|_DtO`hch+z*6DrXWIJ z+7&Fh8iw%*QCjv2$$EgXz`#~cXbDxrZ1Bz5u5S;vMlSwiRhg$`vL+TXVTzu=MQhL~IyDoU1xuUq3WmjC2Fwj*R)y00x~a3-!`?Y{rF-`U_eTa+1}8NllC z2wKW*VW|?FinaH&*H2$)c;cG!ok%X2+#L4G9PARZVB zNAN;V#Bk%V1WsIF3KQ@HJkyv_R{_~NT0x-z21mSCHdEV*?B8WdBbbZMeevRS z5@SuaWDeYeP zJU#!$?RGZ$Zc?k+#|O=etIbPhFYl*?sC_`2!?uYj+OZlr8pmSz`I|xsdpz9hChm#( zu*$t>CKkmG+y_se&03X4+v425296ZH4GgQ7LHcu_GAZf?EN zakuLZW#vHoP#4x?(e~(W=e>>SBV_p5fmg5JynXk6<+u5q@;fK6{QXfqTq-#+@=~r5 zlpUX98A%6@(#3MqWjwd-ay_rQPU^1urOS{&fpa#ia+GL2xq0((il>|MhRngFBs4&q zEAjLX*T(_RBQZv3{0Z+QeF%^PiD^7A1CV8Na)Gb{Zc%C}yQri>D<`wKiVcBvV1A7X zTo1Z8X`-zcIv8hL_uW%L>LKVxlJEUH!^7o9Gy$DE_!xpmxwJX{ln49_h7p`g{WLde zbcVg*@%ve}y<9A{g2@b%_FNSx(By4Tx24FP)!>IO;(L5L1!{zTu%WRSDH8{+1AjN) zo#8L$tdCiU>DcCGwUIe(nQjutQd` LHfkt@K(PD|Q{O_Y literal 0 HcmV?d00001 diff --git a/public/css/images/icons-18-black.png b/public/css/images/icons-18-black.png new file mode 100644 index 0000000000000000000000000000000000000000..ce1b758ad580663f92c36fb0902afb677ded0b11 GIT binary patch literal 1767 zcmVlz%mt-!G0MuWqW8&UGMNlr(K^f(7o)CA zNad5BOvb?OM2WoqFqzE8Z0L&2Dj&M0sH#{bm1tkxbsvujBYJ!cEEXhFV<9-C!ocD0 zg%JydIGA^8#7Bd{fEFom=)s8{?hhdi9-Jt?>8}k0-q@Y^UV$Jr@v)>9bsSvwX)y29 z77*UHsi%HWSf>#3rJ!bLx8)3{CVWZBRFrbz|XfeYncN!yRbkJhMH9aXJ!G-f3 zSY3w$p+OTo8(3)Q;h?7ppSK>ugc&uoFnYC%!w{CWZA?TJrl4bOcvHXj^ZY)1vf)2w zl@DDLgq2<#VyPC{4HtaqqOIxU2SOhz8R0@z6J|vucsaj;7D6X=S!JyB7(qxzqOcn= zV~z@h3G<0KvWiw5CS|*Fm=>Sdb`@$7ji^cYq^rz1Q+CFH*cm92@{E9y$m%RU9amB^_oA2geg`q%>s+gTlTv4|QQT zt{vvUb640cl~kHlK6Fi3#e*p&5Go(yKq8^?ArPpf2ea1af=+xI%xBc&R_M$HJL=Z; ziV;oPT|%!L8wj-QGGtpD*%&4{n_)33BC`%>vT9s}gXVO+Td+}KX(aSoL?ShKIqG24 zlWkts)O^>Gk;ikXhwJ*MwC(QAH96?NK1KArPpdCtB%q zNhdxAHmH*i)&_Az!>i9IinJr6B@Vp8qftk~5(m=MCq-n|nAA6LWi%t2U=W90_9^`` zv#+DR(%nIf7)%%yEviFeLI@k&8~wP*EDN_9og6jy3It(3QXEzuMCjzIZsP)BSgQ$ zRV0k!ppArDd4qD1V&`L*@V6K=ZA#82q=G_NwfDWLEKw)Y?4M2oVFKMf5L#H-0mb5V z12r~G6&LlUd08Ui$5_-AGl|S9AG#*2;%#3KRlK!D-7YtkzwHM`ArP3}%vztzdb>j) zL_W`>UYUD2-$6)lbD9wc!Q&8CHS;=*_H2@;$omAJ*C>BA4aVu_$O|lWq`@jeF73$3 zN#hJdL&XB=R8AQPtvV2z#Va00ivgWP-2}ch5I8j8jd#N|@9!kAFPZ5+fdD)OhcZM0 z`Y-BvFNZX=3a|875cCj6m;}Epwg*odvEntg z=!2UM1CJhQV03V*K=E)O_?-X;533l@3DFf9*b}kx-dGQY1~2akg`+fdw=Q%Z%meMk z`v&YE`=8U7wzM4nCo-#i=$f#SAE6@Vic7l{m9}E$y~_`Ci_dvo@*&haF|?%rF}zcH zS){`vll})v>B(d~C?XI-B$T$O3%9k*4|fa%;59ffF;^m%ICv%CHlI_S^~q#1nan5i ziA4KQ2z;U=nN>b?O<2urUe7wb(k!(k_sL{3narE{Oph1znXrmS^GKKUm2eXS{d45- z4-JO0m5XK)|7{i4z3m#T@GAXWt$|D^F|O41(ht79?AUy4}=$)9||n}-iz&B zzg+t^SxQJP>|br{qF3uvJT=P7ecJ^kxP-36@>_ya6jFm4>U$t^dF?WsCW#? zDG-oowkvwh>kk!(ag7BOCbiCoiM(N3gY#-3w#h4a{ec1juuw^7ju=pTAfN-#FeeQQ z!0?+2v;am1=o)u^17hdVK%zzKJXK(?L`htbqIB!f@UtvoIXAfdQ7rtTvj8Hjs)m%e#>9@ zFd;9+#7YmlWlyyc>?{Bz0b#^jQDPPyyhdKRLWA+-lUlCOA;1RCnOXO3FS3D z7owCO9SGg|%WT4tMay&JBLPFmsb=F~QV*HzU@*k9p&DeHoLFmytJTN+ZkY9(4IW@vgKx5>$CeY9jd>jNdEHD|= zscZQtjxq#IM}<1*7nj#7sB!O!RX%bl)@J0gph6w$ujUm#ldtAb7pkBueb(oL2G&I= z!r^#GA@rMQlUY9^Di&dm+lY=`#z!>#=_klSumC4Rfw1YgLmgaHdPZo`!g`#X`f~T4 zOoCE(27_VDa^d=*^Ph@Ys2W~h4haSFH{G45f=t4b#ji4q?LmZ3W%#o*)K)lPv?T_> z5RWll>rjf)!Jtr&?M+>%L(>g#dN74L%2JkMm5*GCb@|+gG612{uQ=%ymG(d=<&9YD zb1~*VXz`xA-oJ~-$>BvOw&ZLy>q9~kX z=FUOK!(4munecJJDQLQVkfxn%^6xkeCcJqw=`yPQwbJRI;R%u^E)S78zm zsHmTN;OAKB({|C{wy2L({&pbTO@*AMj2;c5@Mv5tv z^J2GOe-Fa~O5Ey!cR_nD>LR7!oiQ+Qka@l;CVmMSKp6aL;sIf{E_=rI*9AZ_T-9zs zh)Ce$put?0e-8mY0|+(d(ok1pJWhjgTDVe`sN|8pbf-@Iv|Uu`BURFcSmh&^VqHG> zvN{2wn*pKofU4xZTj7oI|Wctr^XuYMcs`5+>Jj|0u{Xt_v;IEXhrJu(?n zf)_EKnu^z0B)X{coYJF%SDo~gHW4Eb7-1PD%4`k<>*kl8g($;(d;q9n;MMK{gec6E zoX6;pV8W{I(tvPizFS1$!5md3_W;6!m>kM?w~R`Ms0Xpu=W@LDiM^fqKsS{w%=xHh z@7gyzZ#xOt@X%`P_67%D4ic<)U?ZVsU708_CLeWzKNJQ|net~t&g}V5n00&KRE9zn zV}5!Agb{LgAaqdB5eVEZwb!dBC=w(qD(XY~Xc6?o7Ij4=Lx@#Aaw*p3^DJn>2OU*W zcjueR-=+;C2LzJOVy(~Rc-{dBiO=)I&Ybz!X~Y5l<}@Xj6+Lq#Rxz((F+y$f6nW48 z|AO`ZataI@&OUM!$mg*U4pfBP&Ra%JD4Y!}z-*A_YM4Oi*g$AcUJM^XhXDrltMN#< z76{}D@Ig1j2;k>Px+Ic20Kw_rIg}0wq#wJ-jQk-Wdg=R!E2-GQ+Dq<($Q%W_6q z=hbXAyF{=31qHcD_iG{ezbuA|Pa1(3pQ%GXxv}xBJ?8iV!JuIQMWca)hIY`?P{~dz z!h!QAM&`ksG7bCp;M!l4aE&(6goN>`6>uYNB6$--tn!gdu{NV0 z!sk;_sg5B^RT0tT@f795y9Sy@?GSuf(7 w{Qr0ntI=}7<$FRAh8X4daP}B``i*`50q}Jcs=$TL1^@s607*qoM6N<$g1p~T{{R30 literal 0 HcmV?d00001 diff --git a/public/css/images/icons-36-black.png b/public/css/images/icons-36-black.png new file mode 100644 index 0000000000000000000000000000000000000000..1a59d7c375d6611262a9ac86db23eb94570d7319 GIT binary patch literal 3611 zcmYk9c{J4BAIHu1#h4k}&`?QZ--jkk*(PIOq7W6Pgt3mE#3ea=1ibMEV!vy(LvE(;eB5J1}65RV85 z0Ej)@wfhP#Gmy^TOz@g>b;n&Lm9ObYZdgS?g0Ef`793E(^K(2U#a*o>x~G) zPGk!PFYlJOw~TE&h0=^5<>xKGXZr@kOqE2Mj8MB$$ATv{K9QH6{fLeX#n>rITq9yr zZT`Q&ex_7_?Q3rEgcD58{zzKLUpIJ19ecq3%jO|1k^_G&zi<984Pc%UmQV{wNoWI z+^B#Jv;$lq0cJXA#suiF^HXTvm*mF^B%1XQm$m~*ZpMiRJC<oyc4QEr%cc1r5~?!E8Q5%-G%^e> znqkD+Sj;?1W5{yp*)Zho-)}4Is|rpLaO8Z>){OO|S8Ml->M!KXUnO;$Jzrm4$n7~y zoFT%LPq)%Bnk$~;P4;P`96gz)Y_0IuFxX+?i=F- z9S4=(rhI`D80+~ZQMKCA)PUwI8Pqr!azWlP{`{$s9f|T1cNApQZ3rTmyJc>|#EuH8 z_#0cHWn)E6{*CBo)l7}50$MC3c8X#-+ULtoTH7fADL)iU1XJph#6-R2YGNdK7w#00 zwR@3%A3V&issXwqEbeFG*1Ka^k~u40cVAWW ztO|GC@cu5N{ud|5;6^f~g*cBu9sh z*O)4sxQ+MjmA$E1z_S*{bQDqP0O|@ORAs6=bMO|jW8T%>uwaDG%ix<(|?Rj{Cz9aaEw(Gy6_oRY{ z>E+y5WcYC!Ip6)+OJS$?YML(}(Fudw7jn89u9ub0N9@=wcdo=tA9Gh!qwf?q)LXK6 zSUV`V_hZ_+5q&TX*f&sql%al8+E9rs2BX82$lHOS z6{y0c6-s+Zz$Ga{QQY}fif-9axY3l%1$$ERrn)%_6sVZ$7h3c|Xj*;fAzpF2|3ov0 zZB&HFfJRpOt8Cm7s-`sx)CHvl)#lj@WFO3ZbZ&G5hA0;VEjKS-PBimdH8)Gl9kC9D z#9XdAuGbl&0|$~v-Zb&rE;-G+u!}0PDw6_hG(~}PCc1n1+64z>M>-0o?u^8ua!wW3qpT_e(Gv_|_E>L%A^L6`5i;aCcv|FUYH( za>$0*L;KMM0Oe69ghxC#4^&*b?{p3>oOyU$waki}FW~KIBM-Euz+&?Wk*CFP9U^&% zAdIDn2cvEo502M(Ef@?m&isDu>$d*gV{sCqPu1LbMWWT|?#66Hb1NUp^;>*CE6k-8 z2{#`Q52UgOS?-`>f*KLRVls~=UI{WUh3!2B8d0>cIM31+etoBs*q?r})xDtwxcDXuC zZ+wpojT>~8z(}9r#&n-h{cN1zATlsYo3&x2>1rvkBu^YO;&5)EMd(IeT zrnZ%Qz+s&66YXH+ei&pe-sftEFytke$WD%prNro*Hs0fXJ3yvr>Mc`DXu#n@HS-&T5^JYkN}>+g(6p zCTnqC7^k{v3F0xj)?h_%+{d&`G7Ff|k?x7@(ZpS+8ysG>yY&VWiCaw3pD^$k5Wg1I|fDkRag8Q_TzvWct zy_)fDs<#jUW}D%~aMEkzeOpV$PXqz!CgSvqTCC%YRVfUO#Q2yfWl862Dwun!s#MeV zAQ3AjXfc#}+r`>+!&ubLj%H2zlf}3dDjn1M04caz_xSJB34@+{8 z4njrN4!l&pRn+NXFz{VN!TL z$-HL*E90F!R}hjRzE?T~g1Ed(qi>+3q6>sF4Onlrh~|5py|W>inR8KxVGx}l<$kisNU@!wIO-8y-A9rsebH;;8m;(@pSAy1v9nY%^%;N9xx$>)3 z8l;I=QFKNc=!;l*DffgfouEuIFZzXLZ}`n`sgr3W8nVh{Ww!N-bc9UmFb2c>(kF}` zYJb`#2e+!8uo}$tV;e6U%w!1zSO{$R%=M#?ci&@@aN&vKyJTJI>9wB}`@muNvZ3DY z%?&I@u{>(S?M!-Vtbbbro{UpX8B!$Oq^dekOSusm^?r_w*ZSwa95Hv=YK1<~6S7`f ze)mbczu0PLXd}?@taHu!hDW%Of8CkvVQ(~*QmyUfCu=Q->hAGOg01l}<-LcIWw4c| z@yyv@B=eC2fpcvXowSX!x(WDcg6UxD=&7AwP(;kavxow)lsS%n^J~M z24k_I8gzS(ckrZbu6Mx^l-fB*ep`SDAq;}*6RC?dP-v@(T&Awq1yyR`3z3(9Zi(}kU&Ny{y7K%@ zWj|~{nSx{@z3p-jic5c%5%6L8t-^m8WKuRiOyZ08Ipe9ljP{tanp$TTha-az>SeFCnqcU`!aom@$6~Ma8kXJ<=c=NWL8VcP=ROPg>sC?x!h1Me_S7 zO_6^LnK9RB?KFjOtRat{>Z_7mnQ}z4g9q{NFgln=630C`nt$MRpF`;x84DEIxn7UNU_ z6tT*gS-ldTlExL>hU)bG11B2YvhUhQ{qjshLpABhRI9D#W+8k*r*r_uQ{Zrz{4aV zlr@VmZ-646-rD`G^w%od=hofo=(z$;GT6o88_PLroV5hYPjMAS5nrDuz7Y%k^5NrM z9ZZYvxYDqN=?c}-DH;DdhFwRTxNR^ku{+%yRi)EhCZ3JSkcJg+_RPvDpL32?9R~|@ z*&Sc>Rb?fka$fIKPgucI2?VfZV}w(Gh;ua=Lx@gl;AGW!{4}f+jHXKOV@zN@U;JK@ za=yz_*qZEI@Mu`7-5Y_#3JB8f{Uw{ojV(8pz|1TYeCT9F4M4AUjz5KM$w=l25sYxr z_sc!A{!?PlEf&sQS$Rne7@Q!Z*2`%z;p`TfLj>@$dP|fkr`&Y8uzq^4*wgbtd)a*%a8~kzL&b z#Hg6&D7OxIX`%a)swjeE#!zLnqvh%E^KML#qSn}Y#%-ziAeU1$BE3A~FSyae*=*cTSWDO58VS@rhGEgg2Y}bC06fiuclI z#o2-pZCeg0iV^g=^#ro`myOz0l2ne>W*L^l)h>(%z=a(=E}m=n5H0>&#q4Cq*AI|I zkBk(*O)3A6?)=2Q21t|7OygjB8NQe=y-NMPCx8FfonB$m3Dk8}xIXJeauC@ZLOt1_ zoJ6oeMzQmMm(Afhmx3CkHx6bLz+qg(uh$FdG|lWdyfqpzzXWq-wKKpn#y{_V(aiZV z0Vmb^x&WxQ2JYpWn{Q{F>E$pRi6GNeCGqh!rZ?V5J$O$BqD!nSD%#HL>Bb@b!4)Qo z0hEKU8dFS$H`9N;I`NhbSoDZgV}D%xoL%}dPpPYCSTvkVWr;V`S;E785yG0yd~TeT z-$UHRX((=f+f3R-eQGJQRMr~ze{g}+tnTDGW_e3bV`QX+=0L{Yw_i6Uf@MJpN)1L@R$^ZVTFTW?Up6Z*N&=Td;1kT^#6ZYd8io<9! zFLMoOSi6SUw67H=+=Q-JAGu14+p9Q)KLl&0zS_4_i{%Qm+rt#?S8JvjjyHZ*hm+#N zZ(m6`k$4MwZ5mnJ-=46yUNUovM1>rVN61ok>gIVJo$B83KHZ%pb(Jmg7O66$4(|6y z5uE@u>t0N!rul9y=MyX*=5jwIFuhki#vdi45vhvC(SS)YF$3yBC9u3N~)dXvyJaHl{B;>$v2 zMI(ei)pg|f-CS4G*sOjO6U190q}Dk%Zl5)=aWMI5_~xX0bZwanR+SLl{-d{_aR$zG z=Q=*)qZpiYec1J0*xHLaa<{I**3xTNMYT1DgLz{^XpQq#2)H~Sg)dnG6%NMNp05(pk5N0TwPGYisyl!OOc z>!+Chs%vh7`)mqvq`F(8&7lvS%o4J>CB*>T1AKasmVoXfLTkH`&~RWaUWb^T2*<80 zQOkhk$3KLaq^3meE7`WHuWDYgrUl8MB%fTJ`4I{u6?x6?l$MNa+B7Fuc|=@9wN>Cu zU6sV)<7-Y742(3QM((~PH&s!adV6Rs^`Wg8WzIL)fMeb=gag~z>5h)lPs$aLRzW#* z`qmh}xB)Gt!lTO!6bL&PczNE{scVum>Qu;E{g!?S-TTTJC0R7UV{qTpX^|@m`lArCv&uZ z?bu?#r2=nVY;FWC+q)xWleBpGhLnt4JEq45m~Tig@l3u78eSGGCaB5*wu*QvU3lws zY-xhVrwe%46mnr*TM&yKA;-WyF&tVVL?ziX>;+8}4RV>=#eKYwKJUxplaZjbFHhYm zcA`I54%XdIt4_-wO)-b!RTw|_v71-1obV(aQN24?p$F4ljaquqgj8&e1A(To|Gve2 zZ1T^_NI@JAP2oCApa4GVgp=$!IW($B47l_P`b4mR#ql*Ssp!a#r1LC!LlJ7%$cAo< z9D2c_L<;i`?zf729`GtNESFD+xKH|L9Xon`4#(+j2#MUclblK3v*6_T==xCc!e&`^ z;T29PmIxIpacBLM6Tg<8;nTZ}+5D%9!%~=Zu+R$g&z~A>tFSqOSh=mdB`hLv^&8^8 z{=z-u3;G-aJfcEn!&!v|)D*=hN%UV_NiN0Qd&vua-gi(61OF{LZi`U$ymSKr6@ndB zBi7vnR*3|{J8=mm+j! zuNKo=V0f9RW5L!)?_IBOy;)_bbfchDsH;mqroCGeV6LE#Lh}Wx?q6&wBzJF7ZjO)Q ze7x+>qLC`I3m3m5R^M%Y2~}@-wg4kp+yo{^9c(m|5j&6Oc#obTt6pJ>weBNivnC!K zXc%%ZEBihY)SdweXCIy^u}u^YsHk)9uT_dWl~^85%&UaFvanU~e0ij*QQO0v{U}g$ z)hxlOn+J`Q#3bRBy~k(2#@@2Ua*VrK^)hYuMw-rAPa(;e2f)m#ymmy0O=mK>*+CG$ zeT2(rgG=JT!eD#Y6J~pRn9W(QXS^nPs$esPK-{`v!+18kiBoJdIOi| zImTWZxC}*PgaydUTvcIst1KJUSw>YE8gk_HG*w5+%6v$QhCYiQ5`KyL*_1YCJLk@a7=|a<3Fxw7liQNo6AM$gy-T&;Z1^KM%~7!gDOnB zY|g~RnB6=XpcF8BHk4ZdY)c)&9qByc=T){#vwcU5U&Uajy8K;EYY*^YhYn+JRS~i+ zF-jhVrgj|jB-I2&CdSWtKVjELrZ)213;Kim2eS8|krIBznUcH?zmM7%Q=Uxn7!;I% zE4&_eea~-ZtXWn4^MSE%9hJz@fSlXuOo_i9&cr;pbJF_5*{`XlYkR5Gu(zUs<@K|i zMR&ChCF!LOMBYuFiPP1X!W&(( zuJauxEO0sA{k@Aw<<3Z65wA$p;sz=KyhGC#s?qhM_am7*O}md1Zu9J>NY2DM1+scy z>zGrjPCCw*>KwyJn|14jR4Rbsda_aQRxtb`??2Vs%Eupqmq}e;6IeOyd}_5f1_<_z zo?5NmX~FNs|I0XJM7j`S+Ye*uq~ A8~^|S literal 0 HcmV?d00001 diff --git a/public/css/jquery.mobile-1.2.0.css b/public/css/jquery.mobile-1.2.0.css new file mode 100644 index 0000000..85c673c --- /dev/null +++ b/public/css/jquery.mobile-1.2.0.css @@ -0,0 +1,2332 @@ +/* +* jQuery Mobile Framework Git Build: SHA1: b49cc06499abf8f987cf90f35349cfac0918c939 <> Date: Tue Oct 2 11:22:34 2012 -0700 +* http://jquerymobile.com +* +* Copyright 2012 jQuery Foundation and other contributors +* Released under the MIT license. +* http://jquery.org/license +* +*/ + + +/* Swatches */ +/* A +-----------------------------------------------------------------------------------------------------------*/ +.ui-bar-a { + border: 1px solid #333 /*{a-bar-border}*/; + background: #111 /*{a-bar-background-color}*/; + color: #fff /*{a-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{a-bar-shadow-x}*/ -1px /*{a-bar-shadow-y}*/ 1px /*{a-bar-shadow-radius}*/ #000 /*{a-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #3c3c3c /*{a-bar-background-start}*/), to( #111 /*{a-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); +} +.ui-bar-a, +.ui-bar-a input, +.ui-bar-a select, +.ui-bar-a textarea, +.ui-bar-a button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-bar-a .ui-link-inherit { + color: #fff /*{a-bar-color}*/; +} +.ui-bar-a a.ui-link { + color: #7cc4e7 /*{a-bar-link-color}*/; + font-weight: bold; +} +.ui-bar-a a.ui-link:visited { + color: #2489ce /*{a-bar-link-visited}*/; +} +.ui-bar-a a.ui-link:hover { + color: #2489ce /*{a-bar-link-hover}*/; +} +.ui-bar-a a.ui-link:active { + color: #2489ce /*{a-bar-link-active}*/; +} +.ui-body-a, +.ui-overlay-a { + border: 1px solid #444 /*{a-body-border}*/; + background: #222 /*{a-body-background-color}*/; + color: #fff /*{a-body-color}*/; + text-shadow: 0 /*{a-body-shadow-x}*/ 1px /*{a-body-shadow-y}*/ 1px /*{a-body-shadow-radius}*/ #111 /*{a-body-shadow-color}*/; + font-weight: normal; + background-image: -webkit-gradient(linear, left top, left bottom, from( #444 /*{a-body-background-start}*/), to( #222 /*{a-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); +} +.ui-overlay-a { + background-image: none; + border-width: 0; +} +.ui-body-a, +.ui-body-a input, +.ui-body-a select, +.ui-body-a textarea, +.ui-body-a button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-a .ui-link-inherit { + color: #fff /*{a-body-color}*/; +} +.ui-body-a .ui-link { + color: #2489ce /*{a-body-link-color}*/; + font-weight: bold; +} +.ui-body-a .ui-link:visited { + color: #2489ce /*{a-body-link-visited}*/; +} +.ui-body-a .ui-link:hover { + color: #2489ce /*{a-body-link-hover}*/; +} +.ui-body-a .ui-link:active { + color: #2489ce /*{a-body-link-active}*/; +} +.ui-btn-up-a { + border: 1px solid #111 /*{a-bup-border}*/; + background: #333 /*{a-bup-background-color}*/; + font-weight: bold; + color: #fff /*{a-bup-color}*/; + text-shadow: 0 /*{a-bup-shadow-x}*/ 1px /*{a-bup-shadow-y}*/ 1px /*{a-bup-shadow-radius}*/ #111 /*{a-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #444 /*{a-bup-background-start}*/), to( #2d2d2d /*{a-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); +} +.ui-btn-up-a:visited, +.ui-btn-up-a a.ui-link-inherit { + color: #fff /*{a-bup-color}*/; +} +.ui-btn-hover-a { + border: 1px solid #000 /*{a-bhover-border}*/; + background: #444 /*{a-bhover-background-color}*/; + font-weight: bold; + color: #fff /*{a-bhover-color}*/; + text-shadow: 0 /*{a-bhover-shadow-x}*/ 1px /*{a-bhover-shadow-y}*/ 1px /*{a-bhover-shadow-radius}*/ #111 /*{a-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #555 /*{a-bhover-background-start}*/), to( #383838 /*{a-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); +} +.ui-btn-hover-a:visited, +.ui-btn-hover-a:hover, +.ui-btn-hover-a a.ui-link-inherit { + color: #fff /*{a-bhover-color}*/; +} +.ui-btn-down-a { + border: 1px solid #000 /*{a-bdown-border}*/; + background: #222 /*{a-bdown-background-color}*/; + font-weight: bold; + color: #fff /*{a-bdown-color}*/; + text-shadow: 0 /*{a-bdown-shadow-x}*/ 1px /*{a-bdown-shadow-y}*/ 1px /*{a-bdown-shadow-radius}*/ #111 /*{a-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #202020 /*{a-bdown-background-start}*/), to( #2c2c2c /*{a-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); +} +.ui-btn-down-a:visited, +.ui-btn-down-a:hover, +.ui-btn-down-a a.ui-link-inherit { + color: #fff /*{a-bdown-color}*/; +} +.ui-btn-up-a, +.ui-btn-hover-a, +.ui-btn-down-a { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} +/* B +-----------------------------------------------------------------------------------------------------------*/ +.ui-bar-b { + border: 1px solid #456f9a /*{b-bar-border}*/; + background: #5e87b0 /*{b-bar-background-color}*/; + color: #fff /*{b-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{b-bar-shadow-x}*/ 1px /*{b-bar-shadow-y}*/ 1px /*{b-bar-shadow-radius}*/ #3e6790 /*{b-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #6facd5 /*{b-bar-background-start}*/), to( #497bae /*{b-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); +} +.ui-bar-b, +.ui-bar-b input, +.ui-bar-b select, +.ui-bar-b textarea, +.ui-bar-b button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-bar-b .ui-link-inherit { + color: #fff /*{b-bar-color}*/; +} +.ui-bar-b a.ui-link { + color: #ddf0f8 /*{b-bar-link-color}*/; + font-weight: bold; +} +.ui-bar-b a.ui-link:visited { + color: #ddf0f8 /*{b-bar-link-visited}*/; +} +.ui-bar-b a.ui-link:hover { + color: #ddf0f8 /*{b-bar-link-hover}*/; +} +.ui-bar-b a.ui-link:active { + color: #ddf0f8 /*{b-bar-link-active}*/; +} +.ui-body-b, +.ui-overlay-b { + border: 1px solid #999 /*{b-body-border}*/; + background: #f3f3f3 /*{b-body-background-color}*/; + color: #222 /*{b-body-color}*/; + text-shadow: 0 /*{b-body-shadow-x}*/ 1px /*{b-body-shadow-y}*/ 0 /*{b-body-shadow-radius}*/ #fff /*{b-body-shadow-color}*/; + font-weight: normal; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ddd /*{b-body-background-start}*/), to( #ccc /*{b-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); +} +.ui-overlay-b { + background-image: none; + border-width: 0; +} +.ui-body-b, +.ui-body-b input, +.ui-body-b select, +.ui-body-b textarea, +.ui-body-b button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-b .ui-link-inherit { + color: #333 /*{b-body-color}*/; +} +.ui-body-b .ui-link { + color: #2489ce /*{b-body-link-color}*/; + font-weight: bold; +} +.ui-body-b .ui-link:visited { + color: #2489ce /*{b-body-link-visited}*/; +} +.ui-body-b .ui-link:hover { + color: #2489ce /*{b-body-link-hover}*/; +} +.ui-body-b .ui-link:active { + color: #2489ce /*{b-body-link-active}*/; +} +.ui-btn-up-b { + border: 1px solid #044062 /*{b-bup-border}*/; + background: #396b9e /*{b-bup-background-color}*/; + font-weight: bold; + color: #fff /*{b-bup-color}*/; + text-shadow: 0 /*{b-bup-shadow-x}*/ 1px /*{b-bup-shadow-y}*/ 1px /*{b-bup-shadow-radius}*/ #194b7e /*{b-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #5f9cc5 /*{b-bup-background-start}*/), to( #396b9e /*{b-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); +} +.ui-btn-up-b:visited, +.ui-btn-up-b a.ui-link-inherit { + color: #fff /*{b-bup-color}*/; +} +.ui-btn-hover-b { + border: 1px solid #00415e /*{b-bhover-border}*/; + background: #4b88b6 /*{b-bhover-background-color}*/; + font-weight: bold; + color: #fff /*{b-bhover-color}*/; + text-shadow: 0 /*{b-bhover-shadow-x}*/ 1px /*{b-bhover-shadow-y}*/ 1px /*{b-bhover-shadow-radius}*/ #194b7e /*{b-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #6facd5 /*{b-bhover-background-start}*/), to( #4272a4 /*{b-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); +} +.ui-btn-hover-b:visited, +.ui-btn-hover-b:hover, +.ui-btn-hover-b a.ui-link-inherit { + color: #fff /*{b-bhover-color}*/; +} +.ui-btn-down-b { + border: 1px solid #225377 /*{b-bdown-border}*/; + background: #4e89c5 /*{b-bdown-background-color}*/; + font-weight: bold; + color: #fff /*{b-bdown-color}*/; + text-shadow: 0 /*{b-bdown-shadow-x}*/ 1px /*{b-bdown-shadow-y}*/ 1px /*{b-bdown-shadow-radius}*/ #194b7e /*{b-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #295b8e /*{b-bdown-background-start}*/), to( #3e79b5 /*{b-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); +} +.ui-btn-down-b:visited, +.ui-btn-down-b:hover, +.ui-btn-down-b a.ui-link-inherit { + color: #fff /*{b-bdown-color}*/; +} +.ui-btn-up-b, +.ui-btn-hover-b, +.ui-btn-down-b { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} +/* C +-----------------------------------------------------------------------------------------------------------*/ +.ui-bar-c { + border: 1px solid #b3b3b3 /*{c-bar-border}*/; + background: #eee /*{c-bar-background-color}*/; + color: #3e3e3e /*{c-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{c-bar-shadow-x}*/ 1px /*{c-bar-shadow-y}*/ 1px /*{c-bar-shadow-radius}*/ #fff /*{c-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f0f0f0 /*{c-bar-background-start}*/), to( #ddd /*{c-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); +} +.ui-bar-c .ui-link-inherit { + color: #3e3e3e /*{c-bar-color}*/; +} +.ui-bar-c a.ui-link { + color: #7cc4e7 /*{c-bar-link-color}*/; + font-weight: bold; +} +.ui-bar-c a.ui-link:visited { + color: #2489ce /*{c-bar-link-visited}*/; +} +.ui-bar-c a.ui-link:hover { + color: #2489ce /*{c-bar-link-hover}*/; +} +.ui-bar-c a.ui-link:active { + color: #2489ce /*{c-bar-link-active}*/; +} +.ui-bar-c, +.ui-bar-c input, +.ui-bar-c select, +.ui-bar-c textarea, +.ui-bar-c button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-c, +.ui-overlay-c { + border: 1px solid #aaa /*{c-body-border}*/; + color: #333 /*{c-body-color}*/; + text-shadow: 0 /*{c-body-shadow-x}*/ 1px /*{c-body-shadow-y}*/ 0 /*{c-body-shadow-radius}*/ #fff /*{c-body-shadow-color}*/; + background: #f9f9f9 /*{c-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f9f9f9 /*{c-body-background-start}*/), to( #eee /*{c-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eee /*{c-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eee /*{c-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eee /*{c-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eee /*{c-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eee /*{c-body-background-end}*/); +} +.ui-overlay-c { + background-image: none; + border-width: 0; +} +.ui-body-c, +.ui-body-c input, +.ui-body-c select, +.ui-body-c textarea, +.ui-body-c button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-c .ui-link-inherit { + color: #333 /*{c-body-color}*/; +} +.ui-body-c .ui-link { + color: #2489ce /*{c-body-link-color}*/; + font-weight: bold; +} +.ui-body-c .ui-link:visited { + color: #2489ce /*{c-body-link-visited}*/; +} +.ui-body-c .ui-link:hover { + color: #2489ce /*{c-body-link-hover}*/; +} +.ui-body-c .ui-link:active { + color: #2489ce /*{c-body-link-active}*/; +} +.ui-btn-up-c { + border: 1px solid #ccc /*{c-bup-border}*/; + background: #eee /*{c-bup-background-color}*/; + font-weight: bold; + color: #222 /*{c-bup-color}*/; + text-shadow: 0 /*{c-bup-shadow-x}*/ 1px /*{c-bup-shadow-y}*/ 0 /*{c-bup-shadow-radius}*/ #fff /*{c-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fff /*{c-bup-background-start}*/), to( #f1f1f1 /*{c-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); +} +.ui-btn-up-c:visited, +.ui-btn-up-c a.ui-link-inherit { + color: #2f3e46 /*{c-bup-color}*/; +} +.ui-btn-hover-c { + border: 1px solid #bbb /*{c-bhover-border}*/; + background: #dfdfdf /*{c-bhover-background-color}*/; + font-weight: bold; + color: #222 /*{c-bhover-color}*/; + text-shadow: 0 /*{c-bhover-shadow-x}*/ 1px /*{c-bhover-shadow-y}*/ 0 /*{c-bhover-shadow-radius}*/ #fff /*{c-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f6f6f6 /*{c-bhover-background-start}*/), to( #e0e0e0 /*{c-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); +} +.ui-btn-hover-c:visited, +.ui-btn-hover-c:hover, +.ui-btn-hover-c a.ui-link-inherit { + color: #2f3e46 /*{c-bhover-color}*/; +} +.ui-btn-down-c { + border: 1px solid #bbb /*{c-bdown-border}*/; + background: #d6d6d6 /*{c-bdown-background-color}*/; + font-weight: bold; + color: #222 /*{c-bdown-color}*/; + text-shadow: 0 /*{c-bdown-shadow-x}*/ 1px /*{c-bdown-shadow-y}*/ 0 /*{c-bdown-shadow-radius}*/ #fff /*{c-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #d0d0d0 /*{c-bdown-background-start}*/), to( #dfdfdf /*{c-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); +} +.ui-btn-down-c:visited, +.ui-btn-down-c:hover, +.ui-btn-down-c a.ui-link-inherit { + color: #2f3e46 /*{c-bdown-color}*/; +} +.ui-btn-up-c, +.ui-btn-hover-c, +.ui-btn-down-c { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} +/* D +-----------------------------------------------------------------------------------------------------------*/ +.ui-bar-d { + border: 1px solid #bbb /*{d-bar-border}*/; + background: #bbb /*{d-bar-background-color}*/; + color: #333 /*{d-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{d-bar-shadow-x}*/ 1px /*{d-bar-shadow-y}*/ 0 /*{d-bar-shadow-radius}*/ #eee /*{d-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ddd /*{d-bar-background-start}*/), to( #bbb /*{d-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); +} +.ui-bar-d, +.ui-bar-d input, +.ui-bar-d select, +.ui-bar-d textarea, +.ui-bar-d button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-bar-d .ui-link-inherit { + color: #333 /*{d-bar-color}*/; +} +.ui-bar-d a.ui-link { + color: #2489ce /*{d-bar-link-color}*/; + font-weight: bold; +} +.ui-bar-d a.ui-link:visited { + color: #2489ce /*{d-bar-link-visited}*/; +} +.ui-bar-d a.ui-link:hover { + color: #2489ce /*{d-bar-link-hover}*/; +} +.ui-bar-d a.ui-link:active { + color: #2489ce /*{d-bar-link-active}*/; +} +.ui-body-d, +.ui-overlay-d { + border: 1px solid #bbb /*{d-body-border}*/; + color: #333 /*{d-body-color}*/; + text-shadow: 0 /*{d-body-shadow-x}*/ 1px /*{d-body-shadow-y}*/ 0 /*{d-body-shadow-radius}*/ #fff /*{d-body-shadow-color}*/; + background: #fff /*{d-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fff /*{d-body-background-start}*/), to( #fff /*{d-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); +} +.ui-overlay-d { + background-image: none; + border-width: 0; +} +.ui-body-d, +.ui-body-d input, +.ui-body-d select, +.ui-body-d textarea, +.ui-body-d button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-d .ui-link-inherit { + color: #333 /*{d-body-color}*/; +} +.ui-body-d .ui-link { + color: #2489ce /*{d-body-link-color}*/; + font-weight: bold; +} +.ui-body-d .ui-link:visited { + color: #2489ce /*{d-body-link-visited}*/; +} +.ui-body-d .ui-link:hover { + color: #2489ce /*{d-body-link-hover}*/; +} +.ui-body-d .ui-link:active { + color: #2489ce /*{d-body-link-active}*/; +} +.ui-btn-up-d { + border: 1px solid #bbb /*{d-bup-border}*/; + background: #fff /*{d-bup-background-color}*/; + font-weight: bold; + color: #333 /*{d-bup-color}*/; + text-shadow: 0 /*{d-bup-shadow-x}*/ 1px /*{d-bup-shadow-y}*/ 0 /*{d-bup-shadow-radius}*/ #fff /*{d-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fafafa /*{d-bup-background-start}*/), to( #f6f6f6 /*{d-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); +} +.ui-btn-up-d:visited, +.ui-btn-up-d a.ui-link-inherit { + color: #333 /*{d-bup-color}*/; +} +.ui-btn-hover-d { + border: 1px solid #aaa /*{d-bhover-border}*/; + background: #eee /*{d-bhover-background-color}*/; + font-weight: bold; + color: #333 /*{d-bhover-color}*/; + cursor: pointer; + text-shadow: 0 /*{d-bhover-shadow-x}*/ 1px /*{d-bhover-shadow-y}*/ 0 /*{d-bhover-shadow-radius}*/ #fff /*{d-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #eee /*{d-bhover-background-start}*/), to( #fff /*{d-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); +} +.ui-btn-hover-d:visited, +.ui-btn-hover-d:hover, +.ui-btn-hover-d a.ui-link-inherit { + color: #333 /*{d-bhover-color}*/; +} +.ui-btn-down-d { + border: 1px solid #aaa /*{d-bdown-border}*/; + background: #eee /*{d-bdown-background-color}*/; + font-weight: bold; + color: #333 /*{d-bdown-color}*/; + text-shadow: 0 /*{d-bdown-shadow-x}*/ 1px /*{d-bdown-shadow-y}*/ 0 /*{d-bdown-shadow-radius}*/ #fff /*{d-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #e5e5e5 /*{d-bdown-background-start}*/), to( #f2f2f2 /*{d-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); +} +.ui-btn-down-d:visited, +.ui-btn-down-d:hover, +.ui-btn-down-d a.ui-link-inherit { + color: #333 /*{d-bdown-color}*/; +} +.ui-btn-up-d, +.ui-btn-hover-d, +.ui-btn-down-d { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} +/* E +-----------------------------------------------------------------------------------------------------------*/ +.ui-bar-e { + border: 1px solid #f7c942 /*{e-bar-border}*/; + background: #fadb4e /*{e-bar-background-color}*/; + color: #333 /*{e-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{e-bar-shadow-x}*/ 1px /*{e-bar-shadow-y}*/ 0 /*{e-bar-shadow-radius}*/ #fff /*{e-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fceda7 /*{e-bar-background-start}*/), to( #fbef7e /*{e-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); +} +.ui-bar-e, +.ui-bar-e input, +.ui-bar-e select, +.ui-bar-e textarea, +.ui-bar-e button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-bar-e .ui-link-inherit { + color: #333 /*{e-bar-color}*/; +} +.ui-bar-e a.ui-link { + color: #2489ce /*{e-bar-link-color}*/; + font-weight: bold; +} +.ui-bar-e a.ui-link:visited { + color: #2489ce /*{e-bar-link-visited}*/; +} +.ui-bar-e a.ui-link:hover { + color: #2489ce /*{e-bar-link-hover}*/; +} +.ui-bar-e a.ui-link:active { + color: #2489ce /*{e-bar-link-active}*/; +} +.ui-body-e, +.ui-overlay-e { + border: 1px solid #f7c942 /*{e-body-border}*/; + color: #222 /*{e-body-color}*/; + text-shadow: 0 /*{e-body-shadow-x}*/ 1px /*{e-body-shadow-y}*/ 0 /*{e-body-shadow-radius}*/ #fff /*{e-body-shadow-color}*/; + background: #fff9df /*{e-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fffadf /*{e-body-background-start}*/), to( #fff3a5 /*{e-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); +} +.ui-overlay-e { + background-image: none; + border-width: 0; +} +.ui-body-e, +.ui-body-e input, +.ui-body-e select, +.ui-body-e textarea, +.ui-body-e button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-e .ui-link-inherit { + color: #222 /*{e-body-color}*/; +} +.ui-body-e .ui-link { + color: #2489ce /*{e-body-link-color}*/; + font-weight: bold; +} +.ui-body-e .ui-link:visited { + color: #2489ce /*{e-body-link-visited}*/; +} +.ui-body-e .ui-link:hover { + color: #2489ce /*{e-body-link-hover}*/; +} +.ui-body-e .ui-link:active { + color: #2489ce /*{e-body-link-active}*/; +} +.ui-btn-up-e { + border: 1px solid #f4c63f /*{e-bup-border}*/; + background: #fadb4e /*{e-bup-background-color}*/; + font-weight: bold; + color: #222 /*{e-bup-color}*/; + text-shadow: 0 /*{e-bup-shadow-x}*/ 1px /*{e-bup-shadow-y}*/ 0 /*{e-bup-shadow-radius}*/ #fff /*{e-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffefaa /*{e-bup-background-start}*/), to( #ffe155 /*{e-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); +} +.ui-btn-up-e:visited, +.ui-btn-up-e a.ui-link-inherit { + color: #222 /*{e-bup-color}*/; +} +.ui-btn-hover-e { + border: 1px solid #f2c43d /*{e-bhover-border}*/; + background: #fbe26f /*{e-bhover-background-color}*/; + font-weight: bold; + color: #111 /*{e-bhover-color}*/; + text-shadow: 0 /*{e-bhover-shadow-x}*/ 1px /*{e-bhover-shadow-y}*/ 0 /*{e-bhover-shadow-radius}*/ #fff /*{e-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fff5ba /*{e-bhover-background-start}*/), to( #fbdd52 /*{e-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); +} +.ui-btn-hover-e:visited, +.ui-btn-hover-e:hover, +.ui-btn-hover-e a.ui-link-inherit { + color: #333 /*{e-bhover-color}*/; +} +.ui-btn-down-e { + border: 1px solid #f2c43d /*{e-bdown-border}*/; + background: #fceda7 /*{e-bdown-background-color}*/; + font-weight: bold; + color: #111 /*{e-bdown-color}*/; + text-shadow: 0 /*{e-bdown-shadow-x}*/ 1px /*{e-bdown-shadow-y}*/ 0 /*{e-bdown-shadow-radius}*/ #fff /*{e-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f8d94c /*{e-bdown-background-start}*/), to( #fadb4e /*{e-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); +} +.ui-btn-down-e:visited, +.ui-btn-down-e:hover, +.ui-btn-down-e a.ui-link-inherit { + color: #333 /*{e-bdown-color}*/; +} +.ui-btn-up-e, +.ui-btn-hover-e, +.ui-btn-down-e { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} +/* Structure */ +/* links within "buttons" +-----------------------------------------------------------------------------------------------------------*/ +a.ui-link-inherit { + text-decoration: none !important; +} +/* Active class used as the "on" state across all themes +-----------------------------------------------------------------------------------------------------------*/ +.ui-btn-active { + border: 1px solid #2373a5 /*{global-active-border}*/; + background: #5393c5 /*{global-active-background-color}*/; + font-weight: bold; + color: #fff /*{global-active-color}*/; + cursor: pointer; + text-shadow: 0 /*{global-active-shadow-x}*/ 1px /*{global-active-shadow-y}*/ 1px /*{global-active-shadow-radius}*/ #3373a5 /*{global-active-shadow-color}*/; + text-decoration: none; + background-image: -webkit-gradient(linear, left top, left bottom, from( #5393c5 /*{global-active-background-start}*/), to( #6facd5 /*{global-active-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-btn-active:visited, +.ui-btn-active:hover, +.ui-btn-active a.ui-link-inherit { + color: #fff /*{global-active-color}*/; +} +/* button inner top highlight +-----------------------------------------------------------------------------------------------------------*/ +.ui-btn-inner { + border-top: 1px solid #fff; + border-color: rgba(255,255,255,.3); +} +/* corner rounding classes +-----------------------------------------------------------------------------------------------------------*/ +.ui-corner-tl { + -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; + -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; + border-top-left-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-tr { + -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; + -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; + border-top-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-bl { + -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + border-bottom-left-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-br { + -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + border-bottom-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-top { + -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; + -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; + border-top-left-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; + -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; + border-top-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-bottom { + -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + } +.ui-corner-right { + -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; + -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; + border-top-right-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + border-bottom-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-left { + -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; + -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; + border-top-left-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + border-bottom-left-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-all { + -moz-border-radius: .6em /*{global-radii-blocks}*/; + -webkit-border-radius: .6em /*{global-radii-blocks}*/; + border-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-none { + -moz-border-radius: 0; + -webkit-border-radius: 0; + border-radius: 0; +} +/* Form field separator +-----------------------------------------------------------------------------------------------------------*/ +.ui-br { + border-bottom: rgb(130,130,130); + border-bottom: rgba(130,130,130,.3); + border-bottom-width: 1px; + border-bottom-style: solid; +} +/* Interaction cues +-----------------------------------------------------------------------------------------------------------*/ +.ui-disabled { + filter: Alpha(Opacity=30); + opacity: .3; + zoom: 1; +} +.ui-disabled, +.ui-disabled a { + cursor: default !important; + pointer-events: none; +} +/* Icons +-----------------------------------------------------------------------------------------------------------*/ +.ui-icon, +.ui-icon-searchfield:after { + background: #666 /*{global-icon-color}*/; + background: rgba(0,0,0,.4) /*{global-icon-disc}*/; + background-image: url(images/icons-18-white.png) /*{global-icon-set}*/; + background-repeat: no-repeat; + -moz-border-radius: 9px; + -webkit-border-radius: 9px; + border-radius: 9px; +} +/* Alt icon color +-----------------------------------------------------------------------------------------------------------*/ +.ui-icon-alt { + background: #fff; + background: rgba(255,255,255,.3); + background-image: url(images/icons-18-black.png); + background-repeat: no-repeat; +} +/* HD/"retina" sprite +-----------------------------------------------------------------------------------------------------------*/ +@media only screen and (-webkit-min-device-pixel-ratio: 1.5), + only screen and (min--moz-device-pixel-ratio: 1.5), + only screen and (min-resolution: 240dpi) { + + .ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r, + .ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check, + .ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back, + .ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search, .ui-icon-searchfield:after, + .ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on { + background-image: url(images/icons-36-white.png); + -moz-background-size: 776px 18px; + -o-background-size: 776px 18px; + -webkit-background-size: 776px 18px; + background-size: 776px 18px; + } + .ui-icon-alt { + background-image: url(images/icons-36-black.png); + } +} +/* plus minus */ +.ui-icon-plus { + background-position: -0 50%; +} +.ui-icon-minus { + background-position: -36px 50%; +} +/* delete/close */ +.ui-icon-delete { + background-position: -72px 50%; +} +/* arrows */ +.ui-icon-arrow-r { + background-position: -108px 50%; +} +.ui-icon-arrow-l { + background-position: -144px 50%; +} +.ui-icon-arrow-u { + background-position: -180px 50%; +} +.ui-icon-arrow-d { + background-position: -216px 50%; +} +/* misc */ +.ui-icon-check { + background-position: -252px 50%; +} +.ui-icon-gear { + background-position: -288px 50%; +} +.ui-icon-refresh { + background-position: -324px 50%; +} +.ui-icon-forward { + background-position: -360px 50%; +} +.ui-icon-back { + background-position: -396px 50%; +} +.ui-icon-grid { + background-position: -432px 50%; +} +.ui-icon-star { + background-position: -468px 50%; +} +.ui-icon-alert { + background-position: -504px 50%; +} +.ui-icon-info { + background-position: -540px 50%; +} +.ui-icon-home { + background-position: -576px 50%; +} +.ui-icon-search, +.ui-icon-searchfield:after { + background-position: -612px 50%; +} +.ui-icon-checkbox-off { + background-position: -684px 50%; +} +.ui-icon-checkbox-on { + background-position: -648px 50%; +} +.ui-icon-radio-off { + background-position: -756px 50%; +} +.ui-icon-radio-on { + background-position: -720px 50%; +} +/* checks,radios */ +.ui-checkbox .ui-icon, +.ui-selectmenu-list .ui-icon { + -moz-border-radius: 3px; + -webkit-border-radius: 3px; + border-radius: 3px; +} +.ui-icon-checkbox-off, +.ui-icon-radio-off { + background-color: transparent; +} +.ui-checkbox-on .ui-icon, +.ui-radio-on .ui-icon { + background-color: #4596ce /*{global-active-background-color}*/; /* NOTE: this hex should match the active state color. It's repeated here for cascade */ +} +/* loading icon */ +.ui-icon-loading { + background: url(images/ajax-loader.gif); + background-size: 46px 46px; +} +/* Button corner classes +-----------------------------------------------------------------------------------------------------------*/ +.ui-btn-corner-tl { + -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; + -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; + border-top-left-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-tr { + -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; + -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; + border-top-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-bl { + -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + border-bottom-left-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-br { + -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; + border-bottom-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-top { + -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; + -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; + border-top-left-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; + -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; + border-top-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-bottom { + -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; + border-bottom-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-right { + -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; + -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; + border-top-right-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; + border-bottom-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-left { + -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; + -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; + border-top-left-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + border-bottom-left-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-all { + -moz-border-radius: 1em /*{global-radii-buttons}*/; + -webkit-border-radius: 1em /*{global-radii-buttons}*/; + border-radius: 1em /*{global-radii-buttons}*/; +} +/* radius clip workaround for cleaning up corner trapping */ +.ui-corner-tl, +.ui-corner-tr, +.ui-corner-bl, +.ui-corner-br, +.ui-corner-top, +.ui-corner-bottom, +.ui-corner-right, +.ui-corner-left, +.ui-corner-all, +.ui-btn-corner-tl, +.ui-btn-corner-tr, +.ui-btn-corner-bl, +.ui--corner-br, +.ui-btn-corner-top, +.ui-btn-corner-bottom, +.ui-btn-corner-right, +.ui-btn-corner-left, +.ui-btn-corner-all { + -webkit-background-clip: padding-box; + -moz-background-clip: padding; + background-clip: padding-box; +} +/* Overlay / modal +-----------------------------------------------------------------------------------------------------------*/ +.ui-overlay { + background: #666; + filter: Alpha(Opacity=50); + opacity: .5; + position: absolute; + width: 100%; + height: 100%; +} +.ui-overlay-shadow { + -moz-box-shadow: 0px 0px 12px rgba(0,0,0,.6); + -webkit-box-shadow: 0px 0px 12px rgba(0,0,0,.6); + box-shadow: 0px 0px 12px rgba(0,0,0,.6); +} +.ui-shadow { + -moz-box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; + -webkit-box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; + box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; +} +.ui-bar-a .ui-shadow, +.ui-bar-b .ui-shadow , +.ui-bar-c .ui-shadow { + -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.3); + -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.3); + box-shadow: 0px 1px 0 rgba(255,255,255,.3); +} +.ui-shadow-inset { + -moz-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); + -webkit-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); + box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); +} +.ui-icon-shadow { + -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; + -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; + box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; +} +/* Focus state - set here for specificity (note: these classes are added by JavaScript) +-----------------------------------------------------------------------------------------------------------*/ +.ui-btn:focus, .ui-link-inherit:focus { + outline: 0; +} +.ui-btn.ui-focus { + z-index: 1; +} +.ui-focus, +.ui-btn:focus { + -moz-box-shadow: inset 0px 0px 3px #387bbe /*{global-active-background-color}*/, 0px 0px 9px #387bbe /*{global-active-background-color}*/; + -webkit-box-shadow: inset 0px 0px 3px #387bbe /*{global-active-background-color}*/, 0px 0px 9px #387bbe /*{global-active-background-color}*/; + box-shadow: inset 0px 0px 3px #387bbe /*{global-active-background-color}*/, 0px 0px 9px #387bbe /*{global-active-background-color}*/; +} +.ui-input-text.ui-focus, +.ui-input-search.ui-focus { + -moz-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; + -webkit-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; + box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; +} +/* unset box shadow in browsers that don't do it right +-----------------------------------------------------------------------------------------------------------*/ +.ui-mobile-nosupport-boxshadow * { + -moz-box-shadow: none !important; + -webkit-box-shadow: none !important; + box-shadow: none !important; +} +/* ...and bring back focus */ +.ui-mobile-nosupport-boxshadow .ui-focus, +.ui-mobile-nosupport-boxshadow .ui-btn:focus, +.ui-mobile-nosupport-boxshadow .ui-link-inherit:focus { + outline-width: 1px; + outline-style: auto; +} +/* some unsets - more probably needed */ +.ui-mobile, .ui-mobile body { height: 99.9%; } +.ui-mobile fieldset, .ui-page { padding: 0; margin: 0; } +.ui-mobile a img, .ui-mobile fieldset { border-width: 0; } +/* responsive page widths */ +.ui-mobile-viewport { margin: 0; overflow-x: visible; -webkit-text-size-adjust: 100%; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); } +/* Issue #2066 */ +body.ui-mobile-viewport, +div.ui-mobile-viewport { overflow-x: hidden; } +/* "page" containers - full-screen views, one should always be in view post-pageload */ +.ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; } +.ui-mobile .ui-page-active { display: block; overflow: visible; } +/* on ios4, setting focus on the page element causes flashing during transitions when there is an outline, so we turn off outlines */ +.ui-page { outline: none; } +/*orientations from js are available */ +@media screen and (orientation: portrait){ +.ui-mobile, .ui-mobile .ui-page { min-height: 420px; } +} +@media screen and (orientation: landscape){ +.ui-mobile, .ui-mobile .ui-page { min-height: 300px; } +} +/* loading screen */ +.ui-loading .ui-loader { display: block; } +.ui-loader { display: none; z-index: 9999999; position: fixed; top: 50%; left: 50%; border:0; } +.ui-loader-default { background: none; filter: Alpha(Opacity=18); opacity: .18; width: 46px; height: 46px; margin-left: -23px; margin-top: -23px; } +.ui-loader-verbose { width: 200px; filter: Alpha(Opacity=88); opacity: .88; box-shadow: 0 1px 1px -1px #fff; height: auto; margin-left: -110px; margin-top: -43px; padding: 10px; } +.ui-loader-default h1 { font-size: 0; width: 0; height: 0; overflow: hidden; } +.ui-loader-verbose h1 { font-size: 16px; margin: 0; text-align: center; } +.ui-loader .ui-icon { background-color: #000; display: block; margin: 0; width: 44px; height: 44px; padding: 1px; -webkit-border-radius: 36px; -moz-border-radius: 36px; border-radius: 36px; } +.ui-loader-verbose .ui-icon { margin: 0 auto 10px; filter: Alpha(Opacity=75); opacity: .75; } +.ui-loader-textonly { padding: 15px; margin-left: -115px; } +.ui-loader-textonly .ui-icon { display: none; } +.ui-loader-fakefix { position: absolute; } +/*fouc*/ +.ui-mobile-rendering > * { visibility: hidden; } +/*headers, content panels*/ +.ui-bar, .ui-body { position: relative; padding: .4em 15px; overflow: hidden; display: block; clear:both; } +.ui-bar { font-size: 16px; margin: 0; } +.ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; } +.ui-header, .ui-footer { position: relative; border-left-width: 0; border-right-width: 0; zoom: 1; } +.ui-header .ui-btn-left, +.ui-header .ui-btn-right, +.ui-footer .ui-btn-left, +.ui-footer .ui-btn-right { position: absolute; top: 3px; } +.ui-header .ui-btn-left, +.ui-footer .ui-btn-left { left: 5px; } +.ui-header .ui-btn-right, +.ui-footer .ui-btn-right { right: 5px; } +.ui-footer .ui-btn-icon-notext, +.ui-header .ui-btn-icon-notext { top: 6px; } +.ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 30% .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; } +.ui-footer .ui-title { margin: .6em 15px .8em; } +/*content area*/ +.ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; } +/* icons sizing */ +.ui-icon { width: 18px; height: 18px; } +/* non-js content hiding */ +.ui-nojs { position: absolute; left: -9999px; } +/* accessible content hiding */ +.ui-hide-label label.ui-input-text, .ui-hide-label label.ui-select, .ui-hide-label label.ui-slider, .ui-hide-label label.ui-submit, .ui-hide-label .ui-controlgroup-label, +.ui-hidden-accessible { position: absolute !important; left: -9999px; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +/* Transitions originally inspired by those from jQtouch, nice work, folks */ +.ui-mobile-viewport-transitioning, +.ui-mobile-viewport-transitioning .ui-page { + width: 100%; + height: 100%; + overflow: hidden; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} +.ui-page-pre-in { + opacity: 0; +} +.in { + -webkit-animation-timing-function: ease-out; + -webkit-animation-duration: 350ms; + -moz-animation-timing-function: ease-out; + -moz-animation-duration: 350ms; +} +.out { + -webkit-animation-timing-function: ease-in; + -webkit-animation-duration: 225ms; + -moz-animation-timing-function: ease-in; + -moz-animation-duration: 225ms; +} +@-webkit-keyframes fadein { + from { opacity: 0; } + to { opacity: 1; } +} +@-moz-keyframes fadein { + from { opacity: 0; } + to { opacity: 1; } +} +@-webkit-keyframes fadeout { + from { opacity: 1; } + to { opacity: 0; } +} +@-moz-keyframes fadeout { + from { opacity: 1; } + to { opacity: 0; } +} +.fade.out { + opacity: 0; + -webkit-animation-duration: 125ms; + -webkit-animation-name: fadeout; + -moz-animation-duration: 125ms; + -moz-animation-name: fadeout; +} +.fade.in { + opacity: 1; + -webkit-animation-duration: 225ms; + -webkit-animation-name: fadein; + -moz-animation-duration: 225ms; + -moz-animation-name: fadein; +} +.pop { + -webkit-transform-origin: 50% 50%; + -moz-transform-origin: 50% 50%; +} +.pop.in { + -webkit-transform: scale(1); + -moz-transform: scale(1); + opacity: 1; + -webkit-animation-name: popin; + -moz-animation-name: popin; + -webkit-animation-duration: 350ms; + -moz-animation-duration: 350ms; +} +.pop.out { + -webkit-animation-name: fadeout; + -moz-animation-name: fadeout; + opacity: 0; + -webkit-animation-duration: 100ms; + -moz-animation-duration: 100ms; +} +.pop.in.reverse { + -webkit-animation-name: fadein; + -moz-animation-name: fadein; +} +.pop.out.reverse { + -webkit-transform: scale(.8); + -moz-transform: scale(.8); + -webkit-animation-name: popout; + -moz-animation-name: popout; +} +@-webkit-keyframes popin { + from { + -webkit-transform: scale(.8); + opacity: 0; + } + to { + -webkit-transform: scale(1); + opacity: 1; + } +} +@-moz-keyframes popin { + from { + -moz-transform: scale(.8); + opacity: 0; + } + to { + -moz-transform: scale(1); + opacity: 1; + } +} +@-webkit-keyframes popout { + from { + -webkit-transform: scale(1); + opacity: 1; + } + to { + -webkit-transform: scale(.8); + opacity: 0; + } +} +@-moz-keyframes popout { + from { + -moz-transform: scale(1); + opacity: 1; + } + to { + -moz-transform: scale(.8); + opacity: 0; + } +} +/* keyframes for slidein from sides */ +@-webkit-keyframes slideinfromright { + from { -webkit-transform: translateX(100%); } + to { -webkit-transform: translateX(0); } +} +@-moz-keyframes slideinfromright { + from { -moz-transform: translateX(100%); } + to { -moz-transform: translateX(0); } +} +@-webkit-keyframes slideinfromleft { + from { -webkit-transform: translateX(-100%); } + to { -webkit-transform: translateX(0); } +} +@-moz-keyframes slideinfromleft { + from { -moz-transform: translateX(-100%); } + to { -moz-transform: translateX(0); } +} +/* keyframes for slideout to sides */ +@-webkit-keyframes slideouttoleft { + from { -webkit-transform: translateX(0); } + to { -webkit-transform: translateX(-100%); } +} +@-moz-keyframes slideouttoleft { + from { -moz-transform: translateX(0); } + to { -moz-transform: translateX(-100%); } +} +@-webkit-keyframes slideouttoright { + from { -webkit-transform: translateX(0); } + to { -webkit-transform: translateX(100%); } +} +@-moz-keyframes slideouttoright { + from { -moz-transform: translateX(0); } + to { -moz-transform: translateX(100%); } +} +.slide.out, .slide.in { + -webkit-animation-timing-function: ease-out; + -webkit-animation-duration: 350ms; + -moz-animation-timing-function: ease-out; + -moz-animation-duration: 350ms; +} +.slide.out { + -webkit-transform: translateX(-100%); + -webkit-animation-name: slideouttoleft; + -moz-transform: translateX(-100%); + -moz-animation-name: slideouttoleft; +} +.slide.in { + -webkit-transform: translateX(0); + -webkit-animation-name: slideinfromright; + -moz-transform: translateX(0); + -moz-animation-name: slideinfromright; +} +.slide.out.reverse { + -webkit-transform: translateX(100%); + -webkit-animation-name: slideouttoright; + -moz-transform: translateX(100%); + -moz-animation-name: slideouttoright; +} +.slide.in.reverse { + -webkit-transform: translateX(0); + -webkit-animation-name: slideinfromleft; + -moz-transform: translateX(0); + -moz-animation-name: slideinfromleft; +} +.slidefade.out { + -webkit-transform: translateX(-100%); + -webkit-animation-name: slideouttoleft; + -moz-transform: translateX(-100%); + -moz-animation-name: slideouttoleft; + -webkit-animation-duration: 225ms; + -moz-animation-duration: 225ms; +} +.slidefade.in { + -webkit-transform: translateX(0); + -webkit-animation-name: fadein; + -moz-transform: translateX(0); + -moz-animation-name: fadein; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; +} +.slidefade.out.reverse { + -webkit-transform: translateX(100%); + -webkit-animation-name: slideouttoright; + -moz-transform: translateX(100%); + -moz-animation-name: slideouttoright; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; +} +.slidefade.in.reverse { + -webkit-transform: translateX(0); + -webkit-animation-name: fadein; + -moz-transform: translateX(0); + -moz-animation-name: fadein; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; +} +/* slide down */ +.slidedown.out { + -webkit-animation-name: fadeout; + -moz-animation-name: fadeout; + -webkit-animation-duration: 100ms; + -moz-animation-duration: 100ms; +} +.slidedown.in { + -webkit-transform: translateY(0); + -webkit-animation-name: slideinfromtop; + -moz-transform: translateY(0); + -moz-animation-name: slideinfromtop; + -webkit-animation-duration: 250ms; + -moz-animation-duration: 250ms; +} +.slidedown.in.reverse { + -webkit-animation-name: fadein; + -moz-animation-name: fadein; + -webkit-animation-duration: 150ms; + -moz-animation-duration: 150ms; +} +.slidedown.out.reverse { + -webkit-transform: translateY(-100%); + -moz-transform: translateY(-100%); + -webkit-animation-name: slideouttotop; + -moz-animation-name: slideouttotop; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; +} +@-webkit-keyframes slideinfromtop { + from { -webkit-transform: translateY(-100%); } + to { -webkit-transform: translateY(0); } +} +@-moz-keyframes slideinfromtop { + from { -moz-transform: translateY(-100%); } + to { -moz-transform: translateY(0); } +} +@-webkit-keyframes slideouttotop { + from { -webkit-transform: translateY(0); } + to { -webkit-transform: translateY(-100%); } +} +@-moz-keyframes slideouttotop { + from { -moz-transform: translateY(0); } + to { -moz-transform: translateY(-100%); } +} +/* slide up */ +.slideup.out { + -webkit-animation-name: fadeout; + -moz-animation-name: fadeout; + -webkit-animation-duration: 100ms; + -moz-animation-duration: 100ms; +} +.slideup.in { + -webkit-transform: translateY(0); + -webkit-animation-name: slideinfrombottom; + -moz-transform: translateY(0); + -moz-animation-name: slideinfrombottom; + -webkit-animation-duration: 250ms; + -moz-animation-duration: 250ms; +} +.slideup.in.reverse { + -webkit-animation-name: fadein; + -moz-animation-name: fadein; + -webkit-animation-duration: 150ms; + -moz-animation-duration: 150ms; +} +.slideup.out.reverse { + -webkit-transform: translateY(100%); + -moz-transform: translateY(100%); + -webkit-animation-name: slideouttobottom; + -moz-animation-name: slideouttobottom; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; +} +@-webkit-keyframes slideinfrombottom { + from { -webkit-transform: translateY(100%); } + to { -webkit-transform: translateY(0); } +} +@-moz-keyframes slideinfrombottom { + from { -moz-transform: translateY(100%); } + to { -moz-transform: translateY(0); } +} +@-webkit-keyframes slideouttobottom { + from { -webkit-transform: translateY(0); } + to { -webkit-transform: translateY(100%); } +} +@-moz-keyframes slideouttobottom { + from { -moz-transform: translateY(0); } + to { -moz-transform: translateY(100%); } +} +/* The properties in this rule are only necessary for the 'flip' transition. + * We need specify the perspective to create a projection matrix. This will add + * some depth as the element flips. The depth number represents the distance of + * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate + * value. + */ +.viewport-flip { + -webkit-perspective: 1000; + -moz-perspective: 1000; + position: absolute; +} +.flip { + -webkit-backface-visibility:hidden; + -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ + -moz-backface-visibility:hidden; + -moz-transform:translateX(0); +} +.flip.out { + -webkit-transform: rotateY(-90deg) scale(.9); + -webkit-animation-name: flipouttoleft; + -webkit-animation-duration: 175ms; + -moz-transform: rotateY(-90deg) scale(.9); + -moz-animation-name: flipouttoleft; + -moz-animation-duration: 175ms; +} +.flip.in { + -webkit-animation-name: flipintoright; + -webkit-animation-duration: 225ms; + -moz-animation-name: flipintoright; + -moz-animation-duration: 225ms; +} +.flip.out.reverse { + -webkit-transform: rotateY(90deg) scale(.9); + -webkit-animation-name: flipouttoright; + -moz-transform: rotateY(90deg) scale(.9); + -moz-animation-name: flipouttoright; +} +.flip.in.reverse { + -webkit-animation-name: flipintoleft; + -moz-animation-name: flipintoleft; +} +@-webkit-keyframes flipouttoleft { + from { -webkit-transform: rotateY(0); } + to { -webkit-transform: rotateY(-90deg) scale(.9); } +} +@-moz-keyframes flipouttoleft { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(-90deg) scale(.9); } +} +@-webkit-keyframes flipouttoright { + from { -webkit-transform: rotateY(0) ; } + to { -webkit-transform: rotateY(90deg) scale(.9); } +} +@-moz-keyframes flipouttoright { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(90deg) scale(.9); } +} +@-webkit-keyframes flipintoleft { + from { -webkit-transform: rotateY(-90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } +} +@-moz-keyframes flipintoleft { + from { -moz-transform: rotateY(-90deg) scale(.9); } + to { -moz-transform: rotateY(0); } +} +@-webkit-keyframes flipintoright { + from { -webkit-transform: rotateY(90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } +} +@-moz-keyframes flipintoright { + from { -moz-transform: rotateY(90deg) scale(.9); } + to { -moz-transform: rotateY(0); } +} +/* The properties in this rule are only necessary for the 'flip' transition. + * We need specify the perspective to create a projection matrix. This will add + * some depth as the element flips. The depth number represents the distance of + * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate + * value. + */ +.viewport-turn { + -webkit-perspective: 1000; + -moz-perspective: 1000; + position: absolute; +} +.turn { + -webkit-backface-visibility:hidden; + -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ + -webkit-transform-origin: 0; + + -moz-backface-visibility:hidden; + -moz-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ + -moz-transform-origin: 0; +} +.turn.out { + -webkit-transform: rotateY(-90deg) scale(.9); + -webkit-animation-name: flipouttoleft; + -moz-transform: rotateY(-90deg) scale(.9); + -moz-animation-name: flipouttoleft; + -webkit-animation-duration: 125ms; + -moz-animation-duration: 125ms; +} +.turn.in { + -webkit-animation-name: flipintoright; + -moz-animation-name: flipintoright; + -webkit-animation-duration: 250ms; + -moz-animation-duration: 250ms; + +} +.turn.out.reverse { + -webkit-transform: rotateY(90deg) scale(.9); + -webkit-animation-name: flipouttoright; + -moz-transform: rotateY(90deg) scale(.9); + -moz-animation-name: flipouttoright; +} +.turn.in.reverse { + -webkit-animation-name: flipintoleft; + -moz-animation-name: flipintoleft; +} +@-webkit-keyframes flipouttoleft { + from { -webkit-transform: rotateY(0); } + to { -webkit-transform: rotateY(-90deg) scale(.9); } +} +@-moz-keyframes flipouttoleft { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(-90deg) scale(.9); } +} +@-webkit-keyframes flipouttoright { + from { -webkit-transform: rotateY(0) ; } + to { -webkit-transform: rotateY(90deg) scale(.9); } +} +@-moz-keyframes flipouttoright { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(90deg) scale(.9); } +} +@-webkit-keyframes flipintoleft { + from { -webkit-transform: rotateY(-90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } +} +@-moz-keyframes flipintoleft { + from { -moz-transform: rotateY(-90deg) scale(.9); } + to { -moz-transform: rotateY(0); } +} +@-webkit-keyframes flipintoright { + from { -webkit-transform: rotateY(90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } +} +@-moz-keyframes flipintoright { + from { -moz-transform: rotateY(90deg) scale(.9); } + to { -moz-transform: rotateY(0); } +} +/* flow transition */ +.flow { + -webkit-transform-origin: 50% 30%; + -moz-transform-origin: 50% 30%; + -webkit-box-shadow: 0 0 20px rgba(0,0,0,.4); + -moz-box-shadow: 0 0 20px rgba(0,0,0,.4); +} +.ui-dialog.flow { + -webkit-transform-origin: none; + -moz-transform-origin: none; + -webkit-box-shadow: none; + -moz-box-shadow: none; +} +.flow.out { + -webkit-transform: translateX(-100%) scale(.7); + -webkit-animation-name: flowouttoleft; + -webkit-animation-timing-function: ease; + -webkit-animation-duration: 350ms; + -moz-transform: translateX(-100%) scale(.7); + -moz-animation-name: flowouttoleft; + -moz-animation-timing-function: ease; + -moz-animation-duration: 350ms; +} +.flow.in { + -webkit-transform: translateX(0) scale(1); + -webkit-animation-name: flowinfromright; + -webkit-animation-timing-function: ease; + -webkit-animation-duration: 350ms; + -moz-transform: translateX(0) scale(1); + -moz-animation-name: flowinfromright; + -moz-animation-timing-function: ease; + -moz-animation-duration: 350ms; +} +.flow.out.reverse { + -webkit-transform: translateX(100%); + -webkit-animation-name: flowouttoright; + -moz-transform: translateX(100%); + -moz-animation-name: flowouttoright; +} +.flow.in.reverse { + -webkit-animation-name: flowinfromleft; + -moz-animation-name: flowinfromleft; +} +@-webkit-keyframes flowouttoleft { + 0% { -webkit-transform: translateX(0) scale(1); } + 60%, 70% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(-100%) scale(.7); } +} +@-moz-keyframes flowouttoleft { + 0% { -moz-transform: translateX(0) scale(1); } + 60%, 70% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(-100%) scale(.7); } +} +@-webkit-keyframes flowouttoright { + 0% { -webkit-transform: translateX(0) scale(1); } + 60%, 70% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(100%) scale(.7); } +} +@-moz-keyframes flowouttoright { + 0% { -moz-transform: translateX(0) scale(1); } + 60%, 70% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(100%) scale(.7); } +} +@-webkit-keyframes flowinfromleft { + 0% { -webkit-transform: translateX(-100%) scale(.7); } + 30%, 40% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(0) scale(1); } +} +@-moz-keyframes flowinfromleft { + 0% { -moz-transform: translateX(-100%) scale(.7); } + 30%, 40% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(0) scale(1); } +} +@-webkit-keyframes flowinfromright { + 0% { -webkit-transform: translateX(100%) scale(.7); } + 30%, 40% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(0) scale(1); } +} +@-moz-keyframes flowinfromright { + 0% { -moz-transform: translateX(100%) scale(.7); } + 30%, 40% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(0) scale(1); } +} +/* content configurations. */ +.ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; } +.ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height: 1px; -webkit-box-sizing: border-box; -moz-box-sizing: border-box; -ms-box-sizing: border-box; box-sizing: border-box; } +/* grid solo: 100 - single item fallback */ +.ui-grid-solo .ui-block-a { display: block; float: none; } +/* Lower percentages for older browsers (i.e. IE7) to prevent wrapping. -.5px to fix BB5 wrap issue. */ +/* grid a: 50/50 */ +.ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 49.95%; } +.ui-grid-a > :nth-child(n) { width: 50%; margin-right: -.5px; } +.ui-grid-a .ui-block-a { clear: left; } +/* grid b: 33/33/33 */ +.ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.25%; } +.ui-grid-b > :nth-child(n) { width: 33.333%; margin-right: -.5px; } +.ui-grid-b .ui-block-a { clear: left; } +/* grid c: 25/25/25/25 */ +.ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 24.925%; } +.ui-grid-c > :nth-child(n) { width: 25%; margin-right: -.5px; } +.ui-grid-c .ui-block-a { clear: left; } +/* grid d: 20/20/20/20/20 */ +.ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 19.925%; } +.ui-grid-d > :nth-child(n) { width: 20%; } +.ui-grid-d .ui-block-a { clear: left; } +/* fixed page header & footer configuration */ +.ui-header-fixed, +.ui-footer-fixed { + left: 0; + right: 0; + width: 100%; + position: fixed; + z-index: 1000; +} +.ui-header-fixed { + top: 0; +} +.ui-footer-fixed { + bottom: 0; +} +.ui-header-fullscreen, +.ui-footer-fullscreen { + filter: Alpha(Opacity=90); + opacity: .9; +} +.ui-page-header-fixed { + padding-top: 2.6875em; +} +.ui-page-footer-fixed { + padding-bottom: 2.6875em; +} +.ui-page-header-fullscreen .ui-content, +.ui-page-footer-fullscreen .ui-content { + padding: 0; +} +.ui-fixed-hidden { + position: absolute; +} +.ui-page-header-fullscreen .ui-fixed-hidden, +.ui-page-footer-fullscreen .ui-fixed-hidden { + left: -9999px; +} +.ui-header-fixed .ui-btn, +.ui-footer-fixed .ui-btn { + z-index: 10; +} +.ui-navbar { max-width: 100%; } +.ui-navbar.ui-mini { margin: 0; } +.ui-navbar ul:before, .ui-navbar ul:after { content: " "; display: table; } +.ui-navbar ul:after { clear: both; } +.ui-navbar ul { list-style:none; margin: 0; padding: 0; position: relative; display: block; border: 0; max-width: 100%; overflow: visible; zoom: 1; } +.ui-navbar li .ui-btn { display: block; text-align: center; margin: 0 -1px 0 0; border-right-width: 0; } +.ui-navbar li .ui-btn-icon-right .ui-icon { right: 6px; } +/* add border if not in header/footer (full width) */ +.ui-navbar li:last-child .ui-btn, +.ui-navbar .ui-grid-duo .ui-block-b .ui-btn { margin-right: 0; border-right-width: 1px; } +.ui-header .ui-navbar li:last-child .ui-btn, +.ui-footer .ui-navbar li:last-child .ui-btn, +.ui-header .ui-navbar .ui-grid-duo .ui-block-b .ui-btn, +.ui-footer .ui-navbar .ui-grid-duo .ui-block-b .ui-btn { margin-right: -1px; border-right-width: 0; } +.ui-navbar .ui-grid-duo li.ui-block-a:last-child .ui-btn { margin-right: -1px; border-right-width: 1px; } +.ui-header .ui-navbar li .ui-btn, +.ui-footer .ui-navbar li .ui-btn { border-top-width: 0; border-bottom-width: 0; } +/* fixing gaps caused by subpixel problem */ +.ui-header .ui-navbar .ui-grid-b li.ui-block-c .ui-btn, +.ui-footer .ui-navbar .ui-grid-b li.ui-block-c .ui-btn { margin-right: -5px; } +.ui-header .ui-navbar .ui-grid-c li.ui-block-d .ui-btn, +.ui-footer .ui-navbar .ui-grid-c li.ui-block-d .ui-btn, +.ui-header .ui-navbar .ui-grid-d li.ui-block-e .ui-btn, +.ui-footer .ui-navbar .ui-grid-d li.ui-block-e .ui-btn { margin-right: -4px; } +.ui-header .ui-navbar .ui-grid-b li.ui-block-c .ui-btn-icon-right .ui-icon, +.ui-footer .ui-navbar .ui-grid-b li.ui-block-c .ui-btn-icon-right .ui-icon, +.ui-header .ui-navbar .ui-grid-c li.ui-block-d .ui-btn-icon-right .ui-icon, +.ui-footer .ui-navbar .ui-grid-c li.ui-block-d .ui-btn-icon-right .ui-icon, +.ui-header .ui-navbar .ui-grid-d li.ui-block-e .ui-btn-icon-right .ui-icon, +.ui-footer .ui-navbar .ui-grid-d li.ui-block-e .ui-btn-icon-right .ui-icon { right: 8px; } +.ui-navbar li .ui-btn .ui-btn-inner { padding-top: .7em; padding-bottom: .8em } +.ui-navbar li .ui-btn-icon-top .ui-btn-inner { padding-top: 30px; } +.ui-navbar li .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 30px; } +.ui-btn { display: block; text-align: center; cursor:pointer; position: relative; margin: .5em 0; padding: 0; } +.ui-mini { margin-top: .25em; margin-bottom: .25em; } +.ui-btn-left, .ui-btn-right, .ui-input-clear, .ui-btn-inline, +.ui-grid-a .ui-btn, .ui-grid-b .ui-btn, .ui-grid-c .ui-btn, .ui-grid-d .ui-btn, .ui-grid-e .ui-btn, .ui-grid-solo .ui-btn { margin-right: 5px; margin-left: 5px; } +.ui-btn-inner { font-size: 16px; padding: .6em 20px; min-width: .75em; display: block; position: relative; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; zoom: 1; } +.ui-btn input, .ui-btn button { z-index: 2; } +.ui-btn-left, .ui-btn-right, .ui-btn-inline { display: inline-block; vertical-align: middle; } +.ui-mobile .ui-btn-left, .ui-mobile .ui-btn-right { margin: 0; } /* .ui-mobile to increase specificity level */ +.ui-btn-block { display: block; } +.ui-header > .ui-btn, +.ui-footer > .ui-btn { display: inline-block; margin: 0; } +.ui-header .ui-btn-block, +.ui-footer .ui-btn-block { display: block; } +.ui-header .ui-btn-inner, +.ui-footer .ui-btn-inner, +.ui-mini .ui-btn-inner { font-size: 12.5px; padding: .55em 11px .5em; } +.ui-fullsize .ui-btn-inner, +.ui-fullsize .ui-btn-inner { font-size: 16px; padding: .6em 20px; } +.ui-btn-icon-notext { width: 24px; height: 24px; } +.ui-btn-icon-notext .ui-btn-inner { padding: 0; height: 100%; } +.ui-btn-icon-notext .ui-btn-inner .ui-icon { margin: 2px 1px 2px 3px; float: left; } +.ui-btn-text { position: relative; z-index: 1; width: 100%; -moz-user-select: none; -webkit-user-select: none; -ms-user-select: none; } +.ui-btn-icon-notext .ui-btn-text { position: absolute; left: -9999px; } +.ui-btn-icon-left .ui-btn-inner { padding-left: 40px; } +.ui-btn-icon-right .ui-btn-inner { padding-right: 40px; } +.ui-btn-icon-top .ui-btn-inner { padding-top: 40px; } +.ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 40px; } +.ui-header .ui-btn-icon-left .ui-btn-inner, +.ui-footer .ui-btn-icon-left .ui-btn-inner, +.ui-mini.ui-btn-icon-left .ui-btn-inner, +.ui-mini .ui-btn-icon-left .ui-btn-inner { padding-left: 30px; } +.ui-header .ui-btn-icon-right .ui-btn-inner, +.ui-footer .ui-btn-icon-right .ui-btn-inner, +.ui-mini.ui-btn-icon-right .ui-btn-inner, +.ui-mini .ui-btn-icon-right .ui-btn-inner { padding-right: 30px; } +.ui-header .ui-btn-icon-top .ui-btn-inner, +.ui-footer .ui-btn-icon-top .ui-btn-inner { padding: 30px 3px .5em 3px; } +.ui-mini.ui-btn-icon-top .ui-btn-inner, +.ui-mini .ui-btn-icon-top .ui-btn-inner { padding-top: 30px; } +.ui-header .ui-btn-icon-bottom .ui-btn-inner, +.ui-footer .ui-btn-icon-bottom .ui-btn-inner { padding: .55em 3px 30px 3px; } +.ui-mini.ui-btn-icon-bottom .ui-btn-inner, +.ui-mini .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 30px; } +/*btn icon positioning*/ +.ui-btn-icon-notext .ui-icon { display: block; z-index: 0;} +.ui-btn-icon-left > .ui-btn-inner > .ui-icon, .ui-btn-icon-right > .ui-btn-inner > .ui-icon { position: absolute; top: 50%; margin-top: -9px; } +.ui-btn-icon-top .ui-btn-inner .ui-icon, .ui-btn-icon-bottom .ui-btn-inner .ui-icon { position: absolute; left: 50%; margin-left: -9px; } +.ui-btn-icon-left .ui-icon { left: 10px; } +.ui-btn-icon-right .ui-icon { right: 10px; } +.ui-btn-icon-top .ui-icon { top: 10px; } +.ui-btn-icon-bottom .ui-icon { top: auto; bottom: 10px; } +.ui-header .ui-btn-icon-left .ui-icon, +.ui-footer .ui-btn-icon-left .ui-icon, +.ui-mini.ui-btn-icon-left .ui-icon, +.ui-mini .ui-btn-icon-left .ui-icon { left: 5px; } +.ui-header .ui-btn-icon-right .ui-icon, +.ui-footer .ui-btn-icon-right .ui-icon, +.ui-mini.ui-btn-icon-right .ui-icon, +.ui-mini .ui-btn-icon-right .ui-icon { right: 5px; } +.ui-header .ui-btn-icon-top .ui-icon, +.ui-footer .ui-btn-icon-top .ui-icon, +.ui-mini.ui-btn-icon-top .ui-icon, +.ui-mini .ui-btn-icon-top .ui-icon { top: 5px; } +.ui-header .ui-btn-icon-bottom .ui-icon, +.ui-footer .ui-btn-icon-bottom .ui-icon, +.ui-mini.ui-btn-icon-bottom .ui-icon, +.ui-mini .ui-btn-icon-bottom .ui-icon { bottom: 5px; } +/*hiding native button,inputs */ +.ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: none; cursor: pointer; background: #fff; background: rgba(255,255,255,0); filter: Alpha(Opacity=0); opacity: .1; font-size: 1px; border: none; text-indent: -9999px; } +/* Fixes IE/WP filter alpha opacity bugs */ +.ui-disabled .ui-btn-hidden { display: none; } +.ui-disabled { z-index: 1; } +.ui-field-contain .ui-btn.ui-submit { margin: 0; } +label.ui-submit { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } +@media all and (min-width: 450px){ + .ui-field-contain label.ui-submit { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } + .ui-field-contain .ui-btn.ui-submit { width: 78%; display: inline-block; -webkit-box-sizing: border-box; -moz-box-sizing: border-box; -ms-box-sizing: border-box; box-sizing: border-box; } + .ui-hide-label .ui-btn.ui-submit { width: auto; display: block; } +} +.ui-collapsible-inset { margin: .5em 0; } +.ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -15px; padding: 0; position: relative; } +.ui-collapsible-inset .ui-collapsible-heading { margin: 0; } +.ui-collapsible-heading .ui-btn { text-align: left; margin: 0; border-left-width: 0; border-right-width: 0; } +.ui-collapsible-inset .ui-collapsible-heading .ui-btn { border-right-width: 1px; border-left-width: 1px; } +.ui-collapsible-collapsed + .ui-collapsible:not(.ui-collapsible-inset) .ui-collapsible-heading .ui-btn { border-top-width: 0; } +.ui-collapsible-set .ui-collapsible:not(.ui-collapsible-inset) .ui-collapsible-heading .ui-btn { border-top-width: 1px; } +.ui-collapsible-heading .ui-btn-inner, +.ui-collapsible-heading .ui-btn-icon-left .ui-btn-inner { padding-left: 40px; } +.ui-collapsible-heading .ui-btn-icon-right .ui-btn-inner { padding-left: 12px; padding-right: 40px; } +.ui-collapsible-heading .ui-btn-icon-top .ui-btn-inner, +.ui-collapsible-heading .ui-btn-icon-bottom .ui-btn-inner { padding-right: 40px; text-align: center; } +.ui-collapsible-heading .ui-btn span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; } +.ui-collapsible-heading .ui-btn span.ui-btn .ui-btn-inner { padding: 10px 0; } +.ui-collapsible-heading .ui-btn span.ui-btn .ui-icon { left: 0; margin-top: -10px; } +.ui-collapsible-heading-status { position: absolute; top: -9999px; left:0px; } +.ui-collapsible-content { + display: block; + margin: 0 -15px; + padding: 10px 15px; + border-left-width: 0; + border-right-width: 0; + border-top: none; /* Overrides ui-body-* */ + background-image: none; /* Overrides ui-body-* */ +} +.ui-collapsible-inset .ui-collapsible-content { margin: 0; border-right-width: 1px; border-left-width: 1px; } +.ui-collapsible-content-collapsed { display: none; } +.ui-collapsible-set { margin: .5em 0; } +.ui-collapsible-set .ui-collapsible { margin: -1px 0 0; } +.ui-collapsible-set .ui-collapsible:first-child { margin-top: 0; } +.ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: .5em 0; zoom: 1; } +.ui-controlgroup.ui-mini, fieldset.ui-controlgroup.ui-mini { margin: .25em 0; } +.ui-field-contain .ui-controlgroup, .ui-field-contain fieldset.ui-controlgroup { margin: 0; } +.ui-bar .ui-controlgroup { margin: 0 5px; } +.ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .4em; } +.ui-controlgroup li { list-style: none; } +.ui-controlgroup-vertical .ui-btn, +.ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0; } +.ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; } +.ui-controlgroup-controls label.ui-select { position: absolute; left: -9999px; } +.ui-controlgroup .ui-btn-icon-notext { width: auto; height: auto; top: auto; } +.ui-controlgroup .ui-btn-icon-notext .ui-btn-inner { height: 20px; padding: .6em 20px .6em 20px } +.ui-controlgroup-horizontal .ui-btn-icon-notext .ui-btn-inner { width: 18px; } +.ui-controlgroup.ui-mini .ui-btn-icon-notext .ui-btn-inner, +.ui-header .ui-controlgroup .ui-btn-icon-notext .ui-btn-inner, +.ui-footer .ui-controlgroup .ui-btn-icon-notext .ui-btn-inner { height: 16px; padding: .55em 11px .5em 11px; } +.ui-controlgroup .ui-btn-icon-notext .ui-btn-inner .ui-icon { position: absolute; top: 50%; right: 50%; margin: -9px -9px 0 0; } +.ui-controlgroup-horizontal .ui-controlgroup-controls:before, +.ui-controlgroup-horizontal .ui-controlgroup-controls:after { content: ""; display: table; } +.ui-controlgroup-horizontal .ui-controlgroup-controls:after { clear: both; } +.ui-controlgroup-horizontal .ui-controlgroup-controls { display: inline-block; vertical-align: middle; zoom: 1; } +.ui-controlgroup-horizontal .ui-btn-inner { text-align: center; } +.ui-controlgroup-horizontal.ui-mini .ui-btn-inner { height: 16px; line-height: 16px; } +.ui-controlgroup-horizontal .ui-btn, .ui-controlgroup-horizontal .ui-select, +.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { float: left; clear: none; margin: 0 -1px 0 0; } +.ui-controlgroup-horizontal .ui-select .ui-btn, +.ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn { float: none; margin: 0; } +.ui-controlgroup-horizontal .ui-controlgroup-last, .ui-controlgroup-horizontal .ui-select:last-child, +.ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; } +.ui-controlgroup .ui-checkbox label, .ui-controlgroup .ui-radio label { font-size: 16px; } +@media all and (min-width: 450px){ + .ui-field-contain .ui-controlgroup-label { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } + .ui-field-contain .ui-controlgroup-controls { width: 78%; display: inline-block; } + .ui-field-contain .ui-controlgroup .ui-select { width: 100%; display: block; } + .ui-field-contain .ui-controlgroup-horizontal .ui-select { width: auto; } + .ui-hide-label .ui-controlgroup-controls { width: 100%; } +} +.ui-dialog { + background: none !important; /* this is to ensure that dialog theming does not apply (by default at least) on the page div */ +} +.ui-dialog-contain { + width: 92.5%; + max-width: 500px; + margin: 10% auto 15px auto; + padding: 0; + position: relative; + top: -15px; +} +.ui-dialog-contain > .ui-header, +.ui-dialog-contain > .ui-content, +.ui-dialog-contain > .ui-footer { + display: block; + position: relative; + width: auto; + margin: 0; +} +.ui-dialog-contain > .ui-header { + border: none; + overflow: hidden; + z-index: 10; + padding: 0; +} +.ui-dialog-contain > .ui-content { + padding: 15px; +} +.ui-dialog-contain > .ui-footer { + z-index: 10; + padding: 0 15px; +} +.ui-popup-open .ui-header-fixed, +.ui-popup-open .ui-footer-fixed { + position: absolute !important; /* See line #553 of popup.js */ +} +.ui-popup-screen { + background-image: url(data:image/gif;base64,R0lGODlhAQABAID/AMDAwAAAACH5BAEAAAAALAAAAAABAAEAAAICRAEAOw==); /* Necessary to set some form of background to ensure element is clickable in IE6/7. While legacy IE won't understand the data-URI'd image, it ensures no additional requests occur in all other browsers with little overhead. */ + top: 0px; + left: 0px; + right: 0px; + bottom: 1px; + position: absolute; + filter: Alpha(Opacity=0); + opacity: 0; + z-index: 1099; +} +.ui-popup-screen.in { + opacity: 0.5; + filter: Alpha(Opacity=50); +} +.ui-popup-screen.out { + opacity: 0; + filter: Alpha(Opacity=0); +} +.ui-popup-container { + z-index: 1100; + display: inline-block; + position: absolute; + padding: 0; + outline: 0; +} +.ui-popup { + position: relative; +} +.ui-popup.ui-content, +.ui-popup .ui-content { + overflow: visible; +} +.ui-popup > p, +.ui-popup > h1, +.ui-popup > h2, +.ui-popup > h3, +.ui-popup > h4, +.ui-popup > h5, +.ui-popup > h6 { + margin: .5em 7px; +} +.ui-popup > span { + display: block; + margin: .5em 7px; +} +.ui-popup .ui-title { + font-size: 16px; + font-weight: bold; + margin-top: .5em; + margin-bottom: .5em; +} +.ui-popup-container .ui-content > p, +.ui-popup-container .ui-content > h1, +.ui-popup-container .ui-content > h2, +.ui-popup-container .ui-content > h3, +.ui-popup-container .ui-content > h4, +.ui-popup-container .ui-content > h5, +.ui-popup-container .ui-content > h6 { + margin: .5em 0; +} +.ui-popup-container .ui-content > span { + margin: 0; +} +.ui-popup-container .ui-content > p:first-child, +.ui-popup-container .ui-content > h1:first-child, +.ui-popup-container .ui-content > h2:first-child, +.ui-popup-container .ui-content > h3:first-child, +.ui-popup-container .ui-content > h4:first-child, +.ui-popup-container .ui-content > h5:first-child, +.ui-popup-container .ui-content > h6:first-child { + margin-top: 0; +} +.ui-popup-container .ui-content > p:last-child, +.ui-popup-container .ui-content > h1:last-child, +.ui-popup-container .ui-content > h2:last-child, +.ui-popup-container .ui-content > h3:last-child, +.ui-popup-container .ui-content > h4:last-child, +.ui-popup-container .ui-content > h5:last-child, +.ui-popup-container .ui-content > h6:last-child { + margin-bottom: 0; +} +.ui-popup > img { + width: auto; + height: auto; + max-width: 100%; + max-height: 100%; + vertical-align: middle; +} +.ui-popup iframe { + vertical-align: middle; +} +@media all and (min-width: 450px){ + .ui-popup .ui-field-contain label.ui-submit, + .ui-popup .ui-field-contain .ui-controlgroup-label, + .ui-popup .ui-field-contain label.ui-select, + .ui-popup .ui-field-contain label.ui-input-text { + font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; + } + .ui-popup .ui-field-contain .ui-btn.ui-submit, + .ui-popup .ui-field-contain .ui-controlgroup-controls, + .ui-popup .ui-field-contain .ui-select, + .ui-popup .ui-field-contain input.ui-input-text, + .ui-popup .ui-field-contain textarea.ui-input-text, + .ui-popup .ui-field-contain .ui-input-search { + width: 100%; display: block; + } +} +.ui-popup > .ui-btn-left, +.ui-popup > .ui-btn-right { + position: absolute; + top: -9px; + margin: 0; + z-index: 1101; +} +.ui-popup > .ui-btn-left { left: -9px; } +.ui-popup > .ui-btn-right { right: -9px; } +.ui-popup.ui-corner-all > .ui-header, +.ui-popup.ui-corner-all ~ .ui-content, +.ui-popup.ui-corner-all > .ui-content:first-child { + -webkit-border-top-left-radius: inherit; + border-top-left-radius: inherit; + -webkit-border-top-right-radius: inherit; + border-top-right-radius: inherit; +} +.ui-popup.ui-corner-all > .ui-content, +.ui-popup.ui-corner-all > .ui-footer, +.ui-popup.ui-corner-all > .ui-header:nth-child(n):last-child { + -webkit-border-bottom-left-radius: inherit; + border-bottom-left-radius: inherit; + -webkit-border-bottom-right-radius: inherit; + border-bottom-right-radius: inherit; +} +.ui-popup.ui-corner-all > .ui-content:nth-child(2), +.ui-popup.ui-corner-all > .ui-header:nth-child(2) { + -webkit-border-top-left-radius: 0; + border-top-left-radius: 0; + -webkit-border-top-right-radius: 0; + border-top-right-radius: 0; +} +.ui-popup.ui-corner-all > .ui-content:nth-last-child(1n+2), +.ui-popup.ui-corner-all > .ui-footer:nth-last-child(1n+2) { + -webkit-border-bottom-left-radius: 0; + border-bottom-left-radius: 0; + -webkit-border-bottom-right-radius: 0; + border-bottom-right-radius: 0; +} +.ui-popup.ui-corner-all > .ui-header:only-child, +.ui-popup.ui-corner-all > .ui-footer:only-child { + -webkit-border-radius: inherit; + border-radius: inherit; +} +.ui-checkbox, .ui-radio { position: relative; clear: both; margin: 0; z-index: 1; } +.ui-checkbox .ui-btn, .ui-radio .ui-btn { margin-top: .5em; margin-bottom: .5em; text-align: left; z-index: 2; } +.ui-checkbox .ui-btn.ui-mini, .ui-radio .ui-btn.ui-mini { margin: .25em 0; } +.ui-controlgroup .ui-checkbox .ui-btn, .ui-controlgroup .ui-radio .ui-btn { margin: 0; } +.ui-checkbox .ui-btn-inner, .ui-radio .ui-btn-inner { white-space: normal; } +.ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; } +.ui-checkbox .ui-mini.ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-mini.ui-btn-icon-left .ui-btn-inner { padding-left: 36px; } +.ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } +.ui-checkbox .ui-mini.ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-mini.ui-btn-icon-right .ui-btn-inner { padding-right: 36px; } +.ui-checkbox .ui-btn-icon-top .ui-btn-inner,.ui-radio .ui-btn-icon-top .ui-btn-inner { padding-right: 0; padding-left: 0; text-align: center; } +.ui-checkbox .ui-btn-icon-bottom .ui-btn-inner, .ui-radio .ui-btn-icon-bottom .ui-btn-inner { padding-right: 0; padding-left: 0; text-align: center; } +.ui-checkbox .ui-icon, .ui-radio .ui-icon { top: 1.1em; } +.ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon { left: 15px; } +.ui-checkbox .ui-mini.ui-btn-icon-left .ui-icon, .ui-radio .ui-mini.ui-btn-icon-left .ui-icon { left: 9px; } +.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon { right: 15px; } +.ui-checkbox .ui-mini.ui-btn-icon-right .ui-icon, .ui-radio .ui-mini.ui-btn-icon-right .ui-icon { right: 9px; } +.ui-checkbox .ui-btn-icon-top .ui-icon, .ui-radio .ui-btn-icon-top .ui-icon { top: 10px; } +.ui-checkbox .ui-btn-icon-bottom .ui-icon, .ui-radio .ui-btn-icon-bottom .ui-icon { top: auto; bottom: 10px; } +.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon { right: 15px; } +.ui-checkbox .ui-mini.ui-btn-icon-right .ui-icon, .ui-radio .ui-mini.ui-btn-icon-right .ui-icon { right: 9px; } +/* input, label positioning */ +.ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; } +.ui-field-contain, fieldset.ui-field-contain { padding: .8em 0; margin: 0; border-width: 0 0 1px 0; overflow: visible; } +.ui-field-contain:last-child { border-bottom-width: 0; } +.ui-field-contain { max-width: 100%; } /* This prevents horizontal scrollbar in IE7 */ +@media all and (min-width: 450px){ + .ui-field-contain, .ui-mobile fieldset.ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; } +} +.ui-select { display: block; position: relative; } +.ui-select select { position: absolute; left: -9999px; top: -9999px; } +.ui-select .ui-btn { overflow: hidden; opacity: 1; } +.ui-field-contain .ui-select .ui-btn { margin: 0; } +/* Fixes #2588: When Windows Phone 7.5 (Mango) tries to calculate a numeric opacity for a select (including "inherit") without explicitly specifying an opacity on the parent to give it context, a bug appears where clicking elsewhere on the page after opening the select will open the select again. */ +.ui-select .ui-btn select { cursor: pointer; -webkit-appearance: none; left: 0; top:0; width: 100%; min-height: 1.5em; min-height: 100%; height: 3em; max-height: 100%; filter: Alpha(Opacity=0); opacity: 0; z-index: 2; } +.ui-select .ui-disabled { opacity: .3; } +/* Display none because of issues with IE/WP's filter alpha opacity */ +.ui-select .ui-disabled select { display: none; } +@-moz-document url-prefix() { .ui-select .ui-btn select { opacity: 0.0001; }} +.ui-select .ui-btn.ui-select-nativeonly { border-radius: 0; border: 0; } +.ui-select .ui-btn.ui-select-nativeonly select { opacity: 1; text-indent: 0; display: block; } +.ui-select .ui-disabled.ui-select-nativeonly .ui-btn-inner { opacity: 0; } +.ui-select .ui-btn-icon-right .ui-btn-inner, .ui-select .ui-li-has-count .ui-btn-inner { padding-right: 45px; } +.ui-select .ui-mini.ui-btn-icon-right .ui-btn-inner { padding-right: 32px; } +.ui-select .ui-btn-icon-right.ui-li-has-count .ui-btn-inner { padding-right: 80px; } +.ui-select .ui-mini.ui-btn-icon-right.ui-li-has-count .ui-btn-inner { padding-right: 67px; } +.ui-select .ui-btn-icon-right .ui-icon { right: 15px; } +.ui-select .ui-mini.ui-btn-icon-right .ui-icon { right: 7px; } +.ui-select .ui-btn-icon-right.ui-li-has-count .ui-li-count { right: 45px; } +.ui-select .ui-mini.ui-btn-icon-right.ui-li-has-count .ui-li-count { right: 32px; } +/* labels */ +label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } +/*listbox*/ +.ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: block; min-height: 1em; overflow: hidden !important; +/* This !important is required for iPad Safari specifically. See https://github.com/jquery/jquery-mobile/issues/2647 */ } +.ui-select .ui-btn-text { text-overflow: ellipsis; } +.ui-selectmenu { padding: 6px; min-width: 160px; } +.ui-selectmenu .ui-listview { margin: 0; } +.ui-selectmenu .ui-btn.ui-li-divider { cursor: default; } +.ui-selectmenu-hidden { top: -99999px; left: -9999px; } +.ui-screen-hidden, .ui-selectmenu-list .ui-li .ui-icon { display: none; } +.ui-selectmenu-list .ui-li .ui-icon { display: block; } +.ui-li.ui-selectmenu-placeholder { display: none; } +.ui-selectmenu .ui-header { margin: 0; padding: 0; } +.ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; } +@media all and (min-width: 450px){ + .ui-field-contain label.ui-select { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } + .ui-field-contain .ui-select { width: 78%; display: inline-block; } + .ui-hide-label .ui-select { width: 100%; } +} +/* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button. this shim's content in there */ +.ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; } +label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; } +input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; margin: .5em 0; line-height: 1.4; font-size: 16px; display: block; width: 100%; outline: 0; } +input.ui-input-text.ui-mini, textarea.ui-input-text.ui-mini { margin: .25em 0; } +.ui-field-contain input.ui-input-text, .ui-field-contain textarea.ui-input-text { margin: 0; } +input.ui-input-text, textarea.ui-input-text, .ui-input-search { -webkit-box-sizing: border-box; -moz-box-sizing: border-box; -ms-box-sizing: border-box; box-sizing: border-box; } +input.ui-input-text { -webkit-appearance: none; } +textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; } +.ui-input-search { padding: 0 30px; margin: .5em 0; background-image: none; position: relative; } +.ui-input-search.ui-mini { margin: .25em 0; } +.ui-field-contain .ui-input-search { margin: 0; } +.ui-icon-searchfield:after { position: absolute; left: 7px; top: 50%; margin-top: -9px; content: ""; width: 18px; height: 18px; opacity: .5; } +.ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; } +.ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -13px; } +.ui-mini .ui-input-clear { right: -3px; } +.ui-input-search .ui-input-clear-hidden { display: none; } +input.ui-mini, .ui-mini input, textarea.ui-mini { font-size: 14px; } +textarea.ui-mini { height: 45px; } +@media all and (min-width: 450px){ + .ui-field-contain label.ui-input-text { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0 } + .ui-field-contain input.ui-input-text, + .ui-field-contain textarea.ui-input-text, + .ui-field-contain .ui-input-search { width: 78%; display: inline-block; } + .ui-hide-label input.ui-input-text, + .ui-hide-label textarea.ui-input-text, + .ui-hide-label .ui-input-search { width: 100%; } + .ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ } +} +.ui-listview { margin: 0; } +ol.ui-listview, ol.ui-listview .ui-li-divider { counter-reset: listnumbering; } +.ui-content .ui-listview { margin: -15px; } +.ui-collapsible-content > .ui-listview { margin: -10px -15px; } +.ui-content .ui-listview-inset { margin: 1em 0; } +.ui-collapsible-content .ui-listview-inset { margin: .5em 0; } +.ui-listview, .ui-li { list-style:none; padding:0; } +.ui-li, .ui-li.ui-field-contain { display: block; margin:0; position: relative; overflow: visible; text-align: left; border-width: 0; border-top-width: 1px; } +.ui-li.ui-btn { margin: 0; } +.ui-li .ui-btn-text a.ui-link-inherit { text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } +.ui-li-static { background-image: none; } +.ui-li-divider { padding: .5em 15px; font-size: 14px; font-weight: bold; } +ol.ui-listview .ui-link-inherit:before, ol.ui-listview .ui-li-static:before, .ui-li-dec { font-size: .8em; display: inline-block; padding-right: .3em; font-weight: normal; counter-increment: listnumbering; content: counter(listnumbering) ". "; } +ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid chance of duplication */ +.ui-listview-inset .ui-li { border-right-width: 1px; border-left-width: 1px; } +.ui-li-last, .ui-li.ui-field-contain.ui-li-last { border-bottom-width: 1px; } +.ui-collapsible [class*="ui-body"] > .ui-listview:not(.ui-listview-inset) .ui-li-last { border-bottom-width: 0; } +.ui-collapsible-content > .ui-listview:not(.ui-listview-inset) .ui-li:first-child { border-top-width: 0; } +.ui-collapsible-content > .ui-listview:not(.ui-listview-inset), +.ui-collapsible-content > .ui-listview:not(.ui-listview-inset) .ui-li-last { -webkit-border-bottom-left-radius: inherit; -webkit-border-bottom-right-radius: inherit; border-bottom-left-radius: inherit; border-bottom-right-radius: inherit; } +.ui-collapsible-content > .ui-listview:not(.ui-listview-inset) .ui-li-last .ui-li-link-alt { -webkit-border-bottom-right-radius: inherit; border-bottom-right-radius: inherit; } +.ui-li>.ui-btn-inner { display: block; position: relative; padding: 0; } +.ui-li .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li { padding: .7em 15px; display: block; } +.ui-li-has-thumb .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-thumb { min-height: 60px; padding-left: 100px; } +.ui-li-has-icon .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-icon { min-height: 20px; padding-left: 40px; } +.ui-li-has-count .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-count, .ui-li-divider.ui-li-has-count { padding-right: 45px; } +.ui-li-has-arrow .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-arrow { padding-right: 40px; } +.ui-li-has-arrow.ui-li-has-count .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-arrow.ui-li-has-count { padding-right: 75px; } +.ui-li-heading { font-size: 16px; font-weight: bold; display: block; margin: .6em 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } +.ui-li-desc { font-size: 12px; font-weight: normal; display: block; margin: -.5em 0 .6em; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } +.ui-li-thumb, .ui-listview .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; } +.ui-listview .ui-li-icon { max-height: 16px; max-width: 16px; left: 10px; top: .9em; } +.ui-li-thumb, .ui-listview .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; } +.ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; } +@media all and (min-width: 480px){ + .ui-li-aside { width: 45%; } +} +.ui-li-divider { cursor: default; } +.ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 53px; } +.ui-li-has-alt.ui-li-has-count .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt.ui-li-has-count { padding-right: 88px; } +.ui-li-has-count .ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 10px; } +.ui-li-has-count.ui-li-divider .ui-li-count, .ui-li-has-count .ui-link-inherit .ui-li-count { margin-top: -.95em; } +.ui-li-has-arrow.ui-li-has-count .ui-li-count { right: 40px; } +.ui-li-has-alt.ui-li-has-count .ui-li-count { right: 53px; } +.ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; z-index: 2; } +.ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -13px 0 0 0; border-bottom-width: 1px; z-index: -1;} +.ui-li-link-alt .ui-btn-inner { padding: 0; height: 100%; position: absolute; width: 100%; top: 0; left: 0;} +.ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px; } +.ui-li-link-alt .ui-btn-icon-notext .ui-btn-inner .ui-icon { position: absolute; top: 50%; margin-top: -9px; } +.ui-listview * .ui-btn-inner > .ui-btn > .ui-btn-inner { border-top: 0px; } +.ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px; } +.ui-collapsible-content .ui-listview-filter { margin: -10px -15px 10px -15px; border-bottom: inherit; } +.ui-listview-filter-inset { margin: -15px -5px; background: transparent; } +.ui-collapsible-content .ui-listview-filter-inset { margin: -5px; border-bottom-width: 0; } +.ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; } +.ui-li.ui-screen-hidden{ display:none; } +/* Odd iPad positioning issue. */ +@media only screen and (min-device-width: 768px) and (max-device-width: 1024px) { + .ui-li .ui-btn-text { overflow: visible; } +} +label.ui-slider { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } +input.ui-slider-input, +.ui-field-contain input.ui-slider-input { display: inline-block; width: 50px; background-image: none; padding: .4em; margin: .5em 0; line-height: 1.4; font-size: 16px; outline: 0; } +input.ui-slider-input.ui-mini, +.ui-field-contain input.ui-slider-input.ui-mini { width: 45px; margin: .25em 0; font-size: 14px; } +.ui-field-contain input.ui-slider-input { margin: 0; } +input.ui-slider-input, .ui-field-contain input.ui-slider-input { -webkit-box-sizing: content-box; -moz-box-sizing: content-box; -ms-box-sizing: content-box; box-sizing: content-box; } +/* Fixes input fields being to small on Safari/Mac because of the up and down arrows. */ +.ui-slider-input::-webkit-outer-spin-button { margin: 0; } +select.ui-slider-switch { display: none; } +div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 65%; } +div.ui-slider-mini { height: 12px; margin-left: 10px; top: 2px; } +div.ui-slider-bg { border: none; height: 100%; padding-right: 8px; } +.ui-controlgroup a.ui-slider-handle, a.ui-btn.ui-slider-handle { position: absolute; z-index: 1; top: 50%; width: 28px; height: 28px; margin: -15px 0 0 -15px; outline: 0; } +a.ui-btn.ui-slider-handle .ui-btn-inner { padding: 0; height: 100%; } +div.ui-slider-mini a.ui-slider-handle { height: 14px; width: 14px; margin: -8px 0 0 -7px; } +div.ui-slider-mini a.ui-slider-handle .ui-btn-inner { height: 30px; width: 30px; padding: 0; margin: -9px 0 0 -9px; border-top: none; } +@media all and (min-width: 450px){ + .ui-field-contain label.ui-slider { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } + .ui-field-contain div.ui-slider { width: 43%; } + .ui-field-contain div.ui-slider-switch { width: 5.5em; } +} +div.ui-slider-switch { height: 32px; margin-left: 0; width: 5.8em; } +a.ui-slider-handle-snapping { -webkit-transition: left 70ms linear; -moz-transition: left 70ms linear; } +div.ui-slider-switch .ui-slider-handle { margin: 1px 0 0 -15px; } +.ui-slider-inneroffset { margin: 0 16px; position: relative; z-index: 1; } +div.ui-slider-switch.ui-slider-mini { width: 5em; height: 29px; } +div.ui-slider-switch.ui-slider-mini .ui-slider-inneroffset { margin: 0 15px 0 14px; } +div.ui-slider-switch.ui-slider-mini .ui-slider-handle { width: 25px; height: 25px; margin: 1px 0 0 -13px; } +div.ui-slider-switch.ui-slider-mini a.ui-slider-handle .ui-btn-inner { height: 30px; width: 30px; padding: 0; margin: 0; } +span.ui-slider-label { position: absolute; text-align: center; width: 100%; overflow: hidden; font-size: 16px; top: 0; line-height: 2; min-height: 100%; border-width: 0; white-space: nowrap; } +.ui-slider-mini span.ui-slider-label { font-size: 14px; } +span.ui-slider-label-a { z-index: 1; left: 0; text-indent: -1.5em; } +span.ui-slider-label-b { z-index: 0; right: 0; text-indent: 1.5em;} +.ui-slider-inline { width: 120px; display: inline-block; } diff --git a/public/css/mainstyle.css b/public/css/mainstyle.css new file mode 100644 index 0000000..5ba1c29 --- /dev/null +++ b/public/css/mainstyle.css @@ -0,0 +1,189 @@ +#main { + width: 300px; + margin:auto; + /*background: #ececec;*/ + padding: 20px; + border: 1px solid #ccc; +} + +#image-list { + list-style:none; + margin:0; + padding:0; +} +#image-list li { + /*background: #fff;*/ + border: 1px solid #ccc; + text-align:center; + padding:20px; + margin-bottom:19px; +} +#image-list li img { + width: 258px; + vertical-align: middle; + border:1px solid #474747; +} + + + + +button {width:50px;height:50px;} +div {text-align:center;} +#backBtn {width: 300px;} +#board{width:300px;height:300px; } + +.wood {width:100%;height:80%} + +#popupPanel-popup { + right: 0 !important; + left: auto !important; +} +#popupPanel { + width: 200px; + border: 1px solid #000; + border-right: none; + background: rgba(0,0,0,.5); + margin: -1px 0; +}; +#popupPanel .ui-btn { + margin: 2em 15px; +} + +#errMessage { + color: rgb(70,0,0); + height : 50px; + font-family: Helvetica, Arial, sans-serif; + font-weight: bold; + +} + +/*#pic {width:90%;height:50%}*/ +#center {background-color:red;width:90%;height:40;} +#reset{text-decoration:none} +#home{text-decoration:none} + +/* css for custom BlackBerry 10 icons */ +.ui-icon-ic_settings { + background-image : url("icons/ic_settings.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_search { + background-image : url("icons/ic_search.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_done { + background-image : url("icons/ic_done.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_edit { + background-image : url("icons/ic_edit.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_add { + background-image : url("icons/ic_add.png"); + background-size: 18px 18px; +} +.ui-icon-ic_cancel { + background-image : url("icons/ic_cancel.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_bbm { + background-image : url("icons/ic_bbm.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_delete { + background-image : url("icons/ic_delete.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_cut { + background-image : url("icons/ic_cut.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_email { + background-image : url("icons/ic_email.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_help { + background-image : url("icons/ic_help.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_info { + background-image : url("icons/ic_info.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_lock { + background-image : url("icons/ic_lock.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_map { + background-image : url("icons/ic_map.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_move { + background-image : url("icons/ic_move.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_nav_to { + background-image : url("icons/ic_nav_to.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_disable { + background-image : url("icons/ic_disable.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_next { + background-image : url("icons/ic_next.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_open { + background-image : url("icons/ic_open.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_open_link { + background-image : url("icons/ic_open_link.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_forward_as_text { + background-image : url("icons/ic_forward_as_text.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_overflow_action { + background-image : url("icons/ic_overflow_action.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_view_details { + background-image : url("icons/ic_view_details.png"); + background-size: 18px 18px; +} + +.ui-icon-ic_view_grid { + background-image : url("icons/ic_view_grid.png"); + background-size: 18px 18px; +} + + + + + + diff --git a/public/css/mobile-s.css b/public/css/mobile-s.css new file mode 100644 index 0000000..4adb177 --- /dev/null +++ b/public/css/mobile-s.css @@ -0,0 +1,909 @@ +/* +* jQuery Mobile Framework Git Build: SHA1: c2d61e2e592c67519d9a9ed0ba796fa44787e136 <> Date: Tue Sep 25 10:38:12 2012 -0700 +* http://jquerymobile.com +* +* Copyright 2012 jQuery Foundation and other contributors +* Released under the MIT license. +* http://jquery.org/license +* +*/ + + +/* Swatches */ + +/* A +-----------------------------------------------------------------------------------------------------------*/ + +.ui-bar-a { + border: 1px solid #b3b3b3 /*{a-bar-border}*/; + background: #eeeeee /*{a-bar-background-color}*/; + color: #3e3e3e /*{a-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{a-bar-shadow-x}*/ 1px /*{a-bar-shadow-y}*/ 1px /*{a-bar-shadow-radius}*/ #ffffff /*{a-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f0f0f0 /*{a-bar-background-start}*/), to( #dddddd /*{a-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f0f0f0 /*{a-bar-background-start}*/, #dddddd /*{a-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f0f0f0 /*{a-bar-background-start}*/, #dddddd /*{a-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f0f0f0 /*{a-bar-background-start}*/, #dddddd /*{a-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f0f0f0 /*{a-bar-background-start}*/, #dddddd /*{a-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f0f0f0 /*{a-bar-background-start}*/, #dddddd /*{a-bar-background-end}*/); +} +.ui-bar-a .ui-link-inherit { + color: #3e3e3e /*{a-bar-color}*/; +} + +.ui-bar-a a.ui-link { + color: #7cc4e7 /*{a-bar-link-color}*/; + font-weight: bold; +} + +.ui-bar-a a.ui-link:visited { + color: #2489ce /*{a-bar-link-visited}*/; +} + +.ui-bar-a a.ui-link:hover { + color: #2489ce /*{a-bar-link-hover}*/; +} + +.ui-bar-a a.ui-link:active { + color: #2489ce /*{a-bar-link-active}*/; +} + +.ui-bar-a, +.ui-bar-a input, +.ui-bar-a select, +.ui-bar-a textarea, +.ui-bar-a button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-a, +.ui-overlay-a { + border: 1px solid #aaaaaa /*{a-body-border}*/; + color: #333333 /*{a-body-color}*/; + text-shadow: 0 /*{a-body-shadow-x}*/ 1px /*{a-body-shadow-y}*/ 0 /*{a-body-shadow-radius}*/ #ffffff /*{a-body-shadow-color}*/; + background: #f9f9f9 /*{a-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f9f9f9 /*{a-body-background-start}*/), to( #eeeeee /*{a-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{a-body-background-start}*/, #eeeeee /*{a-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f9f9f9 /*{a-body-background-start}*/, #eeeeee /*{a-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f9f9f9 /*{a-body-background-start}*/, #eeeeee /*{a-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f9f9f9 /*{a-body-background-start}*/, #eeeeee /*{a-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f9f9f9 /*{a-body-background-start}*/, #eeeeee /*{a-body-background-end}*/); +} +.ui-overlay-a { + background-image: none; + border-width: 0; +} +.ui-body-a, +.ui-body-a input, +.ui-body-a select, +.ui-body-a textarea, +.ui-body-a button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-a .ui-link-inherit { + color: #333333 /*{a-body-color}*/; +} + +.ui-body-a .ui-link { + color: #2489ce /*{a-body-link-color}*/; + font-weight: bold; +} + +.ui-body-a .ui-link:visited { + color: #2489ce /*{a-body-link-visited}*/; +} + +.ui-body-a .ui-link:hover { + color: #2489ce /*{a-body-link-hover}*/; +} + +.ui-body-a .ui-link:active { + color: #2489ce /*{a-body-link-active}*/; +} + +.ui-btn-up-a { + border: 1px solid #cccccc /*{a-bup-border}*/; + background: #eeeeee /*{a-bup-background-color}*/; + font-weight: bold; + color: #222222 /*{a-bup-color}*/; + text-shadow: 0 /*{a-bup-shadow-x}*/ 1px /*{a-bup-shadow-y}*/ 0 /*{a-bup-shadow-radius}*/ #ffffff /*{a-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffffff /*{a-bup-background-start}*/), to( #f1f1f1 /*{a-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffffff /*{a-bup-background-start}*/, #f1f1f1 /*{a-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffffff /*{a-bup-background-start}*/, #f1f1f1 /*{a-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffffff /*{a-bup-background-start}*/, #f1f1f1 /*{a-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffffff /*{a-bup-background-start}*/, #f1f1f1 /*{a-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffffff /*{a-bup-background-start}*/, #f1f1f1 /*{a-bup-background-end}*/); +} +.ui-btn-up-a:visited, +.ui-btn-up-a a.ui-link-inherit { + color: #2f3e46 /*{a-bup-color}*/; +} +.ui-btn-hover-a { + border: 1px solid #bbbbbb /*{a-bhover-border}*/; + background: #dfdfdf /*{a-bhover-background-color}*/; + font-weight: bold; + color: #222222 /*{a-bhover-color}*/; + text-shadow: 0 /*{a-bhover-shadow-x}*/ 1px /*{a-bhover-shadow-y}*/ 0 /*{a-bhover-shadow-radius}*/ #ffffff /*{a-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f6f6f6 /*{a-bhover-background-start}*/), to( #e0e0e0 /*{a-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f6f6f6 /*{a-bhover-background-start}*/, #e0e0e0 /*{a-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f6f6f6 /*{a-bhover-background-start}*/, #e0e0e0 /*{a-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f6f6f6 /*{a-bhover-background-start}*/, #e0e0e0 /*{a-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f6f6f6 /*{a-bhover-background-start}*/, #e0e0e0 /*{a-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f6f6f6 /*{a-bhover-background-start}*/, #e0e0e0 /*{a-bhover-background-end}*/); +} +.ui-btn-hover-a:visited, +.ui-btn-hover-a:hover, +.ui-btn-hover-a a.ui-link-inherit { + color: #2f3e46 /*{a-bhover-color}*/; +} +.ui-btn-down-a { + border: 1px solid #bbbbbb /*{a-bdown-border}*/; + background: #d6d6d6 /*{a-bdown-background-color}*/; + font-weight: bold; + color: #222222 /*{a-bdown-color}*/; + text-shadow: 0 /*{a-bdown-shadow-x}*/ 1px /*{a-bdown-shadow-y}*/ 0 /*{a-bdown-shadow-radius}*/ #ffffff /*{a-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #d0d0d0 /*{a-bdown-background-start}*/), to( #dfdfdf /*{a-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #d0d0d0 /*{a-bdown-background-start}*/, #dfdfdf /*{a-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #d0d0d0 /*{a-bdown-background-start}*/, #dfdfdf /*{a-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #d0d0d0 /*{a-bdown-background-start}*/, #dfdfdf /*{a-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #d0d0d0 /*{a-bdown-background-start}*/, #dfdfdf /*{a-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #d0d0d0 /*{a-bdown-background-start}*/, #dfdfdf /*{a-bdown-background-end}*/); +} +.ui-btn-down-a:visited, +.ui-btn-down-a:hover, +.ui-btn-down-a a.ui-link-inherit { + color: #2f3e46 /*{a-bdown-color}*/; +} +.ui-btn-up-a, +.ui-btn-hover-a, +.ui-btn-down-a { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} + + +/* B +-----------------------------------------------------------------------------------------------------------*/ + +.ui-bar-b { + border: 1px solid #b3b3b3 /*{b-bar-border}*/; + background: #eeeeee /*{b-bar-background-color}*/; + color: #3e3e3e /*{b-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{b-bar-shadow-x}*/ 1px /*{b-bar-shadow-y}*/ 1px /*{b-bar-shadow-radius}*/ #ffffff /*{b-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f0f0f0 /*{b-bar-background-start}*/), to( #dddddd /*{b-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f0f0f0 /*{b-bar-background-start}*/, #dddddd /*{b-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f0f0f0 /*{b-bar-background-start}*/, #dddddd /*{b-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f0f0f0 /*{b-bar-background-start}*/, #dddddd /*{b-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f0f0f0 /*{b-bar-background-start}*/, #dddddd /*{b-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f0f0f0 /*{b-bar-background-start}*/, #dddddd /*{b-bar-background-end}*/); +} +.ui-bar-b .ui-link-inherit { + color: #3e3e3e /*{b-bar-color}*/; +} + +.ui-bar-b a.ui-link { + color: #7cc4e7 /*{b-bar-link-color}*/; + font-weight: bold; +} + +.ui-bar-b a.ui-link:visited { + color: #2489ce /*{b-bar-link-visited}*/; +} + +.ui-bar-b a.ui-link:hover { + color: #2489ce /*{b-bar-link-hover}*/; +} + +.ui-bar-b a.ui-link:active { + color: #2489ce /*{b-bar-link-active}*/; +} + +.ui-bar-b, +.ui-bar-b input, +.ui-bar-b select, +.ui-bar-b textarea, +.ui-bar-b button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-b, +.ui-overlay-b { + border: 1px solid #aaaaaa /*{b-body-border}*/; + color: #333333 /*{b-body-color}*/; + text-shadow: 0 /*{b-body-shadow-x}*/ 1px /*{b-body-shadow-y}*/ 0 /*{b-body-shadow-radius}*/ #ffffff /*{b-body-shadow-color}*/; + background: #f9f9f9 /*{b-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f9f9f9 /*{b-body-background-start}*/), to( #eeeeee /*{b-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{b-body-background-start}*/, #eeeeee /*{b-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f9f9f9 /*{b-body-background-start}*/, #eeeeee /*{b-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f9f9f9 /*{b-body-background-start}*/, #eeeeee /*{b-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f9f9f9 /*{b-body-background-start}*/, #eeeeee /*{b-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f9f9f9 /*{b-body-background-start}*/, #eeeeee /*{b-body-background-end}*/); +} +.ui-overlay-b { + background-image: none; + border-width: 0; +} +.ui-body-b, +.ui-body-b input, +.ui-body-b select, +.ui-body-b textarea, +.ui-body-b button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-b .ui-link-inherit { + color: #333333 /*{b-body-color}*/; +} + +.ui-body-b .ui-link { + color: #2489ce /*{b-body-link-color}*/; + font-weight: bold; +} + +.ui-body-b .ui-link:visited { + color: #2489ce /*{b-body-link-visited}*/; +} + +.ui-body-b .ui-link:hover { + color: #2489ce /*{b-body-link-hover}*/; +} + +.ui-body-b .ui-link:active { + color: #2489ce /*{b-body-link-active}*/; +} + +.ui-btn-up-b { + border: 1px solid #cccccc /*{b-bup-border}*/; + background: #eeeeee /*{b-bup-background-color}*/; + font-weight: bold; + color: #222222 /*{b-bup-color}*/; + text-shadow: 0 /*{b-bup-shadow-x}*/ 1px /*{b-bup-shadow-y}*/ 0 /*{b-bup-shadow-radius}*/ #ffffff /*{b-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffffff /*{b-bup-background-start}*/), to( #f1f1f1 /*{b-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffffff /*{b-bup-background-start}*/, #f1f1f1 /*{b-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffffff /*{b-bup-background-start}*/, #f1f1f1 /*{b-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffffff /*{b-bup-background-start}*/, #f1f1f1 /*{b-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffffff /*{b-bup-background-start}*/, #f1f1f1 /*{b-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffffff /*{b-bup-background-start}*/, #f1f1f1 /*{b-bup-background-end}*/); +} +.ui-btn-up-b:visited, +.ui-btn-up-b a.ui-link-inherit { + color: #2f3e46 /*{b-bup-color}*/; +} +.ui-btn-hover-b { + border: 1px solid #bbbbbb /*{b-bhover-border}*/; + background: #dfdfdf /*{b-bhover-background-color}*/; + font-weight: bold; + color: #222222 /*{b-bhover-color}*/; + text-shadow: 0 /*{b-bhover-shadow-x}*/ 1px /*{b-bhover-shadow-y}*/ 0 /*{b-bhover-shadow-radius}*/ #ffffff /*{b-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f6f6f6 /*{b-bhover-background-start}*/), to( #e0e0e0 /*{b-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f6f6f6 /*{b-bhover-background-start}*/, #e0e0e0 /*{b-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f6f6f6 /*{b-bhover-background-start}*/, #e0e0e0 /*{b-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f6f6f6 /*{b-bhover-background-start}*/, #e0e0e0 /*{b-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f6f6f6 /*{b-bhover-background-start}*/, #e0e0e0 /*{b-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f6f6f6 /*{b-bhover-background-start}*/, #e0e0e0 /*{b-bhover-background-end}*/); +} +.ui-btn-hover-b:visited, +.ui-btn-hover-b:hover, +.ui-btn-hover-b a.ui-link-inherit { + color: #2f3e46 /*{b-bhover-color}*/; +} +.ui-btn-down-b { + border: 1px solid #bbbbbb /*{b-bdown-border}*/; + background: #d6d6d6 /*{b-bdown-background-color}*/; + font-weight: bold; + color: #222222 /*{b-bdown-color}*/; + text-shadow: 0 /*{b-bdown-shadow-x}*/ 1px /*{b-bdown-shadow-y}*/ 0 /*{b-bdown-shadow-radius}*/ #ffffff /*{b-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #d0d0d0 /*{b-bdown-background-start}*/), to( #dfdfdf /*{b-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #d0d0d0 /*{b-bdown-background-start}*/, #dfdfdf /*{b-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #d0d0d0 /*{b-bdown-background-start}*/, #dfdfdf /*{b-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #d0d0d0 /*{b-bdown-background-start}*/, #dfdfdf /*{b-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #d0d0d0 /*{b-bdown-background-start}*/, #dfdfdf /*{b-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #d0d0d0 /*{b-bdown-background-start}*/, #dfdfdf /*{b-bdown-background-end}*/); +} +.ui-btn-down-b:visited, +.ui-btn-down-b:hover, +.ui-btn-down-b a.ui-link-inherit { + color: #2f3e46 /*{b-bdown-color}*/; +} +.ui-btn-up-b, +.ui-btn-hover-b, +.ui-btn-down-b { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} + + + + +/* C +-----------------------------------------------------------------------------------------------------------*/ + +.ui-bar-c { + border: 1px solid #b3b3b3 /*{c-bar-border}*/; + background: #eeeeee /*{c-bar-background-color}*/; + color: #3e3e3e /*{c-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{c-bar-shadow-x}*/ 1px /*{c-bar-shadow-y}*/ 1px /*{c-bar-shadow-radius}*/ #ffffff /*{c-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f0f0f0 /*{c-bar-background-start}*/), to( #dddddd /*{c-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #dddddd /*{c-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #dddddd /*{c-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #dddddd /*{c-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #dddddd /*{c-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #dddddd /*{c-bar-background-end}*/); +} +.ui-bar-c .ui-link-inherit { + color: #3e3e3e /*{c-bar-color}*/; +} + +.ui-bar-c a.ui-link { + color: #7cc4e7 /*{c-bar-link-color}*/; + font-weight: bold; +} + +.ui-bar-c a.ui-link:visited { + color: #2489ce /*{c-bar-link-visited}*/; +} + +.ui-bar-c a.ui-link:hover { + color: #2489ce /*{c-bar-link-hover}*/; +} + +.ui-bar-c a.ui-link:active { + color: #2489ce /*{c-bar-link-active}*/; +} + +.ui-bar-c, +.ui-bar-c input, +.ui-bar-c select, +.ui-bar-c textarea, +.ui-bar-c button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-c, +.ui-overlay-c { + border: 1px solid #aaaaaa /*{c-body-border}*/; + color: #333333 /*{c-body-color}*/; + text-shadow: 0 /*{c-body-shadow-x}*/ 1px /*{c-body-shadow-y}*/ 0 /*{c-body-shadow-radius}*/ #ffffff /*{c-body-shadow-color}*/; + background: #f9f9f9 /*{c-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f9f9f9 /*{c-body-background-start}*/), to( #eeeeee /*{c-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); +} +.ui-overlay-c { + background-image: none; + border-width: 0; +} +.ui-body-c, +.ui-body-c input, +.ui-body-c select, +.ui-body-c textarea, +.ui-body-c button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-c .ui-link-inherit { + color: #333333 /*{c-body-color}*/; +} + +.ui-body-c .ui-link { + color: #2489ce /*{c-body-link-color}*/; + font-weight: bold; +} + +.ui-body-c .ui-link:visited { + color: #2489ce /*{c-body-link-visited}*/; +} + +.ui-body-c .ui-link:hover { + color: #2489ce /*{c-body-link-hover}*/; +} + +.ui-body-c .ui-link:active { + color: #2489ce /*{c-body-link-active}*/; +} + +.ui-btn-up-c { + border: 1px solid #cccccc /*{c-bup-border}*/; + background: #eeeeee /*{c-bup-background-color}*/; + font-weight: bold; + color: #222222 /*{c-bup-color}*/; + text-shadow: 0 /*{c-bup-shadow-x}*/ 1px /*{c-bup-shadow-y}*/ 0 /*{c-bup-shadow-radius}*/ #ffffff /*{c-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffffff /*{c-bup-background-start}*/), to( #f1f1f1 /*{c-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); +} +.ui-btn-up-c:visited, +.ui-btn-up-c a.ui-link-inherit { + color: #2f3e46 /*{c-bup-color}*/; +} +.ui-btn-hover-c { + border: 1px solid #bbbbbb /*{c-bhover-border}*/; + background: #dfdfdf /*{c-bhover-background-color}*/; + font-weight: bold; + color: #222222 /*{c-bhover-color}*/; + text-shadow: 0 /*{c-bhover-shadow-x}*/ 1px /*{c-bhover-shadow-y}*/ 0 /*{c-bhover-shadow-radius}*/ #ffffff /*{c-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f6f6f6 /*{c-bhover-background-start}*/), to( #e0e0e0 /*{c-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); +} +.ui-btn-hover-c:visited, +.ui-btn-hover-c:hover, +.ui-btn-hover-c a.ui-link-inherit { + color: #2f3e46 /*{c-bhover-color}*/; +} +.ui-btn-down-c { + border: 1px solid #bbbbbb /*{c-bdown-border}*/; + background: #d6d6d6 /*{c-bdown-background-color}*/; + font-weight: bold; + color: #222222 /*{c-bdown-color}*/; + text-shadow: 0 /*{c-bdown-shadow-x}*/ 1px /*{c-bdown-shadow-y}*/ 0 /*{c-bdown-shadow-radius}*/ #ffffff /*{c-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #d0d0d0 /*{c-bdown-background-start}*/), to( #dfdfdf /*{c-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); +} +.ui-btn-down-c:visited, +.ui-btn-down-c:hover, +.ui-btn-down-c a.ui-link-inherit { + color: #2f3e46 /*{c-bdown-color}*/; +} +.ui-btn-up-c, +.ui-btn-hover-c, +.ui-btn-down-c { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} + + + + +/* Structure */ + +/* links within "buttons" +-----------------------------------------------------------------------------------------------------------*/ + +a.ui-link-inherit { + text-decoration: none !important; +} + + +/* Active class used as the "on" state across all themes +-----------------------------------------------------------------------------------------------------------*/ +.ui-btn-active { + border: 1px solid #2373a5 /*{global-active-border}*/; + background: #5393c5 /*{global-active-background-color}*/; + font-weight: bold; + color: #ffffff /*{global-active-color}*/; + cursor: pointer; + text-shadow: 0 /*{global-active-shadow-x}*/ 1px /*{global-active-shadow-y}*/ 1px /*{global-active-shadow-radius}*/ #3373a5 /*{global-active-shadow-color}*/; + text-decoration: none; + background-image: -webkit-gradient(linear, left top, left bottom, from( #5393c5 /*{global-active-background-start}*/), to( #6facd5 /*{global-active-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-btn-active:visited, +.ui-btn-active:hover, +.ui-btn-active a.ui-link-inherit { + color: #ffffff /*{global-active-color}*/; +} + + +/* button inner top highlight +-----------------------------------------------------------------------------------------------------------*/ + +.ui-btn-inner { + border-top: 1px solid #fff; + border-color: rgba(255,255,255,.3); +} + + +/* corner rounding classes +-----------------------------------------------------------------------------------------------------------*/ + +.ui-corner-tl { + -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; + -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; + border-top-left-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-tr { + -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; + -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; + border-top-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-bl { + -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + border-bottom-left-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-br { + -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + border-bottom-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-top { + -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; + -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; + border-top-left-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; + -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; + border-top-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-bottom { + -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + } +.ui-corner-right { + -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; + -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; + border-top-right-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + border-bottom-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-left { + -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; + -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; + border-top-left-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + border-bottom-left-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-all { + -moz-border-radius: .6em /*{global-radii-blocks}*/; + -webkit-border-radius: .6em /*{global-radii-blocks}*/; + border-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-none { + -moz-border-radius: 0; + -webkit-border-radius: 0; + border-radius: 0; +} + +/* Form field separator +-----------------------------------------------------------------------------------------------------------*/ +.ui-br { + border-bottom: rgb(130,130,130); + border-bottom: rgba(130,130,130,.3); + border-bottom-width: 1px; + border-bottom-style: solid; +} + +/* Interaction cues +-----------------------------------------------------------------------------------------------------------*/ +.ui-disabled { + filter: Alpha(Opacity=30); + opacity: .3; + zoom: 1; +} +.ui-disabled, +.ui-disabled a { + cursor: default !important; + pointer-events: none; +} + +/* Icons +-----------------------------------------------------------------------------------------------------------*/ + +.ui-icon, +.ui-icon-searchfield:after { + background: #666666 /*{global-icon-color}*/; + background: rgba(0,0,0,.4) /*{global-icon-disc}*/; + background-image: url(images/icons-18-white.png) /*{global-icon-set}*/; + background-repeat: no-repeat; + -moz-border-radius: 9px; + -webkit-border-radius: 9px; + border-radius: 9px; +} + + +/* Alt icon color +-----------------------------------------------------------------------------------------------------------*/ + +.ui-icon-alt { + background: #fff; + background: rgba(255,255,255,.3); + background-image: url(images/icons-18-black.png); + background-repeat: no-repeat; +} + +/* HD/"retina" sprite +-----------------------------------------------------------------------------------------------------------*/ + +@media only screen and (-webkit-min-device-pixel-ratio: 1.5), + only screen and (min--moz-device-pixel-ratio: 1.5), + only screen and (min-resolution: 240dpi) { + + .ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r, + .ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check, + .ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back, + .ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search, .ui-icon-searchfield:after, + .ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on { + background-image: url(images/icons-36-white.png); + -moz-background-size: 776px 18px; + -o-background-size: 776px 18px; + -webkit-background-size: 776px 18px; + background-size: 776px 18px; + } + .ui-icon-alt { + background-image: url(images/icons-36-black.png); + } +} + +/* plus minus */ +.ui-icon-plus { + background-position: -0 50%; +} +.ui-icon-minus { + background-position: -36px 50%; +} + +/* delete/close */ +.ui-icon-delete { + background-position: -72px 50%; +} + +/* arrows */ +.ui-icon-arrow-r { + background-position: -108px 50%; +} +.ui-icon-arrow-l { + background-position: -144px 50%; +} +.ui-icon-arrow-u { + background-position: -180px 50%; +} +.ui-icon-arrow-d { + background-position: -216px 50%; +} + +/* misc */ +.ui-icon-check { + background-position: -252px 50%; +} +.ui-icon-gear { + background-position: -288px 50%; +} +.ui-icon-refresh { + background-position: -324px 50%; +} +.ui-icon-forward { + background-position: -360px 50%; +} +.ui-icon-back { + background-position: -396px 50%; +} +.ui-icon-grid { + background-position: -432px 50%; +} +.ui-icon-star { + background-position: -468px 50%; +} +.ui-icon-alert { + background-position: -504px 50%; +} +.ui-icon-info { + background-position: -540px 50%; +} +.ui-icon-home { + background-position: -576px 50%; +} +.ui-icon-search, +.ui-icon-searchfield:after { + background-position: -612px 50%; +} +.ui-icon-checkbox-off { + background-position: -684px 50%; +} +.ui-icon-checkbox-on { + background-position: -648px 50%; +} +.ui-icon-radio-off { + background-position: -756px 50%; +} +.ui-icon-radio-on { + background-position: -720px 50%; +} + + +/* checks,radios */ +.ui-checkbox .ui-icon, +.ui-selectmenu-list .ui-icon { + -moz-border-radius: 3px; + -webkit-border-radius: 3px; + border-radius: 3px; +} +.ui-icon-checkbox-off, +.ui-icon-radio-off { + background-color: transparent; +} +.ui-checkbox-on .ui-icon, +.ui-radio-on .ui-icon { + background-color: #4596ce /*{global-active-background-color}*/; /* NOTE: this hex should match the active state color. It's repeated here for cascade */ +} + +/* loading icon */ +.ui-icon-loading { + background: url(images/ajax-loader.gif); + background-size: 46px 46px; +} + + +/* Button corner classes +-----------------------------------------------------------------------------------------------------------*/ + +.ui-btn-corner-tl { + -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; + -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; + border-top-left-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-tr { + -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; + -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; + border-top-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-bl { + -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + border-bottom-left-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-br { + -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; + border-bottom-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-top { + -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; + -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; + border-top-left-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; + -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; + border-top-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-bottom { + -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; + border-bottom-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-right { + -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; + -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; + border-top-right-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; + border-bottom-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-left { + -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; + -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; + border-top-left-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + border-bottom-left-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-all { + -moz-border-radius: 1em /*{global-radii-buttons}*/; + -webkit-border-radius: 1em /*{global-radii-buttons}*/; + border-radius: 1em /*{global-radii-buttons}*/; +} + +/* radius clip workaround for cleaning up corner trapping */ +.ui-corner-tl, +.ui-corner-tr, +.ui-corner-bl, +.ui-corner-br, +.ui-corner-top, +.ui-corner-bottom, +.ui-corner-right, +.ui-corner-left, +.ui-corner-all, +.ui-btn-corner-tl, +.ui-btn-corner-tr, +.ui-btn-corner-bl, +.ui-btn-corner-br, +.ui-btn-corner-top, +.ui-btn-corner-bottom, +.ui-btn-corner-right, +.ui-btn-corner-left, +.ui-btn-corner-all { + -webkit-background-clip: padding-box; + -moz-background-clip: padding; + background-clip: padding-box; +} + +/* Overlay / modal +-----------------------------------------------------------------------------------------------------------*/ + +.ui-overlay { + background: #666; + filter: Alpha(Opacity=50); + opacity: .5; + position: absolute; + width: 100%; + height: 100%; +} +.ui-overlay-shadow { + -moz-box-shadow: 0px 0px 12px rgba(0,0,0,.6); + -webkit-box-shadow: 0px 0px 12px rgba(0,0,0,.6); + box-shadow: 0px 0px 12px rgba(0,0,0,.6); +} +.ui-shadow { + -moz-box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; + -webkit-box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; + box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; +} +.ui-bar-a .ui-shadow, +.ui-bar-b .ui-shadow , +.ui-bar-c .ui-shadow { + -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.3); + -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.3); + box-shadow: 0px 1px 0 rgba(255,255,255,.3); +} +.ui-shadow-inset { + -moz-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); + -webkit-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); + box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); +} +.ui-icon-shadow { + -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; + -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; + box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; +} + +/* Focus state - set here for specificity (note: these classes are added by JavaScript) +-----------------------------------------------------------------------------------------------------------*/ + +.ui-btn:focus, .ui-link-inherit:focus { + outline: 0; +} +.ui-btn.ui-focus { + z-index: 1; +} +.ui-focus, +.ui-btn:focus { + -moz-box-shadow: inset 0px 0px 3px #387bbe /*{global-active-background-color}*/, 0px 0px 9px #387bbe /*{global-active-background-color}*/; + -webkit-box-shadow: inset 0px 0px 3px #387bbe /*{global-active-background-color}*/, 0px 0px 9px #387bbe /*{global-active-background-color}*/; + box-shadow: inset 0px 0px 3px #387bbe /*{global-active-background-color}*/, 0px 0px 9px #387bbe /*{global-active-background-color}*/; +} +.ui-input-text.ui-focus, +.ui-input-search.ui-focus { + -moz-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; + -webkit-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; + box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; +} + +/* unset box shadow in browsers that don't do it right +-----------------------------------------------------------------------------------------------------------*/ + +.ui-mobile-nosupport-boxshadow * { + -moz-box-shadow: none !important; + -webkit-box-shadow: none !important; + box-shadow: none !important; +} + +/* ...and bring back focus */ +.ui-mobile-nosupport-boxshadow .ui-focus, +.ui-mobile-nosupport-boxshadow .ui-btn:focus, +.ui-mobile-nosupport-boxshadow .ui-link-inherit:focus { + outline-width: 1px; + outline-style: auto; +} + \ No newline at end of file diff --git a/public/css/themes/mobile-super-white.css b/public/css/themes/mobile-super-white.css new file mode 100644 index 0000000..4adb177 --- /dev/null +++ b/public/css/themes/mobile-super-white.css @@ -0,0 +1,909 @@ +/* +* jQuery Mobile Framework Git Build: SHA1: c2d61e2e592c67519d9a9ed0ba796fa44787e136 <> Date: Tue Sep 25 10:38:12 2012 -0700 +* http://jquerymobile.com +* +* Copyright 2012 jQuery Foundation and other contributors +* Released under the MIT license. +* http://jquery.org/license +* +*/ + + +/* Swatches */ + +/* A +-----------------------------------------------------------------------------------------------------------*/ + +.ui-bar-a { + border: 1px solid #b3b3b3 /*{a-bar-border}*/; + background: #eeeeee /*{a-bar-background-color}*/; + color: #3e3e3e /*{a-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{a-bar-shadow-x}*/ 1px /*{a-bar-shadow-y}*/ 1px /*{a-bar-shadow-radius}*/ #ffffff /*{a-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f0f0f0 /*{a-bar-background-start}*/), to( #dddddd /*{a-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f0f0f0 /*{a-bar-background-start}*/, #dddddd /*{a-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f0f0f0 /*{a-bar-background-start}*/, #dddddd /*{a-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f0f0f0 /*{a-bar-background-start}*/, #dddddd /*{a-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f0f0f0 /*{a-bar-background-start}*/, #dddddd /*{a-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f0f0f0 /*{a-bar-background-start}*/, #dddddd /*{a-bar-background-end}*/); +} +.ui-bar-a .ui-link-inherit { + color: #3e3e3e /*{a-bar-color}*/; +} + +.ui-bar-a a.ui-link { + color: #7cc4e7 /*{a-bar-link-color}*/; + font-weight: bold; +} + +.ui-bar-a a.ui-link:visited { + color: #2489ce /*{a-bar-link-visited}*/; +} + +.ui-bar-a a.ui-link:hover { + color: #2489ce /*{a-bar-link-hover}*/; +} + +.ui-bar-a a.ui-link:active { + color: #2489ce /*{a-bar-link-active}*/; +} + +.ui-bar-a, +.ui-bar-a input, +.ui-bar-a select, +.ui-bar-a textarea, +.ui-bar-a button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-a, +.ui-overlay-a { + border: 1px solid #aaaaaa /*{a-body-border}*/; + color: #333333 /*{a-body-color}*/; + text-shadow: 0 /*{a-body-shadow-x}*/ 1px /*{a-body-shadow-y}*/ 0 /*{a-body-shadow-radius}*/ #ffffff /*{a-body-shadow-color}*/; + background: #f9f9f9 /*{a-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f9f9f9 /*{a-body-background-start}*/), to( #eeeeee /*{a-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{a-body-background-start}*/, #eeeeee /*{a-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f9f9f9 /*{a-body-background-start}*/, #eeeeee /*{a-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f9f9f9 /*{a-body-background-start}*/, #eeeeee /*{a-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f9f9f9 /*{a-body-background-start}*/, #eeeeee /*{a-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f9f9f9 /*{a-body-background-start}*/, #eeeeee /*{a-body-background-end}*/); +} +.ui-overlay-a { + background-image: none; + border-width: 0; +} +.ui-body-a, +.ui-body-a input, +.ui-body-a select, +.ui-body-a textarea, +.ui-body-a button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-a .ui-link-inherit { + color: #333333 /*{a-body-color}*/; +} + +.ui-body-a .ui-link { + color: #2489ce /*{a-body-link-color}*/; + font-weight: bold; +} + +.ui-body-a .ui-link:visited { + color: #2489ce /*{a-body-link-visited}*/; +} + +.ui-body-a .ui-link:hover { + color: #2489ce /*{a-body-link-hover}*/; +} + +.ui-body-a .ui-link:active { + color: #2489ce /*{a-body-link-active}*/; +} + +.ui-btn-up-a { + border: 1px solid #cccccc /*{a-bup-border}*/; + background: #eeeeee /*{a-bup-background-color}*/; + font-weight: bold; + color: #222222 /*{a-bup-color}*/; + text-shadow: 0 /*{a-bup-shadow-x}*/ 1px /*{a-bup-shadow-y}*/ 0 /*{a-bup-shadow-radius}*/ #ffffff /*{a-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffffff /*{a-bup-background-start}*/), to( #f1f1f1 /*{a-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffffff /*{a-bup-background-start}*/, #f1f1f1 /*{a-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffffff /*{a-bup-background-start}*/, #f1f1f1 /*{a-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffffff /*{a-bup-background-start}*/, #f1f1f1 /*{a-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffffff /*{a-bup-background-start}*/, #f1f1f1 /*{a-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffffff /*{a-bup-background-start}*/, #f1f1f1 /*{a-bup-background-end}*/); +} +.ui-btn-up-a:visited, +.ui-btn-up-a a.ui-link-inherit { + color: #2f3e46 /*{a-bup-color}*/; +} +.ui-btn-hover-a { + border: 1px solid #bbbbbb /*{a-bhover-border}*/; + background: #dfdfdf /*{a-bhover-background-color}*/; + font-weight: bold; + color: #222222 /*{a-bhover-color}*/; + text-shadow: 0 /*{a-bhover-shadow-x}*/ 1px /*{a-bhover-shadow-y}*/ 0 /*{a-bhover-shadow-radius}*/ #ffffff /*{a-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f6f6f6 /*{a-bhover-background-start}*/), to( #e0e0e0 /*{a-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f6f6f6 /*{a-bhover-background-start}*/, #e0e0e0 /*{a-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f6f6f6 /*{a-bhover-background-start}*/, #e0e0e0 /*{a-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f6f6f6 /*{a-bhover-background-start}*/, #e0e0e0 /*{a-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f6f6f6 /*{a-bhover-background-start}*/, #e0e0e0 /*{a-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f6f6f6 /*{a-bhover-background-start}*/, #e0e0e0 /*{a-bhover-background-end}*/); +} +.ui-btn-hover-a:visited, +.ui-btn-hover-a:hover, +.ui-btn-hover-a a.ui-link-inherit { + color: #2f3e46 /*{a-bhover-color}*/; +} +.ui-btn-down-a { + border: 1px solid #bbbbbb /*{a-bdown-border}*/; + background: #d6d6d6 /*{a-bdown-background-color}*/; + font-weight: bold; + color: #222222 /*{a-bdown-color}*/; + text-shadow: 0 /*{a-bdown-shadow-x}*/ 1px /*{a-bdown-shadow-y}*/ 0 /*{a-bdown-shadow-radius}*/ #ffffff /*{a-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #d0d0d0 /*{a-bdown-background-start}*/), to( #dfdfdf /*{a-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #d0d0d0 /*{a-bdown-background-start}*/, #dfdfdf /*{a-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #d0d0d0 /*{a-bdown-background-start}*/, #dfdfdf /*{a-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #d0d0d0 /*{a-bdown-background-start}*/, #dfdfdf /*{a-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #d0d0d0 /*{a-bdown-background-start}*/, #dfdfdf /*{a-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #d0d0d0 /*{a-bdown-background-start}*/, #dfdfdf /*{a-bdown-background-end}*/); +} +.ui-btn-down-a:visited, +.ui-btn-down-a:hover, +.ui-btn-down-a a.ui-link-inherit { + color: #2f3e46 /*{a-bdown-color}*/; +} +.ui-btn-up-a, +.ui-btn-hover-a, +.ui-btn-down-a { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} + + +/* B +-----------------------------------------------------------------------------------------------------------*/ + +.ui-bar-b { + border: 1px solid #b3b3b3 /*{b-bar-border}*/; + background: #eeeeee /*{b-bar-background-color}*/; + color: #3e3e3e /*{b-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{b-bar-shadow-x}*/ 1px /*{b-bar-shadow-y}*/ 1px /*{b-bar-shadow-radius}*/ #ffffff /*{b-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f0f0f0 /*{b-bar-background-start}*/), to( #dddddd /*{b-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f0f0f0 /*{b-bar-background-start}*/, #dddddd /*{b-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f0f0f0 /*{b-bar-background-start}*/, #dddddd /*{b-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f0f0f0 /*{b-bar-background-start}*/, #dddddd /*{b-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f0f0f0 /*{b-bar-background-start}*/, #dddddd /*{b-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f0f0f0 /*{b-bar-background-start}*/, #dddddd /*{b-bar-background-end}*/); +} +.ui-bar-b .ui-link-inherit { + color: #3e3e3e /*{b-bar-color}*/; +} + +.ui-bar-b a.ui-link { + color: #7cc4e7 /*{b-bar-link-color}*/; + font-weight: bold; +} + +.ui-bar-b a.ui-link:visited { + color: #2489ce /*{b-bar-link-visited}*/; +} + +.ui-bar-b a.ui-link:hover { + color: #2489ce /*{b-bar-link-hover}*/; +} + +.ui-bar-b a.ui-link:active { + color: #2489ce /*{b-bar-link-active}*/; +} + +.ui-bar-b, +.ui-bar-b input, +.ui-bar-b select, +.ui-bar-b textarea, +.ui-bar-b button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-b, +.ui-overlay-b { + border: 1px solid #aaaaaa /*{b-body-border}*/; + color: #333333 /*{b-body-color}*/; + text-shadow: 0 /*{b-body-shadow-x}*/ 1px /*{b-body-shadow-y}*/ 0 /*{b-body-shadow-radius}*/ #ffffff /*{b-body-shadow-color}*/; + background: #f9f9f9 /*{b-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f9f9f9 /*{b-body-background-start}*/), to( #eeeeee /*{b-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{b-body-background-start}*/, #eeeeee /*{b-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f9f9f9 /*{b-body-background-start}*/, #eeeeee /*{b-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f9f9f9 /*{b-body-background-start}*/, #eeeeee /*{b-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f9f9f9 /*{b-body-background-start}*/, #eeeeee /*{b-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f9f9f9 /*{b-body-background-start}*/, #eeeeee /*{b-body-background-end}*/); +} +.ui-overlay-b { + background-image: none; + border-width: 0; +} +.ui-body-b, +.ui-body-b input, +.ui-body-b select, +.ui-body-b textarea, +.ui-body-b button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-b .ui-link-inherit { + color: #333333 /*{b-body-color}*/; +} + +.ui-body-b .ui-link { + color: #2489ce /*{b-body-link-color}*/; + font-weight: bold; +} + +.ui-body-b .ui-link:visited { + color: #2489ce /*{b-body-link-visited}*/; +} + +.ui-body-b .ui-link:hover { + color: #2489ce /*{b-body-link-hover}*/; +} + +.ui-body-b .ui-link:active { + color: #2489ce /*{b-body-link-active}*/; +} + +.ui-btn-up-b { + border: 1px solid #cccccc /*{b-bup-border}*/; + background: #eeeeee /*{b-bup-background-color}*/; + font-weight: bold; + color: #222222 /*{b-bup-color}*/; + text-shadow: 0 /*{b-bup-shadow-x}*/ 1px /*{b-bup-shadow-y}*/ 0 /*{b-bup-shadow-radius}*/ #ffffff /*{b-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffffff /*{b-bup-background-start}*/), to( #f1f1f1 /*{b-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffffff /*{b-bup-background-start}*/, #f1f1f1 /*{b-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffffff /*{b-bup-background-start}*/, #f1f1f1 /*{b-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffffff /*{b-bup-background-start}*/, #f1f1f1 /*{b-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffffff /*{b-bup-background-start}*/, #f1f1f1 /*{b-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffffff /*{b-bup-background-start}*/, #f1f1f1 /*{b-bup-background-end}*/); +} +.ui-btn-up-b:visited, +.ui-btn-up-b a.ui-link-inherit { + color: #2f3e46 /*{b-bup-color}*/; +} +.ui-btn-hover-b { + border: 1px solid #bbbbbb /*{b-bhover-border}*/; + background: #dfdfdf /*{b-bhover-background-color}*/; + font-weight: bold; + color: #222222 /*{b-bhover-color}*/; + text-shadow: 0 /*{b-bhover-shadow-x}*/ 1px /*{b-bhover-shadow-y}*/ 0 /*{b-bhover-shadow-radius}*/ #ffffff /*{b-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f6f6f6 /*{b-bhover-background-start}*/), to( #e0e0e0 /*{b-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f6f6f6 /*{b-bhover-background-start}*/, #e0e0e0 /*{b-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f6f6f6 /*{b-bhover-background-start}*/, #e0e0e0 /*{b-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f6f6f6 /*{b-bhover-background-start}*/, #e0e0e0 /*{b-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f6f6f6 /*{b-bhover-background-start}*/, #e0e0e0 /*{b-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f6f6f6 /*{b-bhover-background-start}*/, #e0e0e0 /*{b-bhover-background-end}*/); +} +.ui-btn-hover-b:visited, +.ui-btn-hover-b:hover, +.ui-btn-hover-b a.ui-link-inherit { + color: #2f3e46 /*{b-bhover-color}*/; +} +.ui-btn-down-b { + border: 1px solid #bbbbbb /*{b-bdown-border}*/; + background: #d6d6d6 /*{b-bdown-background-color}*/; + font-weight: bold; + color: #222222 /*{b-bdown-color}*/; + text-shadow: 0 /*{b-bdown-shadow-x}*/ 1px /*{b-bdown-shadow-y}*/ 0 /*{b-bdown-shadow-radius}*/ #ffffff /*{b-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #d0d0d0 /*{b-bdown-background-start}*/), to( #dfdfdf /*{b-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #d0d0d0 /*{b-bdown-background-start}*/, #dfdfdf /*{b-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #d0d0d0 /*{b-bdown-background-start}*/, #dfdfdf /*{b-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #d0d0d0 /*{b-bdown-background-start}*/, #dfdfdf /*{b-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #d0d0d0 /*{b-bdown-background-start}*/, #dfdfdf /*{b-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #d0d0d0 /*{b-bdown-background-start}*/, #dfdfdf /*{b-bdown-background-end}*/); +} +.ui-btn-down-b:visited, +.ui-btn-down-b:hover, +.ui-btn-down-b a.ui-link-inherit { + color: #2f3e46 /*{b-bdown-color}*/; +} +.ui-btn-up-b, +.ui-btn-hover-b, +.ui-btn-down-b { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} + + + + +/* C +-----------------------------------------------------------------------------------------------------------*/ + +.ui-bar-c { + border: 1px solid #b3b3b3 /*{c-bar-border}*/; + background: #eeeeee /*{c-bar-background-color}*/; + color: #3e3e3e /*{c-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{c-bar-shadow-x}*/ 1px /*{c-bar-shadow-y}*/ 1px /*{c-bar-shadow-radius}*/ #ffffff /*{c-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f0f0f0 /*{c-bar-background-start}*/), to( #dddddd /*{c-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #dddddd /*{c-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #dddddd /*{c-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #dddddd /*{c-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #dddddd /*{c-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #dddddd /*{c-bar-background-end}*/); +} +.ui-bar-c .ui-link-inherit { + color: #3e3e3e /*{c-bar-color}*/; +} + +.ui-bar-c a.ui-link { + color: #7cc4e7 /*{c-bar-link-color}*/; + font-weight: bold; +} + +.ui-bar-c a.ui-link:visited { + color: #2489ce /*{c-bar-link-visited}*/; +} + +.ui-bar-c a.ui-link:hover { + color: #2489ce /*{c-bar-link-hover}*/; +} + +.ui-bar-c a.ui-link:active { + color: #2489ce /*{c-bar-link-active}*/; +} + +.ui-bar-c, +.ui-bar-c input, +.ui-bar-c select, +.ui-bar-c textarea, +.ui-bar-c button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-c, +.ui-overlay-c { + border: 1px solid #aaaaaa /*{c-body-border}*/; + color: #333333 /*{c-body-color}*/; + text-shadow: 0 /*{c-body-shadow-x}*/ 1px /*{c-body-shadow-y}*/ 0 /*{c-body-shadow-radius}*/ #ffffff /*{c-body-shadow-color}*/; + background: #f9f9f9 /*{c-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f9f9f9 /*{c-body-background-start}*/), to( #eeeeee /*{c-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); +} +.ui-overlay-c { + background-image: none; + border-width: 0; +} +.ui-body-c, +.ui-body-c input, +.ui-body-c select, +.ui-body-c textarea, +.ui-body-c button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-c .ui-link-inherit { + color: #333333 /*{c-body-color}*/; +} + +.ui-body-c .ui-link { + color: #2489ce /*{c-body-link-color}*/; + font-weight: bold; +} + +.ui-body-c .ui-link:visited { + color: #2489ce /*{c-body-link-visited}*/; +} + +.ui-body-c .ui-link:hover { + color: #2489ce /*{c-body-link-hover}*/; +} + +.ui-body-c .ui-link:active { + color: #2489ce /*{c-body-link-active}*/; +} + +.ui-btn-up-c { + border: 1px solid #cccccc /*{c-bup-border}*/; + background: #eeeeee /*{c-bup-background-color}*/; + font-weight: bold; + color: #222222 /*{c-bup-color}*/; + text-shadow: 0 /*{c-bup-shadow-x}*/ 1px /*{c-bup-shadow-y}*/ 0 /*{c-bup-shadow-radius}*/ #ffffff /*{c-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffffff /*{c-bup-background-start}*/), to( #f1f1f1 /*{c-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); +} +.ui-btn-up-c:visited, +.ui-btn-up-c a.ui-link-inherit { + color: #2f3e46 /*{c-bup-color}*/; +} +.ui-btn-hover-c { + border: 1px solid #bbbbbb /*{c-bhover-border}*/; + background: #dfdfdf /*{c-bhover-background-color}*/; + font-weight: bold; + color: #222222 /*{c-bhover-color}*/; + text-shadow: 0 /*{c-bhover-shadow-x}*/ 1px /*{c-bhover-shadow-y}*/ 0 /*{c-bhover-shadow-radius}*/ #ffffff /*{c-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f6f6f6 /*{c-bhover-background-start}*/), to( #e0e0e0 /*{c-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); +} +.ui-btn-hover-c:visited, +.ui-btn-hover-c:hover, +.ui-btn-hover-c a.ui-link-inherit { + color: #2f3e46 /*{c-bhover-color}*/; +} +.ui-btn-down-c { + border: 1px solid #bbbbbb /*{c-bdown-border}*/; + background: #d6d6d6 /*{c-bdown-background-color}*/; + font-weight: bold; + color: #222222 /*{c-bdown-color}*/; + text-shadow: 0 /*{c-bdown-shadow-x}*/ 1px /*{c-bdown-shadow-y}*/ 0 /*{c-bdown-shadow-radius}*/ #ffffff /*{c-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #d0d0d0 /*{c-bdown-background-start}*/), to( #dfdfdf /*{c-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); +} +.ui-btn-down-c:visited, +.ui-btn-down-c:hover, +.ui-btn-down-c a.ui-link-inherit { + color: #2f3e46 /*{c-bdown-color}*/; +} +.ui-btn-up-c, +.ui-btn-hover-c, +.ui-btn-down-c { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} + + + + +/* Structure */ + +/* links within "buttons" +-----------------------------------------------------------------------------------------------------------*/ + +a.ui-link-inherit { + text-decoration: none !important; +} + + +/* Active class used as the "on" state across all themes +-----------------------------------------------------------------------------------------------------------*/ +.ui-btn-active { + border: 1px solid #2373a5 /*{global-active-border}*/; + background: #5393c5 /*{global-active-background-color}*/; + font-weight: bold; + color: #ffffff /*{global-active-color}*/; + cursor: pointer; + text-shadow: 0 /*{global-active-shadow-x}*/ 1px /*{global-active-shadow-y}*/ 1px /*{global-active-shadow-radius}*/ #3373a5 /*{global-active-shadow-color}*/; + text-decoration: none; + background-image: -webkit-gradient(linear, left top, left bottom, from( #5393c5 /*{global-active-background-start}*/), to( #6facd5 /*{global-active-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-btn-active:visited, +.ui-btn-active:hover, +.ui-btn-active a.ui-link-inherit { + color: #ffffff /*{global-active-color}*/; +} + + +/* button inner top highlight +-----------------------------------------------------------------------------------------------------------*/ + +.ui-btn-inner { + border-top: 1px solid #fff; + border-color: rgba(255,255,255,.3); +} + + +/* corner rounding classes +-----------------------------------------------------------------------------------------------------------*/ + +.ui-corner-tl { + -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; + -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; + border-top-left-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-tr { + -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; + -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; + border-top-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-bl { + -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + border-bottom-left-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-br { + -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + border-bottom-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-top { + -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; + -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; + border-top-left-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; + -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; + border-top-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-bottom { + -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + } +.ui-corner-right { + -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; + -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; + border-top-right-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + border-bottom-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-left { + -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; + -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; + border-top-left-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + border-bottom-left-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-all { + -moz-border-radius: .6em /*{global-radii-blocks}*/; + -webkit-border-radius: .6em /*{global-radii-blocks}*/; + border-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-none { + -moz-border-radius: 0; + -webkit-border-radius: 0; + border-radius: 0; +} + +/* Form field separator +-----------------------------------------------------------------------------------------------------------*/ +.ui-br { + border-bottom: rgb(130,130,130); + border-bottom: rgba(130,130,130,.3); + border-bottom-width: 1px; + border-bottom-style: solid; +} + +/* Interaction cues +-----------------------------------------------------------------------------------------------------------*/ +.ui-disabled { + filter: Alpha(Opacity=30); + opacity: .3; + zoom: 1; +} +.ui-disabled, +.ui-disabled a { + cursor: default !important; + pointer-events: none; +} + +/* Icons +-----------------------------------------------------------------------------------------------------------*/ + +.ui-icon, +.ui-icon-searchfield:after { + background: #666666 /*{global-icon-color}*/; + background: rgba(0,0,0,.4) /*{global-icon-disc}*/; + background-image: url(images/icons-18-white.png) /*{global-icon-set}*/; + background-repeat: no-repeat; + -moz-border-radius: 9px; + -webkit-border-radius: 9px; + border-radius: 9px; +} + + +/* Alt icon color +-----------------------------------------------------------------------------------------------------------*/ + +.ui-icon-alt { + background: #fff; + background: rgba(255,255,255,.3); + background-image: url(images/icons-18-black.png); + background-repeat: no-repeat; +} + +/* HD/"retina" sprite +-----------------------------------------------------------------------------------------------------------*/ + +@media only screen and (-webkit-min-device-pixel-ratio: 1.5), + only screen and (min--moz-device-pixel-ratio: 1.5), + only screen and (min-resolution: 240dpi) { + + .ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r, + .ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check, + .ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back, + .ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search, .ui-icon-searchfield:after, + .ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on { + background-image: url(images/icons-36-white.png); + -moz-background-size: 776px 18px; + -o-background-size: 776px 18px; + -webkit-background-size: 776px 18px; + background-size: 776px 18px; + } + .ui-icon-alt { + background-image: url(images/icons-36-black.png); + } +} + +/* plus minus */ +.ui-icon-plus { + background-position: -0 50%; +} +.ui-icon-minus { + background-position: -36px 50%; +} + +/* delete/close */ +.ui-icon-delete { + background-position: -72px 50%; +} + +/* arrows */ +.ui-icon-arrow-r { + background-position: -108px 50%; +} +.ui-icon-arrow-l { + background-position: -144px 50%; +} +.ui-icon-arrow-u { + background-position: -180px 50%; +} +.ui-icon-arrow-d { + background-position: -216px 50%; +} + +/* misc */ +.ui-icon-check { + background-position: -252px 50%; +} +.ui-icon-gear { + background-position: -288px 50%; +} +.ui-icon-refresh { + background-position: -324px 50%; +} +.ui-icon-forward { + background-position: -360px 50%; +} +.ui-icon-back { + background-position: -396px 50%; +} +.ui-icon-grid { + background-position: -432px 50%; +} +.ui-icon-star { + background-position: -468px 50%; +} +.ui-icon-alert { + background-position: -504px 50%; +} +.ui-icon-info { + background-position: -540px 50%; +} +.ui-icon-home { + background-position: -576px 50%; +} +.ui-icon-search, +.ui-icon-searchfield:after { + background-position: -612px 50%; +} +.ui-icon-checkbox-off { + background-position: -684px 50%; +} +.ui-icon-checkbox-on { + background-position: -648px 50%; +} +.ui-icon-radio-off { + background-position: -756px 50%; +} +.ui-icon-radio-on { + background-position: -720px 50%; +} + + +/* checks,radios */ +.ui-checkbox .ui-icon, +.ui-selectmenu-list .ui-icon { + -moz-border-radius: 3px; + -webkit-border-radius: 3px; + border-radius: 3px; +} +.ui-icon-checkbox-off, +.ui-icon-radio-off { + background-color: transparent; +} +.ui-checkbox-on .ui-icon, +.ui-radio-on .ui-icon { + background-color: #4596ce /*{global-active-background-color}*/; /* NOTE: this hex should match the active state color. It's repeated here for cascade */ +} + +/* loading icon */ +.ui-icon-loading { + background: url(images/ajax-loader.gif); + background-size: 46px 46px; +} + + +/* Button corner classes +-----------------------------------------------------------------------------------------------------------*/ + +.ui-btn-corner-tl { + -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; + -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; + border-top-left-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-tr { + -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; + -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; + border-top-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-bl { + -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + border-bottom-left-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-br { + -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; + border-bottom-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-top { + -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; + -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; + border-top-left-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; + -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; + border-top-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-bottom { + -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; + border-bottom-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-right { + -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; + -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; + border-top-right-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; + border-bottom-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-left { + -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; + -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; + border-top-left-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + border-bottom-left-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-all { + -moz-border-radius: 1em /*{global-radii-buttons}*/; + -webkit-border-radius: 1em /*{global-radii-buttons}*/; + border-radius: 1em /*{global-radii-buttons}*/; +} + +/* radius clip workaround for cleaning up corner trapping */ +.ui-corner-tl, +.ui-corner-tr, +.ui-corner-bl, +.ui-corner-br, +.ui-corner-top, +.ui-corner-bottom, +.ui-corner-right, +.ui-corner-left, +.ui-corner-all, +.ui-btn-corner-tl, +.ui-btn-corner-tr, +.ui-btn-corner-bl, +.ui-btn-corner-br, +.ui-btn-corner-top, +.ui-btn-corner-bottom, +.ui-btn-corner-right, +.ui-btn-corner-left, +.ui-btn-corner-all { + -webkit-background-clip: padding-box; + -moz-background-clip: padding; + background-clip: padding-box; +} + +/* Overlay / modal +-----------------------------------------------------------------------------------------------------------*/ + +.ui-overlay { + background: #666; + filter: Alpha(Opacity=50); + opacity: .5; + position: absolute; + width: 100%; + height: 100%; +} +.ui-overlay-shadow { + -moz-box-shadow: 0px 0px 12px rgba(0,0,0,.6); + -webkit-box-shadow: 0px 0px 12px rgba(0,0,0,.6); + box-shadow: 0px 0px 12px rgba(0,0,0,.6); +} +.ui-shadow { + -moz-box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; + -webkit-box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; + box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; +} +.ui-bar-a .ui-shadow, +.ui-bar-b .ui-shadow , +.ui-bar-c .ui-shadow { + -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.3); + -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.3); + box-shadow: 0px 1px 0 rgba(255,255,255,.3); +} +.ui-shadow-inset { + -moz-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); + -webkit-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); + box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); +} +.ui-icon-shadow { + -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; + -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; + box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; +} + +/* Focus state - set here for specificity (note: these classes are added by JavaScript) +-----------------------------------------------------------------------------------------------------------*/ + +.ui-btn:focus, .ui-link-inherit:focus { + outline: 0; +} +.ui-btn.ui-focus { + z-index: 1; +} +.ui-focus, +.ui-btn:focus { + -moz-box-shadow: inset 0px 0px 3px #387bbe /*{global-active-background-color}*/, 0px 0px 9px #387bbe /*{global-active-background-color}*/; + -webkit-box-shadow: inset 0px 0px 3px #387bbe /*{global-active-background-color}*/, 0px 0px 9px #387bbe /*{global-active-background-color}*/; + box-shadow: inset 0px 0px 3px #387bbe /*{global-active-background-color}*/, 0px 0px 9px #387bbe /*{global-active-background-color}*/; +} +.ui-input-text.ui-focus, +.ui-input-search.ui-focus { + -moz-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; + -webkit-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; + box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; +} + +/* unset box shadow in browsers that don't do it right +-----------------------------------------------------------------------------------------------------------*/ + +.ui-mobile-nosupport-boxshadow * { + -moz-box-shadow: none !important; + -webkit-box-shadow: none !important; + box-shadow: none !important; +} + +/* ...and bring back focus */ +.ui-mobile-nosupport-boxshadow .ui-focus, +.ui-mobile-nosupport-boxshadow .ui-btn:focus, +.ui-mobile-nosupport-boxshadow .ui-link-inherit:focus { + outline-width: 1px; + outline-style: auto; +} + \ No newline at end of file diff --git a/public/images/background/watermelon-duck-outline.png b/public/images/background/watermelon-duck-outline.png new file mode 100644 index 0000000000000000000000000000000000000000..fdcd7089f4150622f4b8e0b0866a761a38f18798 GIT binary patch literal 5919 zcmZ{IXHXMduyzuPKme&hDN;qc^p4U(QA#Mm011Q==^YdlBqF^D(nWelN+?nyNGJiM zH|Yvelo}~2C?GfAzi;N=_s4V2o|&C<_SxCpne)WKO!OJ(IOzZY0E3}{t~mez1e5J4 z8fx;2V%-Fix9fpWM4*Mw!@$Q5{uqFkvyUT&&(O=k1!InJa1QbNh*1XsAl-(#T9(0! zdwD$4~pP3s4xwtWTFH@{%>eusVM&wOlY9ie}WRB z$@Kq2-e^AtfB5CgjeKwDrHX+t@nvb-(VES_A1)udEuK3w{D~xV!lEc7{zde)ogNMr zia-g<;@F0M)(A%|)pE)~A)jWASRvE-50!i-wgf=J0baDutk+{5B-|RT3!{(VVwtVx zGdQ2>ki3md)sctNcn^B-&a7(C4#@M7ZN}X}K}$Xw+`Qw>{34JRmY6B_>--K4Na7Jn zok&NfSjxTznJA2^n#RpW4EK)4?;3Vgy!h@~{QhR?(;s!Vhf_z2l*ut5PH>lq;jW-z{nVhJN9Ho`iMJ@<`s}Un)IA)5FD+pJva$K z!dK0;Xsxe0)_xkt;~lCBVpIm(a;z`TcpRUw;{XyZ6f9iHGO#bY4>?`Xu1LS@mNslB zk!m1vI2xJ}s@pX;h5iAGw+4qZH~Gb#>ioh!@XgaA0{JPG_f^ZKe*4~5_wKuo6CHwf z-4Xkuw`o^M%}*%if{oZBSZBNa@X4xtf6l2JA$5&Gq_Xa{zjLt$!ad8uK^BUK?cFT8ckzLK;*_QB z)}#RjmF)OV3Ri2_G`ISq^@MAz{^V=I~v5}9@@XE{PW#DkLms$_b)BF zE8Lb#vR~4K`j5R%9y75CTRiCBl~g_vI6<1Y8;BPbG=yk!B#l+4tZ-$(PiYG)>j!0x zTVwpq6W87YMP&DWYbY-uz~39f+D+9!@wN_G^m4Mkz|gEz0CYCejqWd7Sb%S14$Hn{ z9AKGg*klWTuD;pT$@q@OU{UYKl)okZ1)RAPV`jrKIkP@XN+Z&?7V0^m#gm8X_soSusUIXFeW6Fub05?qq*MvG3kmXfNjYIo=)-h2OpDxpwHhzZ--MJUBZrgt%K7*?_#A5_Xi@VZ3 z7CIOzvHDlII+?Wz6bMB1iH=)N^veZ2fE~nkeytgHnj9~daM!hu6xO=cpV-BdHumbg zs&ZY#s_0ofB_r)kI6KF_yzZmL65qQir^Vj;)Z>prce4+;4jb@6i;Xhcy~);0BKd5Y zRE`iyfYxkJ+yMvQvb0Dhb;0M~^vo7!DL;+=BHI2Tw$G>wRz9bGf5cz+Vl)qUA1_25%3*Xoq7r*z-I`zlseG+A-uorJ! z5#%;m@V|D2l&)uyJoTrz{8m|R;t`&)b@F`afqvH4v-WbMqTND?2keQPCt;Z%E}wwE zzJfoi=c2z7j+l8ikWv^ED2UI|8k~PU$UwlTZQf(}Gkx?AuwGVIP zDklK@CGEJ3^Yg9Ziz-rsyJbkGzZ%{Rkm%VSNu4+*mUj27^{sf*FWkYKC!Z;4s?Tqw z@l-1Zhb;8qtxp$eJz~_tc}qHJ(TeOIK9WJCaJw|VV{41dcMkT3eb^Jr&sXW=r-~04 z;@?Qdy7Vq2$%gEfW2{M``;k;ohwf5{%ry%oUH0606e9KnTU766+IT~RsYPBRG21Xq zbU8rQ85P_tQuujl2qdAl8{KxJC9P>&&v($XWNpv=&C~eQYo_nDCltl6Nhn*%G*b4Z ze@#&fwd;ZOwd=Q5?B5$VYP&6Up z!vdp1exiU$=SjiEifC(_r$tIcy?w+E}Oi&Bj>&<(o z9gitdcf}c+Mt=U(V9%8kipCS~Wc(<0;-lA7Jg9qf)mHnP=HI)TM02gVXauS9bHxx9 z>T$llwtI>=u@d?CPTY`Jw`XFwM_FY2-VryPZ#skVGPjHV5fcsP>c)kDKl8)CGaN#s zcGgFEe@>7bS4H!)=pbDbLDzPen%|!4HloYlOP^V&oM5&A=`#V=kER$zc>zg7eKm#U$Sz(A1#b?+0+=o3qvB$BucFl z(rys6R-bIS_X+XZ%5;$&-9lD`qFzKBCj|@p>K4ZZUZKudV(I`uey0l`pJk4&q^or! zB575bCpqZjuKC}@+m+WHeN02`{+ilZXBiplhA!F_HQcEh<>D5hM7R>nq|R-u^ze-! z#?lr2OdcuL=Vpqpdh45&)S7!fWPVCSd(^Z$^1eXK=t{N%7i^<)a%}V%PirbNm2_{ZWxHHQ*Z}c>7nK8IL zcji}R<}EwWR*U7ByM0INE!c}&Z^{m7JhqCO>5#AO?+L~n4^B``ipH~#Vxe6-&XgHb zB-ZT!pZLpykiW5I51Z?zErGAx?Ad#oZnz++@yT3{N-a_bYXHkOel_7GY#GV9amJy) zLNw~Ux^1P?ozi*Y&HY);&xS{H=REofCA-BR_oPT+BZtYB_{*RbIUDue221rc|94Fc zns8h&wFKWQF?5cVvG;2g8r)m+;t)xnEw*FMt~bfa>S=27kI!|Y&9`kdwjtkS0+R)6 zEF?vo0Rd~732&(pntHRuc{XW&N4mWZqh(QN-|DMpfW2xo3#uwj!ES-UB1PyC~ z>g#MOG_zg%+Piv2!BLkOS^2!x+QmkgLa&y~xUf#bs**FBt{~2idiyh(nLJJt+hmVO zmDG14lW zFnDwkX{IdxW{QVD^QoM{RS2Y%i5Vl*+ejl}ToL#@N*d8UZwcAi(0gCjRIu{%LlJ3~ zJy7iRy0Vyfk=y0VKIS1TRZT({=W1Jd$&OxbTJliXh?J33Qp5m--AAs)H%ch^hwG~U z63du-8MgJRkqN15KK*oQs;66Hq+v;Wnb?{laiWJ;4PDxD{L{2zpE`#&({^vhH@{^U+}7z0+4#~;wa_Qa3PJ?#M$3!( z$(s&uR5k$$vtzqn`tt3@nD^$5J>48r^TAb%++NFdIWf$s+lT#|A!xh)?I`iWiLFKl z3K?OoBx>2QYAd#C?MJ0nj?vjoPlrUC%z)Z0!2N;R6U$9|Tj7wKC~J+3 zPj7p=;YO{*YJdd(fknl&s)*2z+mVJboKHd2)^d+omKD!`fCtVb|M(~=)Gef(G)-8u zTc-t~ajL&mTKW^JroDd&&Adn5Rv^XJ0fz|69!}qmNMF7*>XxmGPiH<1mg1h9LD;ZY zP264#cqeubrdQTEH#aA(^ks>HbBF6|LUBX5Mb01YWn0=NDhnUld#T(DuE*ylD&A(_ z$3l-!Rm6>BZq4(E{mUPkca}7V{k;DfT=Z9PIYqgQGwB=kVWg8o3);O8qK7xW`V#fp z$<29e0jm0&CcZQY?tn`cN;q8TZQOe1TpIne7{>^S4^S9>Y7~gB!b^wc^K&}zY}e35 z{Bp3UZqd4spS>ahHn?$JiF4Pnc=-Bi^g~up`kWY?SD|z~+;ui^+0(WIlu7ihO@KlA zm#m&NjQ)6xyq$iK(To$Lkr#*aR62^|B=~H1i<_m>??T3=I&_8IScDx~4lmSub+I>G9p=|LB>&P;#3Gt zd_U^3QQ^Jm=-wy8(PtufYo5Q<$wdgBH@tqmg$J}Ft>>9|L==@sx*-xv#l~_?C6_oH zo%(BXz0w^MbRg2P4P;3Jw4MOzrgGvG$kVPoDPLf_MUMTtj?@13vk&QpRs*Wq23wk` z@!vL&;BFP&GCg{&r@?XIZPS#xn))v4N_fRFHf7>@1VG*6DKGgO zc>qlGm$S?26m?TOS8Mk>x~P0^A5W-wWKD2F_2_im67!KrW)y>~dU@hrZjuCx^6&6Grp$hGTWr8*`|@tU9)^4CcxWZO@l%?@ zOqAE^yxXVSXyCi3e)h9(f-#ITUhiX#Y@$NeT=(ggqj@DqbJKVoE>N=e*735Brx5 zoa{&8ojm$IY}C*|B3;tdNcq_I&9f=r=J0^3MeQPLCXDo><)aW}q)iYQp}7P|vRj>; zdZLnnKL?Zcs{0ZOp=ydI$K4)c)9U9O26+hbk;zS$eft$N*u^UWCV-C6aG3sU zkuS3IJZ(VodB+NG@u?zMmwfSCZ5Q|k%F~|rR4v(Tn#|pw^KHY8l@Lcq_^Kv90rZ!ND2hbJTaW@}cFg$f$ZuH* zO0=^)ko1;`+dDI_*?b=brXtr8lP%S8W@~%m=6lGT*WqpgE?4T}c_uj+5-Fx8vNnz1 zmL(uM@_wUr^24bl-_WnVYLjmFPfF({f%KuIElhXJZ_}JOwnE!k(K&DB>)`) z0^?diWsg&)?2%I#tB{R zJoheQc3xtMzpdE!4F(?;WQqai>aHX>MAyt{Vx8AzT+D}`Itz3Bu4 zhGpgl7MF|i-@37(aiy=R*W>B0L$VoY>#g+*be{cjn%w&6NF#G^QG2{UZ!uk3JK%a9 zS+peSXMIpLPE7`*kqOdn6BQ8KTzhLm|Hsa`p1TiPDi@?a8tAgV^ zzBX|&fnKPM>^lndl6()Dm+`oKI%o% z-WA~<(>iLc9Z!P+H30%GI*~XK8ZOdWs@NT?wud}!Z+A{*qIovc$2MChC~XS9T>pU9 zy&}O!qdh{Fgb8GjTjjq2B76Q9$bCrjztCcF$$|k3?#4J%UA`ZBuiW)N`mv#O3D+9QW+dm@{>{( zJaZG%Q-e|yQz{EjrrH1%aR&H=xZb^c_y7O@Gcq+cb8O`X3aWX!IEGZ*N=i`RG7w@> xaP?t1uwqf5>*6jqQQj#^NnD0X3=R#947$%aTA7YlMges&c)I$ztaD0e0sys0Egk>> literal 0 HcmV?d00001 diff --git a/public/images/color-swatch-erase.png b/public/images/color-swatch-erase.png new file mode 100644 index 0000000000000000000000000000000000000000..41a7d0e40a1b5596b3c309d90db28d17230de9de GIT binary patch literal 240 zcmeAS@N?(olHy`uVBq!ia0vp^Dj>|k3?#4J%UA`ZBuiW)N`mv#O3D+9QW+dm@{>{( zJaZG%Q-e|yQz{EjrrH1%@dWsUxc(Ox|9|n~-Me@H|Nno)ttS>JUghcH7*cVo=hSh= z0}4DW2F$Ph{ubSv;veg{#lw;zLavouki}J()9Q?%Ye8gX+?l m(p5^TnwG0qR8@W8G+@}P%Dem8?k12c7(8A5T-G@yGywpb)?&y2 literal 0 HcmV?d00001 diff --git a/public/images/color-swatch-green.png b/public/images/color-swatch-green.png new file mode 100644 index 0000000000000000000000000000000000000000..3b00ffed353a60a671e90292ef036a2e7d25f0c2 GIT binary patch literal 153 zcmeAS@N?(olHy`uVBq!ia0vp^Dj>|k3?#4J%UA`ZBuiW)N`mv#O3D+9QW+dm@{>{( zJaZG%Q-e|yQz{EjrrH1%aR&H=xZb^c_y7O@sk0qrKJa@31=T!V978H@B_$|u83?f` xxcaahSg|P3b#a%QDDM=dBrZcG28RYl2Hj^ItxU%&qkuXXJYD@<);T3K0RXj@Eg=8^ literal 0 HcmV?d00001 diff --git a/public/images/color-swatch-purple.png b/public/images/color-swatch-purple.png new file mode 100644 index 0000000000000000000000000000000000000000..165324cc1c2652dbea0f2b730d66505f8670f7a6 GIT binary patch literal 153 zcmeAS@N?(olHy`uVBq!ia0vp^Dj>|k3?#4J%UA`ZBuiW)N`mv#O3D+9QW+dm@{>{( zJaZG%Q-e|yQz{EjrrH1%aR&H=xZb^c_y7O@r%k7DYM+n=3aWX!IEGZ*N=i`RG7w@> xaP?t1uwqf5>*6jqQQj#^NnD0X3=R#947$%aTA7YlMges&c)I$ztaD0e0syzTEhhi~ literal 0 HcmV?d00001 diff --git a/public/images/color-swatch-yellow.png b/public/images/color-swatch-yellow.png new file mode 100644 index 0000000000000000000000000000000000000000..982e4b4197aea45a52d1b5c5140875d66e283922 GIT binary patch literal 153 zcmeAS@N?(olHy`uVBq!ia0vp^Dj>|k3?#4J%UA`ZBuiW)N`mv#O3D+9QW+dm@{>{( zJaZG%Q-e|yQz{EjrrH1%aR&H=xZb^c_dgJvH||-nOBX1p=IP=XQgJIOL4nIah(*EG vhvmSEMS-r1yWB*1rzjgTe~DWM4f7eg+V literal 0 HcmV?d00001 diff --git a/public/images/crayon-background.png b/public/images/crayon-background.png new file mode 100644 index 0000000000000000000000000000000000000000..c4f17e637abd2f51512ccd5319de4465d8bc9bd0 GIT binary patch literal 5688 zcmY*dbyyQ#xJFWG5S03nIzR>zGLTS#F>=Ugqy!yEgF28dk%0;l5)#5jjP8<>mXaC` zf;6LJ3`X7g$Gy*U|2g%1=RD_p=X<~RJttCMPlJJ$ieL zcyDj7u&{7pVWG0J(!t(-YHEr=AT%^IY;0^SFE4j=bj;1o_4M@2&dzE;AQtA&+S=N- zwzdWb2N@X|Uwe3BvDoJ3=7@+0Iayf|0HD9WKQlAa&&Ri`t1BfXB`+^8E-o%3JtHkO z^@*}FAJ2bhXJ?0phihwV6B84go12%HmqL8}Gcz+wOH1eH=NA_jCnqP1i;FlM?)3B& zkH;S!9TADd)z#JM>FI-mgYoh4y1F{j39hcL{O6TS$;j9lwZJMy@20oXZ+N46S%Xc<^z9xC0geyVmdBikB$rfW47gL1?P!_JP0r~SLONr!UI zN2@y*4>2^CMnmKyh6*CuF_hmV@ic3w=*mxNOOt_?o=-GfZ_+osSbmBEZC7(H5X$;a zQ;VSa>jw39)?|1O5X-81p*@>EEfw0HeXZ>!NQvMq>uMjNo~f$^y4gpTvU>IWXC-w@ zpYBdb--O&+y|UbWyPpxw7V!ZPD|aa^9lYiP!h#6d%mAHU|R^lS1xxvFJP z7cf+8q{QWq%aH7y(0R~7jr5ZRi~QtEkhd3QwVo)V|Dun;M@@v=mD=kV(jtAC5GupZ z1`dN_&Y?Eibt1nXqusoj@z-#AXRH{jD|h{?$CR)u4NQv|k_#r}1pbU+kwrnU|JT9K zY1YnszLzLba0ORqMd?v({N?xUWrm)Vip4SGt6@wuOCs(fA*(;o!ki18BE`VVwAAJTc@Bi^K>dH1P3ta;u2~tyA;cuz6`*>pRw-uitWx5~9CKsYu^S zDnpAjWwgDgbY(nKwdaA^+^C)>{ty%eQoE|86(nVS#u$E@u3|$~N-usKf?!QS3sJ^m z%bXKqhB^93RP8hBTkX07NWuF_)xLM?m|ejE@LF9Q{LeUs&fOjMGWizpmSPH*>DEMA z5nF9l_nN#TlGxjt2ta%ij{b3A9}JiXuFBm2_ki_&FIDkPR242JsM}b915!oVRD|rq zSq5%9<#MWXs)wq3ONg@6txPFT$Cca=$IlZk`EkzW*1`~Dm0DVQht6ORu_(5Dag3AB zP&QJ-GO96WE`C+D&s`9g8vn8(EI{1-6Fkcvp#Z~fHk4r`3J*nk^1j$P=$tu9=yt1t z157b0#X?QRjzXrRcSj5>>b<>U9}p`D8b~K3u|~fk)`Y!d#fWXThWCr)(lQF!-?DYl zqd|^pmc>fU@9h~wEQFQLaT{$VguLU%?tPz8{;PAcAdzzcB=LiOSUW?B!jRhyg>_kZ z*9%-#z41JcpN|h2Jf^RQi63vE%g39sgbXZOMk=gee4dZ<)I#Fg^l5f#JUYdMTRt=~ zpHOW@xF}1MUj=&`MOPq+tNKh`qfar;x{jOG@^|Eb^AUpG*u!Jvy#Lbz0^ zg%^l>WfAz0YYsc6J0Tr+sgF1VTi*bet=}6Y#8fh|d~RBQSYQYaP;;9~Zh*hxcjc{v zw}q`K2irYPdPqp}Jvz{5eKK{JxnE{|uX`}Z0URLHYVy%@oPQGcvVt#E{NTKiTf^w4 zU0kW>dg|AEz6)~kswuVAEIL_~1~7Bw<^#6g{C&~UOq1Bknr$pvPP(g(2Yk@S5MwreRnP?GwKerC8Y@} z+}wLKlffMWNpJJf^Bi*_oLJVQ`bzvBuFNWWrQ^HRxQ-guQH^0lUo+FV6D}PX=SKqe zANmu)el{G_u$r~N#X~U$uXv-AyGpOY>Gx`ZUo=bATBA%=?@n#fzTH-}=0fQim&uN- zUfVeLMgDQ-6r)$`t4I)he0k#E3Bhh?XYG~vY@R*`*lNBtP5U%BQ1}n-k1{ym(4;r4 zJC%W%Db_!Aeh&7L#tVDOw;6|yr>Y9#C3{~=+Yc-ZkPYjoYq6aH#iB8W;op=y$8rj9 zqZzq*t;E2?GTg2SbbbbkocaWZaS2p2C)U$jiM@(nu>bZT2dwJZS95{$oU4v+ugtUXevi1^PgYA-l>RgdF3>n$>Ti*mx&FollTQ=Xd-LFZA>!dM;%!HgHr+##TT(JE#ciz!JFin8f& z)QIrua_Ev-_5)70cFs*KXp$+qJ;5Rm;DmQ|l+8@+1LCGp(fR2))KvF@+2*}KFHn2r zOymm)bkt!1L4y9E(`bKkmyl8sT45MOt(2I5ql>d@oU$17qUFn7Bi;UouPQa$m-)a* zj3JN9UEX&=n;|Wn)G@`})x3P+ahZ&w`TBx}usriHd)Fy~Yf`CVg1uHJBUB>>{$N2= zFRQHXhxqm)F0WT6m3pVg7UrGQ@Vt-h;*QNCu^i)WC~Rj}c@dSyG)(bS2Djsp8TD-F zW1DNuCuoyTUc=j|+b!dGsqnaa53A>-4uwBev8VVw+>3A^YZ8@jzs6Y$A$9;(4T@^+ zcJ^-Xx{S%tY4PnB7Yi`{B7s;~=jOBmtmxn`r*9AMYCZQjlBkV&%Fd(JskcHU_{t=F z#MW5EU%TtTWe7=phIu*`BF4GIsk#oy9km#Q)lE)y{hM%Q#B;8{TgGByCgr<^;cHA& z%|6vMn+Pd1qY3;@omPENHWlW7#P8)jTW*nfw3hx*mkl}tU?)^AB0AQsqpFg5X3HCqPXFL|`FrZW;j!A#~tvY#x&f6 zTVzcUaq+fqZYJ8)m4~$V6dJY}ks(&hvEp#zBUH0GHb`u@ zsXmjWPKvWGA$AD}vR6d{l@2Lg79f&PvJJ(!Ga$T&J{{OU^$su1#yP#wDtCH)RB}{^ zBp&MrHC0wSFR{*LIut)CJR95Kb$Wb%_k-XU#K+=S-^w_8Kg3`R+Z764W;^LzL<2Qc z?lTSI)UdBX?xlHi9TGV`X+kqn2QJjKsiASza-x6N?WbJO zFHx}Y65-h)rL!Kd$?H^?yf7P^W*ZM|ddM?V6k+k2Q~HPgSE>HfpW|~}Dp<Vs?5b$(e13V}s4wp$9IOg*4K6>L7-Bn)t~Jv!b|PFnUqMdyetmoVQ5 zEInKXG#or1VbbkpUE*Tt0V3C!xR`VZ3NcQCk7_WTyH#;5;rP&FNMc}^I2Je4pXsk? zK~0{0+b4rV9V-_>^qcvQ+fheJ>c^8}l4IvF6!Vc)WzxYv!W1p!kVFf_LPNcVNms&O z^Ur5vB${aGY(2}l(OHAU1W`LRO>@0y9S-2$%Rm96&i8TvsAl)tB0frm@7nTRiwlZO zHScIjCKYyFUVsDWL=#M2Kf3VQP9{O5=n5d^8(aS#NpuQ*;m-X3r0V~6a6zI$>8hs_ z6$4HDII-BvnU3|AL{|tq%!UTPza0$|6ei+g0#6+AOR8W0o9}>R2>c_Jib&32&A1Nh zXxA6KXM2ZEWw8S>0bb2aGZ$b|*as9nur1eTH3vq2l2Ro8%^T|syYo+=I&0CIw;~AujZA>6%76U0BMuMs@*?^HvqTh6p#pxno?qJ+0JGfa+PU0rsTHUy)kBr;EsFBzx87)EO=f8fpD4T`Ddzm`teoN}!+3(A? zPL@)R@g@_%9Z_1iKvKYWwZ8M^%a2a`@;#yqA}-vj)5zQMP*kdIhFePn#xQ~?KQO94VHx2shxS|4(ZFt~&8=j2_p>p@ls%%t zKZ#^P5MghA?@gwMisfWrwy$KcX1D*1$qdN^wKZMQw| zi(gG!kpu1PZsg+E3(U9IHo7dxpwQUq8dv5~m0BPILlf9HMh7o_DRyUQ=G*u<1#0qc zspZg|$?IpH;f>$db!siZQfqq(`+cw_kl#P?|nDU`eKjH@ST7V02$=VjTv9d z$@`@(IV_5lm5MIW6EK3pDzDt*iesqEk(5QE6ZW16qI_$NT}ua5c;}dW98qdXS?$Ic z0S%&UHDg7n^>0TRwww+~k^~xOEfKWY*DZtfsQRa;vw{`vw#|OjvJ`BB|lnE1Y9Q1@jck=4% zF}M%47$Z0g+`Ptt z(!1%D-slTh&u{52*bD3#h=XG*-l&I8#`E1{^q5EuE5Z z4Z^0}#6<4UqGqnPznU<6HH0qwz6&=#2qc($QQ1ktI2>JF?;thECBf+m6nc8xdy9?t zo_t9Udrt3iYGj<}QExzaeeJ~g#oh$u#~l`}5sg{crXcQZ1Dx5!@L)<@Y{c86uRygL zs+~bmmRs5S97Odt+LS!Vl~$l0&=d1{q6^LQs_nhsp0kGQQmz0FOJ&i!_T0HOOk4%? zyS0t`efrAKHlvZgGX?O>(oC-tMwam~o_fVk$SMQ){d0FE6vYFZ*P~TuD}1xT;j~)1 zA^mQ(=#Cp0nD*svR!#d;#Q)aYv=zR` zg@>Tss;J(*6~aBp`jY@?(IG)fQnZNy7e%1I=G*%YcrqpLpI0Z>mo?7Q0ROgalgPs8&|Rz8wGbRa zbNO3&kI+Fu$`X(Zbx#jD&+4=}fPJE(71WJ^aS12Dwf6x12zct=*xbyMcPS9|m$CqXYk^}JCN3Y}&ZnQ1=9)ro_Vgee2Fd~;qtV1d6JqwVjj^!H&w-NVt2gYlZr<5^i1W^1 z`bRh5lBu$%JcPM>lb5Z&HD_Ko9fk>)`LQr(}7WF#jDn%m!8T}!FGiqbOc|_ z{__GnJ-8|U*Sh0q>(%ZRAqcGOsl@=>%_?E>e*GO|EKv6Er%H?&+W=NRQZMGn+RDa6 zUhYZ2DtFK*V;NeJ@K9J~l>hs6Wz-I%*@o{EUu_!ojq((fVbD;M4z@k_v2DZdGj8=4 zc$#?k7}_RT>|C~&)3oZ8j?1hNF58WroCxT(wp)^bp)F1S34(gL)9+*yWPbQ#@!Vq$ S0_l&GOiNu4T%!6s^nU;rrDA#j literal 0 HcmV?d00001 diff --git a/public/images/crayon-outline.png b/public/images/crayon-outline.png new file mode 100644 index 0000000000000000000000000000000000000000..60fcfd385eab6d6c9bd71700fc7e193f7ee7e14d GIT binary patch literal 1312 zcmV+*1>gFKP)26_C@83iM$}*+3zr%Zokw?Dot(q{ z?su!Yd#-)&^mVG>qlfO9>h52iI(6z)jV+48#Im-B{^5_pkxzIlb(xq35DZ-aBgxy7jN32y_oDyu8UkKo3OsWAxIFMfb>+Bm{i`RvtsfRRE2^69K-*>4-?nKIw8} zIc9RcPcG@2oIe2WN3Z=x&-%5~Ytc~Z&b#Jb(kTYSI>-uIzq8ZnxYIGG?VkEGfied0 z1_na*=Xt}(B$xUWde)(V^gpFFz%krQK?xlZ^ihGmgX(+RAauQ+ zK*RWeYwsBe_*p|Q$l~)lOSb@82g8)KO(6R~|K)T^^oXDiMI*9w0}YPQ$ME|k;2JXm zKJ?T(^T|;abdEqai24Gz^q(gyK>zCWXT`MmO$Bsc9FEZS*|?0swG8DRU4Y(bAl0s| z7GA>M?R3iN8xQEGPQL@_33T<)L`OlR417+>HDpjv9&j7zJGtI<5xrQl^grnO-{PNt za(aLR1w z3^p}Om+7LVH_VP{IU{;3@%k?^Bh3QhY$YetR(B5Gfh{JyC{$8#V%8p|KR7%;bPC$wCLYn**ZcIgVx9?8R$nZ?cY^Lx?|WiR-Lpz6&YI&CqF zY27g-v=+cMEkM%j6X>0K?JC`Sztan+=T5J>n((TE&Wp(zF4<)r0p4ieOVj1LloDgA zy#l{nN&1LpwB`4|AlHJ>aR~EC6)+1LXRavUzg>r00RJJ Wn(#Ql3EL(B0000m|o1VB*p=O0P` z{jd4_^S^)l=ReZ-NA%BsYyA}e`kz1f`Jd0f{P`_=$p8QL`yqcm!XEbX*ZWUDKk^v4 zXyp1nQ0p=CGl3i_Pi`e&&2HeLPR3++DE+W909-h{4bCIg)bHY%A&573%<~ zXZ>?-DbAktB9!a2c2)n~K1OrH*HKl!_%ofFJW_x5U!U~yB~m*VPqeCp`7R63j zuj0@6WamsSJ=HfJIFYp1XD+Zfm=!0A{33{ZU~lbx=j?qvy%u9-`wNV(%x`g@>^&7) zL4zG>pXnIb=zdz~LGj%l7EVZ?x3yMle4zH~)A$9Nr%ztTe*5s;?FYi9`;Oe-&l<~~ zGY?w&y|1?t53nEpPMJ-`j%8FQw)!j2cjU3$E57*tkuPW;j|XOPWaova2r}X9>H}Wm z@qi*~%FAHKd>O&yS?(jBYvg%2Nun#VpXjSH_CfvoU;d+xKq^A>DbE|wR@ja;u8|Lo z9AkPI==Wq^qn6@lViXvis$ywrDzK5AocbB8_Di-2QlH4`3-XtdUvKm0(aHyUbQi(h z)L~FFx>GOp8~gsfADy1f)Qs!8kM$jrY{LBI%BKv%{Iw&00-%VEIIs8gBVP93M;W#qZHY}3b>F@wrI?o$@$i>E4< zX!>`wOTKotlo$6DxI=mPO6!%0njkC&3hj5m{?*BK(mji~i+cDiX5sLoR@% ze0QCWuCTOnRxKz+mGAo!!I6&!M=lOadzO8{f1djNKNV?JIH$N0Xo^Ika%YY+kYB=< zR4@3J?!7&X)nQ*IwQ&2L03Yrhr* z{GB4W&mi~dkiDkDFO&`_6~Lx#^CL^grPA5w3h8>}a=-yl1Rd*_;op9=?Tx}Hrx(>A zPjn?t0Dlgq{p|#2NJAc-_jz)tj*H}X5Hte&+njk|~L6Gk5taab!0Lv=CoZ9#I zB`rU06{yXL$q>rous*#y7)yVA}rA);$ z6O3{5+KJ1+7w$N@@d8PXpRSpR6ue`ozZrQ&EwEDsa0D=+g*Fb8Q!CSR>?#<6!WJyK zmje-f^L4Cn#e72n-@-uE(g#;0XkREWX){OMxAp~K5*muHhN3bV1hTo8PoRbor-0%Y zXf611Z`ADbM9^#~aU5-e?*w-$T%5WHnky<4U{gaxI@x-Jk*gV)7936NYC5zah%ESU z5_4JU%oQZXiT-&D*PXM4HgFzE!R?V=XPvJxIeA$&#H-$<0@{3^)`bJM07f~V4&1<9 zmU~nH=!s>YNmK2*Jz1hAWGLxRCE>j>pF z{YnJklQGsOofb4#q{z#u9nYAQjvm1_a*_OLs~IXellP>m*T29WwAEzvpI~p zsl^pA`fvnJ1Y>F&K|3ZsdJ3K3csGLr`g9(-UL%LN{EMGQN?9ZaB;;`0mdKHovo>x+ z;jW0N56MM~YALFp4U|7)PK>-W z2?~~LL=^+7DTO0=+>oE2FMVasTPoB1sjdSNv`mGOV9qX#e=Bd8N4gp`UCxCPp3ubk z`p{%1Bt(+k8Yc+z5mJe_uRN<%ssBTKQz*UPA``3;lhnj*LOd2ZKa5;6%qGm}gm9NA z2(uyPRDgkHy}=HflKcl%c;V{}S}KH`BNfcta23nl&Nmy&O(2#J&Q?f3{vuyfr8Y;{ z1iU&1dZpJK3UELwKop<7zKxR0sPEv#R-p+6Xeh1K5)O zj>%vgTR&C-X%Czz=Tk6swDLo$RNtE_NpV0*!QK$mXOO~!p^2pd6+4#pw2oR_7gQV0 zB~}qXq{KxKhXktZDyIjlxGRU|fHt!NL0i$7b$Og#qC`s&(@n+0-xPdGjUeC%N%w1Y z6NFPyp3=&@gYG!?f5JhHujNEnW>v4kln(JawpC<=rKy+v2KzZ5L z)|^O23zoewtaIdNg!RI!7aW#rSjCl)G>WL}T_==Nfngce2>mkhf!D8GPzMd%D`~Uj z04e85LCYkGf>(+SSgM4vTGGP@n$8;14AVXJBc8UeRV-vpjI2(YC5X|`)*aNy275?U zSwM?7N^@R}l!GOn#cBb)glsG! zr?K#?*2&nNu&9P2k9#hP1(zQB!QqnNPQyi*$yRl!CnO~In54cgkRqxmA=f4=kGBoN zS4O)G-!H)geRf@C>XXui6UjC0Y-o-oZ&+UIt3=L|_3oHeDA!DSGF7{-qAfyFtzv~` zX>B3EpOtdAt+Wu};*c^{5y$37T455<7$B`yfT?TQcX%f9(-0LqHS0TM3J_sU74aWs z0FAp0S8nFqIo?`x6V;HRDItukt^$c+&;9qcQP<2vi4Lm2=g-^kQGa%qUp z>ug>CQr9E_yNSuAsLZ`Xw@8&pWES!e#38I8Vh(w|zq^!M=H-`64Cl7Ovu#ksSHiXg z7vqk7Q$qM=(mjEy0&(P7j?M+dRU96AfmX9ws+nOI*ZmBrI&>g9bLru_Sa{ofwbG&B zuF*izkWg2ZRwEUrGIZRGm-fdV@*=oMef*|>mWMtya$eu?#xXeOGFl2j8cJyW1fr>t zCYy3jw}R9Zn}FgSqNYkjEb*t}ClRk5N{vtw9|`0H@zNZPlI-Zi6--19#`7BaFDg!g zSLlq&VfFH9rX zZ--op4m()@V7d$?r7GK~++0GlfhZBZrs60q7qU1=o)NI%k)%}&2yTx#k1omKbCW6c z7^E^9Dm4`xyQTOQx$a#iaV%A@qLFd>y*r;gT2;of@UNb1E+r z-~rMzox1M%l%J`f1%6TdzH^6?i{t*G9pbtxGNU7CK}FGDZnHyDwLBhOWvgH85y;Qd} zEAaU9oY56&!$@c{cUe=0NfOlk$H-f{k9bcK^Msibd}~#35~#*Jc4en7otZe&;}iBxChF)AV&T+hi*KL*rj>v(^1(!FQ@fLvekFzl#u!4*OO-z&nUgX06xWW=4r zX00M44D}=rd0nP$QEC0I<|U!V#Aq^$Sg({&YLE($kMMOw-Jm;4h8{wb1%X_GTLjDA zWa!VUz;hj-)K<^xvb^At%ZnYewo}J`h}xvUK}tmCkdXQRJkTLC1#R@!Yi;lpQs!{& zvf}E?Xz-w__#c!wPEzER#t+JMWZpQ^GZj8)BXlMJe_hvuK%ox=Vjz7Klm)9TGQ!v% z@1!y$5dv*E6;rxC1~h3Odjc6@k%9=@Ewps8t;)T7MCwBVl3mBFLV|OIQ#fCt94h;Z z$H*-NH^AcblkN*3bV)M>VYYugMbOy^BuYEW`I3# zoD*x$QS1c?+*G~3AlZzXrueKIuKwGRM+e8ZM!{(E#>1PVDn`VURhNI%@myUTP4nEP zgZ=fz3)K$|7yq!h1>*qoxw%ieyhKFWT48B49JvXRE<{?bJUj#zN=;)XSk%U+@r$at z@^fy6**7)VHeP!>h*6H_Y6dE}lcsEVx{BJ{iIhM$KsJ??Gpz2yGHRQs@%N)3^P#y4 zk1OKEn=h_{73v;DEO}hUdee({53j`LfR9i6P)kOt%9AZ9Z|OvnV^~Ua8(3)ObVTI% z5p*R!7h+>M8L{t0#bH3@=-woi>|X3AgM#l>Se&L)g2k#JyrtacWy)Xc!L)E8B5_45 zr0cd{gUBLP96tEnvZ#A4C@kA*(bk1j%smy?#Y3gk<$OXy>Qm4N&Tys5k2L&{G*V~a zhZLs38g#20Udu?3fDc^1#o_$^a_Y-=UmkQ-_!FW%HLqRSTq3`8Jaj5G(2viJevn+` z7K_KoK`R4u!EauNgQ?r=2ihUy=Q0ppLH5J}y>IU3X+3YCf=N_)}qUH7ro6KbZv#H?inujhK1ao?Is0u+tvN>t#HE zZaYBQCMh5|uN^`p4bx2)NbbO@=m!c+_JV9g|P2tWCC5p)Is2c!m zjG9oSW>iAt#xc2$gsL?)RehY$CU656ecdIc?HoCsHK+9(^E+NxpXrD$goC;2a+Z}Y zzy@gZ;b!ZvQ@VWiQd@Oz5~NK+zF{nZI=%ujkM6)&5!{q(N~zN=l;#1OIfm>FSBD}) z3M`)!t_M!f8j!d2v7;(1ZZkQly{F$&4qn8q5>V?v&pFPm-woK_Nv!Vb?I5N zY~@8Aj4m1D@dpOrPWFH7RDR5~UfCNwfys_guz6tm4Zn;9y&yTOM;`7fr9v~gRrOTl+G^BImY(#Fafp1+(kYkGTbdyIh85ulv7i z$s`@lAcvja?<414!j38qkEe!r92yRVJa>hr zp*EUT+C4jNQ{{UQpb+KcB8EUW+bncHFHY94?1{Kb4GGg)ji=H}vYKOZ8s?rBpDA@vK*6R341RHv?CZ*Bosj2Eh0ax-Mx zDmLS|`Y+S|itr?n-UL1c*bMhq79@3-=cLjgTWvaZTuKQ#^2n>V_QU2;bvr!ddwo_D zgD&=5tHm=1WfIrdfg%_k#DtdUk=DM&fYE?RQ;6j;%{+~8fvRO3hJeAo^+YOyEUB-| zoU%qAIlg3_-16>U_$a;5P_)T*$evJ<@HV3mb=x;lXsi-ZhtQg^zi!9b5GR&AL&Hrn zd2P>^Iv^Rt&cy4&(n+vAXsERGxqjnij7~~)1=`5ElCSZ)j}~{z?ev- z$h{?Uw{rU&Ulvf=+plAbRbE&Qk-!HzF76AWI5U$N()sS)tZ#utWgbj%jF$uV4#HN% z45D}iZ0Oue^t7<mu{zs?~bufk*tKm9Yo@HZe^T(Ym_~lyll(PIb@}Z6nDZCN5xSS-Zy7^`wK8J@_ct9~MRXwnbLTZq) zdC_y^DKOYlk`4G6uv4~M= z@actH-f>*R>Q=CGgchi?2#26wy|Ra>M^oc@>x7S(P8ZnN#IVaEg-i3rH7^(HudUQF8J`xNqkHfr$0|Aw zJqWF+?3w(z4gPsP;ZB0>+^DocZ&cqvQavXXgZ^EA!b)NUE282at? zvk@6Q?UI8<*CBVq+OGkM%8==~y2eeZyY=f_WZoAQD(v$~X!oHJZ86ZJjp9HV-xpaM zWLNYs5`zfpF>;;3s3uL9x=GkkPFSvK+}SlX$Lg+FY_30q<*;LS?40n=Q`fUC;JTz_ z#@IG~`DejC0>*>D2{dY&d~Oy@XQB$f=frt?=s^uu3+ha4>2LWEl%9H-LG)5&RFuu6 zTA(?nhe_>()G6v7`O&5~M&4bo?iRI2-5 z!J@16Xsg~o~BqG$qK>kIu4mO4BV`+4TlSk_bYD^iZHM(o93hIGZepWJ6bconXYt$C4 zb6G0eT#$!Eh>`kyNY+GE3s7ELP*Ch0h{?ha7xp|yE=YMVnPOOowD>*PgzzqG$?1eB zJ?A3#pWs%-0+dH@xd#2)7_Lks!Run_da&Qtge9f2x9NtlMuFFL>IzT=W=tjRbdL$1j-jKP^|y$H;a0N`zLBUg8{J%v{q`A6y-Au%S|(u~&yrsUS^9i*LfB z4iGYRNf((zY1owF|d7YfQmXq5_y+EOV}M3-VOY;6Y=JL&VR;sqVO0$*d7 zg?NT>Se%~IU9O^OiV{AV7ZXthusSXsGz0;<#e`-@#}Bk6a_Lvl;$&b7ou3iiJbb!% z43i!KY4$88f+&m&3vtfi$yV|xDGLI-JZ)L`6t2b)9qZ_97r&gCh@N3wAE}w)_N8_X7VezURmd5LOai@S{sm zaR-+WLicots(W*^RwPS|jYt&5aQPe6mQ>(QJ)fz1=H6v=q z9ewzS;d-X0zv#$Yg=ot?shg31aC73Jk2!NG{QIA3p{!NI}r-@g|X7QM~N z=H=oBtEgsWWu2X!{rU4}eSLj$a&l{H>+(3hlf}!R!Ty$x2LDIwe|W1S65g2xU()25@xKPrux%Y)7u5N0*m`u zBN9x3jU%X3S?xzle(I1e7XI_Aa6%>Zq^4DSlaB21yBuWk%b|mT&$FK)w1LhZyc+K(iiKs)~_m^`s>SF?(<*R=zqQ%?9h0LUg{FoD7*WiznoOD!C>NKSje7GKO z-Oeat46Jq2GALirVVRj>1 zyxwsOZ$GfE*#(`TLsTk7_Mg@)mZ3tK)31~$r5999&4^EBX?H~2aJF-WQ_dSRQ&B9z zj%O!~7_vep3`vMSo92Oc5p}*=D>FR5Y(;$F?{dACKL&)bZ#g=LVq!l(AlsHX+Syje zYU}!^T7zmMf)y5{T}M4OC{i`lz21KN@YN_bJFF(wXy=oz2!H;nV-8sR6nA^SdPvnt zpzyAjU8utFcAF0ind*^N)9u$DWvKYeZzwH?C}iL_h?RD=)zPJ=Vjm=75a^eh_D^g_ zD8ZhxE%C(_HHu2{t`t8a6~vhHI+fG<+#SW^?5SbilBU}&?ArhrKfCP~)gfIwZJ~Bb z8>$>~C);e)?2-eeNF`4~pu9*?{-*g~bmlg1;8ielLvj%1%fh0|`{a--e#|;`5hW&q148Bo2B1jg{yVsk z8rvci*MC5^g-@lCqn@Y-D^yjfp%=I%lZItHI#XwG$+a|^9uAHmzJt<#w-(6eEMF3}$&g3v3uSz& z5_wkv=~9pD>P%;+!pLjvv^)+Ji1}8;kC@GLA;UA5fD9?ztCLPR8c7LBfK~?(bO0#<#Iw9E7o}X+=oLF41P63m@@6tC7=h7n&;>0u z5~{4-OFBJDlZ~|df*R+amkjv0%xEWe-_PQLRB*}B3|cP#)in{pf1Q%8HUBXpkXOJA zbP%ZH893tY=3ET~*^}Ty)KzZ#;ULOSUE#txiFDAcxnf{CQez-Er$`$`i`x4Yk>ZyR z_QHlx=A-SLtPF)p05`CR3*P{7eu?iOYDXG&U3yXicbikRjL$$hZuSALS$xLANZVbc zs-#-tOxor(gEAdwo&4WeSyDJUss?05T}Bb@4{G4`K*rVqs<_lx<>J(Fwxsmuwk9Iu z$x6kdZ@~BN4G?Jz-sf8v7T@j9nq$LzI=t}?GgfHNDGPWYO^q5C(rYWZ&m|f-7&C;P zJ+QVL$yR%CXgF3WJir~H1TS?3j-P}AGuD$f%BqxzuYL~E)*TWq-jAME{VP2`u+QrpVZmH|{@<|Cba}OSmVgCfp zY<7UJZ>PK*G?_C@hLNXj=J43aN}5aV9Gr#4!9IfEG$^mP8jE%Je66O8M`d0^i8}TL zN3YNNjvc>7CdL8HL[ghw3vvubu8*Mwinx`kuq95p;Pos$L^L_RmLqp(sosi_^C zn{)=Cyz(_R_mJhTPcob7lc{=mio$MUW&k>NrHHcUcuLrV{@R-}oLI>|@074eX6D3tI{Z&X6us8PWW>wKBE`u^v?N zzQI1i1^SHfTW5bf8UE?}^1y@H+0l4twqy$II>}_#f__H7!|1VMF5Wefq4p@@vz&gB z9GY*5OC3B~15PoZbW5A^-xX`GQYrtly3~u89V^d`X5o)lrSY1w)2uTn=S%8+k|3N0 zRK^8xlHwbShnixbrO&D=g<_x>m)n$A`YfEH>Y1FvC~ieMGtCQ|M&B?G=S_ysmpkU} z-~xS&zjEw?{|&)-mv9BI6$8yWFU2L(dKo@lTdw)$=6h0IYp$66W1 zb?WEG^l>DYI<#~kietJOW|6M-66}8ll$l5fNf6#GGP4u;ELNHJdAF4Ai6Ic>b-lW{ z#=Tr~C9RS+FBc&rFUQ_hiSb$Jg5m~QxFMObPSD1#dUG&CxiZgh34^silGZ}hsJ*+t z9rBVSZT=1UVh-s+*O;(sP|d&X*%g^c#r(fi9F|(JYvv|AKUgV2JK3o;iouj`U_@z} zJ9}-+EQoZd@wXbM>BgIh8~Ecb)OF3*E0s)R#bGyd$mcI$*U(?SaR3{a!g>{bV?Q)*)#;raSK%%bUXxn-nZqeym&p) zMvvM95($8apx!{rd^cjMYgk zag!(9X0yj@#f_h;e@3EORy(aSk59O1PaIv~gUa zs9sc86Yc0i7qUX67dja99SXdcfyRG3Yl0f7$+TgAK8BHSAa83NnD*rW5A&s8fA9O9N> z0k?(HPn^=(4r90KZ`}bGynCLoE0U2a;5tsm?d+zrmBEHo`+N*MWCx7)uuK@C%1kU` ztnN7(L8y$|DNy4X8bFF0%)mF1Cn`*Q)GMZ%wlg6Z)1UOMBO!ZiCMCFJotrj-x3J{n{2c zW+knH{uOa5mZuCl9NL+lf|ZeQU7$D6kZ8=GUm2# z5$=;mxRMA8JGJ#f-zN-%RlSd58 zbCJ3ZTR@-Ddcl_DilfF3+m0l3i}Z0e?wd1w;Cs7qoA?%Akueb8wl}Q97<}p!lCFP4 zyzr)uL5j@TBn`Fp5yRm8CplZKxvIAzv&5g%@`)pH9u}3*b%Y6<7|bXQBY@U-xNmCW z28)65dH~`i3Mn1+Fh&kA#@N#unI5TYCSbVi?c07i52D8Mq$V7?dDY}?5@u`qWHW?N z7m`2U*s}go!v8g0^uR_a$)U6=zsj|!(rE7-q3rbz{7SVS}Y3# z90K%^z=I(zF?6-9dvBZlVeK@O`9+I?Es?jL7GBB~m0ML>pkWjGFea$u@OhH}WmGW1 zrik@N4Kcf2ARg~!UPMS(|1qH&;S=jIRX=I`1G1x5#E)-NBfB*1O9L=zcX)1oC4u8<6)p=%KT-?y z54AQ)!bkmNWqSl@2O!~|hUZObLVD)ujcMMkpc|;YK8Y&o2|CF(*4N*RD5Gxaj99>s zMEB_Sdp`(k1`U!_0wj(+=RcuV?XK4(?#en;`JG$$+<>9-Nyo_u(qtVmP3Nmw0}os@ zicyrv=#aM{!Tv+9?NB@6_~Y=$tA`fCKd+H&A~Joztd9d~MH0VVL=t1n1C~Cz`u^c} z{Bn2c%>c(h_Bhu)oot6{*j$8?3hJ?-_9nYk96;fqzZ9JpBt!dX_#cdGXZ|WA2JiCJ zW_|qM4;uH?0S|CDkgd|W%C3t9EM%{_>;%*^El-Sw39XweHj>56c|BC7vf-&+oq z!6#I%W$4v{P_$x`zTkST6(!-s?eWXyQ<-9KSRlelSbt6`QT|w~xPmak#6qxauo%C! z#ad*{f-jYOzh5S2uWiMo>gukMa4zcKSq4E5)-%-v$0TyqoR2){(mYwqpxP% z`MHegvX#I0lFqzZ;6+khE2<=-rl0qHpQdV0pv*vi?K81siCUgW(#JA*&jGdh=5w|d ziL1|xXu0?E)*WvirrDBy>B*; zB@r>N<`+TTrS0Bd>L;R@^?yPOInXL&T(f7kA7gu6rmu%(k1a1Z!#EG8n^&(w*r?wq zkEJN7*4>Hn)L=Ihl4$M=4axj{+2z)9w#LXTJ)X>goj<>W`80^XOYsbI!8P{j)nP?Z zEWBQgN=_VkDT=ZuoDHi3sFXXk`;B#~Os`~6WdWm^r&wGVaZau`lZNy2ca^FV83IQ81=B+=6{ K)~wZd9{E2Og$eWk literal 0 HcmV?d00001 diff --git a/public/images/eraser-outline.png b/public/images/eraser-outline.png new file mode 100644 index 0000000000000000000000000000000000000000..9094359337711dfa59e0b4fb78f250546f952857 GIT binary patch literal 815 zcmV+~1JL}5P)RCwC#o4bn?K@i5LXM5+)2O0@# zXefxOxfly7DE^0n=z(y-p^<1{U}7Z3f|-fnx%23&IjZEN?3HErdXDL?f{)p~+ZVs7 zsjlj(aUq1tY+7>$-JlzEGlQOu`7=F(&h7Me_1LZX-y97+JDjPfZvovY$fN4WPNYuGhwp^h%%^>YO-(EBN&uk-2!$VZ^(;N^n=Cv{Um|DRV2Xs_T4^jzZkU*M!R z6?DA_)*uhC5xP9TMtVYeM!I1s<7UuZ1h$8xkANPJ_Zakj($ezu&7li$3?WN~x@0u~ z{3_`Y=`raReAG|U0qF(lyR7;u^_o+7=^?zVQb2bQmq*BZtOj(4^px~~bOAo%GwCJi zE$Ntl=#T;Qq%qw=7-<;x2z8%yh4hfU`Zm1n7wM4niu4VBTo2GgCeV{)FA`G3qc4)~ zlAbg0%kc8Aq}QY)2H$~t<>f=9va^&CpiA5yJ^T{s17sn8Nbg8*NM97_ZjG1EIkf0% zv`1{<96>6Maz~sU$l9 zz2fYoRg2}EWA~r%rIAUb84DPoJbB4GO&MKn7K%mI6HKhF4H!FNPPdt^!{ObSw;=Pkku?c!vL!8~U8-Rt95}*(&{!L5G)x-W(q2QC<6cD>@C8t|i tcHRcC8@=Y9y_gwvgKlQf&(%%@7ywkqNqWb2SwR2*002ovPDHLkV1fWUh&=!R literal 0 HcmV?d00001 diff --git a/public/images/marker-background.png b/public/images/marker-background.png new file mode 100644 index 0000000000000000000000000000000000000000..7e1d72ceae31cd87fda494630d704d89c2eb0eec GIT binary patch literal 5938 zcmV-27tQF2P)51gm-p!^Yiok{QT?d>%+sttgNiw-rl35qvz-6`1tr`WMmBt z4Davn(9qE6=;-9+*%Ton+5;6lL%4-QT21nxxi1@;?!a{se@Ygiw>bowRK+JxG3p z`n$K2ypt4d%UCLeWJxq$$;6LPfA{tWWsmYj^7Uo@5)b}0B`}sUE0$_1;+v>dd)M0^ z1pQSMyIn*QMY~;5d_4?%7+g`TEV5{Cp;jWh>+KJb{wj8nA2&@-(loIj?Ev<}He9&y zGge^03shHp8YyL6MP0~geKz;t+s%XNE$aCAA=JgrZ>-F5KVOpc2O@)uVtc(T9#`uW z$)!>jLn1*(r2@k)IlGEl$;k}J6dswkM2US^MkIG@H?0PMEDc2ewQ-pL7t%d&t3yyjW27CZ) zB7*P<7TY+L*HEJo7-E?g<30Fx^MH*jxO2rK{1EjnR)l(qy369-Gkov}0&G-9D>81H z%Y@)pQKv;b>aMv5y*l$iA!5#ibf1E{VT5{x+HIbIdi22$lBnX4JG+3|0`Eww<=YqU zsIBKDPrsrjCDbRVqp!z*54+Qs8Zkyz`|JPDzM@J@4ye+KHf_zCJ)2%ruK^;)Z+ zg8E*0De90=|AJP(BkHCk)JxRfAJ%G{Q2$R*$33C`zi4$|5$gX3>b4`)OVs@z*6NB- zuTZPz&wAjRP_MPRt&88RNZJmyOQ?^s-|L=dP5s*yN!y@K2=#(=0jOQ8iBTGmcrCtP zKcymR8`O+YA5ni5+T+TxP_j|1@oSQ{ZTzRg{&mzD=TeBWEIqH&6jvWm7dx%7$jLJ@ zR!EgW5C%aomZT{sv+~%$-oG_!OO&?PcV{&=1bIds-7ZKfxt06TvuOXKRyz!EgF2T2 zgmIoE9-;mb>PmN_HD$!lp#9oSOj@g#2E0nR>pCt^!Uf)hE4-*wFyRgpL;G>vekp3V zC)5kKtmC*IJBmwW>IE$5wFc7Qs{w0%EG!k-sN2OuP8y-!F4*!C2(}u_w|GgoQ5oPC|DWayCB4>{y7MV%4qWeUYpSyR_drjijgS4wM$zu;orT8_4rN)NRA zz{Tk60oJ6|n+c$7>!PSzH<=e{Ks-qhvwtuBF96omTiwA%Sbs{wUqa^N_8z>nLJ zb>I3&)bXO$zc@5TV^@}P;XB$CbxEi%8SpDwUDfD>?Z*)Wxr1*jEr0iQP+!whXF8(? zCguq?oDHs&Y7p*;B`2+ZU#-@&zYVaX*mA%>5AoIMemOQxn%>Ds2s6PZ;{(Hgz+14z zBn;B(_tt9d%&7OpF1GL!A&#hh;e!gtV`sE0QnN%00IUXA#^ zi?z@?JsNOyzYiBg)+ew?tf*AV5{cp7*@r_ z5LvN-e!Q|}wv15Ut<`=5D>D|HjVTlsnuM8kGlkNM_sEuog!*2s_H(TRQ+S4)y)iNB z-A;@W>i0x#;dY00K&{;4c1LbOXocGyGv})JdU1QZgHXSn?Dsl6+r;FDP0ZW^?4_DH zdm(o$tSY>@iCHK@{cfZS9dc0Nd@fB8$I=A2m|?=iGn^|=xK3t$R%wD85b7EA7or9g z2But?4N6RWV8M~OI2RmMy#&r#n`3#|ClwqK>I3Rxr)`|NS=#n!qx+NzcvPZtV|i@~ zob6Gcfph&?WrU*d2=xK=J;lMUi)H`M;QUh5`?{x+|267rB^tk0*FspfpTzmaT1}|e z20Soz;EwAmBRGB9{BUML(C^>KbJ2izgnH?g1qpay?V&x-%I4<0wjJB^;?HW&Te@Wl zp$g@nL2uz{uj&kgxH}c7?^i&7F5FJP)kC+KrJs!IC{R_Ce-iZmYoeYdb&GCsNW&ja;@{hMo$m2wn3c|>O~5r z3a1H2M`_zOAG_wCuh@ioBh)zI2%E6x`9>w4s3+4jWw^sp|AJx@>a9>;+u5o-iOFxY z;?MQc2=%+6#;t2Nvl`Qd`AjeEwWt}PUKnsT?rg2ZRY_Rsis5`Z zxn)=jj14D+XY+fLa^23R_2Nd2VIT(*UE9gm_I|YsgY;96iRX- zg%Z`+H6JWjZd+z;`~<~*8ETh_zM}o=g#haF#3(jh<|nLstPOu?j@4^W*E|i%<6K!H zyg+?vy8};j2ffyvQi_jr3UQVlDE6bV_HUz3?TRJ`{{%ILVR7qd4{OeNGS3ipO{{&J zHGh+}n$E<$1NBhs>c-N2Hr4%CJ!(rQU9)1}VyzjW{v6a_yC}}JJx;LFI!TfgYi(_X zO`5k@>tNtPwmoV()c7vcMdZi2^nDyEt2O6}s{kv+g=-ypZdE_bQ*G)c+TM;T&xZ$L z9}wyfKwZZ=jIbTk(ON026K6Imc9zeb^h{^E97G8ZZC#FT5quoVzza0?Vg^;H`QYR9 z_)SntLVY)CQO~F`lcJIY72AX8Y(`z`YQPHIY<6}7U<=o)5TA4&DmT-?Mp~T`>VHD5 zT%H)Ut`4XNaMyIG!3z`G(`d21v2d>%9WxyS5rStMp=N~o?zK8Stku}$!$XW&yWn8J zhhBr4cc8VHZ3%|D>{FeM<{Y#+)8p_2EeQ47d*I2@1Lr)z6jaZhqgw{boR%6~^NeXP z)Lzxsex=NHc(0e1l?XaE^cxxQh8lV9i>q-E3ZLU@mKe|-bDefMAS1}?F<+wUAxjQp zF|yHSM`dq|4Lxv9sBfa)?=geoXl1fxU9T>>?~p=q3H2KFg+?BeD|1|J zR%kwMdsG2}el!VAs5g?Uo0wp|$1(4RVzUrHw=qtPUhZRxF65l&?~0l_F^{CLl_s>X zM%&9BB0P8t_b^X3tQUt+;z%>E$Ab#XU^=RhuO`V7>Mc=Y!BKL#;0O>Zy#-IV&SHkyY1)j)S#jPncImsJBM_-Grmi zjIjFPiqXdP2=z_WRaZLG2&+%711Ho=1CHn6G3QLoOu8Boe{y#R4aiu!Wms*HUFy&C zf1_oKP;VG)!IFGF;m91LR{TcS?Q5s}6Y6COMTdX4l|CU4d?8u~7ZRg?V?ah5Qet$4 zI{bTMZxT%6l%-AG9Ve*UKRDq?F%gy?mHe+!m)A$s{emrjX$r+7)GN2lzOb`(;-Nj! zMSCe~TC3N=R_|UPC%c?>^m#*~^MrP`RwS_nNvFi0Ir^RA>IG^{jC$ugTk90* zba2OWVAJ{4TcN(=><-<9$#m?}6B1~I`khgm!w+QVU(8RGBDt4)CFTleA(2v6Deik>_=V@>bGI7 z6J=p5)@|8E!1^3DOPL%7M+%V)u@I5DC?#iuC6rLZkjnY$>rvA&Eep|!YkgaqaFku0 zTM4Yy?Gkk)QeZqNfz4To5MwvJz)t!^N*Pa&H$qKQ{@1AQtu6bC8bs}^P`AQGqpi$v z1epq)q2NeY0A!XZ)MlYJL7nj=2xzBTHTJudHjzMLKZ_S-62jTpdKxJ@+#B{ zLVppKrFR@0OsF40z1Hd>O&u}hyQ-gYu0gqEtH#myt^?1q< z^=v&+tB07eWad`@@3t+50)JrH=D7?0y0v=0YutoTKT)gSI<6+v&(vx{{XwYP`-82F zwEAN+C|4#NT~3$fCWZ1rIdDR~Abokl(Phb}#3*U?C!)SK;pnnBu41%Se<@=4l5uU>2p#vBOs2L@aE?qF-0eDv56sDygE6pFq(g<=}( zA8o5A)SHRccUPf2WiBD1-V$~G2glwJYC=t@2{oZ6)P$N)e;#T@sQ)jh8KM5apq7OC z|AIPb?@yupvmA0SgnA<}qu;Ij6Qlnuhm7h=QB!xvf^?yE`Gf6_f0lVr=_^sYC80i| zo{nj;eqYA(eO`(>;)ME$`tpoXGn(#th1sPSzrAHT%?Vh4?a6>|g*w91(_SG}RSBGU zMyNML{TkBnSMRa@kWg=Ezy)8MUaSEY>WV$ap`+(7nyYIQ?z-am)KwfDn#JEI=b%=j=$m@zu<61iY4=T^6Sovt_S<8-V|Z9YBP7!(fZ8gDo?oOdQU*Jv+nP zvV?W=BF;5y1s<;0EUq<&XASm+bUMu9=!;Nqm_kX`wPiJqC=-Cvzm!GGj^mRWSR-nSP;Z+UFx0$y{@Na{UoSAk9(;#TZ;$%4G~o)(8&JQiB%M*WgnCodm3u*}(G*`} z_w(}L3AG@tek0VQ^`4gFf2r+nBhu=(Mco}yBWS?v8~KMr)QUt(R+LXgtZ|R|PS(b7$HNd6Ln@?50k}*gJEE3^`aMu1 z={6JPaW|?ISv%Gf+$Bm#uG(T?Y>4Ybf;zh*MNQufwN0qks2xO&q#G*w3-57IU zJl(iZ$}O&E%aT{4ZURDmh8mT+>_T_+!uC__)nsnim5xzsBwf!@w>5@g_vTlowfg0# zb3(mBT>@%6S1Ij!b}-f^cLw~kr0=9zt${SCxhu-v^ZF7`-1F~dy_HtSf>58Lj-tj2 zyKsGAF}i9Ns5LhF6i7O^pZhNaWejSzw_Hnbhed) zvBt1l^j#mMoTm_m^#YCk!36AY?^jp+)j9AcCDbRV>j+GB-+}#J4T{|t@CjgDpP{RU zCLZH#*TJGujKI^`2JB76k=f$@)_|**Yjr}Xm#9O7y3M>!;Y{F_M-7^+IuDdRf)9gR zb|ucJ%yS62IXrP&RBLeHOblkK(Jrg@gxYzvR=1o`UqJ03>gE)6j;JvcUdJs2W6Xrz ze%x9Po5Qeq=kuFQ&&hy0FV||9P%lvjHw`#MTQzv!5R5tKq8I3)nJ^4L8im;=!4S;4 zx;HYRc3+RWBGhZtvs;#3cFTaT5AJv0rJ$E4#NNeLmYPL;^w+>o^ZGDd?u{({wC%K- zP_IxshhWP+54Ic=Y=Ktiu$XgTYZ7M#Jmp~7jlX6*bCez}`fe<9Ku_&ZiMSbRa1e;_ z5w#doDDCAG3M|RsY1g&!+m5K~c0?VczlNT<-~yfU*4&Tl_s$H(7=PIqS8t)!bSCC0 z>Nzp$m=OAy7`3LvXf!V7O9Sq}N5g_eypF*hlw83V`~qVZOb*qLV}H(_&RYHQ+A_B% z)TgMyR>P{?O9zbgVY?$gYENi5p}nLRuk%T)N{d+7be&e4`H$?II`K8={DZ@F)`|z#At?=-T3b7wHjB0z6(QG z%p2p;PpCJDt4l(?K+W7k8DW-$Ue}iw$_VkJFm88*l5-i%+a0)Wx2GQX5p@2VWN8m9}w=d-vP4Y+m5fWKa=osdv3P$%n>|11sczVmuJl*^L; zLuo>2N)v?Jj-?6v^K6;102kb{Ewnly)aR&=jXc@Z$kVPGdFFznvEHbi3y#K5$T|l; zS^z6Eg(~|kQ9FeC66#y+c~{B^FYIhxNug|^)igQyGU^*mw^xdTFYH%eNQ@Hd_d51G|2tz`uf`WCMKbNH`Kp2_J&ZuM+)WCO8>$z zD?+_BY6y{ke?(nQsJE8=UWe)@gD3rI@MQhd!ILhb-k5ZuOa7v9vV?k5)L(`6q)eH+ z9PT^~iMFyQ4vAK2Rhi}yLcI}c9Q}SOo#%P@jndl-2}TLaFbHIN6mCxLI2j1P9R2PB zX-{iGsJBEN0o%%aJxSnKRn?UP9jsR$=s>8~s4pJVQY{}==c12a7g+0yAD#Z?$FvaY zwE?&J=`kH>iQP%YgOg5=Sz6uz>vYCPQ_kSahz!;e+E~o+^23)1^~x=SXzNKwsqa_AI~nqo|`i)FemomOa&f3ia16?%wK8-OV}YtKX|c z^koTeiV#Ac|C1@p{N2}|M2!ieu&TT}{(Qkr5$P>q?mG(}aeDutxz9uWRTM!mZl``P zSPuQImOSK@^6ox_f3?{0zR(EfYyE{`mUGOslJv&?d^{aPOz0ql!s%lK_2r2{>^a^@4CTB$Ujn=xNQGRI0 z`z(;@KhS${!rCM7s6fo!z)rdiT{|Wlz+_Rr0@nh#QQR%)8e)lgAF={?4Lq`R1T76G z1=wx8pQuY#VPQwC&;h;I!Q;IIU^o_d3c#D)fR4)#Vb@p@Ox`Egg2rO*;a#chWs-v- z0ynBNZ2P)~beOb+G}t#O;{*ngz!3~JSVIJ`jjoY4Of#-)*`RXG(`GNx=DIM`pFY+W17{Yg=Jm1$X9&L`f{Tds3YiE!LTNRVgM2uNnAL2W)qh&lAr*1BrJL+%e+5GdIrG1azIoff}?+HK$v^5+e>d#qMQ1jpbQ0Q8pd;nNy+o?i+epSBimgQfA?n_xwly!0aJ z3;Znx69n59(A&a)C;b3C%hD10AVXirzI%v2V~Uxxq^FJ@Hw7!8A)wp*Ryi!ZZ$^}} zb7ozON$Yljb(^a33WINhOV9vRIihzg;zrtUu#0@U&04OLHbS60PkIZ%5G_^i3?}^w zwQTkx2k!Wp^l%lF?(zZ2z3@Q!bL7@_=y>9>mvn~xvia;z(jC%vs7$dst%<#fFk?f^ zRZ#RTbUg8Bu^YL;73VNtGr{x_=>cgQq?3bUWehlEAC7fxfmji`UoAZm(0`GBkoGa; z&-}TC9AxjZ-$$TIY!}E}UqOZISU zvKm<&)z#mp<%wro027+MqySzXu(lZ1bJ9!FX3`PTY|>Kp|LD^rk^AH78pz0;Vox$3 z*P;5jhPGY1qQgt8;=|-R`0^dR7c*31(pS~kQC-tfNcjR?#;cEfZJ8R|IUNPHilEEQ zFKjhH@baI&D>-o!4^F{$K~q?IuODL6MS@`Oe>sC5f!A^Er>BmrMytOYXkvg><0p*0 zA6Piy5#Mc|*lzwCvr4}4L-hrEC=!L5Bc8>;N{z?T^DG~a-fALe4@If3GThW9sCLbk z!a33lu#VV+%rEO;dbRp^f_eX_rr110A>3{V(*g4<`^VDG$2#0D74Q(vF*r zIvtq#r0U-`;?Uuqe6jZNwo13B8oEqDZCYq6P}v9R%N~puKMHW=|A_;%Pn%v|{QM;g zzL$weK_cP2UtRrTx;s@>H7e*8^lD7P_$|NyBb<@MP07Nn00000NkvXXu0mjf+wybo literal 0 HcmV?d00001 diff --git a/public/index.html b/public/index.html new file mode 100644 index 0000000..1f58d9a --- /dev/null +++ b/public/index.html @@ -0,0 +1,206 @@ + + + + SimplyColor + + + + + + + + +
+

SimplyColor

+
+
    +

  • Home

    • +
+
+ +
+ Save + +
+

Instructions

+

+
+
+

About

+

Name : SimplyColor
Version : 1.0
Developers : William Melon and Khulekani Ngongoma

+
+
+
+ +
+
+ +
+

SimplyColor

+
+
    +

  • Collection

    • +
+ +
+
+ +
+
+ + + +
+

SimplyColor

+
+
    +

  • Beginner Tournament

    • +
+ +
+
+ +
+
+ +
+

SimplyColor

+
+
    +

  • Intermediate Tournament

    • +
+ +
+
+ +
+
+ +
+

SimplyColor

+
+
    +

  • Pro Tournament

    • +
+ +
+
+ +
+
+ +
+

SimplyColor

+
+
    +

  • Chat

    • +
+ +
+
+ +
+
+ + + + + + + + \ No newline at end of file diff --git a/public/js/drawingApp.js b/public/js/drawingApp.js new file mode 100644 index 0000000..a692b80 --- /dev/null +++ b/public/js/drawingApp.js @@ -0,0 +1,452 @@ +// Copyright 2010 William Malone (www.williammalone.com) +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +/*jslint browser: true */ +/*global G_vmlCanvasManager */ + +var drawingApp = (function () { + + "use strict"; + + var canvas, + context, + canvasWidth = 490, + canvasHeight = 220, + colorPurple = "#cb3594", + colorGreen = "#659b41", + colorYellow = "#ffcf33", + colorBrown = "#986928", + outlineImage = new Image(), + crayonImage = new Image(), + markerImage = new Image(), + eraserImage = new Image(), + crayonBackgroundImage = new Image(), + markerBackgroundImage = new Image(), + eraserBackgroundImage = new Image(), + crayonTextureImage = new Image(), + clickX = [], + clickY = [], + clickColor = [], + clickTool = [], + clickSize = [], + clickDrag = [], + paint = false, + curColor = colorPurple, + curTool = "crayon", + curSize = "normal", + mediumStartX = 18, + mediumStartY = 19, + mediumImageWidth = 93, + mediumImageHeight = 46, + drawingAreaX = 111, + drawingAreaY = 11, + drawingAreaWidth = 267, + drawingAreaHeight = 200, + toolHotspotStartY = 23, + toolHotspotHeight = 38, + sizeHotspotStartY = 157, + sizeHotspotHeight = 36, + totalLoadResources = 8, + curLoadResNum = 0, + sizeHotspotWidthObject = { + huge: 39, + large: 25, + normal: 18, + small: 16 + }, + + // Clears the canvas. + clearCanvas = function () { + + context.clearRect(0, 0, canvasWidth, canvasHeight); + }, + + // Redraws the canvas. + redraw = function () { + + var locX, + locY, + radius, + i, + selected, + + drawCrayon = function (x, y, color, selected) { + + context.beginPath(); + context.moveTo(x + 41, y + 11); + context.lineTo(x + 41, y + 35); + context.lineTo(x + 29, y + 35); + context.lineTo(x + 29, y + 33); + context.lineTo(x + 11, y + 27); + context.lineTo(x + 11, y + 19); + context.lineTo(x + 29, y + 13); + context.lineTo(x + 29, y + 11); + context.lineTo(x + 41, y + 11); + context.closePath(); + context.fillStyle = color; + context.fill(); + + if (selected) { + context.drawImage(crayonImage, x, y, mediumImageWidth, mediumImageHeight); + } else { + context.drawImage(crayonImage, 0, 0, 59, mediumImageHeight, x, y, 59, mediumImageHeight); + } + }, + + drawMarker = function (x, y, color, selected) { + + context.beginPath(); + context.moveTo(x + 10, y + 24); + context.lineTo(x + 10, y + 24); + context.lineTo(x + 22, y + 16); + context.lineTo(x + 22, y + 31); + context.closePath(); + context.fillStyle = color; + context.fill(); + + if (selected) { + context.drawImage(markerImage, x, y, mediumImageWidth, mediumImageHeight); + } else { + context.drawImage(markerImage, 0, 0, 59, mediumImageHeight, x, y, 59, mediumImageHeight); + } + }; + + // Make sure required resources are loaded before redrawing + if (curLoadResNum < totalLoadResources) { + return; + } + + clearCanvas(); + + if (curTool === "crayon") { + + // Draw the crayon tool background + context.drawImage(crayonBackgroundImage, 0, 0, canvasWidth, canvasHeight); + + // Draw purple crayon + selected = (curColor === colorPurple); + locX = selected ? 18 : 52; + locY = 19; + drawCrayon(locX, locY, colorPurple, selected); + + // Draw green crayon + selected = (curColor === colorGreen); + locX = selected ? 18 : 52; + locY += 46; + drawCrayon(locX, locY, colorGreen, selected); + + // Draw yellow crayon + selected = (curColor === colorYellow); + locX = selected ? 18 : 52; + locY += 46; + drawCrayon(locX, locY, colorYellow, selected); + + // Draw brown crayon + selected = (curColor === colorBrown); + locX = selected ? 18 : 52; + locY += 46; + drawCrayon(locX, locY, colorBrown, selected); + + } else if (curTool === "marker") { + + // Draw the marker tool background + context.drawImage(markerBackgroundImage, 0, 0, canvasWidth, canvasHeight); + + // Draw purple marker + selected = (curColor === colorPurple); + locX = selected ? 18 : 52; + locY = 19; + drawMarker(locX, locY, colorPurple, selected); + + // Draw green marker + selected = (curColor === colorGreen); + locX = selected ? 18 : 52; + locY += 46; + drawMarker(locX, locY, colorGreen, selected); + + // Draw yellow marker + selected = (curColor === colorYellow); + locX = selected ? 18 : 52; + locY += 46; + drawMarker(locX, locY, colorYellow, selected); + + // Draw brown marker + selected = (curColor === colorBrown); + locX = selected ? 18 : 52; + locY += 46; + drawMarker(locX, locY, colorBrown, selected); + + } else if (curTool === "eraser") { + + context.drawImage(eraserBackgroundImage, 0, 0, canvasWidth, canvasHeight); + context.drawImage(eraserImage, 18, 19, mediumImageWidth, mediumImageHeight); + } + + // Draw line on ruler to indicate size + switch (curSize) { + case "small": + locX = 467; + break; + case "normal": + locX = 450; + break; + case "large": + locX = 428; + break; + case "huge": + locX = 399; + break; + default: + break; + } + locY = 189; + context.beginPath(); + context.rect(locX, locY, 2, 12); + context.closePath(); + context.fillStyle = '#333333'; + context.fill(); + + // Keep the drawing in the drawing area + context.save(); + context.beginPath(); + context.rect(drawingAreaX, drawingAreaY, drawingAreaWidth, drawingAreaHeight); + context.clip(); + + // For each point drawn + for (i = 0; i < clickX.length; i += 1) { + + // Set the drawing radius + switch (clickSize[i]) { + case "small": + radius = 2; + break; + case "normal": + radius = 5; + break; + case "large": + radius = 10; + break; + case "huge": + radius = 20; + break; + default: + break; + } + + // Set the drawing path + context.beginPath(); + // If dragging then draw a line between the two points + if (clickDrag[i] && i) { + context.moveTo(clickX[i - 1], clickY[i - 1]); + } else { + // The x position is moved over one pixel so a circle even if not dragging + context.moveTo(clickX[i] - 1, clickY[i]); + } + context.lineTo(clickX[i], clickY[i]); + + // Set the drawing color + if (clickTool[i] === "eraser") { + //context.globalCompositeOperation = "destination-out"; // To erase instead of draw over with white + context.strokeStyle = 'white'; + } else { + //context.globalCompositeOperation = "source-over"; // To erase instead of draw over with white + context.strokeStyle = clickColor[i]; + } + context.lineCap = "round"; + context.lineJoin = "round"; + context.lineWidth = radius; + context.stroke(); + } + context.closePath(); + //context.globalCompositeOperation = "source-over";// To erase instead of draw over with white + context.restore(); + + // Overlay a crayon texture (if the current tool is crayon) + if (curTool === "crayon") { + context.globalAlpha = 0.4; // No IE support + context.drawImage(crayonTextureImage, 0, 0, canvasWidth, canvasHeight); + } + context.globalAlpha = 1; // No IE support + + // Draw the outline image + context.drawImage(outlineImage, drawingAreaX, drawingAreaY, drawingAreaWidth, drawingAreaHeight); + }, + + // Adds a point to the drawing array. + // @param x + // @param y + // @param dragging + addClick = function (x, y, dragging) { + + clickX.push(x); + clickY.push(y); + clickTool.push(curTool); + clickColor.push(curColor); + clickSize.push(curSize); + clickDrag.push(dragging); + }, + + // Add mouse and touch event listeners to the canvas + createUserEvents = function () { + + var press = function (e) { + // Mouse down location + var sizeHotspotStartX, + mouseX = e.pageX - this.offsetLeft, + mouseY = e.pageY - this.offsetTop; + + if (mouseX < drawingAreaX) { // Left of the drawing area + if (mouseX > mediumStartX) { + if (mouseY > mediumStartY && mouseY < mediumStartY + mediumImageHeight) { + curColor = colorPurple; + } else if (mouseY > mediumStartY + mediumImageHeight && mouseY < mediumStartY + mediumImageHeight * 2) { + curColor = colorGreen; + } else if (mouseY > mediumStartY + mediumImageHeight * 2 && mouseY < mediumStartY + mediumImageHeight * 3) { + curColor = colorYellow; + } else if (mouseY > mediumStartY + mediumImageHeight * 3 && mouseY < mediumStartY + mediumImageHeight * 4) { + curColor = colorBrown; + } + } + } else if (mouseX > drawingAreaX + drawingAreaWidth) { // Right of the drawing area + + if (mouseY > toolHotspotStartY) { + if (mouseY > sizeHotspotStartY) { + sizeHotspotStartX = drawingAreaX + drawingAreaWidth; + if (mouseY < sizeHotspotStartY + sizeHotspotHeight && mouseX > sizeHotspotStartX) { + if (mouseX < sizeHotspotStartX + sizeHotspotWidthObject.huge) { + curSize = "huge"; + } else if (mouseX < sizeHotspotStartX + sizeHotspotWidthObject.large + sizeHotspotWidthObject.huge) { + curSize = "large"; + } else if (mouseX < sizeHotspotStartX + sizeHotspotWidthObject.normal + sizeHotspotWidthObject.large + sizeHotspotWidthObject.huge) { + curSize = "normal"; + } else if (mouseX < sizeHotspotStartX + sizeHotspotWidthObject.small + sizeHotspotWidthObject.normal + sizeHotspotWidthObject.large + sizeHotspotWidthObject.huge) { + curSize = "small"; + } + } + } else { + if (mouseY < toolHotspotStartY + toolHotspotHeight) { + curTool = "crayon"; + } else if (mouseY < toolHotspotStartY + toolHotspotHeight * 2) { + curTool = "marker"; + } else if (mouseY < toolHotspotStartY + toolHotspotHeight * 3) { + curTool = "eraser"; + } + } + } + } + paint = true; + addClick(mouseX, mouseY, false); + redraw(); + }, + + drag = function (e) { + if (paint) { + addClick(e.pageX - this.offsetLeft, e.pageY - this.offsetTop, true); + redraw(); + } + // Prevent the whole page from dragging if on mobile + e.preventDefault(); + }, + + release = function () { + paint = false; + redraw(); + }, + + cancel = function () { + paint = false; + }; + + // Add mouse event listeners to canvas element + canvas.addEventListener("mousedown", press, false); + canvas.addEventListener("mousemove", drag, false); + canvas.addEventListener("mouseup", release); + canvas.addEventListener("mouseout", cancel, false); + + // Add touch event listeners to canvas element + canvas.addEventListener("touchstart", press, false); + canvas.addEventListener("touchmove", drag, false); + canvas.addEventListener("touchend", release, false); + canvas.addEventListener("touchcancel", cancel, false); + }, + + // Calls the redraw function after all neccessary resources are loaded. + resourceLoaded = function () { + + curLoadResNum += 1; + if (curLoadResNum === totalLoadResources) { + redraw(); + createUserEvents(); + } + }, + + // loads an image to color + loadBackgroundImage = function(image){ + + outlineImage.onload = resourceLoaded; + outlineImage.src = "images/background/"+image; + + }, + // returns an image to color + getBackgroundImage = function(){ + // this function will emit a message get the current randomly chose image for all connected users + return "watermelon-duck-outline.png"; + }, + + // Creates a canvas element, loads images, adds events, and draws the canvas for the first time. + init = function () { + + // Create the canvas (Neccessary for IE because it doesn't know what a canvas element is) + canvas = document.createElement('canvas'); + canvas.setAttribute('width', canvasWidth); + canvas.setAttribute('height', canvasHeight); + canvas.setAttribute('id', 'canvas'); + document.getElementById('canvasDiv').appendChild(canvas); + if (typeof G_vmlCanvasManager !== "undefined") { + canvas = G_vmlCanvasManager.initElement(canvas); + } + context = canvas.getContext("2d"); // Grab the 2d canvas context + // Note: The above code is a workaround for IE 8 and lower. Otherwise we could have used: + // context = document.getElementById('canvas').getContext("2d"); + + // Load images + crayonImage.onload = resourceLoaded; + crayonImage.src = "images/crayon-outline.png"; + + markerImage.onload = resourceLoaded; + markerImage.src = "images/marker-outline.png"; + + eraserImage.onload = resourceLoaded; + eraserImage.src = "images/eraser-outline.png"; + + crayonBackgroundImage.onload = resourceLoaded; + crayonBackgroundImage.src = "images/crayon-background.png"; + + markerBackgroundImage.onload = resourceLoaded; + markerBackgroundImage.src = "images/marker-background.png"; + + eraserBackgroundImage.onload = resourceLoaded; + eraserBackgroundImage.src = "images/eraser-background.png"; + + crayonTextureImage.onload = resourceLoaded; + crayonTextureImage.src = "images/crayon-texture.png"; + + + loadBackgroundImage(getBackgroundImage()); + }; + + return { + init: init + }; +}()); \ No newline at end of file diff --git a/public/js/excanvas.js b/public/js/excanvas.js new file mode 100644 index 0000000..367764b --- /dev/null +++ b/public/js/excanvas.js @@ -0,0 +1,924 @@ +// Copyright 2006 Google Inc. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + + +// Known Issues: +// +// * Patterns are not implemented. +// * Radial gradient are not implemented. The VML version of these look very +// different from the canvas one. +// * Clipping paths are not implemented. +// * Coordsize. The width and height attribute have higher priority than the +// width and height style values which isn't correct. +// * Painting mode isn't implemented. +// * Canvas width/height should is using content-box by default. IE in +// Quirks mode will draw the canvas using border-box. Either change your +// doctype to HTML5 +// (http://www.whatwg.org/specs/web-apps/current-work/#the-doctype) +// or use Box Sizing Behavior from WebFX +// (http://webfx.eae.net/dhtml/boxsizing/boxsizing.html) +// * Non uniform scaling does not correctly scale strokes. +// * Optimize. There is always room for speed improvements. + +// Only add this code if we do not already have a canvas implementation +if (!document.createElement('canvas').getContext) { + +(function() { + + // alias some functions to make (compiled) code shorter + var m = Math; + var mr = m.round; + var ms = m.sin; + var mc = m.cos; + var abs = m.abs; + var sqrt = m.sqrt; + + // this is used for sub pixel precision + var Z = 10; + var Z2 = Z / 2; + + /** + * This funtion is assigned to the elements as element.getContext(). + * @this {HTMLElement} + * @return {CanvasRenderingContext2D_} + */ + function getContext() { + return this.context_ || + (this.context_ = new CanvasRenderingContext2D_(this)); + } + + var slice = Array.prototype.slice; + + /** + * Binds a function to an object. The returned function will always use the + * passed in {@code obj} as {@code this}. + * + * Example: + * + * g = bind(f, obj, a, b) + * g(c, d) // will do f.call(obj, a, b, c, d) + * + * @param {Function} f The function to bind the object to + * @param {Object} obj The object that should act as this when the function + * is called + * @param {*} var_args Rest arguments that will be used as the initial + * arguments when the function is called + * @return {Function} A new function that has bound this + */ + function bind(f, obj, var_args) { + var a = slice.call(arguments, 2); + return function() { + return f.apply(obj, a.concat(slice.call(arguments))); + }; + } + + var G_vmlCanvasManager_ = { + init: function(opt_doc) { + if (/MSIE/.test(navigator.userAgent) && !window.opera) { + var doc = opt_doc || document; + // Create a dummy element so that IE will allow canvas elements to be + // recognized. + doc.createElement('canvas'); + doc.attachEvent('onreadystatechange', bind(this.init_, this, doc)); + } + }, + + init_: function(doc) { + // create xmlns + if (!doc.namespaces['g_vml_']) { + doc.namespaces.add('g_vml_', 'urn:schemas-microsoft-com:vml', + '#default#VML'); + + } + if (!doc.namespaces['g_o_']) { + doc.namespaces.add('g_o_', 'urn:schemas-microsoft-com:office:office', + '#default#VML'); + } + + // Setup default CSS. Only add one style sheet per document + if (!doc.styleSheets['ex_canvas_']) { + var ss = doc.createStyleSheet(); + ss.owningElement.id = 'ex_canvas_'; + ss.cssText = 'canvas{display:inline-block;overflow:hidden;' + + // default size is 300x150 in Gecko and Opera + 'text-align:left;width:300px;height:150px}' + + 'g_vml_\\:*{behavior:url(#default#VML)}' + + 'g_o_\\:*{behavior:url(#default#VML)}'; + + } + + // find all canvas elements + var els = doc.getElementsByTagName('canvas'); + for (var i = 0; i < els.length; i++) { + this.initElement(els[i]); + } + }, + + /** + * Public initializes a canvas element so that it can be used as canvas + * element from now on. This is called automatically before the page is + * loaded but if you are creating elements using createElement you need to + * make sure this is called on the element. + * @param {HTMLElement} el The canvas element to initialize. + * @return {HTMLElement} the element that was created. + */ + initElement: function(el) { + if (!el.getContext) { + + el.getContext = getContext; + + // Remove fallback content. There is no way to hide text nodes so we + // just remove all childNodes. We could hide all elements and remove + // text nodes but who really cares about the fallback content. + el.innerHTML = ''; + + // do not use inline function because that will leak memory + el.attachEvent('onpropertychange', onPropertyChange); + el.attachEvent('onresize', onResize); + + var attrs = el.attributes; + if (attrs.width && attrs.width.specified) { + // TODO: use runtimeStyle and coordsize + // el.getContext().setWidth_(attrs.width.nodeValue); + el.style.width = attrs.width.nodeValue + 'px'; + } else { + el.width = el.clientWidth; + } + if (attrs.height && attrs.height.specified) { + // TODO: use runtimeStyle and coordsize + // el.getContext().setHeight_(attrs.height.nodeValue); + el.style.height = attrs.height.nodeValue + 'px'; + } else { + el.height = el.clientHeight; + } + //el.getContext().setCoordsize_() + } + return el; + } + }; + + function onPropertyChange(e) { + var el = e.srcElement; + + switch (e.propertyName) { + case 'width': + el.style.width = el.attributes.width.nodeValue + 'px'; + el.getContext().clearRect(); + break; + case 'height': + el.style.height = el.attributes.height.nodeValue + 'px'; + el.getContext().clearRect(); + break; + } + } + + function onResize(e) { + var el = e.srcElement; + if (el.firstChild) { + el.firstChild.style.width = el.clientWidth + 'px'; + el.firstChild.style.height = el.clientHeight + 'px'; + } + } + + G_vmlCanvasManager_.init(); + + // precompute "00" to "FF" + var dec2hex = []; + for (var i = 0; i < 16; i++) { + for (var j = 0; j < 16; j++) { + dec2hex[i * 16 + j] = i.toString(16) + j.toString(16); + } + } + + function createMatrixIdentity() { + return [ + [1, 0, 0], + [0, 1, 0], + [0, 0, 1] + ]; + } + + function matrixMultiply(m1, m2) { + var result = createMatrixIdentity(); + + for (var x = 0; x < 3; x++) { + for (var y = 0; y < 3; y++) { + var sum = 0; + + for (var z = 0; z < 3; z++) { + sum += m1[x][z] * m2[z][y]; + } + + result[x][y] = sum; + } + } + return result; + } + + function copyState(o1, o2) { + o2.fillStyle = o1.fillStyle; + o2.lineCap = o1.lineCap; + o2.lineJoin = o1.lineJoin; + o2.lineWidth = o1.lineWidth; + o2.miterLimit = o1.miterLimit; + o2.shadowBlur = o1.shadowBlur; + o2.shadowColor = o1.shadowColor; + o2.shadowOffsetX = o1.shadowOffsetX; + o2.shadowOffsetY = o1.shadowOffsetY; + o2.strokeStyle = o1.strokeStyle; + o2.globalAlpha = o1.globalAlpha; + o2.arcScaleX_ = o1.arcScaleX_; + o2.arcScaleY_ = o1.arcScaleY_; + o2.lineScale_ = o1.lineScale_; + } + + function processStyle(styleString) { + var str, alpha = 1; + + styleString = String(styleString); + if (styleString.substring(0, 3) == 'rgb') { + var start = styleString.indexOf('(', 3); + var end = styleString.indexOf(')', start + 1); + var guts = styleString.substring(start + 1, end).split(','); + + str = '#'; + for (var i = 0; i < 3; i++) { + str += dec2hex[Number(guts[i])]; + } + + if (guts.length == 4 && styleString.substr(3, 1) == 'a') { + alpha = guts[3]; + } + } else { + str = styleString; + } + + return {color: str, alpha: alpha}; + } + + function processLineCap(lineCap) { + switch (lineCap) { + case 'butt': + return 'flat'; + case 'round': + return 'round'; + case 'square': + default: + return 'square'; + } + } + + /** + * This class implements CanvasRenderingContext2D interface as described by + * the WHATWG. + * @param {HTMLElement} surfaceElement The element that the 2D context should + * be associated with + */ + function CanvasRenderingContext2D_(surfaceElement) { + this.m_ = createMatrixIdentity(); + + this.mStack_ = []; + this.aStack_ = []; + this.currentPath_ = []; + + // Canvas context properties + this.strokeStyle = '#000'; + this.fillStyle = '#000'; + + this.lineWidth = 1; + this.lineJoin = 'miter'; + this.lineCap = 'butt'; + this.miterLimit = Z * 1; + this.globalAlpha = 1; + this.canvas = surfaceElement; + + var el = surfaceElement.ownerDocument.createElement('div'); + el.style.width = surfaceElement.clientWidth + 'px'; + el.style.height = surfaceElement.clientHeight + 'px'; + el.style.overflow = 'hidden'; + el.style.position = 'absolute'; + surfaceElement.appendChild(el); + + this.element_ = el; + this.arcScaleX_ = 1; + this.arcScaleY_ = 1; + this.lineScale_ = 1; + } + + var contextPrototype = CanvasRenderingContext2D_.prototype; + contextPrototype.clearRect = function() { + this.element_.innerHTML = ''; + }; + + contextPrototype.beginPath = function() { + // TODO: Branch current matrix so that save/restore has no effect + // as per safari docs. + this.currentPath_ = []; + }; + + contextPrototype.moveTo = function(aX, aY) { + var p = this.getCoords_(aX, aY); + this.currentPath_.push({type: 'moveTo', x: p.x, y: p.y}); + this.currentX_ = p.x; + this.currentY_ = p.y; + }; + + contextPrototype.lineTo = function(aX, aY) { + var p = this.getCoords_(aX, aY); + this.currentPath_.push({type: 'lineTo', x: p.x, y: p.y}); + + this.currentX_ = p.x; + this.currentY_ = p.y; + }; + + contextPrototype.bezierCurveTo = function(aCP1x, aCP1y, + aCP2x, aCP2y, + aX, aY) { + var p = this.getCoords_(aX, aY); + var cp1 = this.getCoords_(aCP1x, aCP1y); + var cp2 = this.getCoords_(aCP2x, aCP2y); + bezierCurveTo(this, cp1, cp2, p); + }; + + // Helper function that takes the already fixed cordinates. + function bezierCurveTo(self, cp1, cp2, p) { + self.currentPath_.push({ + type: 'bezierCurveTo', + cp1x: cp1.x, + cp1y: cp1.y, + cp2x: cp2.x, + cp2y: cp2.y, + x: p.x, + y: p.y + }); + self.currentX_ = p.x; + self.currentY_ = p.y; + } + + contextPrototype.quadraticCurveTo = function(aCPx, aCPy, aX, aY) { + // the following is lifted almost directly from + // http://developer.mozilla.org/en/docs/Canvas_tutorial:Drawing_shapes + + var cp = this.getCoords_(aCPx, aCPy); + var p = this.getCoords_(aX, aY); + + var cp1 = { + x: this.currentX_ + 2.0 / 3.0 * (cp.x - this.currentX_), + y: this.currentY_ + 2.0 / 3.0 * (cp.y - this.currentY_) + }; + var cp2 = { + x: cp1.x + (p.x - this.currentX_) / 3.0, + y: cp1.y + (p.y - this.currentY_) / 3.0 + }; + + bezierCurveTo(this, cp1, cp2, p); + }; + + contextPrototype.arc = function(aX, aY, aRadius, + aStartAngle, aEndAngle, aClockwise) { + aRadius *= Z; + var arcType = aClockwise ? 'at' : 'wa'; + + var xStart = aX + mc(aStartAngle) * aRadius - Z2; + var yStart = aY + ms(aStartAngle) * aRadius - Z2; + + var xEnd = aX + mc(aEndAngle) * aRadius - Z2; + var yEnd = aY + ms(aEndAngle) * aRadius - Z2; + + // IE won't render arches drawn counter clockwise if xStart == xEnd. + if (xStart == xEnd && !aClockwise) { + xStart += 0.125; // Offset xStart by 1/80 of a pixel. Use something + // that can be represented in binary + } + + var p = this.getCoords_(aX, aY); + var pStart = this.getCoords_(xStart, yStart); + var pEnd = this.getCoords_(xEnd, yEnd); + + this.currentPath_.push({type: arcType, + x: p.x, + y: p.y, + radius: aRadius, + xStart: pStart.x, + yStart: pStart.y, + xEnd: pEnd.x, + yEnd: pEnd.y}); + + }; + + contextPrototype.rect = function(aX, aY, aWidth, aHeight) { + this.moveTo(aX, aY); + this.lineTo(aX + aWidth, aY); + this.lineTo(aX + aWidth, aY + aHeight); + this.lineTo(aX, aY + aHeight); + this.closePath(); + }; + + contextPrototype.strokeRect = function(aX, aY, aWidth, aHeight) { + var oldPath = this.currentPath_; + this.beginPath(); + + this.moveTo(aX, aY); + this.lineTo(aX + aWidth, aY); + this.lineTo(aX + aWidth, aY + aHeight); + this.lineTo(aX, aY + aHeight); + this.closePath(); + this.stroke(); + + this.currentPath_ = oldPath; + }; + + contextPrototype.fillRect = function(aX, aY, aWidth, aHeight) { + var oldPath = this.currentPath_; + this.beginPath(); + + this.moveTo(aX, aY); + this.lineTo(aX + aWidth, aY); + this.lineTo(aX + aWidth, aY + aHeight); + this.lineTo(aX, aY + aHeight); + this.closePath(); + this.fill(); + + this.currentPath_ = oldPath; + }; + + contextPrototype.createLinearGradient = function(aX0, aY0, aX1, aY1) { + var gradient = new CanvasGradient_('gradient'); + gradient.x0_ = aX0; + gradient.y0_ = aY0; + gradient.x1_ = aX1; + gradient.y1_ = aY1; + return gradient; + }; + + contextPrototype.createRadialGradient = function(aX0, aY0, aR0, + aX1, aY1, aR1) { + var gradient = new CanvasGradient_('gradientradial'); + gradient.x0_ = aX0; + gradient.y0_ = aY0; + gradient.r0_ = aR0; + gradient.x1_ = aX1; + gradient.y1_ = aY1; + gradient.r1_ = aR1; + return gradient; + }; + + contextPrototype.drawImage = function(image, var_args) { + var dx, dy, dw, dh, sx, sy, sw, sh; + + // to find the original width we overide the width and height + var oldRuntimeWidth = image.runtimeStyle.width; + var oldRuntimeHeight = image.runtimeStyle.height; + image.runtimeStyle.width = 'auto'; + image.runtimeStyle.height = 'auto'; + + // get the original size + var w = image.width; + var h = image.height; + + // and remove overides + image.runtimeStyle.width = oldRuntimeWidth; + image.runtimeStyle.height = oldRuntimeHeight; + + if (arguments.length == 3) { + dx = arguments[1]; + dy = arguments[2]; + sx = sy = 0; + sw = dw = w; + sh = dh = h; + } else if (arguments.length == 5) { + dx = arguments[1]; + dy = arguments[2]; + dw = arguments[3]; + dh = arguments[4]; + sx = sy = 0; + sw = w; + sh = h; + } else if (arguments.length == 9) { + sx = arguments[1]; + sy = arguments[2]; + sw = arguments[3]; + sh = arguments[4]; + dx = arguments[5]; + dy = arguments[6]; + dw = arguments[7]; + dh = arguments[8]; + } else { + throw Error('Invalid number of arguments'); + } + + var d = this.getCoords_(dx, dy); + + var w2 = sw / 2; + var h2 = sh / 2; + + var vmlStr = []; + + var W = 10; + var H = 10; + + // For some reason that I've now forgotten, using divs didn't work + vmlStr.push(' ' , + '', + ''); + + this.element_.insertAdjacentHTML('BeforeEnd', + vmlStr.join('')); + }; + + contextPrototype.stroke = function(aFill) { + var lineStr = []; + var lineOpen = false; + var a = processStyle(aFill ? this.fillStyle : this.strokeStyle); + var color = a.color; + var opacity = a.alpha * this.globalAlpha; + + var W = 10; + var H = 10; + + lineStr.push(''); + + if (!aFill) { + var lineWidth = this.lineScale_ * this.lineWidth; + + // VML cannot correctly render a line if the width is less than 1px. + // In that case, we dilute the color to make the line look thinner. + if (lineWidth < 1) { + opacity *= lineWidth; + } + + lineStr.push( + '' + ); + } else if (typeof this.fillStyle == 'object') { + var fillStyle = this.fillStyle; + var angle = 0; + var focus = {x: 0, y: 0}; + + // additional offset + var shift = 0; + // scale factor for offset + var expansion = 1; + + if (fillStyle.type_ == 'gradient') { + var x0 = fillStyle.x0_ / this.arcScaleX_; + var y0 = fillStyle.y0_ / this.arcScaleY_; + var x1 = fillStyle.x1_ / this.arcScaleX_; + var y1 = fillStyle.y1_ / this.arcScaleY_; + var p0 = this.getCoords_(x0, y0); + var p1 = this.getCoords_(x1, y1); + var dx = p1.x - p0.x; + var dy = p1.y - p0.y; + angle = Math.atan2(dx, dy) * 180 / Math.PI; + + // The angle should be a non-negative number. + if (angle < 0) { + angle += 360; + } + + // Very small angles produce an unexpected result because they are + // converted to a scientific notation string. + if (angle < 1e-6) { + angle = 0; + } + } else { + var p0 = this.getCoords_(fillStyle.x0_, fillStyle.y0_); + var width = max.x - min.x; + var height = max.y - min.y; + focus = { + x: (p0.x - min.x) / width, + y: (p0.y - min.y) / height + }; + + width /= this.arcScaleX_ * Z; + height /= this.arcScaleY_ * Z; + var dimension = m.max(width, height); + shift = 2 * fillStyle.r0_ / dimension; + expansion = 2 * fillStyle.r1_ / dimension - shift; + } + + // We need to sort the color stops in ascending order by offset, + // otherwise IE won't interpret it correctly. + var stops = fillStyle.colors_; + stops.sort(function(cs1, cs2) { + return cs1.offset - cs2.offset; + }); + + var length = stops.length; + var color1 = stops[0].color; + var color2 = stops[length - 1].color; + var opacity1 = stops[0].alpha * this.globalAlpha; + var opacity2 = stops[length - 1].alpha * this.globalAlpha; + + var colors = []; + for (var i = 0; i < length; i++) { + var stop = stops[i]; + colors.push(stop.offset * expansion + shift + ' ' + stop.color); + } + + // When colors attribute is used, the meanings of opacity and o:opacity2 + // are reversed. + lineStr.push(''); + } else { + lineStr.push(''); + } + + lineStr.push(''); + + this.element_.insertAdjacentHTML('beforeEnd', lineStr.join('')); + }; + + contextPrototype.fill = function() { + this.stroke(true); + } + + contextPrototype.closePath = function() { + this.currentPath_.push({type: 'close'}); + }; + + /** + * @private + */ + contextPrototype.getCoords_ = function(aX, aY) { + var m = this.m_; + return { + x: Z * (aX * m[0][0] + aY * m[1][0] + m[2][0]) - Z2, + y: Z * (aX * m[0][1] + aY * m[1][1] + m[2][1]) - Z2 + } + }; + + contextPrototype.save = function() { + var o = {}; + copyState(this, o); + this.aStack_.push(o); + this.mStack_.push(this.m_); + this.m_ = matrixMultiply(createMatrixIdentity(), this.m_); + }; + + contextPrototype.restore = function() { + copyState(this.aStack_.pop(), this); + this.m_ = this.mStack_.pop(); + }; + + function matrixIsFinite(m) { + for (var j = 0; j < 3; j++) { + for (var k = 0; k < 2; k++) { + if (!isFinite(m[j][k]) || isNaN(m[j][k])) { + return false; + } + } + } + return true; + } + + function setM(ctx, m, updateLineScale) { + if (!matrixIsFinite(m)) { + return; + } + ctx.m_ = m; + + if (updateLineScale) { + // Get the line scale. + // Determinant of this.m_ means how much the area is enlarged by the + // transformation. So its square root can be used as a scale factor + // for width. + var det = m[0][0] * m[1][1] - m[0][1] * m[1][0]; + ctx.lineScale_ = sqrt(abs(det)); + } + } + + contextPrototype.translate = function(aX, aY) { + var m1 = [ + [1, 0, 0], + [0, 1, 0], + [aX, aY, 1] + ]; + + setM(this, matrixMultiply(m1, this.m_), false); + }; + + contextPrototype.rotate = function(aRot) { + var c = mc(aRot); + var s = ms(aRot); + + var m1 = [ + [c, s, 0], + [-s, c, 0], + [0, 0, 1] + ]; + + setM(this, matrixMultiply(m1, this.m_), false); + }; + + contextPrototype.scale = function(aX, aY) { + this.arcScaleX_ *= aX; + this.arcScaleY_ *= aY; + var m1 = [ + [aX, 0, 0], + [0, aY, 0], + [0, 0, 1] + ]; + + setM(this, matrixMultiply(m1, this.m_), true); + }; + + contextPrototype.transform = function(m11, m12, m21, m22, dx, dy) { + var m1 = [ + [m11, m12, 0], + [m21, m22, 0], + [dx, dy, 1] + ]; + + setM(this, matrixMultiply(m1, this.m_), true); + }; + + contextPrototype.setTransform = function(m11, m12, m21, m22, dx, dy) { + var m = [ + [m11, m12, 0], + [m21, m22, 0], + [dx, dy, 1] + ]; + + setM(this, m, true); + }; + + /******** STUBS ********/ + contextPrototype.clip = function() { + // TODO: Implement + }; + + contextPrototype.arcTo = function() { + // TODO: Implement + }; + + contextPrototype.createPattern = function() { + return new CanvasPattern_; + }; + + // Gradient / Pattern Stubs + function CanvasGradient_(aType) { + this.type_ = aType; + this.x0_ = 0; + this.y0_ = 0; + this.r0_ = 0; + this.x1_ = 0; + this.y1_ = 0; + this.r1_ = 0; + this.colors_ = []; + } + + CanvasGradient_.prototype.addColorStop = function(aOffset, aColor) { + aColor = processStyle(aColor); + this.colors_.push({offset: aOffset, + color: aColor.color, + alpha: aColor.alpha}); + }; + + function CanvasPattern_() {} + + // set up externs + G_vmlCanvasManager = G_vmlCanvasManager_; + CanvasRenderingContext2D = CanvasRenderingContext2D_; + CanvasGradient = CanvasGradient_; + CanvasPattern = CanvasPattern_; + +})(); + +} // if diff --git a/public/js/jquery-1.8.0.js b/public/js/jquery-1.8.0.js new file mode 100644 index 0000000..dfe5eb0 --- /dev/null +++ b/public/js/jquery-1.8.0.js @@ -0,0 +1,9227 @@ +/*! + * jQuery JavaScript Library v1.8.0 + * http://jquery.com/ + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://jquery.org/license + * + * Date: Thu Aug 09 2012 16:24:48 GMT-0400 (Eastern Daylight Time) + */ +(function( window, undefined ) { +var + // A central reference to the root jQuery(document) + rootjQuery, + + // The deferred used on DOM ready + readyList, + + // Use the correct document accordingly with window argument (sandbox) + document = window.document, + location = window.location, + navigator = window.navigator, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // Save a reference to some core methods + core_push = Array.prototype.push, + core_slice = Array.prototype.slice, + core_indexOf = Array.prototype.indexOf, + core_toString = Object.prototype.toString, + core_hasOwn = Object.prototype.hasOwnProperty, + core_trim = String.prototype.trim, + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Used for matching numbers + core_pnum = /[\-+]?(?:\d*\.|)\d+(?:[eE][\-+]?\d+|)/.source, + + // Used for detecting and trimming whitespace + core_rnotwhite = /\S/, + core_rspace = /\s+/, + + // IE doesn't match non-breaking spaces with \s + rtrim = core_rnotwhite.test("\xA0") ? (/^[\s\xA0]+|[\s\xA0]+$/g) : /^\s+|\s+$/g, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + rquickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + rvalidescape = /\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g, + rvalidtokens = /"[^"\\\r\n]*"|true|false|null|-?(?:\d\d*\.|)\d+(?:[eE][\-+]?\d+|)/g, + + // Matches dashed string for camelizing + rmsPrefix = /^-ms-/, + rdashAlpha = /-([\da-z])/gi, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return ( letter + "" ).toUpperCase(); + }, + + // The ready event handler and self cleanup method + DOMContentLoaded = function() { + if ( document.addEventListener ) { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + } else if ( document.readyState === "complete" ) { + // we're here because readyState === "complete" in oldIE + // which is good enough for us to call the dom ready! + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = ( context && context.nodeType ? context.ownerDocument || context : document ); + + // scripts is true for back-compat + selector = jQuery.parseHTML( match[1], doc, true ); + if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) { + this.attr.call( selector, context, true ); + } + + return jQuery.merge( this, selector ); + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || rootjQuery ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if ( selector.selector !== undefined ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.8.0", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return core_slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Add the callback + jQuery.ready.promise().done( fn ); + + return this; + }, + + eq: function( i ) { + i = +i; + return i === -1 ? + this.slice( i ) : + this.slice( i, i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( core_slice.apply( this, arguments ), + "slice", core_slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: core_push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger("ready").off("ready"); + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + isWindow: function( obj ) { + return obj != null && obj == obj.window; + }, + + isNumeric: function( obj ) { + return !isNaN( parseFloat(obj) ) && isFinite( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ core_toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + try { + // Not own constructor property must be Object + if ( obj.constructor && + !core_hasOwn.call(obj, "constructor") && + !core_hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || core_hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + var name; + for ( name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw new Error( msg ); + }, + + // data: string of html + // context (optional): If specified, the fragment will be created in this context, defaults to document + // scripts (optional): If true, will include scripts passed in the html string + parseHTML: function( data, context, scripts ) { + var parsed; + if ( !data || typeof data !== "string" ) { + return null; + } + if ( typeof context === "boolean" ) { + scripts = context; + context = 0; + } + context = context || document; + + // Single tag + if ( (parsed = rsingleTag.exec( data )) ) { + return [ context.createElement( parsed[1] ) ]; + } + + parsed = jQuery.buildFragment( [ data ], context, scripts ? null : [] ); + return jQuery.merge( [], + (parsed.cacheable ? jQuery.clone( parsed.fragment ) : parsed.fragment).childNodes ); + }, + + parseJSON: function( data ) { + if ( !data || typeof data !== "string") { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return ( new Function( "return " + data ) )(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + if ( !data || typeof data !== "string" ) { + return null; + } + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && core_rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( obj, callback, args ) { + var name, + i = 0, + length = obj.length, + isObj = length === undefined || jQuery.isFunction( obj ); + + if ( args ) { + if ( isObj ) { + for ( name in obj ) { + if ( callback.apply( obj[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( obj[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in obj ) { + if ( callback.call( obj[ name ], name, obj[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( obj[ i ], i, obj[ i++ ] ) === false ) { + break; + } + } + } + } + + return obj; + }, + + // Use native String.trim function wherever possible + trim: core_trim ? + function( text ) { + return text == null ? + "" : + core_trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( rtrim, "" ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var type, + ret = results || []; + + if ( arr != null ) { + // The window, strings (and functions) also have 'length' + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + type = jQuery.type( arr ); + + if ( arr.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( arr ) ) { + core_push.call( ret, arr ); + } else { + jQuery.merge( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + var len; + + if ( arr ) { + if ( core_indexOf ) { + return core_indexOf.call( arr, elem, i ); + } + + len = arr.length; + i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; + + for ( ; i < len; i++ ) { + // Skip accessing in sparse arrays + if ( i in arr && arr[ i ] === elem ) { + return i; + } + } + } + + return -1; + }, + + merge: function( first, second ) { + var l = second.length, + i = first.length, + j = 0; + + if ( typeof l === "number" ) { + for ( ; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var retVal, + ret = [], + i = 0, + length = elems.length; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, + ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + var tmp, args, proxy; + + if ( typeof context === "string" ) { + tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + args = core_slice.call( arguments, 2 ); + proxy = function() { + return fn.apply( context, args.concat( core_slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + + return proxy; + }, + + // Multifunctional method to get and set values of a collection + // The value/s can optionally be executed if it's a function + access: function( elems, fn, key, value, chainable, emptyGet, pass ) { + var exec, + bulk = key == null, + i = 0, + length = elems.length; + + // Sets many values + if ( key && typeof key === "object" ) { + for ( i in key ) { + jQuery.access( elems, fn, i, key[i], 1, emptyGet, value ); + } + chainable = 1; + + // Sets one value + } else if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = pass === undefined && jQuery.isFunction( value ); + + if ( bulk ) { + // Bulk operations only iterate when executing function values + if ( exec ) { + exec = fn; + fn = function( elem, key, value ) { + return exec.call( jQuery( elem ), value ); + }; + + // Otherwise they run against the entire set + } else { + fn.call( elems, value ); + fn = null; + } + } + + if ( fn ) { + for (; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + } + + chainable = 1; + } + + return chainable ? + elems : + + // Gets + bulk ? + fn.call( elems ) : + length ? fn( elems[0], key ) : emptyGet; + }, + + now: function() { + return ( new Date() ).getTime(); + } +}); + +jQuery.ready.promise = function( obj ) { + if ( !readyList ) { + + readyList = jQuery.Deferred(); + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" || ( document.readyState !== "loading" && document.addEventListener ) ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + setTimeout( jQuery.ready, 1 ); + + // Standards-based browsers support DOMContentLoaded + } else if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else { + // Ensure firing before onload, maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var top = false; + + try { + top = window.frameElement == null && document.documentElement; + } catch(e) {} + + if ( top && top.doScroll ) { + (function doScrollCheck() { + if ( !jQuery.isReady ) { + + try { + // Use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + top.doScroll("left"); + } catch(e) { + return setTimeout( doScrollCheck, 50 ); + } + + // and execute any waiting functions + jQuery.ready(); + } + })(); + } + } + } + return readyList.promise( obj ); +}; + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); +// String to Object options format cache +var optionsCache = {}; + +// Convert String-formatted options into Object-formatted ones and store in cache +function createOptions( options ) { + var object = optionsCache[ options ] = {}; + jQuery.each( options.split( core_rspace ), function( _, flag ) { + object[ flag ] = true; + }); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + ( optionsCache[ options ] || createOptions( options ) ) : + jQuery.extend( {}, options ); + + var // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list was already fired + fired, + // Flag to know if list is currently firing + firing, + // First callback to fire (used internally by add and fireWith) + firingStart, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = !options.once && [], + // Fire callbacks + fire = function( data ) { + memory = options.memory && data; + fired = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + firing = true; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) { + memory = false; // To prevent further calls using add + break; + } + } + firing = false; + if ( list ) { + if ( stack ) { + if ( stack.length ) { + fire( stack.shift() ); + } + } else if ( memory ) { + list = []; + } else { + self.disable(); + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + // First, we save the current length + var start = list.length; + (function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( jQuery.isFunction( arg ) && ( !options.unique || !self.has( arg ) ) ) { + list.push( arg ); + } else if ( arg && arg.length ) { + // Inspect recursively + add( arg ); + } + }); + })( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away + } else if ( memory ) { + firingStart = start; + fire( memory ); + } + } + return this; + }, + // Remove a callback from the list + remove: function() { + if ( list ) { + jQuery.each( arguments, function( _, arg ) { + var index; + while( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + // Handle firing indexes + if ( firing ) { + if ( index <= firingLength ) { + firingLength--; + } + if ( index <= firingIndex ) { + firingIndex--; + } + } + } + }); + } + return this; + }, + // Control if a given callback is in the list + has: function( fn ) { + return jQuery.inArray( fn, list ) > -1; + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + if ( list && ( !fired || stack ) ) { + if ( firing ) { + stack.push( args ); + } else { + fire( args ); + } + } + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; +jQuery.extend({ + + Deferred: function( func ) { + var tuples = [ + // action, add listener, listener list, final state + [ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ], + [ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ], + [ "notify", "progress", jQuery.Callbacks("memory") ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + then: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + return jQuery.Deferred(function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + var action = tuple[ 0 ], + fn = fns[ i ]; + // deferred[ done | fail | progress ] for forwarding actions to newDefer + deferred[ tuple[1] ]( jQuery.isFunction( fn ) ? + function() { + var returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise() + .done( newDefer.resolve ) + .fail( newDefer.reject ) + .progress( newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); + } + } : + newDefer[ action ] + ); + }); + fns = null; + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return typeof obj === "object" ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Keep pipe for back-compat + promise.pipe = promise.then; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 3 ]; + + // promise[ done | fail | progress ] = list.add + promise[ tuple[1] ] = list.add; + + // Handle state + if ( stateString ) { + list.add(function() { + // state = [ resolved | rejected ] + state = stateString; + + // [ reject_list | resolve_list ].disable; progress_list.lock + }, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock ); + } + + // deferred[ resolve | reject | notify ] = list.fire + deferred[ tuple[0] ] = list.fire; + deferred[ tuple[0] + "With" ] = list.fireWith; + }); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( subordinate /* , ..., subordinateN */ ) { + var i = 0, + resolveValues = core_slice.call( arguments ), + length = resolveValues.length, + + // the count of uncompleted subordinates + remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0, + + // the master Deferred. If resolveValues consist of only a single Deferred, just use that. + deferred = remaining === 1 ? subordinate : jQuery.Deferred(), + + // Update function for both resolve and progress values + updateFunc = function( i, contexts, values ) { + return function( value ) { + contexts[ i ] = this; + values[ i ] = arguments.length > 1 ? core_slice.call( arguments ) : value; + if( values === progressValues ) { + deferred.notifyWith( contexts, values ); + } else if ( !( --remaining ) ) { + deferred.resolveWith( contexts, values ); + } + }; + }, + + progressValues, progressContexts, resolveContexts; + + // add listeners to Deferred subordinates; treat others as resolved + if ( length > 1 ) { + progressValues = new Array( length ); + progressContexts = new Array( length ); + resolveContexts = new Array( length ); + for ( ; i < length; i++ ) { + if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) { + resolveValues[ i ].promise() + .done( updateFunc( i, resolveContexts, resolveValues ) ) + .fail( deferred.reject ) + .progress( updateFunc( i, progressContexts, progressValues ) ); + } else { + --remaining; + } + } + } + + // if we're not waiting on anything, resolve the master + if ( !remaining ) { + deferred.resolveWith( resolveContexts, resolveValues ); + } + + return deferred.promise(); + } +}); +jQuery.support = (function() { + + var support, + all, + a, + select, + opt, + input, + fragment, + eventName, + i, + isSupported, + clickFn, + div = document.createElement("div"); + + // Preliminary tests + div.setAttribute( "className", "t" ); + div.innerHTML = "
a"; + + all = div.getElementsByTagName("*"); + a = div.getElementsByTagName("a")[ 0 ]; + a.style.cssText = "top:1px;float:left;opacity:.5"; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return {}; + } + + // First batch of supports tests + select = document.createElement("select"); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName("input")[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute("href") === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.5/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Tests for enctype support on a form(#6743) + enctype: !!document.createElement("form").enctype, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav>", + + // jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode + boxModel: ( document.compatMode === "CSS1Compat" ), + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true, + boxSizingReliable: true, + pixelPosition: false + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", clickFn = function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent("onclick"); + div.detachEvent( "onclick", clickFn ); + } + + // Check if a radio maintains its value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute( "type", "radio" ); + support.radioValue = input.value === "t"; + + input.setAttribute( "checked", "checked" ); + + // #11217 - WebKit loses check when the name is after the checked attribute + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.lastChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + fragment.removeChild( input ); + fragment.appendChild( div ); + + // Technique from Juriy Zaytsev + // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for ( i in { + submit: true, + change: true, + focusin: true + }) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + // Run tests that need a body at doc ready + jQuery(function() { + var container, div, tds, marginDiv, + divReset = "padding:0;margin:0;border:0;display:block;overflow:hidden;", + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + container = document.createElement("div"); + container.style.cssText = "visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px"; + body.insertBefore( container, body.firstChild ); + + // Construct the test element + div = document.createElement("div"); + container.appendChild( div ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + div.innerHTML = "
t
"; + tds = div.getElementsByTagName("td"); + tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none"; + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE <= 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Check box-sizing and margin behavior + div.innerHTML = ""; + div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;"; + support.boxSizing = ( div.offsetWidth === 4 ); + support.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== 1 ); + + // NOTE: To any future maintainer, window.getComputedStyle was used here + // instead of getComputedStyle because it gave a better gzip size. + // The difference between window.getComputedStyle and getComputedStyle is + // 7 bytes + if ( window.getComputedStyle ) { + support.pixelPosition = ( window.getComputedStyle( div, null ) || {} ).top !== "1%"; + support.boxSizingReliable = ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px"; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + marginDiv = document.createElement("div"); + marginDiv.style.cssText = div.style.cssText = divReset; + marginDiv.style.marginRight = marginDiv.style.width = "0"; + div.style.width = "1px"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + !parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight ); + } + + if ( typeof div.style.zoom !== "undefined" ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.innerHTML = ""; + div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1"; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = "block"; + div.style.overflow = "visible"; + div.innerHTML = "
"; + div.firstChild.style.width = "5px"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 3 ); + + container.style.zoom = 1; + } + + // Null elements to avoid leaks in IE + body.removeChild( container ); + container = div = tds = marginDiv = null; + }); + + // Null elements to avoid leaks in IE + fragment.removeChild( div ); + all = a = select = opt = input = fragment = div = null; + + return support; +})(); +var rbrace = /^(?:\{.*\}|\[.*\])$/, + rmultiDash = /([A-Z])/g; + +jQuery.extend({ + cache: {}, + + deletedIds: [], + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || !cache[id] || (!pvt && !cache[id].data)) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ internalKey ] = id = jQuery.deletedIds.pop() || ++jQuery.uuid; + } else { + id = internalKey; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // Avoids exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ] = jQuery.extend( cache[ id ], name ); + } else { + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); + } + } + + thisCache = cache[ id ]; + + // jQuery data() is stored in a separate object inside the object's internal data + // cache in order to avoid key collisions between internal data and user-defined + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; + } + + thisCache = thisCache.data; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, i, l, + + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ] : cache[ id ].data; + + if ( thisCache ) { + + // Support array or space separated string names for data keys + if ( !jQuery.isArray( name ) ) { + + // try the string as a key before any manipulation + if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces unless a key with the spaces exists + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split(" "); + } + } + } + + for ( i = 0, l = name.length; i < l; i++ ) { + delete thisCache[ name[i] ]; + } + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( !pvt ) { + delete cache[ id ].data; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject( cache[ id ] ) ) { + return; + } + } + + // Destroy the cache + if ( isNode ) { + jQuery.cleanData( [ elem ], true ); + + // Use delete when supported for expandos or `cache` is not a window per isWindow (#10080) + } else if ( jQuery.support.deleteExpando || cache != cache.window ) { + delete cache[ id ]; + + // When all else fails, null + } else { + cache[ id ] = null; + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + var noData = elem.nodeName && jQuery.noData[ elem.nodeName.toLowerCase() ]; + + // nodes accept data unless otherwise specified; rejection can be conditional + return !noData || noData !== true && elem.getAttribute("classid") === noData; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var parts, part, attr, name, l, + elem = this[0], + i = 0, + data = null; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = jQuery.data( elem ); + + if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) { + attr = elem.attributes; + for ( l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( elem, name, data[ name ] ); + } + } + jQuery._data( elem, "parsedAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + parts = key.split( ".", 2 ); + parts[1] = parts[1] ? "." + parts[1] : ""; + part = parts[1] + "!"; + + return jQuery.access( this, function( value ) { + + if ( value === undefined ) { + data = this.triggerHandler( "getData" + part, [ parts[0] ] ); + + // Try to fetch any internally stored data first + if ( data === undefined && elem ) { + data = jQuery.data( elem, key ); + data = dataAttr( elem, key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + } + + parts[1] = value; + this.each(function() { + var self = jQuery( this ); + + self.triggerHandler( "setData" + part, parts ); + jQuery.data( this, key, value ); + self.triggerHandler( "changeData" + part, parts ); + }); + }, null, value, arguments.length > 1, null, false ); + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + // Only convert to a number if it doesn't change the string + +data + "" === data ? +data : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// checks a cache object for emptiness +function isEmptyDataObject( obj ) { + var name; + for ( name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { + continue; + } + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} +jQuery.extend({ + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || jQuery.isArray(data) ) { + queue = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + if ( !queue.length && hooks ) { + hooks.empty.fire(); + } + }, + + // not intended for public consumption - generates a queueHooks object, or returns the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return jQuery._data( elem, key ) || jQuery._data( elem, key, { + empty: jQuery.Callbacks("once memory").add(function() { + jQuery.removeData( elem, type + "queue", true ); + jQuery.removeData( elem, key, true ); + }) + }); + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[0], type ); + } + + return data === undefined ? + this : + this.each(function() { + var queue = jQuery.queue( this, type, data ); + + // ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while( i-- ) { + if ( (tmp = jQuery._data( elements[ i ], type + "queueHooks" )) && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +}); +var nodeHook, boolHook, fixSpecified, + rclass = /[\t\r\n]/g, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea|)$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + getSetAttribute = jQuery.support.getSetAttribute; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( core_rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var removes, className, elem, c, cl, i, l; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + if ( (value && typeof value === "string") || value === undefined ) { + removes = ( value || "" ).split( core_rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + if ( elem.nodeType === 1 && elem.className ) { + + className = (" " + elem.className + " ").replace( rclass, " " ); + + // loop over each item in the removal list + for ( c = 0, cl = removes.length; c < cl; c++ ) { + // Remove until there is nothing to remove, + while ( className.indexOf(" " + removes[ c ] + " ") > -1 ) { + className = className.replace( " " + removes[ c ] + " " , " " ); + } + } + elem.className = value ? jQuery.trim( className ) : ""; + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( core_rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space separated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var val, + self = jQuery(this); + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, i, max, option, + index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + i = one ? index : 0; + max = one ? index + 1 : options.length; + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + // Unused in 1.8, left in so attrFn-stabbers won't die; remove in 1.9 + attrFn: {}, + + attr: function( elem, name, value, pass ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( pass && jQuery.isFunction( jQuery.fn[ name ] ) ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, "" + value ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var propName, attrNames, name, isBool, + i = 0; + + if ( value && elem.nodeType === 1 ) { + + attrNames = value.split( core_rspace ); + + for ( ; i < attrNames.length; i++ ) { + name = attrNames[ i ]; + + if ( name ) { + propName = jQuery.propFix[ name ] || name; + isBool = rboolean.test( name ); + + // See #9699 for explanation of this approach (setting first, then removal) + // Do not do this for boolean attributes (see #10870) + if ( !isBool ) { + jQuery.attr( elem, name, "" ); + } + elem.removeAttribute( getSetAttribute ? name : propName ); + + // Set corresponding property to false for boolean attributes + if ( isBool && propName in elem ) { + elem[ propName ] = false; + } + } + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + // Fall back to attribute presence where some booleans are not supported + var attrNode, + property = jQuery.prop( elem, name ); + return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !getSetAttribute ) { + + fixSpecified = { + name: true, + id: true, + coords: true + }; + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + return ret && ( fixSpecified[ name ] ? ret.value !== "" : ret.specified ) ? + ret.value : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); + } + return ( ret.value = value + "" ); + } + }; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); + + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + get: nodeHook.get, + set: function( elem, value, name ) { + if ( value === "" ) { + value = "false"; + } + nodeHook.set( elem, value, name ); + } + }; +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return ( elem.style.cssText = "" + value ); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// IE6/7 call enctype encoding +if ( !jQuery.support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); +var rformElems = /^(?:textarea|input|select)$/i, + rtypenamespace = /^([^\.]*|)(?:\.(.+)|)$/, + rhoverHack = /(?:^|\s)hover(\.\S+|)\b/, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + hoverHack = function( events ) { + return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); + }; + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + add: function( elem, types, handler, data, selector ) { + + var elemData, eventHandle, events, + t, tns, type, namespaces, handleObj, + handleObjIn, handlers, special; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + events = elemData.events; + if ( !events ) { + elemData.events = events = {}; + } + eventHandle = elemData.handle; + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = jQuery.trim( hoverHack(types) ).split( " " ); + for ( t = 0; t < types.length; t++ ) { + + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + namespace: namespaces.join(".") + }, handleObjIn ); + + // Init the event handler queue if we're the first + handlers = events[ type ]; + if ( !handlers ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener/attachEvent if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var t, tns, type, origType, namespaces, origCount, + j, events, special, eventType, handleObj, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ); + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = jQuery.trim( hoverHack( types || "" ) ).split(" "); + for ( t = 0; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = origType = tns[1]; + namespaces = tns[2]; + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + + // Remove matching events + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !namespaces || namespaces.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + eventType.splice( j--, 1 ); + + if ( handleObj.selector ) { + eventType.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + delete elemData.handle; + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery.removeData( elem, "events", true ); + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Don't do events on text and comment nodes + if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { + return; + } + + // Event object or event type + var cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType, + type = event.type || event, + namespaces = []; + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "!" ) >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf( "." ) >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.isTrigger = true; + event.exclusive = exclusive; + event.namespace = namespaces.join( "." ); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; + + // Handle a global trigger + if ( !elem ) { + + // TODO: Stop taunting the data cache; remove global events and always attach to document + cache = jQuery.cache; + for ( i in cache ) { + if ( cache[ i ].events && cache[ i ].events[ type ] ) { + jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); + } + } + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; + for ( old = elem; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old === (elem.ownerDocument || document) ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + // Note that this is a bare JS function and not a jQuery handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply( cur, data ) === false ) { + event.preventDefault(); + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction() check here because IE6/7 fails that test. + // Don't do default actions on window, that's where global variables be (#6170) + // IE<9 dies on focus/blur to hidden element (#1486) + if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event || window.event ); + + var i, j, cur, jqcur, ret, selMatch, matched, matches, handleObj, sel, related, + handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = [].slice.call( arguments ), + run_all = !event.exclusive && !event.namespace, + special = jQuery.event.special[ event.type ] || {}, + handlerQueue = []; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers that should run if there are delegated events + // Avoid non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !(event.button && event.type === "click") ) { + + // Pregenerate a single jQuery object for reuse with .is() + jqcur = jQuery(this); + jqcur.context = this; + + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + + // Don't process clicks (ONLY) on disabled elements (#6911, #8165, #xxxx) + if ( cur.disabled !== true || event.type !== "click" ) { + selMatch = {}; + matches = []; + jqcur[0] = cur; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + + if ( selMatch[ sel ] === undefined ) { + selMatch[ sel ] = jqcur.is( sel ); + } + if ( selMatch[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); + } + } + } + } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** + props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button, + fromElement = original.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && fromElement ) { + event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = jQuery.Event( originalEvent ); + + for ( i = copy.length; i; ) { + prop = copy[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) + if ( !event.target ) { + event.target = originalEvent.srcElement || document; + } + + // Target should not be a text node (#504, Safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // For mouse/key events, metaKey==false if it's undefined (#3368, #11328; IE6/7/8) + event.metaKey = !!event.metaKey; + + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; + }, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady + }, + + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + + focus: { + delegateType: "focusin" + }, + blur: { + delegateType: "focusout" + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + var name = "on" + type; + + if ( elem.detachEvent ) { + + // #8545, #7054, preventing memory leaks for custom events in IE6-8 – + // detachEvent needed property on element, by name of that event, to properly expose it to GC + if ( typeof elem[ name ] === "undefined" ) { + elem[ name ] = null; + } + + elem.detachEvent( name, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj, + selector = handleObj.selector; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +}); + +// IE submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Lazy-add a submit handler when a descendant form may potentially be submitted + jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) + var elem = e.target, + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; + if ( form && !jQuery._data( form, "_submit_attached" ) ) { + jQuery.event.add( form, "submit._submit", function( event ) { + event._submit_bubble = true; + }); + jQuery._data( form, "_submit_attached", true ); + } + }); + // return undefined since we don't need an event listener + }, + + postDispatch: function( event ) { + // If form was submitted by the user, bubble the event up the tree + if ( event._submit_bubble ) { + delete event._submit_bubble; + if ( this.parentNode && !event.isTrigger ) { + jQuery.event.simulate( "submit", this.parentNode, event, true ); + } + } + }, + + teardown: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Remove delegated handlers; cleanData eventually reaps submit handlers attached above + jQuery.event.remove( this, "._submit" ); + } + }; +} + +// IE change delegation and checkbox/radio fix +if ( !jQuery.support.changeBubbles ) { + + jQuery.event.special.change = { + + setup: function() { + + if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click + // after a propertychange. Eat the blur-change in special.change.handle. + // This still fires onchange a second time for check/radio after blur. + if ( this.type === "checkbox" || this.type === "radio" ) { + jQuery.event.add( this, "propertychange._change", function( event ) { + if ( event.originalEvent.propertyName === "checked" ) { + this._just_changed = true; + } + }); + jQuery.event.add( this, "click._change", function( event ) { + if ( this._just_changed && !event.isTrigger ) { + this._just_changed = false; + } + // Allow triggered, simulated change events (#11500) + jQuery.event.simulate( "change", this, event, true ); + }); + } + return false; + } + // Delegated event; lazy-add a change handler on descendant inputs + jQuery.event.add( this, "beforeactivate._change", function( e ) { + var elem = e.target; + + if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "_change_attached" ) ) { + jQuery.event.add( elem, "change._change", function( event ) { + if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { + jQuery.event.simulate( "change", this.parentNode, event, true ); + } + }); + jQuery._data( elem, "_change_attached", true ); + } + }); + }, + + handle: function( event ) { + var elem = event.target; + + // Swallow native change events from checkbox/radio, we already triggered them above + if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + return event.handleObj.handler.apply( this, arguments ); + } + }, + + teardown: function() { + jQuery.event.remove( this, "._change" ); + + return rformElems.test( this.nodeName ); + } + }; +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { // && selector != null + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on( types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + live: function( types, data, fn ) { + jQuery( this.context ).on( types, this.selector, data, fn ); + return this; + }, + die: function( types, fn ) { + jQuery( this.context ).off( types, this.selector || "**", fn ); + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector || "**", fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; + + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + } +}); +/*! + * Sizzle CSS Selector Engine + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://sizzlejs.com/ + */ +(function( window, undefined ) { + +var cachedruns, + dirruns, + sortOrder, + siblingCheck, + assertGetIdNotName, + + document = window.document, + docElem = document.documentElement, + + strundefined = "undefined", + hasDuplicate = false, + baseHasDuplicate = true, + done = 0, + slice = [].slice, + push = [].push, + + expando = ( "sizcache" + Math.random() ).replace( ".", "" ), + + // Regex + + // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + // http://www.w3.org/TR/css3-syntax/#characters + characterEncoding = "(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+", + + // Loosely modeled on CSS identifier characters + // An unquoted value should be a CSS identifier (http://www.w3.org/TR/css3-selectors/#attribute-selectors) + // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = characterEncoding.replace( "w", "w#" ), + + // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors + operators = "([*^$|!~]?=)", + attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace + + "*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]", + pseudos = ":(" + characterEncoding + ")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|((?:[^,]|\\\\,|(?:,(?=[^\\[]*\\]))|(?:,(?=[^\\(]*\\))))*))\\)|)", + pos = ":(nth|eq|gt|lt|first|last|even|odd)(?:\\((\\d*)\\)|)(?=[^-]|$)", + combinators = whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*", + groups = "(?=[^\\x20\\t\\r\\n\\f])(?:\\\\.|" + attributes + "|" + pseudos.replace( 2, 7 ) + "|[^\\\\(),])+", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcombinators = new RegExp( "^" + combinators ), + + // All simple (non-comma) selectors, excluding insignifant trailing whitespace + rgroups = new RegExp( groups + "?(?=" + whitespace + "*,|$)", "g" ), + + // A selector, or everything after leading whitespace + // Optionally followed in either case by a ")" for terminating sub-selectors + rselector = new RegExp( "^(?:(?!,)(?:(?:^|,)" + whitespace + "*" + groups + ")*?|" + whitespace + "*(.*?))(\\)|$)" ), + + // All combinators and selector components (attribute test, tag, pseudo, etc.), the latter appearing together when consecutive + rtokens = new RegExp( groups.slice( 19, -6 ) + "\\x20\\t\\r\\n\\f>+~])+|" + combinators, "g" ), + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/, + + rsibling = /[\x20\t\r\n\f]*[+~]/, + rendsWithNot = /:not\($/, + + rheader = /h\d/i, + rinputs = /input|select|textarea|button/i, + + rbackslash = /\\(?!\\)/g, + + matchExpr = { + "ID": new RegExp( "^#(" + characterEncoding + ")" ), + "CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ), + "NAME": new RegExp( "^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]" ), + "TAG": new RegExp( "^(" + characterEncoding.replace( "[-", "[-\\*" ) + ")" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|nth|last|first)-child(?:\\(" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + "POS": new RegExp( pos, "ig" ), + // For use in libraries implementing .is() + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|" + pos, "i" ) + }, + + classCache = {}, + cachedClasses = [], + compilerCache = {}, + cachedSelectors = [], + + // Mark a function for use in filtering + markFunction = function( fn ) { + fn.sizzleFilter = true; + return fn; + }, + + // Returns a function to use in pseudos for input types + createInputFunction = function( type ) { + return function( elem ) { + // Check the input's nodeName and type + return elem.nodeName.toLowerCase() === "input" && elem.type === type; + }; + }, + + // Returns a function to use in pseudos for buttons + createButtonFunction = function( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; + }, + + // Used for testing something on an element + assert = function( fn ) { + var pass = false, + div = document.createElement("div"); + try { + pass = fn( div ); + } catch (e) {} + // release memory in IE + div = null; + return pass; + }, + + // Check if attributes should be retrieved by attribute nodes + assertAttributes = assert(function( div ) { + div.innerHTML = ""; + var type = typeof div.lastChild.getAttribute("multiple"); + // IE8 returns a string for some attributes even when not present + return type !== "boolean" && type !== "string"; + }), + + // Check if getElementById returns elements by name + // Check if getElementsByName privileges form controls or returns elements by ID + assertUsableName = assert(function( div ) { + // Inject content + div.id = expando + 0; + div.innerHTML = "
"; + docElem.insertBefore( div, docElem.firstChild ); + + // Test + var pass = document.getElementsByName && + // buggy browsers will return fewer than the correct 2 + document.getElementsByName( expando ).length === + // buggy browsers will return more than the correct 0 + 2 + document.getElementsByName( expando + 0 ).length; + assertGetIdNotName = !document.getElementById( expando ); + + // Cleanup + docElem.removeChild( div ); + + return pass; + }), + + // Check if the browser returns only elements + // when doing getElementsByTagName("*") + assertTagNameNoComments = assert(function( div ) { + div.appendChild( document.createComment("") ); + return div.getElementsByTagName("*").length === 0; + }), + + // Check if getAttribute returns normalized href attributes + assertHrefNotNormalized = assert(function( div ) { + div.innerHTML = ""; + return div.firstChild && typeof div.firstChild.getAttribute !== strundefined && + div.firstChild.getAttribute("href") === "#"; + }), + + // Check if getElementsByClassName can be trusted + assertUsableClassName = assert(function( div ) { + // Opera can't find a second classname (in 9.6) + div.innerHTML = ""; + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return false; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + return div.getElementsByClassName("e").length !== 1; + }); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + var match, elem, xml, m, + nodeType = context.nodeType; + + if ( nodeType !== 1 && nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + xml = isXML( context ); + + if ( !xml && !seed ) { + if ( (match = rquickExpr.exec( selector )) ) { + // Speed-up: Sizzle("#ID") + if ( (m = match[1]) ) { + if ( nodeType === 9 ) { + elem = context.getElementById( m ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE, Opera, and Webkit return items + // by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + } else { + // Context is not a document + if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) && + contains( context, elem ) && elem.id === m ) { + results.push( elem ); + return results; + } + } + + // Speed-up: Sizzle("TAG") + } else if ( match[2] ) { + push.apply( results, slice.call(context.getElementsByTagName( selector ), 0) ); + return results; + + // Speed-up: Sizzle(".CLASS") + } else if ( (m = match[3]) && assertUsableClassName && context.getElementsByClassName ) { + push.apply( results, slice.call(context.getElementsByClassName( m ), 0) ); + return results; + } + } + } + + // All others + return select( selector, context, results, seed, xml ); +}; + +var Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + match: matchExpr, + + order: [ "ID", "TAG" ], + + attrHandle: {}, + + createPseudo: markFunction, + + find: { + "ID": assertGetIdNotName ? + function( id, context, xml ) { + if ( typeof context.getElementById !== strundefined && !xml ) { + var m = context.getElementById( id ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + } : + function( id, context, xml ) { + if ( typeof context.getElementById !== strundefined && !xml ) { + var m = context.getElementById( id ); + + return m ? + m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ? + [m] : + undefined : + []; + } + }, + + "TAG": assertTagNameNoComments ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== strundefined ) { + return context.getElementsByTagName( tag ); + } + } : + function( tag, context ) { + var results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + var elem, + tmp = [], + i = 0; + + for ( ; (elem = results[i]); i++ ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + } + }, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( rbackslash, "" ); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[4] || match[5] || "" ).replace( rbackslash, "" ); + + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + /* matches from matchExpr.CHILD + 1 type (only|nth|...) + 2 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 3 xn-component of xn+y argument ([+-]?\d*n|) + 4 sign of xn-component + 5 x of xn-component + 6 sign of y-component + 7 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1] === "nth" ) { + // nth-child requires argument + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[3] = +( match[3] ? match[4] + (match[5] || 1) : 2 * ( match[2] === "even" || match[2] === "odd" ) ); + match[4] = +( ( match[6] + match[7] ) || match[2] === "odd" ); + + // other types prohibit arguments + } else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var argument, + unquoted = match[4]; + + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } + + // Relinquish our claim on characters in `unquoted` from a closing parenthesis on + if ( unquoted && (argument = rselector.exec( unquoted )) && argument.pop() ) { + + match[0] = match[0].slice( 0, argument[0].length - unquoted.length - 1 ); + unquoted = argument[0].slice( 0, -1 ); + } + + // Quoted or unquoted, we have the full argument + // Return only captures needed by the pseudo filter method (type and argument) + match.splice( 2, 3, unquoted || match[3] ); + return match; + } + }, + + filter: { + "ID": assertGetIdNotName ? + function( id ) { + id = id.replace( rbackslash, "" ); + return function( elem ) { + return elem.getAttribute("id") === id; + }; + } : + function( id ) { + id = id.replace( rbackslash, "" ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id"); + return node && node.value === id; + }; + }, + + "TAG": function( nodeName ) { + if ( nodeName === "*" ) { + return function() { return true; }; + } + nodeName = nodeName.replace( rbackslash, "" ).toLowerCase(); + + return function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className ]; + if ( !pattern ) { + pattern = classCache[ className ] = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" ); + cachedClasses.push( className ); + // Avoid too large of a cache + if ( cachedClasses.length > Expr.cacheLength ) { + delete classCache[ cachedClasses.shift() ]; + } + } + return function( elem ) { + return pattern.test( elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "" ); + }; + }, + + "ATTR": function( name, operator, check ) { + if ( !operator ) { + return function( elem ) { + return Sizzle.attr( elem, name ) != null; + }; + } + + return function( elem ) { + var result = Sizzle.attr( elem, name ), + value = result + ""; + + if ( result == null ) { + return operator === "!="; + } + + switch ( operator ) { + case "=": + return value === check; + case "!=": + return value !== check; + case "^=": + return check && value.indexOf( check ) === 0; + case "*=": + return check && value.indexOf( check ) > -1; + case "$=": + return check && value.substr( value.length - check.length ) === check; + case "~=": + return ( " " + value + " " ).indexOf( check ) > -1; + case "|=": + return value === check || value.substr( 0, check.length + 1 ) === check + "-"; + } + }; + }, + + "CHILD": function( type, argument, first, last ) { + + if ( type === "nth" ) { + var doneName = done++; + + return function( elem ) { + var parent, diff, + count = 0, + node = elem; + + if ( first === 1 && last === 0 ) { + return true; + } + + parent = elem.parentNode; + + if ( parent && (parent[ expando ] !== doneName || !elem.sizset) ) { + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.sizset = ++count; + if ( node === elem ) { + break; + } + } + } + + parent[ expando ] = doneName; + } + + diff = elem.sizset - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + }; + } + + return function( elem ) { + var node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + /* falls through */ + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + } + }; + }, + + "PSEUDO": function( pseudo, argument, context, xml ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + var fn = Expr.pseudos[ pseudo ] || Expr.pseudos[ pseudo.toLowerCase() ]; + + if ( !fn ) { + Sizzle.error( "unsupported pseudo: " + pseudo ); + } + + // The user may set fn.sizzleFilter to indicate + // that arguments are needed to create the filter function + // just as Sizzle does + if ( !fn.sizzleFilter ) { + return fn; + } + + return fn( argument, context, xml ); + } + }, + + pseudos: { + "not": markFunction(function( selector, context, xml ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var matcher = compile( selector.replace( rtrim, "$1" ), context, xml ); + return function( elem ) { + return !matcher( elem ); + }; + }), + + "enabled": function( elem ) { + return elem.disabled === false; + }, + + "disabled": function( elem ) { + return elem.disabled === true; + }, + + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, + + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, + + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is only affected by element nodes and content nodes(including text(3), cdata(4)), + // not comment, processing instructions, or others + // Thanks to Diego Perini for the nodeName shortcut + // Greater than "@" means alpha characters (specifically not starting with "#" or "?") + var nodeType; + elem = elem.firstChild; + while ( elem ) { + if ( elem.nodeName > "@" || (nodeType = elem.nodeType) === 3 || nodeType === 4 ) { + return false; + } + elem = elem.nextSibling; + } + return true; + }, + + "contains": markFunction(function( text ) { + return function( elem ) { + return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), + + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "text": function( elem ) { + var type, attr; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && + (type = elem.type) === "text" && + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === type ); + }, + + // Input types + "radio": createInputFunction("radio"), + "checkbox": createInputFunction("checkbox"), + "file": createInputFunction("file"), + "password": createInputFunction("password"), + "image": createInputFunction("image"), + + "submit": createButtonFunction("submit"), + "reset": createButtonFunction("reset"), + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "focus": function( elem ) { + var doc = elem.ownerDocument; + return elem === doc.activeElement && (!doc.hasFocus || doc.hasFocus()) && !!(elem.type || elem.href); + }, + + "active": function( elem ) { + return elem === elem.ownerDocument.activeElement; + } + }, + + setFilters: { + "first": function( elements, argument, not ) { + return not ? elements.slice( 1 ) : [ elements[0] ]; + }, + + "last": function( elements, argument, not ) { + var elem = elements.pop(); + return not ? elements : [ elem ]; + }, + + "even": function( elements, argument, not ) { + var results = [], + i = not ? 1 : 0, + len = elements.length; + for ( ; i < len; i = i + 2 ) { + results.push( elements[i] ); + } + return results; + }, + + "odd": function( elements, argument, not ) { + var results = [], + i = not ? 0 : 1, + len = elements.length; + for ( ; i < len; i = i + 2 ) { + results.push( elements[i] ); + } + return results; + }, + + "lt": function( elements, argument, not ) { + return not ? elements.slice( +argument ) : elements.slice( 0, +argument ); + }, + + "gt": function( elements, argument, not ) { + return not ? elements.slice( 0, +argument + 1 ) : elements.slice( +argument + 1 ); + }, + + "eq": function( elements, argument, not ) { + var elem = elements.splice( +argument, 1 ); + return not ? elements : elem; + } + } +}; + +// Deprecated +Expr.setFilters["nth"] = Expr.setFilters["eq"]; + +// Back-compat +Expr.filters = Expr.pseudos; + +// IE6/7 return a modified href +if ( !assertHrefNotNormalized ) { + Expr.attrHandle = { + "href": function( elem ) { + return elem.getAttribute( "href", 2 ); + }, + "type": function( elem ) { + return elem.getAttribute("type"); + } + }; +} + +// Add getElementsByName if usable +if ( assertUsableName ) { + Expr.order.push("NAME"); + Expr.find["NAME"] = function( name, context ) { + if ( typeof context.getElementsByName !== strundefined ) { + return context.getElementsByName( name ); + } + }; +} + +// Add getElementsByClassName if usable +if ( assertUsableClassName ) { + Expr.order.splice( 1, 0, "CLASS" ); + Expr.find["CLASS"] = function( className, context, xml ) { + if ( typeof context.getElementsByClassName !== strundefined && !xml ) { + return context.getElementsByClassName( className ); + } + }; +} + +// If slice is not available, provide a backup +try { + slice.call( docElem.childNodes, 0 )[0].nodeType; +} catch ( e ) { + slice = function( i ) { + var elem, results = []; + for ( ; (elem = this[i]); i++ ) { + results.push( elem ); + } + return results; + }; +} + +var isXML = Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = elem && (elem.ownerDocument || elem).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +// Element contains another +var contains = Sizzle.contains = docElem.compareDocumentPosition ? + function( a, b ) { + return !!( a.compareDocumentPosition( b ) & 16 ); + } : + docElem.contains ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && adown.contains && adown.contains(bup) ); + } : + function( a, b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } + return false; + }; + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +var getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( nodeType ) { + if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (see #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + // Do not include comment or processing instruction nodes + } else { + + // If no nodeType, this is expected to be an array + for ( ; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } + return ret; +}; + +Sizzle.attr = function( elem, name ) { + var attr, + xml = isXML( elem ); + + if ( !xml ) { + name = name.toLowerCase(); + } + if ( Expr.attrHandle[ name ] ) { + return Expr.attrHandle[ name ]( elem ); + } + if ( assertAttributes || xml ) { + return elem.getAttribute( name ); + } + attr = elem.getAttributeNode( name ); + return attr ? + typeof elem[ name ] === "boolean" ? + elem[ name ] ? name : null : + attr.specified ? attr.value : null : + null; +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +// Check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + return (baseHasDuplicate = 0); +}); + + +if ( docElem.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + return ( !a.compareDocumentPosition || !b.compareDocumentPosition ? + a.compareDocumentPosition : + a.compareDocumentPosition(b) & 4 + ) ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Document sorting and removing duplicates +Sizzle.uniqueSort = function( results ) { + var elem, + i = 1; + + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( ; (elem = results[i]); i++ ) { + if ( elem === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +function multipleContexts( selector, contexts, results, seed ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results, seed ); + } +} + +function handlePOSGroup( selector, posfilter, argument, contexts, seed, not ) { + var results, + fn = Expr.setFilters[ posfilter.toLowerCase() ]; + + if ( !fn ) { + Sizzle.error( posfilter ); + } + + if ( selector || !(results = seed) ) { + multipleContexts( selector || "*", contexts, (results = []), seed ); + } + + return results.length > 0 ? fn( results, argument, not ) : []; +} + +function handlePOS( selector, context, results, seed, groups ) { + var match, not, anchor, ret, elements, currentContexts, part, lastIndex, + i = 0, + len = groups.length, + rpos = matchExpr["POS"], + // This is generated here in case matchExpr["POS"] is extended + rposgroups = new RegExp( "^" + rpos.source + "(?!" + whitespace + ")", "i" ), + // This is for making sure non-participating + // matching groups are represented cross-browser (IE6-8) + setUndefined = function() { + var i = 1, + len = arguments.length - 2; + for ( ; i < len; i++ ) { + if ( arguments[i] === undefined ) { + match[i] = undefined; + } + } + }; + + for ( ; i < len; i++ ) { + // Reset regex index to 0 + rpos.exec(""); + selector = groups[i]; + ret = []; + anchor = 0; + elements = seed; + while ( (match = rpos.exec( selector )) ) { + lastIndex = rpos.lastIndex = match.index + match[0].length; + if ( lastIndex > anchor ) { + part = selector.slice( anchor, match.index ); + anchor = lastIndex; + currentContexts = [ context ]; + + if ( rcombinators.test(part) ) { + if ( elements ) { + currentContexts = elements; + } + elements = seed; + } + + if ( (not = rendsWithNot.test( part )) ) { + part = part.slice( 0, -5 ).replace( rcombinators, "$&*" ); + } + + if ( match.length > 1 ) { + match[0].replace( rposgroups, setUndefined ); + } + elements = handlePOSGroup( part, match[1], match[2], currentContexts, elements, not ); + } + } + + if ( elements ) { + ret = ret.concat( elements ); + + if ( (part = selector.slice( anchor )) && part !== ")" ) { + if ( rcombinators.test(part) ) { + multipleContexts( part, ret, results, seed ); + } else { + Sizzle( part, context, results, seed ? seed.concat(elements) : elements ); + } + } else { + push.apply( results, ret ); + } + } else { + Sizzle( selector, context, results, seed ); + } + } + + // Do not sort if this is a single filter + return len === 1 ? results : Sizzle.uniqueSort( results ); +} + +function tokenize( selector, context, xml ) { + var tokens, soFar, type, + groups = [], + i = 0, + + // Catch obvious selector issues: terminal ")"; nonempty fallback match + // rselector never fails to match *something* + match = rselector.exec( selector ), + matched = !match.pop() && !match.pop(), + selectorGroups = matched && selector.match( rgroups ) || [""], + + preFilters = Expr.preFilter, + filters = Expr.filter, + checkContext = !xml && context !== document; + + for ( ; (soFar = selectorGroups[i]) != null && matched; i++ ) { + groups.push( tokens = [] ); + + // Need to make sure we're within a narrower context if necessary + // Adding a descendant combinator will generate what is needed + if ( checkContext ) { + soFar = " " + soFar; + } + + while ( soFar ) { + matched = false; + + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + soFar = soFar.slice( match[0].length ); + + // Cast descendant combinators to space + matched = tokens.push({ part: match.pop().replace( rtrim, " " ), captures: match }); + } + + // Filters + for ( type in filters ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + (match = preFilters[ type ]( match, context, xml )) ) ) { + + soFar = soFar.slice( match.shift().length ); + matched = tokens.push({ part: type, captures: match }); + } + } + + if ( !matched ) { + break; + } + } + } + + if ( !matched ) { + Sizzle.error( selector ); + } + + return groups; +} + +function addCombinator( matcher, combinator, context ) { + var dir = combinator.dir, + doneName = done++; + + if ( !matcher ) { + // If there is no matcher to check, check against the context + matcher = function( elem ) { + return elem === context; + }; + } + return combinator.first ? + function( elem, context ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 ) { + return matcher( elem, context ) && elem; + } + } + } : + function( elem, context ) { + var cache, + dirkey = doneName + "." + dirruns, + cachedkey = dirkey + "." + cachedruns; + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 ) { + if ( (cache = elem[ expando ]) === cachedkey ) { + return elem.sizset; + } else if ( typeof cache === "string" && cache.indexOf(dirkey) === 0 ) { + if ( elem.sizset ) { + return elem; + } + } else { + elem[ expando ] = cachedkey; + if ( matcher( elem, context ) ) { + elem.sizset = true; + return elem; + } + elem.sizset = false; + } + } + } + }; +} + +function addMatcher( higher, deeper ) { + return higher ? + function( elem, context ) { + var result = deeper( elem, context ); + return result && higher( result === true ? elem : result, context ); + } : + deeper; +} + +// ["TAG", ">", "ID", " ", "CLASS"] +function matcherFromTokens( tokens, context, xml ) { + var token, matcher, + i = 0; + + for ( ; (token = tokens[i]); i++ ) { + if ( Expr.relative[ token.part ] ) { + matcher = addCombinator( matcher, Expr.relative[ token.part ], context ); + } else { + token.captures.push( context, xml ); + matcher = addMatcher( matcher, Expr.filter[ token.part ].apply( null, token.captures ) ); + } + } + + return matcher; +} + +function matcherFromGroupMatchers( matchers ) { + return function( elem, context ) { + var matcher, + j = 0; + for ( ; (matcher = matchers[j]); j++ ) { + if ( matcher(elem, context) ) { + return true; + } + } + return false; + }; +} + +var compile = Sizzle.compile = function( selector, context, xml ) { + var tokens, group, i, + cached = compilerCache[ selector ]; + + // Return a cached group function if already generated (context dependent) + if ( cached && cached.context === context ) { + return cached; + } + + // Generate a function of recursive functions that can be used to check each element + group = tokenize( selector, context, xml ); + for ( i = 0; (tokens = group[i]); i++ ) { + group[i] = matcherFromTokens( tokens, context, xml ); + } + + // Cache the compiled function + cached = compilerCache[ selector ] = matcherFromGroupMatchers( group ); + cached.context = context; + cached.runs = cached.dirruns = 0; + cachedSelectors.push( selector ); + // Ensure only the most recent are cached + if ( cachedSelectors.length > Expr.cacheLength ) { + delete compilerCache[ cachedSelectors.shift() ]; + } + return cached; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + return Sizzle( expr, null, null, [ elem ] ).length > 0; +}; + +var select = function( selector, context, results, seed, xml ) { + // Remove excessive whitespace + selector = selector.replace( rtrim, "$1" ); + var elements, matcher, i, len, elem, token, + type, findContext, notTokens, + match = selector.match( rgroups ), + tokens = selector.match( rtokens ), + contextNodeType = context.nodeType; + + // POS handling + if ( matchExpr["POS"].test(selector) ) { + return handlePOS( selector, context, results, seed, match ); + } + + if ( seed ) { + elements = slice.call( seed, 0 ); + + // To maintain document order, only narrow the + // set if there is one group + } else if ( match && match.length === 1 ) { + + // Take a shortcut and set the context if the root selector is an ID + if ( tokens.length > 1 && contextNodeType === 9 && !xml && + (match = matchExpr["ID"].exec( tokens[0] )) ) { + + context = Expr.find["ID"]( match[1], context, xml )[0]; + if ( !context ) { + return results; + } + + selector = selector.slice( tokens.shift().length ); + } + + findContext = ( (match = rsibling.exec( tokens[0] )) && !match.index && context.parentNode ) || context; + + // Get the last token, excluding :not + notTokens = tokens.pop(); + token = notTokens.split(":not")[0]; + + for ( i = 0, len = Expr.order.length; i < len; i++ ) { + type = Expr.order[i]; + + if ( (match = matchExpr[ type ].exec( token )) ) { + elements = Expr.find[ type ]( (match[1] || "").replace( rbackslash, "" ), findContext, xml ); + + if ( elements == null ) { + continue; + } + + if ( token === notTokens ) { + selector = selector.slice( 0, selector.length - notTokens.length ) + + token.replace( matchExpr[ type ], "" ); + + if ( !selector ) { + push.apply( results, slice.call(elements, 0) ); + } + } + break; + } + } + } + + // Only loop over the given elements once + // If selector is empty, we're already done + if ( selector ) { + matcher = compile( selector, context, xml ); + dirruns = matcher.dirruns++; + + if ( elements == null ) { + elements = Expr.find["TAG"]( "*", (rsibling.test( selector ) && context.parentNode) || context ); + } + for ( i = 0; (elem = elements[i]); i++ ) { + cachedruns = matcher.runs++; + if ( matcher(elem, context) ) { + results.push( elem ); + } + } + } + + return results; +}; + +if ( document.querySelectorAll ) { + (function() { + var disconnectedMatch, + oldSelect = select, + rescape = /'|\\/g, + rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g, + rbuggyQSA = [], + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + // A support test would require too much code (would include document ready) + // just skip matchesSelector for :active + rbuggyMatches = [":active"], + matches = docElem.matchesSelector || + docElem.mozMatchesSelector || + docElem.webkitMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector; + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( div ) { + div.innerHTML = ""; + + // IE8 - Some boolean attributes are not treated correctly + if ( !div.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here (do not put tests after this one) + if ( !div.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } + }); + + assert(function( div ) { + + // Opera 10-12/IE9 - ^= $= *= and empty values + // Should not select anything + div.innerHTML = "

"; + if ( div.querySelectorAll("[test^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:\"\"|'')" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here (do not put tests after this one) + div.innerHTML = ""; + if ( !div.querySelectorAll(":enabled").length ) { + rbuggyQSA.push(":enabled", ":disabled"); + } + }); + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") ); + + select = function( selector, context, results, seed, xml ) { + // Only use querySelectorAll when not filtering, + // when this is not xml, + // and when no QSA bugs apply + if ( !seed && !xml && (!rbuggyQSA || !rbuggyQSA.test( selector )) ) { + if ( context.nodeType === 9 ) { + try { + push.apply( results, slice.call(context.querySelectorAll( selector ), 0) ); + return results; + } catch(qsaError) {} + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var old = context.getAttribute("id"), + nid = old || expando, + newContext = rsibling.test( selector ) && context.parentNode || context; + + if ( old ) { + nid = nid.replace( rescape, "\\$&" ); + } else { + context.setAttribute( "id", nid ); + } + + try { + push.apply( results, slice.call( newContext.querySelectorAll( + selector.replace( rgroups, "[id='" + nid + "'] $&" ) + ), 0 ) ); + return results; + } catch(qsaError) { + } finally { + if ( !old ) { + context.removeAttribute("id"); + } + } + } + } + + return oldSelect( selector, context, results, seed, xml ); + }; + + if ( matches ) { + assert(function( div ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + disconnectedMatch = matches.call( div, "div" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + try { + matches.call( div, "[test!='']:sizzle" ); + rbuggyMatches.push( Expr.match.PSEUDO ); + } catch ( e ) {} + }); + + // rbuggyMatches always contains :active, so no need for a length check + rbuggyMatches = /* rbuggyMatches.length && */ new RegExp( rbuggyMatches.join("|") ); + + Sizzle.matchesSelector = function( elem, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace( rattributeQuotes, "='$1']" ); + + // rbuggyMatches always contains :active, so no need for an existence check + if ( !isXML( elem ) && !rbuggyMatches.test( expr ) && (!rbuggyQSA || !rbuggyQSA.test( expr )) ) { + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch(e) {} + } + + return Sizzle( expr, null, null, [ elem ] ).length > 0; + }; + } + })(); +} + +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.pseudos; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})( window ); +var runtil = /Until$/, + rparentsprev = /^(?:parents|prev(?:Until|All))/, + isSimple = /^.[^:#\[\.,]*$/, + rneedsContext = jQuery.expr.match.needsContext, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var i, l, length, n, r, ret, + self = this; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + ret = this.pushStack( "", "find", selector ); + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var i, + targets = jQuery( target, this ), + len = targets.length; + + return this.filter(function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + rneedsContext.test( selector ) ? + jQuery( selector, this.context ).index( this[0] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + ret = [], + pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( ; i < l; i++ ) { + cur = this[i]; + + while ( cur && cur.ownerDocument && cur !== context && cur.nodeType !== 11 ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + } + cur = cur.parentNode; + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter(selector) + ); + } +}); + +jQuery.fn.andSelf = jQuery.fn.addBack; + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +function sibling( cur, dir ) { + do { + cur = cur[ dir ]; + } while ( cur && cur.nodeType !== 1 ); + + return cur; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( this.length > 1 && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, core_slice.call( arguments ).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return ( elem === qualifier ) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; + }); +} +function createSafeFragment( document ) { + var list = nodeNames.split( "|" ), + safeFrag = document.createDocumentFragment(); + + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} + +var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" + + "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", + rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi, + rtagName = /<([\w:]+)/, + rtbody = /]", "i"), + rcheckableType = /^(?:checkbox|radio)$/, + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /\/(java|ecma)script/i, + rcleanScript = /^\s*\s*$/g, + wrapMap = { + option: [ 1, "" ], + legend: [ 1, "
", "
" ], + thead: [ 1, "", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + col: [ 2, "", "
" ], + area: [ 1, "", "" ], + _default: [ 0, "", "" ] + }, + safeFragment = createSafeFragment( document ), + fragmentDiv = safeFragment.appendChild( document.createElement("div") ); + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags, +// unless wrapped in a div with non-breaking characters in front of it. +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "X
", "
" ]; +} + +jQuery.fn.extend({ + text: function( value ) { + return jQuery.access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) ); + }, null, value, arguments.length ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + var isFunction = jQuery.isFunction( html ); + + return this.each(function(i) { + jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( !isDisconnected( this[0] ) ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } + + if ( arguments.length ) { + var set = jQuery.clean( arguments ); + return this.pushStack( jQuery.merge( set, this ), "before", this.selector ); + } + }, + + after: function() { + if ( !isDisconnected( this[0] ) ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } + + if ( arguments.length ) { + var set = jQuery.clean( arguments ); + return this.pushStack( jQuery.merge( this, set ), "after", this.selector ); + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + var elem, + i = 0; + + for ( ; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + var elem, + i = 0; + + for ( ; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + return jQuery.access( this, function( value ) { + var elem = this[0] || {}, + i = 0, + l = this.length; + + if ( value === undefined ) { + return elem.nodeType === 1 ? + elem.innerHTML.replace( rinlinejQuery, "" ) : + undefined; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + ( jQuery.support.htmlSerialize || !rnoshimcache.test( value ) ) && + ( jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value ) ) && + !wrapMap[ ( rtagName.exec( value ) || ["", ""] )[1].toLowerCase() ] ) { + + value = value.replace( rxhtmlTag, "<$1>" ); + + try { + for (; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + elem = this[i] || {}; + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName( "*" ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch(e) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function( value ) { + if ( !isDisconnected( this[0] ) ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } + + return this.length ? + this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : + this; + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + + // Flatten any nested arrays + args = [].concat.apply( [], args ); + + var results, first, fragment, iNoClone, + i = 0, + value = args[0], + scripts = [], + l = this.length; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && l > 1 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call( this, i, table ? self.html() : undefined ); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + results = jQuery.buildFragment( args, this, scripts ); + fragment = results.fragment; + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + // Use the original fragment for the last item instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + // Fragments from the fragment cache must always be cloned and never used in place. + for ( iNoClone = results.cacheable || l - 1; i < l; i++ ) { + callback.call( + table && jQuery.nodeName( this[i], "table" ) ? + findOrAppend( this[i], "tbody" ) : + this[i], + i === iNoClone ? + fragment : + jQuery.clone( fragment, true, true ) + ); + } + } + + // Fix #11809: Avoid leaking memory + fragment = first = null; + + if ( scripts.length ) { + jQuery.each( scripts, function( i, elem ) { + if ( elem.src ) { + if ( jQuery.ajax ) { + jQuery.ajax({ + url: elem.src, + type: "GET", + dataType: "script", + async: false, + global: false, + "throws": true + }); + } else { + jQuery.error("no ajax"); + } + } else { + jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "" ) ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + }); + } + } + + return this; + } +}); + +function findOrAppend( elem, tag ) { + return elem.getElementsByTagName( tag )[0] || elem.appendChild( elem.ownerDocument.createElement( tag ) ); +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var type, i, l, + oldData = jQuery._data( src ), + curData = jQuery._data( dest, oldData ), + events = oldData.events; + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + + // make the cloned public data object a copy from the original + if ( curData.data ) { + curData.data = jQuery.extend( {}, curData.data ); + } +} + +function cloneFixAttributes( src, dest ) { + var nodeName; + + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + // clearAttributes removes the attributes, which we don't want, + // but also removes the attachEvent events, which we *do* want + if ( dest.clearAttributes ) { + dest.clearAttributes(); + } + + // mergeAttributes, in contrast, only merges back on the + // original attributes, not the events + if ( dest.mergeAttributes ) { + dest.mergeAttributes( src ); + } + + nodeName = dest.nodeName.toLowerCase(); + + if ( nodeName === "object" ) { + // IE6-10 improperly clones children of object elements using classid. + // IE10 throws NoModificationAllowedError if parent is null, #12132. + if ( dest.parentNode ) { + dest.outerHTML = src.outerHTML; + } + + // This path appears unavoidable for IE9. When cloning an object + // element in IE9, the outerHTML strategy above is not sufficient. + // If the src has innerHTML and the destination does not, + // copy the src.innerHTML into the dest.innerHTML. #10324 + if ( jQuery.support.html5Clone && (src.innerHTML && !jQuery.trim(dest.innerHTML)) ) { + dest.innerHTML = src.innerHTML; + } + + } else if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + + dest.defaultChecked = dest.checked = src.checked; + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + + // IE blanks contents when cloning scripts + } else if ( nodeName === "script" && dest.text !== src.text ) { + dest.text = src.text; + } + + // Event data gets referenced instead of copied if the expando + // gets copied too + dest.removeAttribute( jQuery.expando ); +} + +jQuery.buildFragment = function( args, context, scripts ) { + var fragment, cacheable, cachehit, + first = args[ 0 ]; + + // Set context from what may come in as undefined or a jQuery collection or a node + context = context || document; + context = (context[0] || context).ownerDocument || context[0] || context; + + // Ensure that an attr object doesn't incorrectly stand in as a document object + // Chrome and Firefox seem to allow this to occur and will throw exception + // Fixes #8950 + if ( typeof context.createDocumentFragment === "undefined" ) { + context = document; + } + + // Only cache "small" (1/2 KB) HTML strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put or elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501 + if ( args.length === 1 && typeof first === "string" && first.length < 512 && context === document && + first.charAt(0) === "<" && !rnocache.test( first ) && + (jQuery.support.checkClone || !rchecked.test( first )) && + (jQuery.support.html5Clone || !rnoshimcache.test( first )) ) { + + // Mark cacheable and look for a hit + cacheable = true; + fragment = jQuery.fragments[ first ]; + cachehit = fragment !== undefined; + } + + if ( !fragment ) { + fragment = context.createDocumentFragment(); + jQuery.clean( args, context, fragment, scripts ); + + // Update the cache, but only store false + // unless this is a second parsing of the same content + if ( cacheable ) { + jQuery.fragments[ first ] = cachehit && fragment; + } + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + i = 0, + ret = [], + insert = jQuery( selector ), + l = insert.length, + parent = this.length === 1 && this[0].parentNode; + + if ( (parent == null || parent && parent.nodeType === 11 && parent.childNodes.length === 1) && l === 1 ) { + insert[ original ]( this[0] ); + return this; + } else { + for ( ; i < l; i++ ) { + elems = ( i > 0 ? this.clone(true) : this ).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +function getAll( elem ) { + if ( typeof elem.getElementsByTagName !== "undefined" ) { + return elem.getElementsByTagName( "*" ); + + } else if ( typeof elem.querySelectorAll !== "undefined" ) { + return elem.querySelectorAll( "*" ); + + } else { + return []; + } +} + +// Used in clean, fixes the defaultChecked property +function fixDefaultChecked( elem ) { + if ( rcheckableType.test( elem.type ) ) { + elem.defaultChecked = elem.checked; + } +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var srcElements, + destElements, + i, + clone; + + if ( jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ) { + clone = elem.cloneNode( true ); + + // IE<=8 does not properly clone detached, unknown element nodes + } else { + fragmentDiv.innerHTML = elem.outerHTML; + fragmentDiv.removeChild( clone = fragmentDiv.firstChild ); + } + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + // IE copies events bound via attachEvent when using cloneNode. + // Calling detachEvent on the clone will also remove the events + // from the original. In order to get around this, we use some + // proprietary methods to clear the events. Thanks to MooTools + // guys for this hotness. + + cloneFixAttributes( elem, clone ); + + // Using Sizzle here is crazy slow, so we use getElementsByTagName instead + srcElements = getAll( elem ); + destElements = getAll( clone ); + + // Weird iteration because IE will replace the length property + // with an element if you are cloning the body and one of the + // elements on the page has a name or id of "length" + for ( i = 0; srcElements[i]; ++i ) { + // Ensure that the destination node is not null; Fixes #9587 + if ( destElements[i] ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + cloneCopyEvent( elem, clone ); + + if ( deepDataAndEvents ) { + srcElements = getAll( elem ); + destElements = getAll( clone ); + + for ( i = 0; srcElements[i]; ++i ) { + cloneCopyEvent( srcElements[i], destElements[i] ); + } + } + } + + srcElements = destElements = null; + + // Return the cloned set + return clone; + }, + + clean: function( elems, context, fragment, scripts ) { + var j, safe, elem, tag, wrap, depth, div, hasBody, tbody, len, handleScript, jsTags, + i = 0, + ret = []; + + // Ensure that context is a document + if ( !context || typeof context.createDocumentFragment === "undefined" ) { + context = document; + } + + // Use the already-created safe fragment if context permits + for ( safe = context === document && safeFragment; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + if ( !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + } else { + // Ensure a safe container in which to render the html + safe = safe || createSafeFragment( context ); + div = div || safe.appendChild( context.createElement("div") ); + + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1>"); + + // Go to html and back, then peel off extra wrappers + tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + depth = wrap[0]; + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted from table fragments + if ( !jQuery.support.tbody ) { + + // String was a , *may* have spurious + hasBody = rtbody.test(elem); + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare or + wrap[1] === "
" && !hasBody ? + div.childNodes : + []; + + for ( j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + + // Remember the top-level container for proper cleanup + div = safe.lastChild; + } + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + ret = jQuery.merge( ret, elem ); + } + } + + // Fix #11356: Clear elements from safeFragment + if ( div ) { + safe.removeChild( div ); + elem = div = safe = null; + } + + // Reset defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + if ( !jQuery.support.appendChecked ) { + for ( i = 0; (elem = ret[i]) != null; i++ ) { + if ( jQuery.nodeName( elem, "input" ) ) { + fixDefaultChecked( elem ); + } else if ( typeof elem.getElementsByTagName !== "undefined" ) { + jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); + } + } + } + + // Append elements to a provided document fragment + if ( fragment ) { + // Special handling of each script element + handleScript = function( elem ) { + // Check if we consider it executable + if ( !elem.type || rscriptType.test( elem.type ) ) { + // Detach the script and store it in the scripts array (if provided) or the fragment + // Return truthy to indicate that it has been handled + return scripts ? + scripts.push( elem.parentNode ? elem.parentNode.removeChild( elem ) : elem ) : + fragment.appendChild( elem ); + } + }; + + for ( i = 0; (elem = ret[i]) != null; i++ ) { + // Check if we're done after handling an executable script + if ( !( jQuery.nodeName( elem, "script" ) && handleScript( elem ) ) ) { + // Append to fragment and handle embedded scripts + fragment.appendChild( elem ); + if ( typeof elem.getElementsByTagName !== "undefined" ) { + // handleScript alters the DOM, so use jQuery.merge to ensure snapshot iteration + jsTags = jQuery.grep( jQuery.merge( [], elem.getElementsByTagName("script") ), handleScript ); + + // Splice the scripts into ret after their former ancestor and advance our index beyond them + ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); + i += jsTags.length; + } + } + } + } + + return ret; + }, + + cleanData: function( elems, /* internal */ acceptData ) { + var data, id, elem, type, + i = 0, + internalKey = jQuery.expando, + cache = jQuery.cache, + deleteExpando = jQuery.support.deleteExpando, + special = jQuery.event.special; + + for ( ; (elem = elems[i]) != null; i++ ) { + + if ( acceptData || jQuery.acceptData( elem ) ) { + + id = elem[ internalKey ]; + data = id && cache[ id ]; + + if ( data ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Remove cache only if it was not already removed by jQuery.event.remove + if ( cache[ id ] ) { + + delete cache[ id ]; + + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( deleteExpando ) { + delete elem[ internalKey ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( internalKey ); + + } else { + elem[ internalKey ] = null; + } + + jQuery.deletedIds.push( id ); + } + } + } + } + } +}); +// Limit scope pollution from any deprecated API +(function() { + +var matched, browser; + +// Use of jQuery.browser is frowned upon. +// More details: http://api.jquery.com/jQuery.browser +// jQuery.uaMatch maintained for back-compat +jQuery.uaMatch = function( ua ) { + ua = ua.toLowerCase(); + + var match = /(chrome)[ \/]([\w.]+)/.exec( ua ) || + /(webkit)[ \/]([\w.]+)/.exec( ua ) || + /(opera)(?:.*version|)[ \/]([\w.]+)/.exec( ua ) || + /(msie) ([\w.]+)/.exec( ua ) || + ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec( ua ) || + []; + + return { + browser: match[ 1 ] || "", + version: match[ 2 ] || "0" + }; +}; + +matched = jQuery.uaMatch( navigator.userAgent ); +browser = {}; + +if ( matched.browser ) { + browser[ matched.browser ] = true; + browser.version = matched.version; +} + +// Deprecated, use jQuery.browser.webkit instead +// Maintained for back-compat only +if ( browser.webkit ) { + browser.safari = true; +} + +jQuery.browser = browser; + +jQuery.sub = function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; +}; + +})(); +var curCSS, iframe, iframeDoc, + ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + rposition = /^(top|right|bottom|left)$/, + rmargin = /^margin/, + rnumsplit = new RegExp( "^(" + core_pnum + ")(.*)$", "i" ), + rnumnonpx = new RegExp( "^(" + core_pnum + ")(?!px)[a-z%]+$", "i" ), + rrelNum = new RegExp( "^([-+])=(" + core_pnum + ")", "i" ), + elemdisplay = {}, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: 0, + fontWeight: 400, + lineHeight: 1 + }, + + cssExpand = [ "Top", "Right", "Bottom", "Left" ], + cssPrefixes = [ "Webkit", "O", "Moz", "ms" ], + + eventsToggle = jQuery.fn.toggle; + +// return a css property mapped to a potentially vendor prefixed property +function vendorPropName( style, name ) { + + // shortcut for names that are not vendor prefixed + if ( name in style ) { + return name; + } + + // check for vendor prefixed names + var capName = name.charAt(0).toUpperCase() + name.slice(1), + origName = name, + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in style ) { + return name; + } + } + + return origName; +} + +function isHidden( elem, el ) { + elem = el || elem; + return jQuery.css( elem, "display" ) === "none" || !jQuery.contains( elem.ownerDocument, elem ); +} + +function showHide( elements, show ) { + var elem, display, + values = [], + index = 0, + length = elements.length; + + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + values[ index ] = jQuery._data( elem, "olddisplay" ); + if ( show ) { + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !values[ index ] && elem.style.display === "none" ) { + elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( elem.style.display === "" && isHidden( elem ) ) { + values[ index ] = jQuery._data( elem, "olddisplay", css_defaultDisplay(elem.nodeName) ); + } + } else { + display = curCSS( elem, "display" ); + + if ( !values[ index ] && display !== "none" ) { + jQuery._data( elem, "olddisplay", display ); + } + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( index = 0; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + if ( !show || elem.style.display === "none" || elem.style.display === "" ) { + elem.style.display = show ? values[ index ] || "" : "none"; + } + } + + return elements; +} + +jQuery.fn.extend({ + css: function( name, value ) { + return jQuery.access( this, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + }, + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state, fn2 ) { + var bool = typeof state === "boolean"; + + if ( jQuery.isFunction( state ) && jQuery.isFunction( fn2 ) ) { + return eventsToggle.apply( this, arguments ); + } + + return this.each(function() { + if ( bool ? state : isHidden( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + }); + } +}); + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "fillOpacity": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = jQuery.camelCase( name ), + style = elem.style; + + name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( style, origName ) ); + + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // convert relative number strings (+= or -=) to relative numbers. #7345 + if ( type === "string" && (ret = rrelNum.exec( value )) ) { + value = ( ret[1] + 1 ) * ret[2] + parseFloat( jQuery.css( elem, name ) ); + // Fixes bug #9237 + type = "number"; + } + + // Make sure that NaN and null values aren't set. See: #7116 + if ( value == null || type === "number" && isNaN( value ) ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( type === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value, extra )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, numeric, extra ) { + var val, num, hooks, + origName = jQuery.camelCase( name ); + + // Make sure that we're working with the right name + name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( elem.style, origName ) ); + + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name ); + } + + //convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Return, converting to number if forced or a qualifier was provided and val looks numeric + if ( numeric || extra !== undefined ) { + num = parseFloat( val ); + return numeric || jQuery.isNumeric( num ) ? num || 0 : val; + } + return val; + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; + } +}); + +// NOTE: To any future maintainer, we've used both window.getComputedStyle +// and getComputedStyle here to produce a better gzip size +if ( window.getComputedStyle ) { + curCSS = function( elem, name ) { + var ret, width, minWidth, maxWidth, + computed = getComputedStyle( elem, null ), + style = elem.style; + + if ( computed ) { + + ret = computed[ name ]; + if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Chrome < 17 and Safari 5.0 uses "computed value" instead of "used value" for margin-right + // Safari 5.1.7 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels + // this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values + if ( rnumnonpx.test( ret ) && rmargin.test( name ) ) { + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret; + }; +} else if ( document.documentElement.currentStyle ) { + curCSS = function( elem, name ) { + var left, rsLeft, + ret = elem.currentStyle && elem.currentStyle[ name ], + style = elem.style; + + // Avoid setting ret to empty string here + // so we don't default to auto + if ( ret == null && style && style[ name ] ) { + ret = style[ name ]; + } + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + // but not position css attributes, as those are proportional to the parent element instead + // and we can't measure the parent instead because it might trigger a "stacking dolls" problem + if ( rnumnonpx.test( ret ) && !rposition.test( name ) ) { + + // Remember the original values + left = style.left; + rsLeft = elem.runtimeStyle && elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + elem.runtimeStyle.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : ret; + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + elem.runtimeStyle.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +function setPositiveNumber( elem, value, subtract ) { + var matches = rnumsplit.exec( value ); + return matches ? + Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) : + value; +} + +function augmentWidthOrHeight( elem, name, extra, isBorderBox ) { + var i = extra === ( isBorderBox ? "border" : "content" ) ? + // If we already have the right measurement, avoid augmentation + 4 : + // Otherwise initialize for horizontal or vertical properties + name === "width" ? 1 : 0, + + val = 0; + + for ( ; i < 4; i += 2 ) { + // both box models exclude margin, so add it if we want it + if ( extra === "margin" ) { + // we use jQuery.css instead of curCSS here + // because of the reliableMarginRight CSS hook! + val += jQuery.css( elem, extra + cssExpand[ i ], true ); + } + + // From this point on we use curCSS for maximum performance (relevant in animations) + if ( isBorderBox ) { + // border-box includes padding, so remove it if we want content + if ( extra === "content" ) { + val -= parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0; + } + + // at this point, extra isn't border nor margin, so remove border + if ( extra !== "margin" ) { + val -= parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; + } + } else { + // at this point, extra isn't content, so add padding + val += parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0; + + // at this point, extra isn't content nor padding, so add border + if ( extra !== "padding" ) { + val += parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; + } + } + } + + return val; +} + +function getWidthOrHeight( elem, name, extra ) { + + // Start with offset property, which is equivalent to the border-box value + var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + valueIsBorderBox = true, + isBorderBox = jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box"; + + if ( val <= 0 ) { + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name ); + if ( val < 0 || val == null ) { + val = elem.style[ name ]; + } + + // Computed unit is not pixels. Stop here and return. + if ( rnumnonpx.test(val) ) { + return val; + } + + // we need the check for style in case a browser which returns unreliable values + // for getComputedStyle silently falls back to the reliable elem.style + valueIsBorderBox = isBorderBox && ( jQuery.support.boxSizingReliable || val === elem.style[ name ] ); + + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + } + + // use the active box-sizing model to add/subtract irrelevant styles + return ( val + + augmentWidthOrHeight( + elem, + name, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox + ) + ) + "px"; +} + + +// Try to determine the default display value of an element +function css_defaultDisplay( nodeName ) { + if ( elemdisplay[ nodeName ] ) { + return elemdisplay[ nodeName ]; + } + + var elem = jQuery( "<" + nodeName + ">" ).appendTo( document.body ), + display = elem.css("display"); + elem.remove(); + + // If the simple way fails, + // get element's real default display by attaching it to a temp iframe + if ( display === "none" || display === "" ) { + // Use the already-created iframe if possible + iframe = document.body.appendChild( + iframe || jQuery.extend( document.createElement("iframe"), { + frameBorder: 0, + width: 0, + height: 0 + }) + ); + + // Create a cacheable copy of the iframe document on first call. + // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML + // document to it; WebKit & Firefox won't allow reusing the iframe document. + if ( !iframeDoc || !iframe.createElement ) { + iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; + iframeDoc.write(""); + iframeDoc.close(); + } + + elem = iframeDoc.body.appendChild( iframeDoc.createElement(nodeName) ); + + display = curCSS( elem, "display" ); + document.body.removeChild( iframe ); + } + + // Store the correct default display + elemdisplay[ nodeName ] = display; + + return display; +} + +jQuery.each([ "height", "width" ], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + if ( elem.offsetWidth !== 0 || curCSS( elem, "display" ) !== "none" ) { + return getWidthOrHeight( elem, name, extra ); + } else { + return jQuery.swap( elem, cssShow, function() { + return getWidthOrHeight( elem, name, extra ); + }); + } + } + }, + + set: function( elem, value, extra ) { + return setPositiveNumber( elem, value, extra ? + augmentWidthOrHeight( + elem, + name, + extra, + jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box" + ) : 0 + ); + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? + ( 0.01 * parseFloat( RegExp.$1 ) ) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style, + currentStyle = elem.currentStyle, + opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "", + filter = currentStyle && currentStyle.filter || style.filter || ""; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 + if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" && + style.removeAttribute ) { + + // Setting style.filter to null, "" & " " still leave "filter:" in the cssText + // if "filter:" is present at all, clearType is disabled, we want to avoid this + // style.removeAttribute is IE Only, but so apparently is this code path... + style.removeAttribute( "filter" ); + + // if there there is no filter style applied in a css rule, we are done + if ( currentStyle && !currentStyle.filter ) { + return; + } + } + + // otherwise, set new filter values + style.filter = ralpha.test( filter ) ? + filter.replace( ralpha, opacity ) : + filter + " " + opacity; + } + }; +} + +// These hooks cannot be added until DOM ready because the support test +// for it is not run until after DOM ready +jQuery(function() { + if ( !jQuery.support.reliableMarginRight ) { + jQuery.cssHooks.marginRight = { + get: function( elem, computed ) { + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + // Work around by temporarily setting element display to inline-block + return jQuery.swap( elem, { "display": "inline-block" }, function() { + if ( computed ) { + return curCSS( elem, "marginRight" ); + } + }); + } + }; + } + + // Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084 + // getComputedStyle returns percent when specified for top/left/bottom/right + // rather than make the css module depend on the offset module, we just check for it here + if ( !jQuery.support.pixelPosition && jQuery.fn.position ) { + jQuery.each( [ "top", "left" ], function( i, prop ) { + jQuery.cssHooks[ prop ] = { + get: function( elem, computed ) { + if ( computed ) { + var ret = curCSS( elem, prop ); + // if curCSS returns percentage, fallback to offset + return rnumnonpx.test( ret ) ? jQuery( elem ).position()[ prop ] + "px" : ret; + } + } + }; + }); + } + +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + return ( elem.offsetWidth === 0 && elem.offsetHeight === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || curCSS( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + +// These hooks are used by animate to expand properties +jQuery.each({ + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i, + + // assumes a single number if not a string + parts = typeof value === "string" ? value.split(" ") : [ value ], + expanded = {}; + + for ( i = 0; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( !rmargin.test( prefix ) ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +}); +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + rselectTextarea = /^(?:select|textarea)/i; + +jQuery.fn.extend({ + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray( this.elements ) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + ( this.checked || rselectTextarea.test( this.nodeName ) || + rinput.test( this.type ) ); + }) + .map(function( i, elem ){ + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val, i ){ + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }).get(); + } +}); + +//Serialize an array of form elements or a set of +//key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : ( value == null ? "" : value ); + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); +}; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( jQuery.isArray( obj ) ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && jQuery.type( obj ) === "object" ) { + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} +var // Document location + ajaxLocation, + // Document location segments + ajaxLocParts, + + rhash = /#.*$/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + rquery = /\?/, + rscript = /)<[^<]*)*<\/script>/gi, + rts = /([?&])_=[^&]*/, + rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/, + + // Keep a copy of the old load method + _load = jQuery.fn.load, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = ["*/"] + ["*"]; + +// #8138, IE may throw an exception when accessing +// a field from window.location if document.domain has been set +try { + ajaxLocation = location.href; +} catch( e ) { + // Use the href attribute of an A element + // since IE will modify it given document.location + ajaxLocation = document.createElement( "a" ); + ajaxLocation.href = ""; + ajaxLocation = ajaxLocation.href; +} + +// Segment location into parts +ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, list, placeBefore, + dataTypes = dataTypeExpression.toLowerCase().split( core_rspace ), + i = 0, + length = dataTypes.length; + + if ( jQuery.isFunction( func ) ) { + // For each dataType in the dataTypeExpression + for ( ; i < length; i++ ) { + dataType = dataTypes[ i ]; + // We control if we're asked to add before + // any existing element + placeBefore = /^\+/.test( dataType ); + if ( placeBefore ) { + dataType = dataType.substr( 1 ) || "*"; + } + list = structure[ dataType ] = structure[ dataType ] || []; + // then we add to the structure accordingly + list[ placeBefore ? "unshift" : "push" ]( func ); + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, + dataType /* internal */, inspected /* internal */ ) { + + dataType = dataType || options.dataTypes[ 0 ]; + inspected = inspected || {}; + + inspected[ dataType ] = true; + + var selection, + list = structure[ dataType ], + i = 0, + length = list ? list.length : 0, + executeOnly = ( structure === prefilters ); + + for ( ; i < length && ( executeOnly || !selection ); i++ ) { + selection = list[ i ]( options, originalOptions, jqXHR ); + // If we got redirected to another dataType + // we try there if executing only and not done already + if ( typeof selection === "string" ) { + if ( !executeOnly || inspected[ selection ] ) { + selection = undefined; + } else { + options.dataTypes.unshift( selection ); + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, selection, inspected ); + } + } + } + // If we're only executing or nothing was selected + // we try the catchall dataType if not done already + if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, "*", inspected ); + } + // unnecessary when only executing (prefilters) + // but it'll be ignored by the caller in that case + return selection; +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } +} + +jQuery.fn.load = function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + } + + // Don't do a request if no elements are being requested + if ( !this.length ) { + return this; + } + + var selector, type, response, + self = this, + off = url.indexOf(" "); + + if ( off >= 0 ) { + selector = url.slice( off, url.length ); + url = url.slice( 0, off ); + } + + // If it's a function + if ( jQuery.isFunction( params ) ) { + + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( typeof params === "object" ) { + type = "POST"; + } + + // Request the remote document + jQuery.ajax({ + url: url, + + // if "type" variable is undefined, then "GET" method will be used + type: type, + dataType: "html", + data: params, + complete: function( jqXHR, status ) { + if ( callback ) { + self.each( callback, response || [ jqXHR.responseText, status, jqXHR ] ); + } + } + }).done(function( responseText ) { + + // Save response for use in complete callback + response = arguments; + + // See if a selector was specified + self.html( selector ? + + // Create a dummy div to hold the results + jQuery("
") + + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append( responseText.replace( rscript, "" ) ) + + // Locate the specified elements + .find( selector ) : + + // If not, just inject the full result + responseText ); + + }); + + return this; +}; + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ + jQuery.fn[ o ] = function( f ){ + return this.on( o, f ); + }; +}); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + return jQuery.ajax({ + type: method, + url: url, + data: data, + success: callback, + dataType: type + }); + }; +}); + +jQuery.extend({ + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + if ( settings ) { + // Building a settings object + ajaxExtend( target, jQuery.ajaxSettings ); + } else { + // Extending ajaxSettings + settings = target; + target = jQuery.ajaxSettings; + } + ajaxExtend( target, settings ); + return target; + }, + + ajaxSettings: { + url: ajaxLocation, + isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + processData: true, + async: true, + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + text: "text/plain", + json: "application/json, text/javascript", + "*": allTypes + }, + + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText" + }, + + // List of data converters + // 1) key format is "source_type destination_type" (a single space in-between) + // 2) the catchall symbol "*" can be used for source_type + converters: { + + // Convert anything to text + "* text": window.String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": jQuery.parseJSON, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + context: true, + url: true + } + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var // ifModified key + ifModifiedKey, + // Response headers + responseHeadersString, + responseHeaders, + // transport + transport, + // timeout handle + timeoutTimer, + // Cross-domain detection vars + parts, + // To know if global events are to be dispatched + fireGlobals, + // Loop variable + i, + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + // Callbacks context + callbackContext = s.context || s, + // Context for global events + // It's the callbackContext if one was provided in the options + // and if it's a DOM node or a jQuery collection + globalEventContext = callbackContext !== s && + ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? + jQuery( callbackContext ) : jQuery.event, + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + // Status-dependent callbacks + statusCode = s.statusCode || {}, + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + // The jqXHR state + state = 0, + // Default abort message + strAbort = "canceled", + // Fake xhr + jqXHR = { + + readyState: 0, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( !state ) { + var lname = name.toLowerCase(); + name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( state === 2 ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match === undefined ? null : match; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( !state ) { + s.mimeType = type; + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + statusText = statusText || strAbort; + if ( transport ) { + transport.abort( statusText ); + } + done( 0, statusText ); + return this; + } + }; + + // Callback for when everything is done + // It is defined here because jslint complains if it is declared + // at the end of the function (which would be more logical and readable) + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Called once + if ( state === 2 ) { + return; + } + + // State is "done" now + state = 2; + + // Clear timeout if it exists + if ( timeoutTimer ) { + clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // If successful, handle type chaining + if ( status >= 200 && status < 300 || status === 304 ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + + modified = jqXHR.getResponseHeader("Last-Modified"); + if ( modified ) { + jQuery.lastModified[ ifModifiedKey ] = modified; + } + modified = jqXHR.getResponseHeader("Etag"); + if ( modified ) { + jQuery.etag[ ifModifiedKey ] = modified; + } + } + + // If not modified + if ( status === 304 ) { + + statusText = "notmodified"; + isSuccess = true; + + // If we have data + } else { + + isSuccess = ajaxConvert( s, response ); + statusText = isSuccess.state; + success = isSuccess.data; + error = isSuccess.error; + isSuccess = !error; + } + } else { + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if ( !statusText || status ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = "" + ( nativeStatusText || statusText ); + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + // Attach deferreds + deferred.promise( jqXHR ); + jqXHR.success = jqXHR.done; + jqXHR.error = jqXHR.fail; + jqXHR.complete = completeDeferred.add; + + // Status-dependent callbacks + jqXHR.statusCode = function( map ) { + if ( map ) { + var tmp; + if ( state < 2 ) { + for ( tmp in map ) { + statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; + } + } else { + tmp = map[ jqXHR.status ]; + jqXHR.always( tmp ); + } + } + return this; + }; + + // Remove hash character (#7531: and string promotion) + // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // We also use the url parameter if available + s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Extract dataTypes list + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( core_rspace ); + + // Determine if a cross-domain request is in order + if ( s.crossDomain == null ) { + parts = rurl.exec( s.url.toLowerCase() ); + s.crossDomain = !!( parts && + ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] || + ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != + ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) + ); + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( state === 2 ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + fireGlobals = s.global; + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // If data is available, append data to url + if ( s.data ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Get ifModifiedKey before adding the anti-cache parameter + ifModifiedKey = s.url; + + // Add anti-cache in url if needed + if ( s.cache === false ) { + + var ts = jQuery.now(), + // try replacing _= if it is there + ret = s.url.replace( rts, "$1_=" + ts ); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + ifModifiedKey = ifModifiedKey || s.url; + if ( jQuery.lastModified[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); + } + if ( jQuery.etag[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); + } + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already and return + return jqXHR.abort(); + + } + + // aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + for ( i in { success: 1, error: 1, complete: 1 } ) { + jqXHR[ i ]( s[ i ] ); + } + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = setTimeout( function(){ + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + state = 1; + transport.send( requestHeaders, done ); + } catch (e) { + // Propagate exception as error if not done + if ( state < 2 ) { + done( -1, e ); + // Simply rethrow otherwise + } else { + throw e; + } + } + } + + return jqXHR; + }, + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {} + +}); + +/* Handles responses to an ajax request: + * - sets all responseXXX fields accordingly + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes, + responseFields = s.responseFields; + + // Fill responseXXX fields + for ( type in responseFields ) { + if ( type in responses ) { + jqXHR[ responseFields[type] ] = responses[ type ]; + } + } + + // Remove auto dataType and get content-type in the process + while( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +// Chain conversions given the request and the original response +function ajaxConvert( s, response ) { + + var conv, conv2, current, tmp, + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(), + prev = dataTypes[ 0 ], + converters = {}, + i = 0; + + // Apply the dataFilter if provided + if ( s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + // Convert to each sequential dataType, tolerating list modification + for ( ; (current = dataTypes[++i]); ) { + + // There's only work to do if current dataType is non-auto + if ( current !== "*" ) { + + // Convert response if prev dataType is non-auto and differs from current + if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split(" "); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.splice( i--, 0, current ); + } + + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s["throws"] ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { state: "parsererror", error: conv ? e : "No conversion from " + prev + " to " + current }; + } + } + } + } + + // Update prev for next iteration + prev = current; + } + } + + return { state: "success", data: response }; +} +var oldCallbacks = [], + rquestion = /\?/, + rjsonp = /(=)\?(?=&|$)|\?\?/, + nonce = jQuery.now(); + +// Default jsonp settings +jQuery.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) ); + this[ callback ] = true; + return callback; + } +}); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var callbackName, overwritten, responseContainer, + data = s.data, + url = s.url, + hasCallback = s.jsonp !== false, + replaceInUrl = hasCallback && rjsonp.test( url ), + replaceInData = hasCallback && !replaceInUrl && typeof data === "string" && + !( s.contentType || "" ).indexOf("application/x-www-form-urlencoded") && + rjsonp.test( data ); + + // Handle iff the expected data type is "jsonp" or we have a parameter to set + if ( s.dataTypes[ 0 ] === "jsonp" || replaceInUrl || replaceInData ) { + + // Get callback name, remembering preexisting value associated with it + callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ? + s.jsonpCallback() : + s.jsonpCallback; + overwritten = window[ callbackName ]; + + // Insert callback into url or form data + if ( replaceInUrl ) { + s.url = url.replace( rjsonp, "$1" + callbackName ); + } else if ( replaceInData ) { + s.data = data.replace( rjsonp, "$1" + callbackName ); + } else if ( hasCallback ) { + s.url += ( rquestion.test( url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName; + } + + // Use data converter to retrieve json after script execution + s.converters["script json"] = function() { + if ( !responseContainer ) { + jQuery.error( callbackName + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // force json dataType + s.dataTypes[ 0 ] = "json"; + + // Install callback + window[ callbackName ] = function() { + responseContainer = arguments; + }; + + // Clean-up function (fires after converters) + jqXHR.always(function() { + // Restore preexisting value + window[ callbackName ] = overwritten; + + // Save back as free + if ( s[ callbackName ] ) { + // make sure that re-using the options doesn't screw things around + s.jsonpCallback = originalSettings.jsonpCallback; + + // save the callback name for future use + oldCallbacks.push( callbackName ); + } + + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( overwritten ) ) { + overwritten( responseContainer[ 0 ] ); + } + + responseContainer = overwritten = undefined; + }); + + // Delegate to script + return "script"; + } +}); +// Install script dataType +jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /javascript|ecmascript/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +}); + +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +}); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function(s) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + + var script, + head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; + + return { + + send: function( _, callback ) { + + script = document.createElement( "script" ); + + script.async = "async"; + + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + + script.src = s.url; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { + + if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + + // Remove the script + if ( head && script.parentNode ) { + head.removeChild( script ); + } + + // Dereference the script + script = undefined; + + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + }, + + abort: function() { + if ( script ) { + script.onload( 0, 1 ); + } + } + }; + } +}); +var xhrCallbacks, + // #5280: Internet Explorer will keep connections alive if we don't abort on unload + xhrOnUnloadAbort = window.ActiveXObject ? function() { + // Abort all pending requests + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( 0, 1 ); + } + } : false, + xhrId = 0; + +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch( e ) {} +} + +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch( e ) {} +} + +// Create the request object +// (This is still attached to ajaxSettings for backward compatibility) +jQuery.ajaxSettings.xhr = window.ActiveXObject ? + /* Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ + function() { + return !this.isLocal && createStandardXHR() || createActiveXHR(); + } : + // For all other browsers, use the standard XMLHttpRequest object + createStandardXHR; + +// Determine support properties +(function( xhr ) { + jQuery.extend( jQuery.support, { + ajax: !!xhr, + cors: !!xhr && ( "withCredentials" in xhr ) + }); +})( jQuery.ajaxSettings.xhr() ); + +// Create transport if the browser can provide an xhr +if ( jQuery.support.ajax ) { + + jQuery.ajaxTransport(function( s ) { + // Cross domain only allowed if supported through XMLHttpRequest + if ( !s.crossDomain || jQuery.support.cors ) { + + var callback; + + return { + send: function( headers, complete ) { + + // Get a new xhr + var handle, i, + xhr = s.xhr(); + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open( s.type, s.url, s.async, s.username, s.password ); + } else { + xhr.open( s.type, s.url, s.async ); + } + + // Apply custom fields if provided + if ( s.xhrFields ) { + for ( i in s.xhrFields ) { + xhr[ i ] = s.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( s.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( s.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !s.crossDomain && !headers["X-Requested-With"] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + } catch( _ ) {} + + // Do send the request + // This may raise an exception which is actually + // handled in jQuery.ajax (so no try/catch here) + xhr.send( ( s.hasContent && s.data ) || null ); + + // Listener + callback = function( _, isAbort ) { + + var status, + statusText, + responseHeaders, + responses, + xml; + + // Firefox throws exceptions when accessing properties + // of an xhr when a network error occurred + // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) + try { + + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + + // Only called once + callback = undefined; + + // Do not keep as active anymore + if ( handle ) { + xhr.onreadystatechange = jQuery.noop; + if ( xhrOnUnloadAbort ) { + delete xhrCallbacks[ handle ]; + } + } + + // If it's an abort + if ( isAbort ) { + // Abort it manually if needed + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + status = xhr.status; + responseHeaders = xhr.getAllResponseHeaders(); + responses = {}; + xml = xhr.responseXML; + + // Construct response list + if ( xml && xml.documentElement /* #4958 */ ) { + responses.xml = xml; + } + + // When requesting binary data, IE6-9 will throw an exception + // on any attempt to access responseText (#11426) + try { + responses.text = xhr.responseText; + } catch( _ ) { + } + + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch( e ) { + // We normalize with Webkit giving an empty statusText + statusText = ""; + } + + // Filter status for non standard behaviors + + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && s.isLocal && !s.crossDomain ) { + status = responses.text ? 200 : 404; + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; + } + } + } + } catch( firefoxAccessException ) { + if ( !isAbort ) { + complete( -1, firefoxAccessException ); + } + } + + // Call complete if needed + if ( responses ) { + complete( status, statusText, responses, responseHeaders ); + } + }; + + if ( !s.async ) { + // if we're in sync mode we fire the callback + callback(); + } else if ( xhr.readyState === 4 ) { + // (IE6 & IE7) if it's in cache and has been + // retrieved directly we need to fire the callback + setTimeout( callback, 0 ); + } else { + handle = ++xhrId; + if ( xhrOnUnloadAbort ) { + // Create the active xhrs callbacks list if needed + // and attach the unload handler + if ( !xhrCallbacks ) { + xhrCallbacks = {}; + jQuery( window ).unload( xhrOnUnloadAbort ); + } + // Add to list of active xhrs callbacks + xhrCallbacks[ handle ] = callback; + } + xhr.onreadystatechange = callback; + } + }, + + abort: function() { + if ( callback ) { + callback(0,1); + } + } + }; + } + }); +} +var fxNow, timerId, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = new RegExp( "^(?:([-+])=|)(" + core_pnum + ")([a-z%]*)$", "i" ), + rrun = /queueHooks$/, + animationPrefilters = [ defaultPrefilter ], + tweeners = { + "*": [function( prop, value ) { + var end, unit, prevScale, + tween = this.createTween( prop, value ), + parts = rfxnum.exec( value ), + target = tween.cur(), + start = +target || 0, + scale = 1; + + if ( parts ) { + end = +parts[2]; + unit = parts[3] || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + + // We need to compute starting value + if ( unit !== "px" && start ) { + // Iteratively approximate from a nonzero starting point + // Prefer the current property, because this process will be trivial if it uses the same units + // Fallback to end or a simple constant + start = jQuery.css( tween.elem, prop, true ) || end || 1; + + do { + // If previous iteration zeroed out, double until we get *something* + // Use a string for doubling factor so we don't accidentally see scale as unchanged below + prevScale = scale = scale || ".5"; + + // Adjust and apply + start = start / scale; + jQuery.style( tween.elem, prop, start + unit ); + + // Update scale, tolerating zeroes from tween.cur() + scale = tween.cur() / target; + + // Stop looping if we've hit the mark or scale is unchanged + } while ( scale !== 1 && scale !== prevScale ); + } + + tween.unit = unit; + tween.start = start; + // If a +=/-= token was provided, we're doing a relative animation + tween.end = parts[1] ? start + ( parts[1] + 1 ) * end : end; + } + return tween; + }] + }; + +// Animations created synchronously will run synchronously +function createFxNow() { + setTimeout(function() { + fxNow = undefined; + }, 0 ); + return ( fxNow = jQuery.now() ); +} + +function createTweens( animation, props ) { + jQuery.each( props, function( prop, value ) { + var collection = ( tweeners[ prop ] || [] ).concat( tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( collection[ index ].call( animation, prop, value ) ) { + + // we're done with this property + return; + } + } + }); +} + +function Animation( elem, properties, options ) { + var result, + index = 0, + tweenerIndex = 0, + length = animationPrefilters.length, + deferred = jQuery.Deferred().always( function() { + // don't match elem in the :animated selector + delete tick.elem; + }), + tick = function() { + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + percent = 1 - ( remaining / animation.duration || 0 ), + index = 0, + length = animation.tweens.length; + + for ( ; index < length ; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ]); + + if ( percent < 1 && length ) { + return remaining; + } else { + deferred.resolveWith( elem, [ animation ] ); + return false; + } + }, + animation = deferred.promise({ + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { specialEasing: {} }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end, easing ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + // if we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + + for ( ; index < length ; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // resolve when we played the last frame + // otherwise, reject + if ( gotoEnd ) { + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + }), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length ; index++ ) { + result = animationPrefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + return result; + } + } + + createTweens( animation, props ); + + if ( jQuery.isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + jQuery.fx.timer( + jQuery.extend( tick, { + anim: animation, + queue: animation.opts.queue, + elem: elem + }) + ); + + // attach callbacks from options + return animation.progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = jQuery.camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( jQuery.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // not quite $.extend, this wont overwrite keys already present. + // also - reusing 'index' from above because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweener: function( props, callback ) { + if ( jQuery.isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.split(" "); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length ; index++ ) { + prop = props[ index ]; + tweeners[ prop ] = tweeners[ prop ] || []; + tweeners[ prop ].unshift( callback ); + } + }, + + prefilter: function( callback, prepend ) { + if ( prepend ) { + animationPrefilters.unshift( callback ); + } else { + animationPrefilters.push( callback ); + } + } +}); + +function defaultPrefilter( elem, props, opts ) { + var index, prop, value, length, dataShow, tween, hooks, oldfire, + anim = this, + style = elem.style, + orig = {}, + handled = [], + hidden = elem.nodeType && isHidden( elem ); + + // handle queue: false promises + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always(function() { + // doing this makes sure that the complete handler will be called + // before this completes + anim.always(function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + }); + }); + } + + // height/width overflow pass + if ( elem.nodeType === 1 && ( "height" in props || "width" in props ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height animated + if ( jQuery.css( elem, "display" ) === "inline" && + jQuery.css( elem, "float" ) === "none" ) { + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( !jQuery.support.inlineBlockNeedsLayout || css_defaultDisplay( elem.nodeName ) === "inline" ) { + style.display = "inline-block"; + + } else { + style.zoom = 1; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + if ( !jQuery.support.shrinkWrapBlocks ) { + anim.done(function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + }); + } + } + + + // show/hide pass + for ( index in props ) { + value = props[ index ]; + if ( rfxtypes.exec( value ) ) { + delete props[ index ]; + if ( value === ( hidden ? "hide" : "show" ) ) { + continue; + } + handled.push( index ); + } + } + + length = handled.length; + if ( length ) { + dataShow = jQuery._data( elem, "fxshow" ) || jQuery._data( elem, "fxshow", {} ); + if ( hidden ) { + jQuery( elem ).show(); + } else { + anim.done(function() { + jQuery( elem ).hide(); + }); + } + anim.done(function() { + var prop; + jQuery.removeData( elem, "fxshow", true ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + }); + for ( index = 0 ; index < length ; index++ ) { + prop = handled[ index ]; + tween = anim.createTween( prop, hidden ? dataShow[ prop ] : 0 ); + orig[ prop ] = dataShow[ prop ] || jQuery.style( elem, prop ); + + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = tween.start; + if ( hidden ) { + tween.end = tween.start; + tween.start = prop === "width" || prop === "height" ? 1 : 0; + } + } + } + } +} + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || "swing"; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + this.pos = eased = jQuery.easing[ this.easing ]( percent, this.options.duration * percent, 0, 1, this.options.duration ); + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + if ( tween.elem[ tween.prop ] != null && + (!tween.elem.style || tween.elem.style[ tween.prop ] == null) ) { + return tween.elem[ tween.prop ]; + } + + // passing any value as a 4th parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails + // so, simple values such as "10px" are parsed to Float. + // complex values such as "rotate(1rad)" are returned as is. + result = jQuery.css( tween.elem, tween.prop, false, "" ); + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + // use step hook for back compat - use cssHook if its there - use .style if its + // available and use plain properties where available + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.style && ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || jQuery.cssHooks[ tween.prop ] ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Remove in 2.0 - this supports IE8's panic based approach +// to setting things on disconnected nodes + +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.each([ "toggle", "show", "hide" ], function( i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" || + // special check for .toggle( handler, handler, ... ) + ( !i && jQuery.isFunction( speed ) && jQuery.isFunction( easing ) ) ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +}); + +jQuery.fn.extend({ + fadeTo: function( speed, to, easing, callback ) { + + // show any hidden elements after setting opacity to 0 + return this.filter( isHidden ).css( "opacity", 0 ).show() + + // animate to the value specified + .end().animate({ opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations resolve immediately + if ( empty ) { + anim.stop( true ); + } + }; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each(function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = jQuery._data( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) { + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // start the next in the queue if the last step wasn't forced + // timers currently will call their complete callbacks, which will dequeue + // but only if they were gotoEnd + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + }); + } +}); + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + attrs = { height: type }, + i = 0; + + // if we include width, step value is 1 to do all cssExpand values, + // if we don't include width, step value is 2 to skip over Left and Right + for( ; i < 4 ; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show"), + slideUp: genFx("hide"), + slideToggle: genFx("toggle"), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default; + + // normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p*Math.PI ) / 2; + } +}; + +jQuery.timers = []; +jQuery.fx = Tween.prototype.init; +jQuery.fx.tick = function() { + var timer, + timers = jQuery.timers, + i = 0; + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + // Checks the timer has not already been removed + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } +}; + +jQuery.fx.timer = function( timer ) { + if ( timer() && jQuery.timers.push( timer ) && !timerId ) { + timerId = setInterval( jQuery.fx.tick, jQuery.fx.interval ); + } +}; + +jQuery.fx.interval = 13; + +jQuery.fx.stop = function() { + clearInterval( timerId ); + timerId = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + // Default speed + _default: 400 +}; + +// Back Compat <1.8 extension point +jQuery.fx.step = {}; + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} +var rroot = /^(?:body|html)$/i; + +jQuery.fn.offset = function( options ) { + if ( arguments.length ) { + return options === undefined ? + this : + this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + var box, docElem, body, win, clientTop, clientLeft, scrollTop, scrollLeft, top, left, + elem = this[ 0 ], + doc = elem && elem.ownerDocument; + + if ( !doc ) { + return; + } + + if ( (body = doc.body) === elem ) { + return jQuery.offset.bodyOffset( elem ); + } + + docElem = doc.documentElement; + + // Make sure we're not dealing with a disconnected DOM node + if ( !jQuery.contains( docElem, elem ) ) { + return { top: 0, left: 0 }; + } + + box = elem.getBoundingClientRect(); + win = getWindow( doc ); + clientTop = docElem.clientTop || body.clientTop || 0; + clientLeft = docElem.clientLeft || body.clientLeft || 0; + scrollTop = win.pageYOffset || docElem.scrollTop; + scrollLeft = win.pageXOffset || docElem.scrollLeft; + top = box.top + scrollTop - clientTop; + left = box.left + scrollLeft - clientLeft; + + return { top: top, left: left }; +}; + +jQuery.offset = { + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if ( options.top != null ) { + props.top = ( options.top - curOffset.top ) + curTop; + } + if ( options.left != null ) { + props.left = ( options.left - curOffset.left ) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + + position: function() { + if ( !this[0] ) { + return; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent || document.body; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( method, prop ) { + var top = /Y/.test( prop ); + + jQuery.fn[ method ] = function( val ) { + return jQuery.access( this, function( elem, method, val ) { + var win = getWindow( elem ); + + if ( val === undefined ) { + return win ? (prop in win) ? win[ prop ] : + win.document.documentElement[ method ] : + elem[ method ]; + } + + if ( win ) { + win.scrollTo( + !top ? val : jQuery( win ).scrollLeft(), + top ? val : jQuery( win ).scrollTop() + ); + + } else { + elem[ method ] = val; + } + }, method, val, arguments.length, null ); + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} +// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods +jQuery.each( { Height: "height", Width: "width" }, function( name, type ) { + jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, function( defaultExtra, funcName ) { + // margin is only for outerHeight, outerWidth + jQuery.fn[ funcName ] = function( margin, value ) { + var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ), + extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" ); + + return jQuery.access( this, function( elem, type, value ) { + var doc; + + if ( jQuery.isWindow( elem ) ) { + // As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there + // isn't a whole lot we can do. See pull request at this URL for discussion: + // https://github.com/jquery/jquery/pull/764 + return elem.document.documentElement[ "client" + name ]; + } + + // Get document width or height + if ( elem.nodeType === 9 ) { + doc = elem.documentElement; + + // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], whichever is greatest + // unfortunately, this causes bug #3838 in IE6/8 only, but there is currently no good, small way to fix it. + return Math.max( + elem.body[ "scroll" + name ], doc[ "scroll" + name ], + elem.body[ "offset" + name ], doc[ "offset" + name ], + doc[ "client" + name ] + ); + } + + return value === undefined ? + // Get width or height on the element, requesting but not forcing parseFloat + jQuery.css( elem, type, value, extra ) : + + // Set width or height on the element + jQuery.style( elem, type, value, extra ); + }, type, chainable ? margin : undefined, chainable ); + }; + }); +}); +// Expose jQuery to the global object +window.jQuery = window.$ = jQuery; + +// Expose jQuery as an AMD module, but only for AMD loaders that +// understand the issues with loading multiple versions of jQuery +// in a page that all might call define(). The loader will indicate +// they have special allowances for multiple jQuery versions by +// specifying define.amd.jQuery = true. Register as a named module, +// since jQuery can be concatenated with other files that may use define, +// but not use a proper concatenation script that understands anonymous +// AMD modules. A named AMD is safest and most robust way to register. +// Lowercase jquery is used because AMD module names are derived from +// file names, and jQuery is normally delivered in a lowercase file name. +// Do this after creating the global so that if an AMD module wants to call +// noConflict to hide this version of jQuery, it will work. +if ( typeof define === "function" && define.amd && define.amd.jQuery ) { + define( "jquery", [], function () { return jQuery; } ); +} + +})( window ); diff --git a/public/js/jquery.mobile-1.2.0.js b/public/js/jquery.mobile-1.2.0.js new file mode 100644 index 0000000..4c1c616 --- /dev/null +++ b/public/js/jquery.mobile-1.2.0.js @@ -0,0 +1,9162 @@ +/* +* jQuery Mobile Framework Git Build: SHA1: b49cc06499abf8f987cf90f35349cfac0918c939 <> Date: Tue Oct 2 11:22:34 2012 -0700 +* http://jquerymobile.com +* +* Copyright 2012 jQuery Foundation and other contributors +* Released under the MIT license. +* http://jquery.org/license +* +*/ + + +(function ( root, doc, factory ) { + if ( typeof define === "function" && define.amd ) { + // AMD. Register as an anonymous module. + define( [ "jquery" ], function ( $ ) { + factory( $, root, doc ); + return $.mobile; + }); + } else { + // Browser globals + factory( root.jQuery, root, doc ); + } +}( this, document, function ( jQuery, window, document, undefined ) { +(function( $, window, undefined ) { + + var nsNormalizeDict = {}; + + // jQuery.mobile configurable options + $.mobile = $.extend( {}, { + + // Version of the jQuery Mobile Framework + version: "1.2.0", + + // Namespace used framework-wide for data-attrs. Default is no namespace + ns: "", + + // Define the url parameter used for referencing widget-generated sub-pages. + // Translates to to example.html&ui-page=subpageIdentifier + // hash segment before &ui-page= is used to make Ajax request + subPageUrlKey: "ui-page", + + // Class assigned to page currently in view, and during transitions + activePageClass: "ui-page-active", + + // Class used for "active" button state, from CSS framework + activeBtnClass: "ui-btn-active", + + // Class used for "focus" form element state, from CSS framework + focusClass: "ui-focus", + + // Automatically handle clicks and form submissions through Ajax, when same-domain + ajaxEnabled: true, + + // Automatically load and show pages based on location.hash + hashListeningEnabled: true, + + // disable to prevent jquery from bothering with links + linkBindingEnabled: true, + + // Set default page transition - 'none' for no transitions + defaultPageTransition: "slideup", + + // Set maximum window width for transitions to apply - 'false' for no limit + maxTransitionWidth: false, + + // Minimum scroll distance that will be remembered when returning to a page + minScrollBack: 250, + + // DEPRECATED: the following property is no longer in use, but defined until 2.0 to prevent conflicts + touchOverflowEnabled: false, + + // Set default dialog transition - 'none' for no transitions + defaultDialogTransition: "pop", + + // Error response message - appears when an Ajax page request fails + pageLoadErrorMessage: "Error Loading Page", + + // For error messages, which theme does the box uses? + pageLoadErrorMessageTheme: "e", + + // replace calls to window.history.back with phonegaps navigation helper + // where it is provided on the window object + phonegapNavigationEnabled: false, + + //automatically initialize the DOM when it's ready + autoInitializePage: true, + + pushStateEnabled: true, + + // allows users to opt in to ignoring content by marking a parent element as + // data-ignored + ignoreContentEnabled: false, + + // turn of binding to the native orientationchange due to android orientation behavior + orientationChangeEnabled: true, + + buttonMarkup: { + hoverDelay: 200 + }, + + // TODO might be useful upstream in jquery itself ? + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + }, + + // Scroll page vertically: scroll to 0 to hide iOS address bar, or pass a Y value + silentScroll: function( ypos ) { + if ( $.type( ypos ) !== "number" ) { + ypos = $.mobile.defaultHomeScroll; + } + + // prevent scrollstart and scrollstop events + $.event.special.scrollstart.enabled = false; + + setTimeout( function() { + window.scrollTo( 0, ypos ); + $( document ).trigger( "silentscroll", { x: 0, y: ypos }); + }, 20 ); + + setTimeout( function() { + $.event.special.scrollstart.enabled = true; + }, 150 ); + }, + + // Expose our cache for testing purposes. + nsNormalizeDict: nsNormalizeDict, + + // Take a data attribute property, prepend the namespace + // and then camel case the attribute string. Add the result + // to our nsNormalizeDict so we don't have to do this again. + nsNormalize: function( prop ) { + if ( !prop ) { + return; + } + + return nsNormalizeDict[ prop ] || ( nsNormalizeDict[ prop ] = $.camelCase( $.mobile.ns + prop ) ); + }, + + // Find the closest parent with a theme class on it. Note that + // we are not using $.fn.closest() on purpose here because this + // method gets called quite a bit and we need it to be as fast + // as possible. + getInheritedTheme: function( el, defaultTheme ) { + var e = el[ 0 ], + ltr = "", + re = /ui-(bar|body|overlay)-([a-z])\b/, + c, m; + + while ( e ) { + c = e.className || ""; + if ( c && ( m = re.exec( c ) ) && ( ltr = m[ 2 ] ) ) { + // We found a parent with a theme class + // on it so bail from this loop. + break; + } + + e = e.parentNode; + } + + // Return the theme letter we found, if none, return the + // specified default. + + return ltr || defaultTheme || "a"; + }, + + // TODO the following $ and $.fn extensions can/probably should be moved into jquery.mobile.core.helpers + // + // Find the closest javascript page element to gather settings data jsperf test + // http://jsperf.com/single-complex-selector-vs-many-complex-selectors/edit + // possibly naive, but it shows that the parsing overhead for *just* the page selector vs + // the page and dialog selector is negligable. This could probably be speed up by + // doing a similar parent node traversal to the one found in the inherited theme code above + closestPageData: function( $target ) { + return $target + .closest( ':jqmData(role="page"), :jqmData(role="dialog")' ) + .data( "page" ); + }, + + enhanceable: function( $set ) { + return this.haveParents( $set, "enhance" ); + }, + + hijackable: function( $set ) { + return this.haveParents( $set, "ajax" ); + }, + + haveParents: function( $set, attr ) { + if ( !$.mobile.ignoreContentEnabled ) { + return $set; + } + + var count = $set.length, + $newSet = $(), + e, $element, excluded; + + for ( var i = 0; i < count; i++ ) { + $element = $set.eq( i ); + excluded = false; + e = $set[ i ]; + + while ( e ) { + var c = e.getAttribute ? e.getAttribute( "data-" + $.mobile.ns + attr ) : ""; + + if ( c === "false" ) { + excluded = true; + break; + } + + e = e.parentNode; + } + + if ( !excluded ) { + $newSet = $newSet.add( $element ); + } + } + + return $newSet; + }, + + getScreenHeight: function() { + // Native innerHeight returns more accurate value for this across platforms, + // jQuery version is here as a normalized fallback for platforms like Symbian + return window.innerHeight || $( window ).height(); + } + }, $.mobile ); + + // Mobile version of data and removeData and hasData methods + // ensures all data is set and retrieved using jQuery Mobile's data namespace + $.fn.jqmData = function( prop, value ) { + var result; + if ( typeof prop !== "undefined" ) { + if ( prop ) { + prop = $.mobile.nsNormalize( prop ); + } + + // undefined is permitted as an explicit input for the second param + // in this case it returns the value and does not set it to undefined + if( arguments.length < 2 || value === undefined ){ + result = this.data( prop ); + } else { + result = this.data( prop, value ); + } + } + return result; + }; + + $.jqmData = function( elem, prop, value ) { + var result; + if ( typeof prop !== "undefined" ) { + result = $.data( elem, prop ? $.mobile.nsNormalize( prop ) : prop, value ); + } + return result; + }; + + $.fn.jqmRemoveData = function( prop ) { + return this.removeData( $.mobile.nsNormalize( prop ) ); + }; + + $.jqmRemoveData = function( elem, prop ) { + return $.removeData( elem, $.mobile.nsNormalize( prop ) ); + }; + + $.fn.removeWithDependents = function() { + $.removeWithDependents( this ); + }; + + $.removeWithDependents = function( elem ) { + var $elem = $( elem ); + + ( $elem.jqmData( 'dependents' ) || $() ).remove(); + $elem.remove(); + }; + + $.fn.addDependents = function( newDependents ) { + $.addDependents( $( this ), newDependents ); + }; + + $.addDependents = function( elem, newDependents ) { + var dependents = $( elem ).jqmData( 'dependents' ) || $(); + + $( elem ).jqmData( 'dependents', $.merge( dependents, newDependents ) ); + }; + + // note that this helper doesn't attempt to handle the callback + // or setting of an html elements text, its only purpose is + // to return the html encoded version of the text in all cases. (thus the name) + $.fn.getEncodedText = function() { + return $( "
" ).text( $( this ).text() ).html(); + }; + + // fluent helper function for the mobile namespaced equivalent + $.fn.jqmEnhanceable = function() { + return $.mobile.enhanceable( this ); + }; + + $.fn.jqmHijackable = function() { + return $.mobile.hijackable( this ); + }; + + // Monkey-patching Sizzle to filter the :jqmData selector + var oldFind = $.find, + jqmDataRE = /:jqmData\(([^)]*)\)/g; + + $.find = function( selector, context, ret, extra ) { + selector = selector.replace( jqmDataRE, "[data-" + ( $.mobile.ns || "" ) + "$1]" ); + + return oldFind.call( this, selector, context, ret, extra ); + }; + + $.extend( $.find, oldFind ); + + $.find.matches = function( expr, set ) { + return $.find( expr, null, null, set ); + }; + + $.find.matchesSelector = function( node, expr ) { + return $.find( expr, null, null, [ node ] ).length > 0; + }; +})( jQuery, this ); + + +/*! + * jQuery UI Widget v1.9.0-beta.1 + * + * Copyright 2012, https://github.com/jquery/jquery-ui/blob/1.9.0-beta.1/AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +var uuid = 0, + slice = Array.prototype.slice, + _cleanData = $.cleanData; +$.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); +}; + +$.widget = function( name, base, prototype ) { + var fullName, existingConstructor, constructor, basePrototype, + namespace = name.split( "." )[ 0 ]; + + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, fullName ); + }; + + $[ namespace ] = $[ namespace ] || {}; + existingConstructor = $[ namespace ][ name ]; + constructor = $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without "new" keyword + if ( !this._createWidget ) { + return new constructor( options, element ); + } + + // allow instantiation without initializing for simple inheritance + // must use "new" keyword (the code above always passes args) + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + // extend with the existing constructor to carry over any static properties + $.extend( constructor, existingConstructor, { + version: prototype.version, + // copy the object used to create the prototype in case we need to + // redefine the widget later + _proto: $.extend( {}, prototype ), + // track widgets that inherit from this widget in case this widget is + // redefined after a widget inherits from it + _childConstructors: [] + }); + + basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from + basePrototype.options = $.widget.extend( {}, basePrototype.options ); + $.each( prototype, function( prop, value ) { + if ( $.isFunction( value ) ) { + prototype[ prop ] = (function() { + var _super = function() { + return base.prototype[ prop ].apply( this, arguments ); + }, + _superApply = function( args ) { + return base.prototype[ prop ].apply( this, args ); + }; + return function() { + var __super = this._super, + __superApply = this._superApply, + returnValue; + + this._super = _super; + this._superApply = _superApply; + + returnValue = value.apply( this, arguments ); + + this._super = __super; + this._superApply = __superApply; + + return returnValue; + }; + })(); + } + }); + constructor.prototype = $.widget.extend( basePrototype, { + // TODO: remove support for widgetEventPrefix + // always use the name + a colon as the prefix, e.g., draggable:start + // don't prefix for widgets that aren't DOM-based + widgetEventPrefix: name + }, prototype, { + constructor: constructor, + namespace: namespace, + widgetName: name, + // TODO remove widgetBaseClass, see #8155 + widgetBaseClass: fullName, + widgetFullName: fullName + }); + + // If this widget is being redefined then we need to find all widgets that + // are inheriting from it and redefine all of them so that they inherit from + // the new version of this widget. We're essentially trying to replace one + // level in the prototype chain. + if ( existingConstructor ) { + $.each( existingConstructor._childConstructors, function( i, child ) { + var childPrototype = child.prototype; + + // redefine the child widget using the same prototype that was + // originally used, but inherit from the new version of the base + $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto ); + }); + // remove the list of existing child constructors from the old constructor + // so the old child constructors can be garbage collected + delete existingConstructor._childConstructors; + } else { + base._childConstructors.push( constructor ); + } + + $.widget.bridge( name, constructor ); +}; + +$.widget.extend = function( target ) { + var input = slice.call( arguments, 1 ), + inputIndex = 0, + inputLength = input.length, + key, + value; + for ( ; inputIndex < inputLength; inputIndex++ ) { + for ( key in input[ inputIndex ] ) { + value = input[ inputIndex ][ key ]; + if (input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) { + target[ key ] = $.isPlainObject( value ) ? $.widget.extend( {}, target[ key ], value ) : value; + } + } + } + return target; +}; + +$.widget.bridge = function( name, object ) { + var fullName = object.prototype.widgetFullName; + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.widget.extend.apply( null, [ options ].concat(args) ) : + options; + + if ( isMethodCall ) { + this.each(function() { + var methodValue, + instance = $.data( this, fullName ); + if ( !instance ) { + return $.error( "cannot call methods on " + name + " prior to initialization; " + + "attempted to call method '" + options + "'" ); + } + if ( !$.isFunction( instance[options] ) || options.charAt( 0 ) === "_" ) { + return $.error( "no such method '" + options + "' for " + name + " widget instance" ); + } + methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue && methodValue.jquery ? + returnValue.pushStack( methodValue.get() ) : + methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, fullName ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + new object( options, this ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) {}; +$.Widget._childConstructors = []; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + defaultElement: "
", + options: { + disabled: false, + + // callbacks + create: null + }, + _createWidget: function( options, element ) { + element = $( element || this.defaultElement || this )[ 0 ]; + this.element = $( element ); + this.uuid = uuid++; + this.eventNamespace = "." + this.widgetName + this.uuid; + this.options = $.widget.extend( {}, + this.options, + this._getCreateOptions(), + options ); + + this.bindings = $(); + this.hoverable = $(); + this.focusable = $(); + + if ( element !== this ) { + // 1.9 BC for #7810 + // TODO remove dual storage + $.data( element, this.widgetName, this ); + $.data( element, this.widgetFullName, this ); + this._on({ remove: "destroy" }); + this.document = $( element.style ? + // element within the document + element.ownerDocument : + // element is window or document + element.document || element ); + this.window = $( this.document[0].defaultView || this.document[0].parentWindow ); + } + + this._create(); + this._trigger( "create", null, this._getCreateEventData() ); + this._init(); + }, + _getCreateOptions: $.noop, + _getCreateEventData: $.noop, + _create: $.noop, + _init: $.noop, + + destroy: function() { + this._destroy(); + // we can probably remove the unbind calls in 2.0 + // all event bindings should go through this._on() + this.element + .unbind( this.eventNamespace ) + // 1.9 BC for #7810 + // TODO remove dual storage + .removeData( this.widgetName ) + .removeData( this.widgetFullName ) + // support: jquery <1.6.3 + // http://bugs.jquery.com/ticket/9413 + .removeData( $.camelCase( this.widgetFullName ) ); + this.widget() + .unbind( this.eventNamespace ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetFullName + "-disabled " + + "ui-state-disabled" ); + + // clean up events and states + this.bindings.unbind( this.eventNamespace ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + }, + _destroy: $.noop, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key, + parts, + curOption, + i; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.widget.extend( {}, this.options ); + } + + if ( typeof key === "string" ) { + // handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } } + options = {}; + parts = key.split( "." ); + key = parts.shift(); + if ( parts.length ) { + curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] ); + for ( i = 0; i < parts.length - 1; i++ ) { + curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {}; + curOption = curOption[ parts[ i ] ]; + } + key = parts.pop(); + if ( value === undefined ) { + return curOption[ key ] === undefined ? null : curOption[ key ]; + } + curOption[ key ] = value; + } else { + if ( value === undefined ) { + return this.options[ key ] === undefined ? null : this.options[ key ]; + } + options[ key ] = value; + } + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var key; + + for ( key in options ) { + this._setOption( key, options[ key ] ); + } + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + .toggleClass( this.widgetFullName + "-disabled ui-state-disabled", !!value ) + .attr( "aria-disabled", value ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _on: function( element, handlers ) { + // no element argument, shuffle and use this.element + if ( !handlers ) { + handlers = element; + element = this.element; + } else { + // accept selectors, DOM elements + element = $( element ); + this.bindings = this.bindings.add( element ); + } + + var instance = this; + $.each( handlers, function( event, handler ) { + function handlerProxy() { + // allow widgets to customize the disabled handling + // - disabled as an array instead of boolean + // - disabled class as method for disabling individual parts + if ( instance.options.disabled === true || + $( this ).hasClass( "ui-state-disabled" ) ) { + return; + } + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + + // copy the guid so direct unbinding works + if ( typeof handler !== "string" ) { + handlerProxy.guid = handler.guid = + handler.guid || handlerProxy.guid || $.guid++; + } + + var match = event.match( /^(\w+)\s*(.*)$/ ), + eventName = match[1] + instance.eventNamespace, + selector = match[2]; + if ( selector ) { + instance.widget().delegate( selector, eventName, handlerProxy ); + } else { + element.bind( eventName, handlerProxy ); + } + }); + }, + + _off: function( element, eventName ) { + eventName = (eventName || "").split( " " ).join( this.eventNamespace + " " ) + this.eventNamespace; + element.unbind( eventName ).undelegate( eventName ); + }, + + _delay: function( handler, delay ) { + function handlerProxy() { + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + var instance = this; + return setTimeout( handlerProxy, delay || 0 ); + }, + + _hoverable: function( element ) { + this.hoverable = this.hoverable.add( element ); + this._on( element, { + mouseenter: function( event ) { + $( event.currentTarget ).addClass( "ui-state-hover" ); + }, + mouseleave: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-hover" ); + } + }); + }, + + _focusable: function( element ) { + this.focusable = this.focusable.add( element ); + this._on( element, { + focusin: function( event ) { + $( event.currentTarget ).addClass( "ui-state-focus" ); + }, + focusout: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-focus" ); + } + }); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + return !( $.isFunction( callback ) && + callback.apply( this.element[0], [ event ].concat( data ) ) === false || + event.isDefaultPrevented() ); + } +}; + +$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) { + $.Widget.prototype[ "_" + method ] = function( element, options, callback ) { + if ( typeof options === "string" ) { + options = { effect: options }; + } + var hasOptions, + effectName = !options ? + method : + options === true || typeof options === "number" ? + defaultEffect : + options.effect || defaultEffect; + options = options || {}; + if ( typeof options === "number" ) { + options = { duration: options }; + } + hasOptions = !$.isEmptyObject( options ); + options.complete = callback; + if ( options.delay ) { + element.delay( options.delay ); + } + if ( hasOptions && $.effects && ( $.effects.effect[ effectName ] || $.uiBackCompat !== false && $.effects[ effectName ] ) ) { + element[ method ]( options ); + } else if ( effectName !== method && element[ effectName ] ) { + element[ effectName ]( options.duration, options.easing, callback ); + } else { + element.queue(function( next ) { + $( this )[ method ](); + if ( callback ) { + callback.call( element[ 0 ] ); + } + next(); + }); + } + }; +}); + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + $.Widget.prototype._getCreateOptions = function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }; +} + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.widget", { + // decorate the parent _createWidget to trigger `widgetinit` for users + // who wish to do post post `widgetcreate` alterations/additions + // + // TODO create a pull request for jquery ui to trigger this event + // in the original _createWidget + _createWidget: function() { + $.Widget.prototype._createWidget.apply( this, arguments ); + this._trigger( 'init' ); + }, + + _getCreateOptions: function() { + + var elem = this.element, + options = {}; + + $.each( this.options, function( option ) { + + var value = elem.jqmData( option.replace( /[A-Z]/g, function( c ) { + return "-" + c.toLowerCase(); + }) + ); + + if ( value !== undefined ) { + options[ option ] = value; + } + }); + + return options; + }, + + enhanceWithin: function( target, useKeepNative ) { + this.enhance( $( this.options.initSelector, $( target )), useKeepNative ); + }, + + enhance: function( targets, useKeepNative ) { + var page, keepNative, $widgetElements = $( targets ), self = this; + + // if ignoreContentEnabled is set to true the framework should + // only enhance the selected elements when they do NOT have a + // parent with the data-namespace-ignore attribute + $widgetElements = $.mobile.enhanceable( $widgetElements ); + + if ( useKeepNative && $widgetElements.length ) { + // TODO remove dependency on the page widget for the keepNative. + // Currently the keepNative value is defined on the page prototype so + // the method is as well + page = $.mobile.closestPageData( $widgetElements ); + keepNative = ( page && page.keepNativeSelector()) || ""; + + $widgetElements = $widgetElements.not( keepNative ); + } + + $widgetElements[ this.widgetName ](); + }, + + raise: function( msg ) { + throw "Widget [" + this.widgetName + "]: " + msg; + } +}); + +})( jQuery ); + + +(function( $, window ) { + // DEPRECATED + // NOTE global mobile object settings + $.extend( $.mobile, { + // DEPRECATED Should the text be visble in the loading message? + loadingMessageTextVisible: undefined, + + // DEPRECATED When the text is visible, what theme does the loading box use? + loadingMessageTheme: undefined, + + // DEPRECATED default message setting + loadingMessage: undefined, + + // DEPRECATED + // Turn on/off page loading message. Theme doubles as an object argument + // with the following shape: { theme: '', text: '', html: '', textVisible: '' } + // NOTE that the $.mobile.loading* settings and params past the first are deprecated + showPageLoadingMsg: function( theme, msgText, textonly ) { + $.mobile.loading( 'show', theme, msgText, textonly ); + }, + + // DEPRECATED + hidePageLoadingMsg: function() { + $.mobile.loading( 'hide' ); + }, + + loading: function() { + this.loaderWidget.loader.apply( this.loaderWidget, arguments ); + } + }); + + // TODO move loader class down into the widget settings + var loaderClass = "ui-loader", $html = $( "html" ), $window = $( window ); + + $.widget( "mobile.loader", { + // NOTE if the global config settings are defined they will override these + // options + options: { + // the theme for the loading message + theme: "a", + + // whether the text in the loading message is shown + textVisible: false, + + // custom html for the inner content of the loading message + html: "", + + // the text to be displayed when the popup is shown + text: "loading" + }, + + defaultHtml: "
" + + "" + + "

" + + "
", + + // For non-fixed supportin browsers. Position at y center (if scrollTop supported), above the activeBtn (if defined), or just 100px from top + fakeFixLoader: function() { + var activeBtn = $( "." + $.mobile.activeBtnClass ).first(); + + this.element + .css({ + top: $.support.scrollTop && $window.scrollTop() + $window.height() / 2 || + activeBtn.length && activeBtn.offset().top || 100 + }); + }, + + // check position of loader to see if it appears to be "fixed" to center + // if not, use abs positioning + checkLoaderPosition: function() { + var offset = this.element.offset(), + scrollTop = $window.scrollTop(), + screenHeight = $.mobile.getScreenHeight(); + + if ( offset.top < scrollTop || ( offset.top - scrollTop ) > screenHeight ) { + this.element.addClass( "ui-loader-fakefix" ); + this.fakeFixLoader(); + $window + .unbind( "scroll", this.checkLoaderPosition ) + .bind( "scroll", this.fakeFixLoader ); + } + }, + + resetHtml: function() { + this.element.html( $( this.defaultHtml ).html() ); + }, + + // Turn on/off page loading message. Theme doubles as an object argument + // with the following shape: { theme: '', text: '', html: '', textVisible: '' } + // NOTE that the $.mobile.loading* settings and params past the first are deprecated + // TODO sweet jesus we need to break some of this out + show: function( theme, msgText, textonly ) { + var textVisible, message, $header, loadSettings; + + this.resetHtml(); + + // use the prototype options so that people can set them globally at + // mobile init. Consistency, it's what's for dinner + if ( $.type(theme) === "object" ) { + loadSettings = $.extend( {}, this.options, theme ); + + // prefer object property from the param then the old theme setting + theme = loadSettings.theme || $.mobile.loadingMessageTheme; + } else { + loadSettings = this.options; + + // here we prefer the them value passed as a string argument, then + // we prefer the global option because we can't use undefined default + // prototype options, then the prototype option + theme = theme || $.mobile.loadingMessageTheme || loadSettings.theme; + } + + // set the message text, prefer the param, then the settings object + // then loading message + message = msgText || $.mobile.loadingMessage || loadSettings.text; + + // prepare the dom + $html.addClass( "ui-loading" ); + + if ( $.mobile.loadingMessage !== false || loadSettings.html ) { + // boolean values require a bit more work :P, supports object properties + // and old settings + if ( $.mobile.loadingMessageTextVisible !== undefined ) { + textVisible = $.mobile.loadingMessageTextVisible; + } else { + textVisible = loadSettings.textVisible; + } + + // add the proper css given the options (theme, text, etc) + // Force text visibility if the second argument was supplied, or + // if the text was explicitly set in the object args + this.element.attr("class", loaderClass + + " ui-corner-all ui-body-" + theme + + " ui-loader-" + ( textVisible || msgText || theme.text ? "verbose" : "default" ) + + ( loadSettings.textonly || textonly ? " ui-loader-textonly" : "" ) ); + + // TODO verify that jquery.fn.html is ok to use in both cases here + // this might be overly defensive in preventing unknowing xss + // if the html attribute is defined on the loading settings, use that + // otherwise use the fallbacks from above + if ( loadSettings.html ) { + this.element.html( loadSettings.html ); + } else { + this.element.find( "h1" ).text( message ); + } + + // attach the loader to the DOM + this.element.appendTo( $.mobile.pageContainer ); + + // check that the loader is visible + this.checkLoaderPosition(); + + // on scroll check the loader position + $window.bind( "scroll", $.proxy( this.checkLoaderPosition, this ) ); + } + }, + + hide: function() { + $html.removeClass( "ui-loading" ); + + if ( $.mobile.loadingMessage ) { + this.element.removeClass( "ui-loader-fakefix" ); + } + + $( window ).unbind( "scroll", $.proxy( this.fakeFixLoader, this) ); + $( window ).unbind( "scroll", $.proxy( this.checkLoaderPosition, this ) ); + } + }); + + $window.bind( 'pagecontainercreate', function() { + $.mobile.loaderWidget = $.mobile.loaderWidget || $( $.mobile.loader.prototype.defaultHtml ).loader(); + }); +})(jQuery, this); + + + +// This plugin is an experiment for abstracting away the touch and mouse +// events so that developers don't have to worry about which method of input +// the device their document is loaded on supports. +// +// The idea here is to allow the developer to register listeners for the +// basic mouse events, such as mousedown, mousemove, mouseup, and click, +// and the plugin will take care of registering the correct listeners +// behind the scenes to invoke the listener at the fastest possible time +// for that device, while still retaining the order of event firing in +// the traditional mouse environment, should multiple handlers be registered +// on the same element for different events. +// +// The current version exposes the following virtual events to jQuery bind methods: +// "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel" + +(function( $, window, document, undefined ) { + +var dataPropertyName = "virtualMouseBindings", + touchTargetPropertyName = "virtualTouchID", + virtualEventNames = "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split( " " ), + touchEventProps = "clientX clientY pageX pageY screenX screenY".split( " " ), + mouseHookProps = $.event.mouseHooks ? $.event.mouseHooks.props : [], + mouseEventProps = $.event.props.concat( mouseHookProps ), + activeDocHandlers = {}, + resetTimerID = 0, + startX = 0, + startY = 0, + didScroll = false, + clickBlockList = [], + blockMouseTriggers = false, + blockTouchTriggers = false, + eventCaptureSupported = "addEventListener" in document, + $document = $( document ), + nextTouchID = 1, + lastTouchID = 0, threshold; + +$.vmouse = { + moveDistanceThreshold: 10, + clickDistanceThreshold: 10, + resetTimerDuration: 1500 +}; + +function getNativeEvent( event ) { + + while ( event && typeof event.originalEvent !== "undefined" ) { + event = event.originalEvent; + } + return event; +} + +function createVirtualEvent( event, eventType ) { + + var t = event.type, + oe, props, ne, prop, ct, touch, i, j, len; + + event = $.Event( event ); + event.type = eventType; + + oe = event.originalEvent; + props = $.event.props; + + // addresses separation of $.event.props in to $.event.mouseHook.props and Issue 3280 + // https://github.com/jquery/jquery-mobile/issues/3280 + if ( t.search( /^(mouse|click)/ ) > -1 ) { + props = mouseEventProps; + } + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( oe ) { + for ( i = props.length, prop; i; ) { + prop = props[ --i ]; + event[ prop ] = oe[ prop ]; + } + } + + // make sure that if the mouse and click virtual events are generated + // without a .which one is defined + if ( t.search(/mouse(down|up)|click/) > -1 && !event.which ) { + event.which = 1; + } + + if ( t.search(/^touch/) !== -1 ) { + ne = getNativeEvent( oe ); + t = ne.touches; + ct = ne.changedTouches; + touch = ( t && t.length ) ? t[0] : ( ( ct && ct.length ) ? ct[ 0 ] : undefined ); + + if ( touch ) { + for ( j = 0, len = touchEventProps.length; j < len; j++) { + prop = touchEventProps[ j ]; + event[ prop ] = touch[ prop ]; + } + } + } + + return event; +} + +function getVirtualBindingFlags( element ) { + + var flags = {}, + b, k; + + while ( element ) { + + b = $.data( element, dataPropertyName ); + + for ( k in b ) { + if ( b[ k ] ) { + flags[ k ] = flags.hasVirtualBinding = true; + } + } + element = element.parentNode; + } + return flags; +} + +function getClosestElementWithVirtualBinding( element, eventType ) { + var b; + while ( element ) { + + b = $.data( element, dataPropertyName ); + + if ( b && ( !eventType || b[ eventType ] ) ) { + return element; + } + element = element.parentNode; + } + return null; +} + +function enableTouchBindings() { + blockTouchTriggers = false; +} + +function disableTouchBindings() { + blockTouchTriggers = true; +} + +function enableMouseBindings() { + lastTouchID = 0; + clickBlockList.length = 0; + blockMouseTriggers = false; + + // When mouse bindings are enabled, our + // touch bindings are disabled. + disableTouchBindings(); +} + +function disableMouseBindings() { + // When mouse bindings are disabled, our + // touch bindings are enabled. + enableTouchBindings(); +} + +function startResetTimer() { + clearResetTimer(); + resetTimerID = setTimeout( function() { + resetTimerID = 0; + enableMouseBindings(); + }, $.vmouse.resetTimerDuration ); +} + +function clearResetTimer() { + if ( resetTimerID ) { + clearTimeout( resetTimerID ); + resetTimerID = 0; + } +} + +function triggerVirtualEvent( eventType, event, flags ) { + var ve; + + if ( ( flags && flags[ eventType ] ) || + ( !flags && getClosestElementWithVirtualBinding( event.target, eventType ) ) ) { + + ve = createVirtualEvent( event, eventType ); + + $( event.target).trigger( ve ); + } + + return ve; +} + +function mouseEventCallback( event ) { + var touchID = $.data( event.target, touchTargetPropertyName ); + + if ( !blockMouseTriggers && ( !lastTouchID || lastTouchID !== touchID ) ) { + var ve = triggerVirtualEvent( "v" + event.type, event ); + if ( ve ) { + if ( ve.isDefaultPrevented() ) { + event.preventDefault(); + } + if ( ve.isPropagationStopped() ) { + event.stopPropagation(); + } + if ( ve.isImmediatePropagationStopped() ) { + event.stopImmediatePropagation(); + } + } + } +} + +function handleTouchStart( event ) { + + var touches = getNativeEvent( event ).touches, + target, flags; + + if ( touches && touches.length === 1 ) { + + target = event.target; + flags = getVirtualBindingFlags( target ); + + if ( flags.hasVirtualBinding ) { + + lastTouchID = nextTouchID++; + $.data( target, touchTargetPropertyName, lastTouchID ); + + clearResetTimer(); + + disableMouseBindings(); + didScroll = false; + + var t = getNativeEvent( event ).touches[ 0 ]; + startX = t.pageX; + startY = t.pageY; + + triggerVirtualEvent( "vmouseover", event, flags ); + triggerVirtualEvent( "vmousedown", event, flags ); + } + } +} + +function handleScroll( event ) { + if ( blockTouchTriggers ) { + return; + } + + if ( !didScroll ) { + triggerVirtualEvent( "vmousecancel", event, getVirtualBindingFlags( event.target ) ); + } + + didScroll = true; + startResetTimer(); +} + +function handleTouchMove( event ) { + if ( blockTouchTriggers ) { + return; + } + + var t = getNativeEvent( event ).touches[ 0 ], + didCancel = didScroll, + moveThreshold = $.vmouse.moveDistanceThreshold, + flags = getVirtualBindingFlags( event.target ); + + didScroll = didScroll || + ( Math.abs( t.pageX - startX ) > moveThreshold || + Math.abs( t.pageY - startY ) > moveThreshold ); + + + if ( didScroll && !didCancel ) { + triggerVirtualEvent( "vmousecancel", event, flags ); + } + + triggerVirtualEvent( "vmousemove", event, flags ); + startResetTimer(); +} + +function handleTouchEnd( event ) { + if ( blockTouchTriggers ) { + return; + } + + disableTouchBindings(); + + var flags = getVirtualBindingFlags( event.target ), + t; + triggerVirtualEvent( "vmouseup", event, flags ); + + if ( !didScroll ) { + var ve = triggerVirtualEvent( "vclick", event, flags ); + if ( ve && ve.isDefaultPrevented() ) { + // The target of the mouse events that follow the touchend + // event don't necessarily match the target used during the + // touch. This means we need to rely on coordinates for blocking + // any click that is generated. + t = getNativeEvent( event ).changedTouches[ 0 ]; + clickBlockList.push({ + touchID: lastTouchID, + x: t.clientX, + y: t.clientY + }); + + // Prevent any mouse events that follow from triggering + // virtual event notifications. + blockMouseTriggers = true; + } + } + triggerVirtualEvent( "vmouseout", event, flags); + didScroll = false; + + startResetTimer(); +} + +function hasVirtualBindings( ele ) { + var bindings = $.data( ele, dataPropertyName ), + k; + + if ( bindings ) { + for ( k in bindings ) { + if ( bindings[ k ] ) { + return true; + } + } + } + return false; +} + +function dummyMouseHandler() {} + +function getSpecialEventObject( eventType ) { + var realType = eventType.substr( 1 ); + + return { + setup: function( data, namespace ) { + // If this is the first virtual mouse binding for this element, + // add a bindings object to its data. + + if ( !hasVirtualBindings( this ) ) { + $.data( this, dataPropertyName, {} ); + } + + // If setup is called, we know it is the first binding for this + // eventType, so initialize the count for the eventType to zero. + var bindings = $.data( this, dataPropertyName ); + bindings[ eventType ] = true; + + // If this is the first virtual mouse event for this type, + // register a global handler on the document. + + activeDocHandlers[ eventType ] = ( activeDocHandlers[ eventType ] || 0 ) + 1; + + if ( activeDocHandlers[ eventType ] === 1 ) { + $document.bind( realType, mouseEventCallback ); + } + + // Some browsers, like Opera Mini, won't dispatch mouse/click events + // for elements unless they actually have handlers registered on them. + // To get around this, we register dummy handlers on the elements. + + $( this ).bind( realType, dummyMouseHandler ); + + // For now, if event capture is not supported, we rely on mouse handlers. + if ( eventCaptureSupported ) { + // If this is the first virtual mouse binding for the document, + // register our touchstart handler on the document. + + activeDocHandlers[ "touchstart" ] = ( activeDocHandlers[ "touchstart" ] || 0) + 1; + + if ( activeDocHandlers[ "touchstart" ] === 1 ) { + $document.bind( "touchstart", handleTouchStart ) + .bind( "touchend", handleTouchEnd ) + + // On touch platforms, touching the screen and then dragging your finger + // causes the window content to scroll after some distance threshold is + // exceeded. On these platforms, a scroll prevents a click event from being + // dispatched, and on some platforms, even the touchend is suppressed. To + // mimic the suppression of the click event, we need to watch for a scroll + // event. Unfortunately, some platforms like iOS don't dispatch scroll + // events until *AFTER* the user lifts their finger (touchend). This means + // we need to watch both scroll and touchmove events to figure out whether + // or not a scroll happenens before the touchend event is fired. + + .bind( "touchmove", handleTouchMove ) + .bind( "scroll", handleScroll ); + } + } + }, + + teardown: function( data, namespace ) { + // If this is the last virtual binding for this eventType, + // remove its global handler from the document. + + --activeDocHandlers[ eventType ]; + + if ( !activeDocHandlers[ eventType ] ) { + $document.unbind( realType, mouseEventCallback ); + } + + if ( eventCaptureSupported ) { + // If this is the last virtual mouse binding in existence, + // remove our document touchstart listener. + + --activeDocHandlers[ "touchstart" ]; + + if ( !activeDocHandlers[ "touchstart" ] ) { + $document.unbind( "touchstart", handleTouchStart ) + .unbind( "touchmove", handleTouchMove ) + .unbind( "touchend", handleTouchEnd ) + .unbind( "scroll", handleScroll ); + } + } + + var $this = $( this ), + bindings = $.data( this, dataPropertyName ); + + // teardown may be called when an element was + // removed from the DOM. If this is the case, + // jQuery core may have already stripped the element + // of any data bindings so we need to check it before + // using it. + if ( bindings ) { + bindings[ eventType ] = false; + } + + // Unregister the dummy event handler. + + $this.unbind( realType, dummyMouseHandler ); + + // If this is the last virtual mouse binding on the + // element, remove the binding data from the element. + + if ( !hasVirtualBindings( this ) ) { + $this.removeData( dataPropertyName ); + } + } + }; +} + +// Expose our custom events to the jQuery bind/unbind mechanism. + +for ( var i = 0; i < virtualEventNames.length; i++ ) { + $.event.special[ virtualEventNames[ i ] ] = getSpecialEventObject( virtualEventNames[ i ] ); +} + +// Add a capture click handler to block clicks. +// Note that we require event capture support for this so if the device +// doesn't support it, we punt for now and rely solely on mouse events. +if ( eventCaptureSupported ) { + document.addEventListener( "click", function( e ) { + var cnt = clickBlockList.length, + target = e.target, + x, y, ele, i, o, touchID; + + if ( cnt ) { + x = e.clientX; + y = e.clientY; + threshold = $.vmouse.clickDistanceThreshold; + + // The idea here is to run through the clickBlockList to see if + // the current click event is in the proximity of one of our + // vclick events that had preventDefault() called on it. If we find + // one, then we block the click. + // + // Why do we have to rely on proximity? + // + // Because the target of the touch event that triggered the vclick + // can be different from the target of the click event synthesized + // by the browser. The target of a mouse/click event that is syntehsized + // from a touch event seems to be implementation specific. For example, + // some browsers will fire mouse/click events for a link that is near + // a touch event, even though the target of the touchstart/touchend event + // says the user touched outside the link. Also, it seems that with most + // browsers, the target of the mouse/click event is not calculated until the + // time it is dispatched, so if you replace an element that you touched + // with another element, the target of the mouse/click will be the new + // element underneath that point. + // + // Aside from proximity, we also check to see if the target and any + // of its ancestors were the ones that blocked a click. This is necessary + // because of the strange mouse/click target calculation done in the + // Android 2.1 browser, where if you click on an element, and there is a + // mouse/click handler on one of its ancestors, the target will be the + // innermost child of the touched element, even if that child is no where + // near the point of touch. + + ele = target; + + while ( ele ) { + for ( i = 0; i < cnt; i++ ) { + o = clickBlockList[ i ]; + touchID = 0; + + if ( ( ele === target && Math.abs( o.x - x ) < threshold && Math.abs( o.y - y ) < threshold ) || + $.data( ele, touchTargetPropertyName ) === o.touchID ) { + // XXX: We may want to consider removing matches from the block list + // instead of waiting for the reset timer to fire. + e.preventDefault(); + e.stopPropagation(); + return; + } + } + ele = ele.parentNode; + } + } + }, true); +} +})( jQuery, window, document ); + + (function( $, undefined ) { + var support = { + touch: "ontouchend" in document + }; + + $.mobile = $.mobile || {}; + $.mobile.support = $.mobile.support || {}; + $.extend( $.support, support ); + $.extend( $.mobile.support, support ); + }( jQuery )); + + +(function( $, window, undefined ) { + // add new event shortcuts + $.each( ( "touchstart touchmove touchend " + + "tap taphold " + + "swipe swipeleft swiperight " + + "scrollstart scrollstop" ).split( " " ), function( i, name ) { + + $.fn[ name ] = function( fn ) { + return fn ? this.bind( name, fn ) : this.trigger( name ); + }; + + // jQuery < 1.8 + if ( $.attrFn ) { + $.attrFn[ name ] = true; + } + }); + + var supportTouch = $.mobile.support.touch, + scrollEvent = "touchmove scroll", + touchStartEvent = supportTouch ? "touchstart" : "mousedown", + touchStopEvent = supportTouch ? "touchend" : "mouseup", + touchMoveEvent = supportTouch ? "touchmove" : "mousemove"; + + function triggerCustomEvent( obj, eventType, event ) { + var originalType = event.type; + event.type = eventType; + $.event.handle.call( obj, event ); + event.type = originalType; + } + + // also handles scrollstop + $.event.special.scrollstart = { + + enabled: true, + + setup: function() { + + var thisObject = this, + $this = $( thisObject ), + scrolling, + timer; + + function trigger( event, state ) { + scrolling = state; + triggerCustomEvent( thisObject, scrolling ? "scrollstart" : "scrollstop", event ); + } + + // iPhone triggers scroll after a small delay; use touchmove instead + $this.bind( scrollEvent, function( event ) { + + if ( !$.event.special.scrollstart.enabled ) { + return; + } + + if ( !scrolling ) { + trigger( event, true ); + } + + clearTimeout( timer ); + timer = setTimeout( function() { + trigger( event, false ); + }, 50 ); + }); + } + }; + + // also handles taphold + $.event.special.tap = { + tapholdThreshold: 750, + + setup: function() { + var thisObject = this, + $this = $( thisObject ); + + $this.bind( "vmousedown", function( event ) { + + if ( event.which && event.which !== 1 ) { + return false; + } + + var origTarget = event.target, + origEvent = event.originalEvent, + timer; + + function clearTapTimer() { + clearTimeout( timer ); + } + + function clearTapHandlers() { + clearTapTimer(); + + $this.unbind( "vclick", clickHandler ) + .unbind( "vmouseup", clearTapTimer ); + $( document ).unbind( "vmousecancel", clearTapHandlers ); + } + + function clickHandler( event ) { + clearTapHandlers(); + + // ONLY trigger a 'tap' event if the start target is + // the same as the stop target. + if ( origTarget === event.target ) { + triggerCustomEvent( thisObject, "tap", event ); + } + } + + $this.bind( "vmouseup", clearTapTimer ) + .bind( "vclick", clickHandler ); + $( document ).bind( "vmousecancel", clearTapHandlers ); + + timer = setTimeout( function() { + triggerCustomEvent( thisObject, "taphold", $.Event( "taphold", { target: origTarget } ) ); + }, $.event.special.tap.tapholdThreshold ); + }); + } + }; + + // also handles swipeleft, swiperight + $.event.special.swipe = { + scrollSupressionThreshold: 30, // More than this horizontal displacement, and we will suppress scrolling. + + durationThreshold: 1000, // More time than this, and it isn't a swipe. + + horizontalDistanceThreshold: 30, // Swipe horizontal displacement must be more than this. + + verticalDistanceThreshold: 75, // Swipe vertical displacement must be less than this. + + setup: function() { + var thisObject = this, + $this = $( thisObject ); + + $this.bind( touchStartEvent, function( event ) { + var data = event.originalEvent.touches ? + event.originalEvent.touches[ 0 ] : event, + start = { + time: ( new Date() ).getTime(), + coords: [ data.pageX, data.pageY ], + origin: $( event.target ) + }, + stop; + + function moveHandler( event ) { + + if ( !start ) { + return; + } + + var data = event.originalEvent.touches ? + event.originalEvent.touches[ 0 ] : event; + + stop = { + time: ( new Date() ).getTime(), + coords: [ data.pageX, data.pageY ] + }; + + // prevent scrolling + if ( Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.scrollSupressionThreshold ) { + event.preventDefault(); + } + } + + $this.bind( touchMoveEvent, moveHandler ) + .one( touchStopEvent, function( event ) { + $this.unbind( touchMoveEvent, moveHandler ); + + if ( start && stop ) { + if ( stop.time - start.time < $.event.special.swipe.durationThreshold && + Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.horizontalDistanceThreshold && + Math.abs( start.coords[ 1 ] - stop.coords[ 1 ] ) < $.event.special.swipe.verticalDistanceThreshold ) { + + start.origin.trigger( "swipe" ) + .trigger( start.coords[0] > stop.coords[ 0 ] ? "swipeleft" : "swiperight" ); + } + } + start = stop = undefined; + }); + }); + } + }; + $.each({ + scrollstop: "scrollstart", + taphold: "tap", + swipeleft: "swipe", + swiperight: "swipe" + }, function( event, sourceEvent ) { + + $.event.special[ event ] = { + setup: function() { + $( this ).bind( sourceEvent, $.noop ); + } + }; + }); + +})( jQuery, this ); + + (function( $, undefined ) { + $.extend( $.support, { + orientation: "orientation" in window && "onorientationchange" in window + }); + }( jQuery )); + + + // throttled resize event + (function( $ ) { + $.event.special.throttledresize = { + setup: function() { + $( this ).bind( "resize", handler ); + }, + teardown: function() { + $( this ).unbind( "resize", handler ); + } + }; + + var throttle = 250, + handler = function() { + curr = ( new Date() ).getTime(); + diff = curr - lastCall; + + if ( diff >= throttle ) { + + lastCall = curr; + $( this ).trigger( "throttledresize" ); + + } else { + + if ( heldCall ) { + clearTimeout( heldCall ); + } + + // Promise a held call will still execute + heldCall = setTimeout( handler, throttle - diff ); + } + }, + lastCall = 0, + heldCall, + curr, + diff; + })( jQuery ); + +(function( $, window ) { + var win = $( window ), + event_name = "orientationchange", + special_event, + get_orientation, + last_orientation, + initial_orientation_is_landscape, + initial_orientation_is_default, + portrait_map = { "0": true, "180": true }; + + // It seems that some device/browser vendors use window.orientation values 0 and 180 to + // denote the "default" orientation. For iOS devices, and most other smart-phones tested, + // the default orientation is always "portrait", but in some Android and RIM based tablets, + // the default orientation is "landscape". The following code attempts to use the window + // dimensions to figure out what the current orientation is, and then makes adjustments + // to the to the portrait_map if necessary, so that we can properly decode the + // window.orientation value whenever get_orientation() is called. + // + // Note that we used to use a media query to figure out what the orientation the browser + // thinks it is in: + // + // initial_orientation_is_landscape = $.mobile.media("all and (orientation: landscape)"); + // + // but there was an iPhone/iPod Touch bug beginning with iOS 4.2, up through iOS 5.1, + // where the browser *ALWAYS* applied the landscape media query. This bug does not + // happen on iPad. + + if ( $.support.orientation ) { + + // Check the window width and height to figure out what the current orientation + // of the device is at this moment. Note that we've initialized the portrait map + // values to 0 and 180, *AND* we purposely check for landscape so that if we guess + // wrong, , we default to the assumption that portrait is the default orientation. + // We use a threshold check below because on some platforms like iOS, the iPhone + // form-factor can report a larger width than height if the user turns on the + // developer console. The actual threshold value is somewhat arbitrary, we just + // need to make sure it is large enough to exclude the developer console case. + + var ww = window.innerWidth || $( window ).width(), + wh = window.innerHeight || $( window ).height(), + landscape_threshold = 50; + + initial_orientation_is_landscape = ww > wh && ( ww - wh ) > landscape_threshold; + + + // Now check to see if the current window.orientation is 0 or 180. + initial_orientation_is_default = portrait_map[ window.orientation ]; + + // If the initial orientation is landscape, but window.orientation reports 0 or 180, *OR* + // if the initial orientation is portrait, but window.orientation reports 90 or -90, we + // need to flip our portrait_map values because landscape is the default orientation for + // this device/browser. + if ( ( initial_orientation_is_landscape && initial_orientation_is_default ) || ( !initial_orientation_is_landscape && !initial_orientation_is_default ) ) { + portrait_map = { "-90": true, "90": true }; + } + } + + $.event.special.orientationchange = $.extend( {}, $.event.special.orientationchange, { + setup: function() { + // If the event is supported natively, return false so that jQuery + // will bind to the event using DOM methods. + if ( $.support.orientation && !$.event.special.orientationchange.disabled ) { + return false; + } + + // Get the current orientation to avoid initial double-triggering. + last_orientation = get_orientation(); + + // Because the orientationchange event doesn't exist, simulate the + // event by testing window dimensions on resize. + win.bind( "throttledresize", handler ); + }, + teardown: function() { + // If the event is not supported natively, return false so that + // jQuery will unbind the event using DOM methods. + if ( $.support.orientation && !$.event.special.orientationchange.disabled ) { + return false; + } + + // Because the orientationchange event doesn't exist, unbind the + // resize event handler. + win.unbind( "throttledresize", handler ); + }, + add: function( handleObj ) { + // Save a reference to the bound event handler. + var old_handler = handleObj.handler; + + + handleObj.handler = function( event ) { + // Modify event object, adding the .orientation property. + event.orientation = get_orientation(); + + // Call the originally-bound event handler and return its result. + return old_handler.apply( this, arguments ); + }; + } + }); + + // If the event is not supported natively, this handler will be bound to + // the window resize event to simulate the orientationchange event. + function handler() { + // Get the current orientation. + var orientation = get_orientation(); + + if ( orientation !== last_orientation ) { + // The orientation has changed, so trigger the orientationchange event. + last_orientation = orientation; + win.trigger( event_name ); + } + } + + // Get the current page orientation. This method is exposed publicly, should it + // be needed, as jQuery.event.special.orientationchange.orientation() + $.event.special.orientationchange.orientation = get_orientation = function() { + var isPortrait = true, elem = document.documentElement; + + // prefer window orientation to the calculation based on screensize as + // the actual screen resize takes place before or after the orientation change event + // has been fired depending on implementation (eg android 2.3 is before, iphone after). + // More testing is required to determine if a more reliable method of determining the new screensize + // is possible when orientationchange is fired. (eg, use media queries + element + opacity) + if ( $.support.orientation ) { + // if the window orientation registers as 0 or 180 degrees report + // portrait, otherwise landscape + isPortrait = portrait_map[ window.orientation ]; + } else { + isPortrait = elem && elem.clientWidth / elem.clientHeight < 1.1; + } + + return isPortrait ? "portrait" : "landscape"; + }; + + $.fn[ event_name ] = function( fn ) { + return fn ? this.bind( event_name, fn ) : this.trigger( event_name ); + }; + + // jQuery < 1.8 + if ( $.attrFn ) { + $.attrFn[ event_name ] = true; + } + +}( jQuery, this )); + + +(function( $, undefined ) { + +var $window = $( window ), + $html = $( "html" ); + +/* $.mobile.media method: pass a CSS media type or query and get a bool return + note: this feature relies on actual media query support for media queries, though types will work most anywhere + examples: + $.mobile.media('screen') // tests for screen media type + $.mobile.media('screen and (min-width: 480px)') // tests for screen media type with window width > 480px + $.mobile.media('@media screen and (-webkit-min-device-pixel-ratio: 2)') // tests for webkit 2x pixel ratio (iPhone 4) +*/ +$.mobile.media = (function() { + // TODO: use window.matchMedia once at least one UA implements it + var cache = {}, + testDiv = $( "
" ), + fakeBody = $( "" ).append( testDiv ); + + return function( query ) { + if ( !( query in cache ) ) { + var styleBlock = document.createElement( "style" ), + cssrule = "@media " + query + " { #jquery-mediatest { position:absolute; } }"; + + //must set type for IE! + styleBlock.type = "text/css"; + + if ( styleBlock.styleSheet ) { + styleBlock.styleSheet.cssText = cssrule; + } else { + styleBlock.appendChild( document.createTextNode(cssrule) ); + } + + $html.prepend( fakeBody ).prepend( styleBlock ); + cache[ query ] = testDiv.css( "position" ) === "absolute"; + fakeBody.add( styleBlock ).remove(); + } + return cache[ query ]; + }; +})(); + +})(jQuery); + +(function( $, undefined ) { + +// thx Modernizr +function propExists( prop ) { + var uc_prop = prop.charAt( 0 ).toUpperCase() + prop.substr( 1 ), + props = ( prop + " " + vendors.join( uc_prop + " " ) + uc_prop ).split( " " ); + + for ( var v in props ) { + if ( fbCSS[ props[ v ] ] !== undefined ) { + return true; + } + } +} + +var fakeBody = $( "" ).prependTo( "html" ), + fbCSS = fakeBody[ 0 ].style, + vendors = [ "Webkit", "Moz", "O" ], + webos = "palmGetResource" in window, //only used to rule out scrollTop + opera = window.opera, + operamini = window.operamini && ({}).toString.call( window.operamini ) === "[object OperaMini]", + bb = window.blackberry && !propExists( "-webkit-transform" ); //only used to rule out box shadow, as it's filled opaque on BB 5 and lower + + +function validStyle( prop, value, check_vend ) { + var div = document.createElement( 'div' ), + uc = function( txt ) { + return txt.charAt( 0 ).toUpperCase() + txt.substr( 1 ); + }, + vend_pref = function( vend ) { + return "-" + vend.charAt( 0 ).toLowerCase() + vend.substr( 1 ) + "-"; + }, + check_style = function( vend ) { + var vend_prop = vend_pref( vend ) + prop + ": " + value + ";", + uc_vend = uc( vend ), + propStyle = uc_vend + uc( prop ); + + div.setAttribute( "style", vend_prop ); + + if ( !!div.style[ propStyle ] ) { + ret = true; + } + }, + check_vends = check_vend ? [ check_vend ] : vendors, + ret; + + for( var i = 0; i < check_vends.length; i++ ) { + check_style( check_vends[i] ); + } + return !!ret; +} + +// Thanks to Modernizr src for this test idea. `perspective` check is limited to Moz to prevent a false positive for 3D transforms on Android. +function transform3dTest() { + var prop = "transform-3d"; + return validStyle( 'perspective', '10px', 'moz' ) || $.mobile.media( "(-" + vendors.join( "-" + prop + "),(-" ) + "-" + prop + "),(" + prop + ")" ); +} + +// Test for dynamic-updating base tag support ( allows us to avoid href,src attr rewriting ) +function baseTagTest() { + var fauxBase = location.protocol + "//" + location.host + location.pathname + "ui-dir/", + base = $( "head base" ), + fauxEle = null, + href = "", + link, rebase; + + if ( !base.length ) { + base = fauxEle = $( "", { "href": fauxBase }).appendTo( "head" ); + } else { + href = base.attr( "href" ); + } + + link = $( "" ).prependTo( fakeBody ); + rebase = link[ 0 ].href; + base[ 0 ].href = href || location.pathname; + + if ( fauxEle ) { + fauxEle.remove(); + } + return rebase.indexOf( fauxBase ) === 0; +} + +// Thanks Modernizr +function cssPointerEventsTest() { + var element = document.createElement( 'x' ), + documentElement = document.documentElement, + getComputedStyle = window.getComputedStyle, + supports; + + if ( !( 'pointerEvents' in element.style ) ) { + return false; + } + + element.style.pointerEvents = 'auto'; + element.style.pointerEvents = 'x'; + documentElement.appendChild( element ); + supports = getComputedStyle && + getComputedStyle( element, '' ).pointerEvents === 'auto'; + documentElement.removeChild( element ); + return !!supports; +} + +function boundingRect() { + var div = document.createElement( "div" ); + return typeof div.getBoundingClientRect !== "undefined"; +} + +// non-UA-based IE version check by James Padolsey, modified by jdalton - from http://gist.github.com/527683 +// allows for inclusion of IE 6+, including Windows Mobile 7 +$.extend( $.mobile, { browser: {} } ); +$.mobile.browser.ie = (function() { + var v = 3, + div = document.createElement( "div" ), + a = div.all || []; + + do { + div.innerHTML = ""; + } while( a[0] ); + + return v > 4 ? v : !v; +})(); + + +$.extend( $.support, { + cssTransitions: "WebKitTransitionEvent" in window || validStyle( 'transition', 'height 100ms linear' ) && !opera, + pushState: "pushState" in history && "replaceState" in history, + mediaquery: $.mobile.media( "only all" ), + cssPseudoElement: !!propExists( "content" ), + touchOverflow: !!propExists( "overflowScrolling" ), + cssTransform3d: transform3dTest(), + boxShadow: !!propExists( "boxShadow" ) && !bb, + scrollTop: ( "pageXOffset" in window || "scrollTop" in document.documentElement || "scrollTop" in fakeBody[ 0 ] ) && !webos && !operamini, + dynamicBaseTag: baseTagTest(), + cssPointerEvents: cssPointerEventsTest(), + boundingRect: boundingRect() +}); + +fakeBody.remove(); + + +// $.mobile.ajaxBlacklist is used to override ajaxEnabled on platforms that have known conflicts with hash history updates (BB5, Symbian) +// or that generally work better browsing in regular http for full page refreshes (Opera Mini) +// Note: This detection below is used as a last resort. +// We recommend only using these detection methods when all other more reliable/forward-looking approaches are not possible +var nokiaLTE7_3 = (function() { + + var ua = window.navigator.userAgent; + + //The following is an attempt to match Nokia browsers that are running Symbian/s60, with webkit, version 7.3 or older + return ua.indexOf( "Nokia" ) > -1 && + ( ua.indexOf( "Symbian/3" ) > -1 || ua.indexOf( "Series60/5" ) > -1 ) && + ua.indexOf( "AppleWebKit" ) > -1 && + ua.match( /(BrowserNG|NokiaBrowser)\/7\.[0-3]/ ); +})(); + +// Support conditions that must be met in order to proceed +// default enhanced qualifications are media query support OR IE 7+ + +$.mobile.gradeA = function() { + return ( $.support.mediaquery || $.mobile.browser.ie && $.mobile.browser.ie >= 7 ) && ( $.support.boundingRect || $.fn.jquery.match(/1\.[0-7+]\.[0-9+]?/) !== null ); +}; + +$.mobile.ajaxBlacklist = + // BlackBerry browsers, pre-webkit + window.blackberry && !window.WebKitPoint || + // Opera Mini + operamini || + // Symbian webkits pre 7.3 + nokiaLTE7_3; + +// Lastly, this workaround is the only way we've found so far to get pre 7.3 Symbian webkit devices +// to render the stylesheets when they're referenced before this script, as we'd recommend doing. +// This simply reappends the CSS in place, which for some reason makes it apply +if ( nokiaLTE7_3 ) { + $(function() { + $( "head link[rel='stylesheet']" ).attr( "rel", "alternate stylesheet" ).attr( "rel", "stylesheet" ); + }); +} + +// For ruling out shadows via css +if ( !$.support.boxShadow ) { + $( "html" ).addClass( "ui-mobile-nosupport-boxshadow" ); +} + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.page", $.mobile.widget, { + options: { + theme: "c", + domCache: false, + keepNativeDefault: ":jqmData(role='none'), :jqmData(role='nojs')" + }, + + _create: function() { + + var self = this; + + // if false is returned by the callbacks do not create the page + if ( self._trigger( "beforecreate" ) === false ) { + return false; + } + + self.element + .attr( "tabindex", "0" ) + .addClass( "ui-page ui-body-" + self.options.theme ) + .bind( "pagebeforehide", function() { + self.removeContainerBackground(); + } ) + .bind( "pagebeforeshow", function() { + self.setContainerBackground(); + } ); + + }, + + removeContainerBackground: function() { + $.mobile.pageContainer.removeClass( "ui-overlay-" + $.mobile.getInheritedTheme( this.element.parent() ) ); + }, + + // set the page container background to the page theme + setContainerBackground: function( theme ) { + if ( this.options.theme ) { + $.mobile.pageContainer.addClass( "ui-overlay-" + ( theme || this.options.theme ) ); + } + }, + + keepNativeSelector: function() { + var options = this.options, + keepNativeDefined = options.keepNative && $.trim( options.keepNative ); + + if ( keepNativeDefined && options.keepNative !== options.keepNativeDefault ) { + return [options.keepNative, options.keepNativeDefault].join( ", " ); + } + + return options.keepNativeDefault; + } +}); +})( jQuery ); + +// Script: jQuery hashchange event +// +// *Version: 1.3, Last updated: 7/21/2010* +// +// Project Home - http://benalman.com/projects/jquery-hashchange-plugin/ +// GitHub - http://github.com/cowboy/jquery-hashchange/ +// Source - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.js +// (Minified) - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.min.js (0.8kb gzipped) +// +// About: License +// +// Copyright (c) 2010 "Cowboy" Ben Alman, +// Dual licensed under the MIT and GPL licenses. +// http://benalman.com/about/license/ +// +// About: Examples +// +// These working examples, complete with fully commented code, illustrate a few +// ways in which this plugin can be used. +// +// hashchange event - http://benalman.com/code/projects/jquery-hashchange/examples/hashchange/ +// document.domain - http://benalman.com/code/projects/jquery-hashchange/examples/document_domain/ +// +// About: Support and Testing +// +// Information about what version or versions of jQuery this plugin has been +// tested with, what browsers it has been tested in, and where the unit tests +// reside (so you can test it yourself). +// +// jQuery Versions - 1.2.6, 1.3.2, 1.4.1, 1.4.2 +// Browsers Tested - Internet Explorer 6-8, Firefox 2-4, Chrome 5-6, Safari 3.2-5, +// Opera 9.6-10.60, iPhone 3.1, Android 1.6-2.2, BlackBerry 4.6-5. +// Unit Tests - http://benalman.com/code/projects/jquery-hashchange/unit/ +// +// About: Known issues +// +// While this jQuery hashchange event implementation is quite stable and +// robust, there are a few unfortunate browser bugs surrounding expected +// hashchange event-based behaviors, independent of any JavaScript +// window.onhashchange abstraction. See the following examples for more +// information: +// +// Chrome: Back Button - http://benalman.com/code/projects/jquery-hashchange/examples/bug-chrome-back-button/ +// Firefox: Remote XMLHttpRequest - http://benalman.com/code/projects/jquery-hashchange/examples/bug-firefox-remote-xhr/ +// WebKit: Back Button in an Iframe - http://benalman.com/code/projects/jquery-hashchange/examples/bug-webkit-hash-iframe/ +// Safari: Back Button from a different domain - http://benalman.com/code/projects/jquery-hashchange/examples/bug-safari-back-from-diff-domain/ +// +// Also note that should a browser natively support the window.onhashchange +// event, but not report that it does, the fallback polling loop will be used. +// +// About: Release History +// +// 1.3 - (7/21/2010) Reorganized IE6/7 Iframe code to make it more +// "removable" for mobile-only development. Added IE6/7 document.title +// support. Attempted to make Iframe as hidden as possible by using +// techniques from http://www.paciellogroup.com/blog/?p=604. Added +// support for the "shortcut" format $(window).hashchange( fn ) and +// $(window).hashchange() like jQuery provides for built-in events. +// Renamed jQuery.hashchangeDelay to and +// lowered its default value to 50. Added +// and properties plus document-domain.html +// file to address access denied issues when setting document.domain in +// IE6/7. +// 1.2 - (2/11/2010) Fixed a bug where coming back to a page using this plugin +// from a page on another domain would cause an error in Safari 4. Also, +// IE6/7 Iframe is now inserted after the body (this actually works), +// which prevents the page from scrolling when the event is first bound. +// Event can also now be bound before DOM ready, but it won't be usable +// before then in IE6/7. +// 1.1 - (1/21/2010) Incorporated document.documentMode test to fix IE8 bug +// where browser version is incorrectly reported as 8.0, despite +// inclusion of the X-UA-Compatible IE=EmulateIE7 meta tag. +// 1.0 - (1/9/2010) Initial Release. Broke out the jQuery BBQ event.special +// window.onhashchange functionality into a separate plugin for users +// who want just the basic event & back button support, without all the +// extra awesomeness that BBQ provides. This plugin will be included as +// part of jQuery BBQ, but also be available separately. + +(function( $, window, undefined ) { + // Reused string. + var str_hashchange = 'hashchange', + + // Method / object references. + doc = document, + fake_onhashchange, + special = $.event.special, + + // Does the browser support window.onhashchange? Note that IE8 running in + // IE7 compatibility mode reports true for 'onhashchange' in window, even + // though the event isn't supported, so also test document.documentMode. + doc_mode = doc.documentMode, + supports_onhashchange = 'on' + str_hashchange in window && ( doc_mode === undefined || doc_mode > 7 ); + + // Get location.hash (or what you'd expect location.hash to be) sans any + // leading #. Thanks for making this necessary, Firefox! + function get_fragment( url ) { + url = url || location.href; + return '#' + url.replace( /^[^#]*#?(.*)$/, '$1' ); + }; + + // Method: jQuery.fn.hashchange + // + // Bind a handler to the window.onhashchange event or trigger all bound + // window.onhashchange event handlers. This behavior is consistent with + // jQuery's built-in event handlers. + // + // Usage: + // + // > jQuery(window).hashchange( [ handler ] ); + // + // Arguments: + // + // handler - (Function) Optional handler to be bound to the hashchange + // event. This is a "shortcut" for the more verbose form: + // jQuery(window).bind( 'hashchange', handler ). If handler is omitted, + // all bound window.onhashchange event handlers will be triggered. This + // is a shortcut for the more verbose + // jQuery(window).trigger( 'hashchange' ). These forms are described in + // the section. + // + // Returns: + // + // (jQuery) The initial jQuery collection of elements. + + // Allow the "shortcut" format $(elem).hashchange( fn ) for binding and + // $(elem).hashchange() for triggering, like jQuery does for built-in events. + $.fn[ str_hashchange ] = function( fn ) { + return fn ? this.bind( str_hashchange, fn ) : this.trigger( str_hashchange ); + }; + + // Property: jQuery.fn.hashchange.delay + // + // The numeric interval (in milliseconds) at which the + // polling loop executes. Defaults to 50. + + // Property: jQuery.fn.hashchange.domain + // + // If you're setting document.domain in your JavaScript, and you want hash + // history to work in IE6/7, not only must this property be set, but you must + // also set document.domain BEFORE jQuery is loaded into the page. This + // property is only applicable if you are supporting IE6/7 (or IE8 operating + // in "IE7 compatibility" mode). + // + // In addition, the property must be set to the + // path of the included "document-domain.html" file, which can be renamed or + // modified if necessary (note that the document.domain specified must be the + // same in both your main JavaScript as well as in this file). + // + // Usage: + // + // jQuery.fn.hashchange.domain = document.domain; + + // Property: jQuery.fn.hashchange.src + // + // If, for some reason, you need to specify an Iframe src file (for example, + // when setting document.domain as in ), you can + // do so using this property. Note that when using this property, history + // won't be recorded in IE6/7 until the Iframe src file loads. This property + // is only applicable if you are supporting IE6/7 (or IE8 operating in "IE7 + // compatibility" mode). + // + // Usage: + // + // jQuery.fn.hashchange.src = 'path/to/file.html'; + + $.fn[ str_hashchange ].delay = 50; + /* + $.fn[ str_hashchange ].domain = null; + $.fn[ str_hashchange ].src = null; + */ + + // Event: hashchange event + // + // Fired when location.hash changes. In browsers that support it, the native + // HTML5 window.onhashchange event is used, otherwise a polling loop is + // initialized, running every milliseconds to + // see if the hash has changed. In IE6/7 (and IE8 operating in "IE7 + // compatibility" mode), a hidden Iframe is created to allow the back button + // and hash-based history to work. + // + // Usage as described in : + // + // > // Bind an event handler. + // > jQuery(window).hashchange( function(e) { + // > var hash = location.hash; + // > ... + // > }); + // > + // > // Manually trigger the event handler. + // > jQuery(window).hashchange(); + // + // A more verbose usage that allows for event namespacing: + // + // > // Bind an event handler. + // > jQuery(window).bind( 'hashchange', function(e) { + // > var hash = location.hash; + // > ... + // > }); + // > + // > // Manually trigger the event handler. + // > jQuery(window).trigger( 'hashchange' ); + // + // Additional Notes: + // + // * The polling loop and Iframe are not created until at least one handler + // is actually bound to the 'hashchange' event. + // * If you need the bound handler(s) to execute immediately, in cases where + // a location.hash exists on page load, via bookmark or page refresh for + // example, use jQuery(window).hashchange() or the more verbose + // jQuery(window).trigger( 'hashchange' ). + // * The event can be bound before DOM ready, but since it won't be usable + // before then in IE6/7 (due to the necessary Iframe), recommended usage is + // to bind it inside a DOM ready handler. + + // Override existing $.event.special.hashchange methods (allowing this plugin + // to be defined after jQuery BBQ in BBQ's source code). + special[ str_hashchange ] = $.extend( special[ str_hashchange ], { + + // Called only when the first 'hashchange' event is bound to window. + setup: function() { + // If window.onhashchange is supported natively, there's nothing to do.. + if ( supports_onhashchange ) { return false; } + + // Otherwise, we need to create our own. And we don't want to call this + // until the user binds to the event, just in case they never do, since it + // will create a polling loop and possibly even a hidden Iframe. + $( fake_onhashchange.start ); + }, + + // Called only when the last 'hashchange' event is unbound from window. + teardown: function() { + // If window.onhashchange is supported natively, there's nothing to do.. + if ( supports_onhashchange ) { return false; } + + // Otherwise, we need to stop ours (if possible). + $( fake_onhashchange.stop ); + } + + }); + + // fake_onhashchange does all the work of triggering the window.onhashchange + // event for browsers that don't natively support it, including creating a + // polling loop to watch for hash changes and in IE 6/7 creating a hidden + // Iframe to enable back and forward. + fake_onhashchange = (function() { + var self = {}, + timeout_id, + + // Remember the initial hash so it doesn't get triggered immediately. + last_hash = get_fragment(), + + fn_retval = function( val ) { return val; }, + history_set = fn_retval, + history_get = fn_retval; + + // Start the polling loop. + self.start = function() { + timeout_id || poll(); + }; + + // Stop the polling loop. + self.stop = function() { + timeout_id && clearTimeout( timeout_id ); + timeout_id = undefined; + }; + + // This polling loop checks every $.fn.hashchange.delay milliseconds to see + // if location.hash has changed, and triggers the 'hashchange' event on + // window when necessary. + function poll() { + var hash = get_fragment(), + history_hash = history_get( last_hash ); + + if ( hash !== last_hash ) { + history_set( last_hash = hash, history_hash ); + + $(window).trigger( str_hashchange ); + + } else if ( history_hash !== last_hash ) { + location.href = location.href.replace( /#.*/, '' ) + history_hash; + } + + timeout_id = setTimeout( poll, $.fn[ str_hashchange ].delay ); + }; + + // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv + // vvvvvvvvvvvvvvvvvvv REMOVE IF NOT SUPPORTING IE6/7/8 vvvvvvvvvvvvvvvvvvv + // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv + $.browser.msie && !supports_onhashchange && (function() { + // Not only do IE6/7 need the "magical" Iframe treatment, but so does IE8 + // when running in "IE7 compatibility" mode. + + var iframe, + iframe_src; + + // When the event is bound and polling starts in IE 6/7, create a hidden + // Iframe for history handling. + self.start = function() { + if ( !iframe ) { + iframe_src = $.fn[ str_hashchange ].src; + iframe_src = iframe_src && iframe_src + get_fragment(); + + // Create hidden Iframe. Attempt to make Iframe as hidden as possible + // by using techniques from http://www.paciellogroup.com/blog/?p=604. + iframe = $(''; +html += '
'; +html += '
'; +html += '
Upload File
'; +html += '
Want to upload multiple files at once? Please upgrade to the latest Flash Player, then reload this page. For some reason our Flash based uploader did not load, so you are currently using our single file uploader.
'; +html += spacer(1,20) + '
'; +var url = zero_client.targetURL; +if (url.indexOf('?') > -1) url += '&'; else url += '?'; +url += 'format=jshtml&onafter=' + escape('window.parent.upload_basic_finish(response);'); +Debug.trace('upload', "Prepping basic upload: " + url); +html += '
'; +html += '
'; +html += '
'; +html += '

'; +html += ''; +html += ''; +html += ''; +html += '
' + large_icon_button('x', 'Cancel', "hide_popup_dialog()") + ' ' + large_icon_button('page_white_get.png', 'Upload', "upload_basic_go()") + '
'; +html += '
'; +html += ''; +html += '
'; +html += ''; +session.hooks.keys[ESC_KEY] = 'hide_popup_dialog'; +show_popup_dialog(528, 200, html); +} +function upload_basic_go() { +$('f_upload_basic').submit(); +$('d_upload_form').hide(); +$('d_upload_progress').show(); +} +function upload_basic_finish(response) { +Debug.trace('upload', "Basic upload complete: " + dumper(response)); +setTimeout( 'upload_basic_finish_2()', 100 ); +} +function upload_basic_finish_2() { +$('i_upload_basic').src = 'blank.html'; +setTimeout( 'upload_basic_finish_3()', 100 ); +} +function upload_basic_finish_3() { +hide_popup_dialog(); +delete session.progress; +show_progress_dialog( 0, 'Finishing Upload...', true ); +fire_callback( session.upload_callback ); +} +function upload_destroy() { +if (zero_client) { +zero_client.destroy(); +delete ZeroUpload.clients[ zero_client.id ]; +zero_client = null; +} +} +function prep_upload(dom_id, url, callback, types) { +session.upload_callback = callback; +if (url) { +if (url.indexOf('?') > -1) url += '&'; else url += '?'; +url += 'session=' + session.cookie.get('effect_session_id'); +} +upload_destroy(); +zero_client = new ZeroUpload.Client(); +if (url) zero_client.setURL( url ); +zero_client.setHandCursor( true ); +if (types) zero_client.setFileTypes( types[0], types[1] ); +zero_client.addEventListener( 'queueStart', uploadQueueStart ); +zero_client.addEventListener( 'fileStart', uploadFileStart ); +zero_client.addEventListener( 'progress', uploadProgress ); +zero_client.addEventListener( 'fileComplete', uploadFileComplete ); +zero_client.addEventListener( 'queueComplete', uploadQueueComplete ); +zero_client.addEventListener( 'error', uploadError ); +zero_client.addEventListener( 'debug', function(client, eventName, args) { +Debug.trace('upload', "Caught event: " + eventName); +} ); +if (dom_id) { +Debug.trace('upload', "Gluing ZeroUpload to: " + dom_id); +zero_client.glue( dom_id ); +} +} +Class.create( 'Debug', { +__static: { +enabled: false, +categories: { all: 1 }, +buffer: [], +max_rows: 5000, +win: null, +ie: !!navigator.userAgent.match(/MSIE/), +ie6: !!navigator.userAgent.match(/MSIE\D+6/), +init: function() { +Debug.enabled = true; +Debug.trace( 'debug', 'Debug log start' ); +var html = '

'; +if (Debug.ie) { +setTimeout( function() { +document.body.insertAdjacentHTML('beforeEnd', +'
' + html + '
' +); +}, 1000 ); +} +else { +var div = document.createElement('DIV'); +div.id = 'd_debug'; +div.setAttribute('id', 'd_debug'); +div.style.position = Debug.ie6 ? 'absolute' : 'fixed'; +div.style.zIndex = '101'; +div.style.left = '0px'; +div.style.top = '0px'; +div.style.width = '100%'; +div.innerHTML = html; +document.getElementsByTagName('body')[0].appendChild(div); +} +}, +show: function() { +if (!Debug.win || Debug.win.closed) { +Debug.trace('debug', "Opening debug window"); +Debug.win = window.open( '', 'DebugWindow', 'width=600,height=500,menubar=no,resizable=yes,scrollbars=yes,location=no,status=no,toolbar=no,directories=no' ); +if (!Debug.win) return alert("Failed to open window. Popup blocker maybe?"); +var doc = Debug.win.document; +doc.open(); +doc.writeln( 'Debug Log' ); +doc.writeln( '
' ); +doc.writeln( '
' ); +doc.writeln( '
' ); +doc.writeln( '' ); +doc.writeln( '' ); +doc.writeln( '
' ); +doc.writeln( '' ); +doc.close(); +} +Debug.win.focus(); +}, +console_execute: function() { +var cmd = Debug.win.document.getElementById('fe_command'); +if (cmd.value.length) { +Debug.trace( 'console', cmd.value ); +try { +Debug.trace( 'console', '' + eval(cmd.value) ); +} +catch (e) { +Debug.trace( 'error', 'JavaScript Interpreter Exception: ' + e.toString() ); +} +} +}, +get_time_stamp: function(now) { +var date = new Date( now * 1000 ); +var hh = date.getHours(); if (hh < 10) hh = "0" + hh; +var mi = date.getMinutes(); if (mi < 10) mi = "0" + mi; +var ss = date.getSeconds(); if (ss < 10) ss = "0" + ss; +var sss = '' + date.getMilliseconds(); while (sss.length < 3) sss = "0" + sss; +return '' + hh + ':' + mi + ':' + ss + '.' + sss; +}, +refresh_console: function() { +if (!Debug.win || Debug.win.closed) return; +var div = Debug.win.document.getElementById('d_debug_log'); +if (div) { +var row = null; +while ( row = Debug.buffer.shift() ) { +var time_stamp = Debug.get_time_stamp(row.time); +var msg = row.msg; +msg = msg.replace(/\t/g, "    "); +msg = msg.replace(//g, ">"); +msg = msg.replace(/\n/g, "
\n"); +var html = ''; +var sty = 'float:left; font-family: Consolas, Courier, mono; font-size: 12px; cursor:default; margin-right:10px; margin-bottom:1px; padding:2px;'; +html += '
' + time_stamp + '
'; +html += '
' + row.cat + '
'; +html += '
' + msg + '
'; +html += '
'; +var chunk = Debug.win.document.createElement('DIV'); +chunk.style['float'] = 'none'; +chunk.innerHTML = html; +div.appendChild(chunk); +} +var cmd = Debug.win.document.getElementById('fe_command'); +cmd.focus(); +} +Debug.dirty = 0; +Debug.win.scrollTo(0, 99999); +}, +hires_time_now: function() { +var now = new Date(); +return ( now.getTime() / 1000 ); +}, +trace: function(cat, msg) { +if (arguments.length == 1) { +msg = cat; +cat = 'debug'; +} +if (Debug.categories.all || Debug.categories[cat]) { +Debug.buffer.push({ cat: cat, msg: msg, time: Debug.hires_time_now() }); +if (Debug.buffer.length > Debug.max_rows) Debug.buffer.shift(); +if (!Debug.dirty) { +Debug.dirty = 1; +setTimeout( 'Debug.refresh_console();', 1 ); +} +} +} +} +} ); +var session = { +inited: false, +api_mod_cache: {}, +query: parseQueryString( ''+location.search ), +cookie: new CookieTree({ path: '/effect/' }), +storage: {}, +storage_dirty: false, +hooks: { +keys: {} +}, +username: '', +em_width: 11, +audioResourceMatch: /\.mp3$/i, +imageResourceMatch: /\.(jpe|jpeg|jpg|png|gif)$/i, +textResourceMatch: /\.xml$/i, +movieResourceMatch: /\.(flv|mp4|mp4v|mov|3gp|3g2)$/i, +imageResourceMatchString: '\.(jpe|jpeg|jpg|png|gif)$' +}; +session.debug = session.query.debug ? true : false; +var page_manager = null; +var preload_icons = []; +var preload_images = [ +'loading.gif', +'aquaprogressbar.gif', +'aquaprogressbar_bkgnd.gif' +]; +function get_base_url() { +return protocol + '://' + location.hostname + session.config.BaseURI; +} +function effect_init() { +if (session.inited) return; +session.inited = true; +assert( window.config, "Config not loaded" ); +session.config = window.config; +Debug.trace("Starting up"); +rendering_page = false; +preload(); +window.$R = {}; +for (var key in config.RegExpShortcuts) { +$R[key] = new RegExp( config.RegExpShortcuts[key] ); +} +ww_precalc_font("body", "effect_precalc_font_finish"); +page_manager = new Effect.PageManager( config.Pages.Page ); +var session_id = session.cookie.get('effect_session_id'); +if (session_id && session_id.match(/^login/)) { +do_session_recover(); +} +else { +show_default_login_status(); +Nav.init(); +} +Blog.search({ +stag: 'sidebar_docs', +limit: 20, +title_only: true, +sort_by: 'seq', +sort_dir: -1, +target: 'd_sidebar_documents', +outer_div_class: 'sidebar_blog_row', +title_class: 'sidebar_blog_title', +after: '
→ See More...
' +}); +Blog.search({ +stag: 'sidebar_tutorials', +limit: 5, +title_only: true, +sort_by: 'seq', +sort_dir: -1, +target: 'd_sidebar_tutorials', +outer_div_class: 'sidebar_blog_row', +title_class: 'sidebar_blog_title', +after: '
→ See More...
' +}); +Blog.search({ +stag: 'sidebar_plugins', +limit: 5, +title_only: true, +sort_by: 'seq', +sort_dir: -1, +target: 'd_sidebar_plugins', +outer_div_class: 'sidebar_blog_row', +title_class: 'sidebar_blog_title', +after: '
→ See More...
' +}); +$('fe_search_bar').onkeydown = delay_onChange_input_text; +user_storage_idle(); +} +function effect_precalc_font_finish(width, height) { +session.em_width = width; +} +function preload() { +for (var idx = 0, len = preload_icons.length; idx < len; idx++) { +var url = images_uri + '/icons/' + preload_icons[idx] + '.gif'; +preload_icons[idx] = new Image(); +preload_icons[idx].src = url; +} +for (var idx = 0, len = preload_images.length; idx < len; idx++) { +var url = images_uri + '/' + preload_images[idx]; +preload_images[idx] = new Image(); +preload_images[idx].src = url; +} +} +function $P(id) { +if (!id) id = page_manager.current_page_id; +var page = page_manager.find(id); +assert( !!page, "Failed to locate page: " + id ); +return page; +} +function get_pref(name) { +if (!session.user || !session.user.Preferences) return alert("ASSERT FAILURE! Tried to lookup pref " + name + " and user is not yet loaded!"); +return session.user.Preferences[name]; +} +function get_bool_pref(name) { +return (get_pref(name) == 1); +} +function set_pref(name, value) { +session.user.Preferences[name] = value; +} +function set_bool_pref(name, value) { +set_pref(name, value ? '1' : '0'); +} +function save_prefs() { +var prefs_to_save = {}; +if (arguments.length) { +for (var idx = 0, len = arguments.length; idx < len; idx++) { +var key = arguments[idx]; +prefs_to_save[key] = get_pref(key); +} +} +else prefs_to_save = session.user.Preferences; +effect_api_mod_touch('user_get'); +effect_api_send('user_update', { +Username: session.username, +Preferences: prefs_to_save +}, 'save_prefs_2'); +} +function save_prefs_2(response) { +do_message('success', 'Preferences saved.'); +} + +function get_full_name(username) { +var user = session.users[username]; +if (!user) return username; +return user.FullName; +} +function get_buddy_icon_url(username, size) { +var mod = session.api_mod_cache.get_buddy_icon || 0; +if (!size) size = 32; +var url = '/effect/api/get_buddy_icon?username='+username + '&mod=' + mod + '&size=' + size; +return url; +} +function get_buddy_icon_display(username, show_icon, show_name) { +if ((typeof(show_icon) == 'undefined') && get_bool_pref('show_user_icons')) show_icon = 1; +if ((typeof(show_name) == 'undefined') && get_bool_pref('show_user_names')) show_name = 1; +var html = ''; +if (show_icon) html += ''; +if (show_icon && show_name) html += '
'; +if (show_name) html += username; +return html; +} +function do_session_recover() { +session.hooks.after_error = 'do_logout'; +effect_api_send('session_recover', {}, 'do_login_2', { _from_recover: 1 } ); +} +function require_login() { +if (session.user) return true; +Debug.trace('Page requires login, showing login page'); +session.nav_after_login = Nav.currentAnchor(); +setTimeout( function() { +Nav.go( 'Login' ); +}, 1 ); +return false; +} +function popup_window(url, name) { +if (!url) url = ''; +if (!name) name = ''; +var win = window.open(url, name); +if (!win) return alert('Failed to open popup window. If you have a popup blocker, please disable it for this website and try again.'); +return win; +} +function do_login_prompt() { +hide_popup_dialog(); +delete session.progress; +if (!session.temp_password) session.temp_password = ''; +if (!session.username) session.username = ''; +var temp_username = session.open_id || session.username || ''; +var html = ''; +html += '
'; +html += ' from table fragments + if ( !jQuery.support.tbody ) { + + // String was a
'; +html += '
Effect Developer Login
'; +html += '
'; +html += '
Effect Username  or  '+icon('openid', 'OpenID', 'popup_window(\'http://openid.net/\')', 'What is OpenID?')+'


'; +html += '
'; +html += '
'; +html += '

'; +html += ''; +html += ''; +html += ''; +html += '
' + large_icon_button('x', 'Cancel', "clear_login()") + ' ' + large_icon_button('check', 'Login', 'do_login()') + '
'; +html += '
'; +html += ''; +session.hooks.keys[ENTER_KEY] = 'do_login'; +session.hooks.keys[ESC_KEY] = 'clear_login'; +safe_focus( 'fe_username' ); +show_popup_dialog(450, 225, html); +} +function do_openid_reg(title, auto_login_button) { +hide_popup_dialog(); +delete session.progress; +if (!title) title = 'Register Account Using OpenID'; +if (typeof(auto_login_button) == 'undefined') auto_login_button = 1; +var html = ''; +html += '
'; +html += ']", "i"), + rcheckableType = /^(?:checkbox|radio)$/, + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /\/(java|ecma)script/i, + rcleanScript = /^\s*\s*$/g, + wrapMap = { + option: [ 1, "" ], + legend: [ 1, "
", "
" ], + thead: [ 1, "
'; +html += '
'+title+'
'; +html += '
'; +html += '
'+icon('openid', 'Enter Your OpenID URL:')+'
'; +if (auto_login_button) html += '


'; +html += '
'; +html += '

'; +html += ''; +html += ''; +html += ''; +html += '
' + large_icon_button('x', 'Cancel', "hide_popup_dialog()") + ' ' + large_icon_button('check', title.match(/login/i) ? 'Login' : 'Register', 'do_openid_login()') + '
'; +html += '
'; +html += ''; +session.hooks.keys[ENTER_KEY] = 'do_openid_login'; +session.hooks.keys[ESC_KEY] = 'hide_popup_dialog'; +safe_focus( 'fe_username' ); +show_popup_dialog(450, 225, html); +} +function do_login_prompt_2() { +hide_popup_dialog(); +delete session.progress; +if (!session.temp_password) session.temp_password = ''; +if (!session.username) session.username = ''; +var html = ''; +html += '
'; +html += '"; + second_cell = ""; + row = $("").attr("id", "s" + index).attr("class", "location_row").html(first_cell + second_cell); + $locationsDiv.append(row); + } + if (index === this.numSearchToDisplay) { + $locationsDiv.append(""); + return $locationsDiv.append(""); + } + }, this); + return this.geocoder.geocode({ + address: address + }, __bind(function(result, status) { + if (status !== "OK") { + $('.error_message').html(t("Search Address Failed")).fadeIn(); + return; + } + _.each(result, showResults); + $("#search_results").html($locationsDiv); + this.locationChange("search"); + this.searchResults = result; + return this.displaySearchLoc(); + }, this)); + }; + ClientsRequestView.prototype.mouseoverLocation = function(e) { + var $el, id, marker; + $el = $(e.currentTarget); + id = $el.attr("id").substring(1); + marker = this.markers[id]; + return marker.setAnimation(google.maps.Animation.BOUNCE); + }; + ClientsRequestView.prototype.mouseoutLocation = function(e) { + var $el, id, marker; + $el = $(e.currentTarget); + id = $el.attr("id").substring(1); + marker = this.markers[id]; + return marker.setAnimation(null); + }; + ClientsRequestView.prototype.searchLocation = function(e) { + e.preventDefault(); + $("#address").val($(e.currentTarget).html()); + return this.searchAddress(); + }; + ClientsRequestView.prototype.favoriteClick = function(e) { + var index, location; + e.preventDefault(); + $(".favorites").attr("href", ""); + index = $(e.currentTarget).removeAttr("href").attr("id"); + location = new google.maps.LatLng(USER.locations[index].latitude, USER.locations[index].longitude); + return this.panToLocation(location); + }; + ClientsRequestView.prototype.clickLocation = function(e) { + var id; + id = $(e.currentTarget).attr("id").substring(1); + return this.panToLocation(this.markers[id].getPosition()); + }; + ClientsRequestView.prototype.panToLocation = function(location) { + this.map.panTo(location); + this.map.setZoom(16); + return this.pickup_icon.setPosition(location); + }; + ClientsRequestView.prototype.locationLinkHandle = function(e) { + var panelName; + e.preventDefault(); + panelName = $(e.currentTarget).attr("id"); + return this.locationChange(panelName); + }; + ClientsRequestView.prototype.locationChange = function(type) { + $(".locations_link").attr("href", "").css("font-weight", "normal"); + switch (type) { + case "favorite": + $(".search_results").attr("href", ""); + $(".locations_link#favorite").removeAttr("href").css("font-weight", "bold"); + $("#search_results").hide(); + $("#favorite_results").fadeIn(); + return this.displayFavLoc(); + case "search": + $(".favorites").attr("href", ""); + $(".locations_link#search").removeAttr("href").css("font-weight", "bold"); + $("#favorite_results").hide(); + $("#search_results").fadeIn(); + return this.displaySearchLoc(); + } + }; + ClientsRequestView.prototype.rateTrip = function(e) { + var rating; + rating = $(e.currentTarget).attr("id"); + $(".stars").attr("src", "/web/img/star_inactive.png"); + return _(rating).times(function(index) { + return $(".stars#" + (index + 1)).attr("src", "/web/img/star_active.png"); + }); + }; + ClientsRequestView.prototype.pickupHandle = function(e) { + var $el, callback, message; + e.preventDefault(); + $el = $(e.currentTarget).find("span"); + switch ($el.html()) { + case t("Request Pickup"): + _.delay(this.requestRide, 3000); + $("#status_message").html(t("Sending pickup request...")); + $el.html(t("Cancel Pickup")).parent().attr("class", "button_red"); + this.pickup_icon.setDraggable(false); + this.map.panTo(this.pickup_icon.getPosition()); + return this.map.setZoom(18); + case t("Cancel Pickup"): + if (this.status === "ready") { + $el.html(t("Request Pickup")).parent().attr("class", "button_green"); + return this.pickup_icon.setDraggable(true); + } else { + callback = __bind(function(v, m, f) { + if (v) { + this.AskDispatch("PickupCanceledClient"); + return this.setStatus("ready"); + } + }, this); + message = t("Cancel Request Prompt"); + if (this.status === "arriving") { + message = 'Cancel Request Arrived Prompt'; + } + return $.prompt(message, { + buttons: { + Ok: true, + Cancel: false + }, + callback: callback + }); + } + } + }; + ClientsRequestView.prototype.requestRide = function() { + if ($("#pickupHandle").find("span").html() === t("Cancel Pickup")) { + this.AskDispatch("Pickup"); + return this.setStatus("searching"); + } + }; + ClientsRequestView.prototype.removeCabs = function() { + _.each(this.cabs, __bind(function(point) { + return point.setMap(null); + }, this)); + return this.cabs = []; + }; + ClientsRequestView.prototype.addToFavLoc = function(e) { + var $el, lat, lng, nickname; + e.preventDefault(); + $el = $(e.currentTarget); + $el.find(".error_message").html(""); + nickname = $el.find("#favLocNickname").val().toString(); + lat = $el.find("#pickupLat").val().toString(); + lng = $el.find("#pickupLng").val().toString(); + if (nickname.length < 3) { + $el.find(".error_message").html(t("Favorite Location Nickname Length Error")); + return; + } + this.ShowSpinner("submit"); + return $.ajax({ + type: 'POST', + url: API + "/locations", + dataType: 'json', + data: { + token: USER.token, + nickname: nickname, + latitude: lat, + longitude: lng + }, + success: __bind(function(data, textStatus, jqXHR) { + return $el.html(t("Favorite Location Save Succeeded")); + }, this), + error: __bind(function(jqXHR, textStatus, errorThrown) { + return $el.find(".error_message").html(t("Favorite Location Save Failed")); + }, this), + complete: __bind(function(data) { + return this.HideSpinner(); + }, this) + }); + }; + ClientsRequestView.prototype.showFavLoc = function(e) { + $(e.currentTarget).fadeOut(); + return $("#favLoc_form").fadeIn(); + }; + ClientsRequestView.prototype.selectInputText = function(e) { + e.currentTarget.focus(); + return e.currentTarget.select(); + }; + ClientsRequestView.prototype.displayFavLoc = function() { + var alphabet, bounds; + alphabet = "ABCDEFGHIJKLMNOPQRSTUVWXYZ"; + this.removeMarkers(); + bounds = new google.maps.LatLngBounds(); + _.each(USER.locations, __bind(function(location, index) { + var marker; + marker = new google.maps.Marker({ + position: new google.maps.LatLng(location.latitude, location.longitude), + map: this.map, + title: t("Favorite Location Title", { + id: alphabet != null ? alphabet[index] : void 0 + }), + icon: "https://www.google.com/mapfiles/marker" + alphabet[index] + ".png" + }); + this.markers.push(marker); + bounds.extend(marker.getPosition()); + return google.maps.event.addListener(marker, 'click', __bind(function() { + return this.pickup_icon.setPosition(marker.getPosition()); + }, this)); + }, this)); + this.pickup_icon.setPosition(_.first(this.markers).getPosition()); + return this.map.fitBounds(bounds); + }; + ClientsRequestView.prototype.displaySearchLoc = function() { + var alphabet; + alphabet = "ABCDEFGHIJKLMNOPQRSTUVWXYZ"; + this.removeMarkers(); + return _.each(this.searchResults, __bind(function(result, index) { + var marker; + if (index < this.numSearchToDisplay) { + marker = new google.maps.Marker({ + position: result.geometry.location, + map: this.map, + title: t("Search Location Title", { + id: alphabet != null ? alphabet[index] : void 0 + }), + icon: "https://www.google.com/mapfiles/marker" + alphabet[index] + ".png" + }); + this.markers.push(marker); + return this.panToLocation(result.geometry.location); + } + }, this)); + }; + ClientsRequestView.prototype.removeMarkers = function() { + _.each(this.markers, __bind(function(marker) { + return marker.setMap(null); + }, this)); + return this.markers = []; + }; + ClientsRequestView.prototype.AskDispatch = function(ask, options) { + var attrs, lowestETA, processData, showCab; + if (ask == null) { + ask = ""; + } + if (options == null) { + options = {}; + } + switch (ask) { + case "NearestCab": + attrs = { + latitude: this.pickup_icon.getPosition().lat(), + longitude: this.pickup_icon.getPosition().lng() + }; + lowestETA = 99999; + showCab = __bind(function(cab) { + var point; + point = new google.maps.Marker({ + position: new google.maps.LatLng(cab.latitude, cab.longitude), + map: this.map, + icon: this.cabMarker, + title: t("ETA Message", { + minutes: app.helpers.FormatSeconds(cab != null ? cab.eta : void 0, true) + }) + }); + if (cab.eta < lowestETA) { + lowestETA = cab.eta; + } + return this.cabs.push(point); + }, this); + processData = __bind(function(data, textStatus, jqXHR) { + if (this.status === "ready") { + this.removeCabs(); + if (data.sorry) { + $("#status_message").html(data.sorry).fadeIn(); + } else { + _.each(data.driverLocations, showCab); + $("#status_message").html(t("Nearest Cab Message", { + minutes: app.helpers.FormatSeconds(lowestETA, true) + })).fadeIn(); + } + if (Backbone.history.fragment === "!/request") { + return _.delay(this.showCabs, this.pollInterval); + } + } + }, this); + return this.AjaxCall(ask, processData, attrs); + case "StatusClient": + processData = __bind(function(data, textStatus, jqXHR) { + var bounds, cabLocation, locationSaved, point, userLocation; + if (data.messageType === "OK") { + switch (data.status) { + case "completed": + this.removeCabs(); + this.setStatus("rate"); + return this.fetchTripDetails(data.tripID); + case "open": + return this.setStatus("ready"); + case "begintrip": + this.setStatus("riding"); + cabLocation = new google.maps.LatLng(data.latitude, data.longitude); + this.removeCabs(); + this.pickup_icon.setMap(null); + point = new google.maps.Marker({ + position: cabLocation, + map: this.map, + icon: this.cabMarker + }); + this.cabs.push(point); + this.map.panTo(point.getPosition()); + $("#rideName").html(data.driverName); + $("#ridePhone").html(data.driverMobile); + $("#ride_address_wrapper").hide(); + if (Backbone.history.fragment === "!/request") { + return _.delay(this.AskDispatch, this.pollInterval, "StatusClient"); + } + break; + case "pending": + this.setStatus("searching"); + if (Backbone.history.fragment === "!/request") { + return _.delay(this.AskDispatch, this.pollInterval, "StatusClient"); + } + break; + case "accepted": + case "arrived": + if (data.status === "accepted") { + this.setStatus("waiting"); + $("#status_message").html(t("Arrival ETA Message", { + minutes: app.helpers.FormatSeconds(data.eta, true) + })); + } else { + this.setStatus("arriving"); + $("#status_message").html(t("Arriving Now Message")); + } + userLocation = new google.maps.LatLng(data.pickupLocation.latitude, data.pickupLocation.longitude); + cabLocation = new google.maps.LatLng(data.latitude, data.longitude); + this.pickup_icon.setPosition(userLocation); + this.removeCabs(); + $("#rideName").html(data.driverName); + $("#ridePhone").html(data.driverMobile); + if ($("#rideAddress").html() === "") { + locationSaved = false; + _.each(USER.locations, __bind(function(location) { + if (parseFloat(location.latitude) === parseFloat(data.pickupLocation.latitude) && parseFloat(location.longitude) === parseFloat(data.pickupLocation.longitude)) { + return locationSaved = true; + } + }, this)); + if (locationSaved) { + $("#addToFavButton").hide(); + } + $("#pickupLat").val(data.pickupLocation.latitude); + $("#pickupLng").val(data.pickupLocation.longitude); + this.geocoder.geocode({ + location: userLocation + }, __bind(function(result, status) { + $("#rideAddress").html(result[0].formatted_address); + return $("#favLocNickname").val("" + result[0].address_components[0].short_name + " " + result[0].address_components[1].short_name); + }, this)); + } + point = new google.maps.Marker({ + position: cabLocation, + map: this.map, + icon: this.cabMarker + }); + this.cabs.push(point); + bounds = bounds = new google.maps.LatLngBounds(); + bounds.extend(cabLocation); + bounds.extend(userLocation); + this.map.fitBounds(bounds); + if (Backbone.history.fragment === "!/request") { + return _.delay(this.AskDispatch, this.pollInterval, "StatusClient"); + } + } + } + }, this); + return this.AjaxCall(ask, processData); + case "Pickup": + attrs = { + latitude: this.pickup_icon.getPosition().lat(), + longitude: this.pickup_icon.getPosition().lng() + }; + processData = __bind(function(data, textStatus, jqXHR) { + if (data.messageType === "Error") { + return $("#status_message").html(data.description); + } else { + return this.AskDispatch("StatusClient"); + } + }, this); + return this.AjaxCall(ask, processData, attrs); + case "PickupCanceledClient": + processData = __bind(function(data, textStatus, jqXHR) { + if (data.messageType === "OK") { + return this.setStatus("ready"); + } else { + return $("#status_message").html(data.description); + } + }, this); + return this.AjaxCall(ask, processData, attrs); + case "RatingDriver": + attrs = { + rating: options.rating + }; + processData = __bind(function(data, textStatus, jqXHR) { + if (data.messageType === "OK") { + this.setStatus("init"); + } else { + $("status_message").html(t("Rating Driver Failed")); + } + return this.HideSpinner(); + }, this); + return this.AjaxCall(ask, processData, attrs); + case "Feedback": + attrs = { + message: options.message + }; + processData = __bind(function(data, textStatus, jqXHR) { + if (data.messageType === "OK") { + return alert("rated"); + } + }, this); + return this.AjaxCall(ask, processData, attrs); + } + }; + ClientsRequestView.prototype.AjaxCall = function(type, successCallback, attrs) { + if (attrs == null) { + attrs = {}; + } + _.extend(attrs, { + token: USER.token, + messageType: type, + app: "client", + version: "1.0.60", + device: "web" + }); + return $.ajax({ + type: 'POST', + url: DISPATCH + "/", + processData: false, + data: JSON.stringify(attrs), + success: successCallback, + dataType: 'json', + error: __bind(function(jqXHR, textStatus, errorThrown) { + $("#status_message").html(errorThrown); + return this.HideSpinner(); + }, this) + }); + }; + return ClientsRequestView; + })(); +}).call(this); +}, "views/clients/settings": function(exports, require, module) {(function() { + var clientsSettingsTemplate; + var __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }, __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + clientsSettingsTemplate = require('templates/clients/settings'); + exports.ClientsSettingsView = (function() { + __extends(ClientsSettingsView, UberView); + function ClientsSettingsView() { + this.render = __bind(this.render, this); + this.initialize = __bind(this.initialize, this); + ClientsSettingsView.__super__.constructor.apply(this, arguments); + } + ClientsSettingsView.prototype.id = 'settings_view'; + ClientsSettingsView.prototype.className = 'view_container'; + ClientsSettingsView.prototype.events = { + 'submit #profile_pic_form': 'processPicUpload', + 'click #submit_pic': 'processPicUpload', + 'click a.setting_change': "changeTab", + 'submit #edit_info_form': "submitInfo", + 'click #change_password': 'changePass' + }; + ClientsSettingsView.prototype.divs = { + 'info_div': "Information", + 'pic_div': "Picture" + }; + ClientsSettingsView.prototype.pageTitle = t("Settings") + " | " + t("Uber"); + ClientsSettingsView.prototype.tabTitle = { + 'info_div': t("Information"), + 'pic_div': t("Picture") + }; + ClientsSettingsView.prototype.initialize = function() { + return this.mixin(require('web-lib/mixins/i18n_phone_form').i18nPhoneForm); + }; + ClientsSettingsView.prototype.render = function(type) { + if (type == null) { + type = "info"; + } + this.RefreshUserInfo(__bind(function() { + var $el, alphabet; + this.delegateEvents(); + this.HideSpinner(); + alphabet = "ABCDEFGHIJKLMNOPQRSTUVWXYZ"; + $el = $(this.el); + $(this.el).html(clientsSettingsTemplate({ + type: type + })); + $el.find("#" + type + "_div").show(); + $el.find("a[href='" + type + "_div']").parent().addClass("active"); + return document.title = "" + this.tabTitle[type + '_div'] + " " + this.pageTitle; + }, this)); + this.delegateEvents(); + return this; + }; + ClientsSettingsView.prototype.changeTab = function(e) { + var $eTarget, $el, div, link, pageDiv, _i, _j, _len, _len2, _ref, _ref2; + e.preventDefault(); + $eTarget = $(e.currentTarget); + this.ClearGlobalStatus(); + $el = $(this.el); + _ref = $el.find(".setting_change"); + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + link = _ref[_i]; + $(link).parent().removeClass("active"); + } + $eTarget.parent().addClass("active"); + _ref2 = _.keys(this.divs); + for (_j = 0, _len2 = _ref2.length; _j < _len2; _j++) { + div = _ref2[_j]; + $el.find("#" + div).hide(); + } + pageDiv = $eTarget.attr('href'); + $el.find("#" + pageDiv).show(); + Backbone.history.navigate("!/settings/" + (this.divs[pageDiv].toLowerCase().replace(" ", "-")), false); + document.title = "" + this.tabTitle[pageDiv] + " " + this.pageTitle; + if (pageDiv === "loc_div") { + try { + google.maps.event.trigger(this.map, 'resize'); + return this.map.fitBounds(this.bounds); + } catch (_e) {} + } + }; + ClientsSettingsView.prototype.submitInfo = function(e) { + var $e, attrs, client, options; + $('#global_status').find('.success_message').text(''); + $('#global_status').find('.error_message').text(''); + $('.error_message').text(''); + e.preventDefault(); + $e = $(e.currentTarget); + attrs = $e.serializeToJson(); + attrs['mobile_country_id'] = this.$('#mobile_country_id').val(); + if (attrs['password'] === '') { + delete attrs['password']; + } + options = { + success: __bind(function(response) { + this.ShowSuccess(t("Information Update Succeeded")); + return this.RefreshUserInfo(); + }, this), + error: __bind(function(model, data) { + var errors; + if (data.status === 406) { + errors = JSON.parse(data.responseText); + return _.each(_.keys(errors), function(field) { + return $("#" + field).parent().find('span.error_message').text(errors[field]); + }); + } else { + return this.ShowError(t("Information Update Failed")); + } + }, this), + type: "PUT" + }; + client = new app.models.client({ + id: USER.id + }); + return client.save(attrs, options); + }; + ClientsSettingsView.prototype.changePass = function(e) { + e.preventDefault(); + $(e.currentTarget).hide(); + return $("#password").show(); + }; + ClientsSettingsView.prototype.processPicUpload = function(e) { + e.preventDefault(); + this.ShowSpinner("submit"); + return $.ajaxFileUpload({ + url: API + '/user_pictures', + secureuri: false, + fileElementId: 'picture', + data: { + token: USER.token + }, + dataType: 'json', + complete: __bind(function(data, status) { + this.HideSpinner(); + if (status === 'success') { + this.ShowSuccess(t("Picture Update Succeeded")); + return this.RefreshUserInfo(__bind(function() { + return $("#settingsProfPic").attr("src", USER.picture_url + ("?" + (Math.floor(Math.random() * 1000)))); + }, this)); + } else { + if (data.error) { + return this.ShowError(data.error); + } else { + return this.ShowError("Picture Update Failed"); + } + } + }, this) + }); + }; + return ClientsSettingsView; + })(); +}).call(this); +}, "views/clients/sign_up": function(exports, require, module) {(function() { + var clientsSignUpTemplate; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }, __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }; + clientsSignUpTemplate = require('templates/clients/sign_up'); + exports.ClientsSignUpView = (function() { + __extends(ClientsSignUpView, UberView); + function ClientsSignUpView() { + ClientsSignUpView.__super__.constructor.apply(this, arguments); + } + ClientsSignUpView.prototype.id = 'signup_view'; + ClientsSignUpView.prototype.className = 'view_container'; + ClientsSignUpView.prototype.initialize = function() { + this.mixin(require('web-lib/mixins/i18n_phone_form').i18nPhoneForm); + return $('#location_country').live('change', function() { + if (!$('#mobile').val()) { + return $('#mobile_country').find("option[value=" + ($(this).val()) + "]").attr('selected', 'selected').end().trigger('change'); + } + }); + }; + ClientsSignUpView.prototype.events = { + 'submit form': 'signup', + 'click button': 'signup', + 'change #card_number': 'showCardType', + 'change #location_country': 'countryChange' + }; + ClientsSignUpView.prototype.render = function(invite) { + this.HideSpinner(); + $(this.el).html(clientsSignUpTemplate({ + invite: invite + })); + return this; + }; + ClientsSignUpView.prototype.signup = function(e) { + var $el, attrs, client, error_messages, options; + e.preventDefault(); + $el = $("form"); + $el.find('#terms_error').hide(); + if (!$el.find('#signup_terms input[type=checkbox]').attr('checked')) { + $('#spinner.submit').hide(); + $el.find('#terms_error').show(); + return; + } + error_messages = $el.find('.error_message').html(""); + attrs = { + first_name: $el.find('#first_name').val(), + last_name: $el.find('#last_name').val(), + email: $el.find('#email').val(), + password: $el.find('#password').val(), + location_country: $el.find('#location_country option:selected').attr('data-iso2'), + location: $el.find('#location').val(), + language: $el.find('#language').val(), + mobile_country: $el.find('#mobile_country option:selected').attr('data-iso2'), + mobile: $el.find('#mobile').val(), + card_number: $el.find('#card_number').val(), + card_expiration_month: $el.find('#card_expiration_month').val(), + card_expiration_year: $el.find('#card_expiration_year').val(), + card_code: $el.find('#card_code').val(), + use_case: $el.find('#use_case').val(), + promotion_code: $el.find('#promotion_code').val() + }; + options = { + statusCode: { + 200: function(response) { + $.cookie('token', response.token); + amplify.store('USERjson', response); + app.refreshMenu(); + return app.routers.clients.navigate('!/dashboard', true); + }, + 406: function(e) { + var error, errors, _i, _len, _ref, _results; + errors = JSON.parse(e.responseText); + _ref = _.keys(errors); + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + error = _ref[_i]; + _results.push($('#' + error).parent().find('span').html($('#' + error).parent().find('span').html() + " " + errors[error])); + } + return _results; + } + }, + complete: __bind(function(response) { + return this.HideSpinner(); + }, this) + }; + client = new app.models.client; + $('.spinner#submit').show(); + return client.save(attrs, options); + }; + ClientsSignUpView.prototype.countryChange = function(e) { + var $e; + $e = $(e.currentTarget); + return $("#mobile_country").val($e.val()).trigger('change'); + }; + ClientsSignUpView.prototype.showCardType = function(e) { + var $el, reAmerica, reDiscover, reMaster, reVisa, validCard; + reVisa = /^4\d{3}-?\d{4}-?\d{4}-?\d{4}$/; + reMaster = /^5[1-5]\d{2}-?\d{4}-?\d{4}-?\d{4}$/; + reAmerica = /^6011-?\d{4}-?\d{4}-?\d{4}$/; + reDiscover = /^3[4,7]\d{13}$/; + $el = $("#card_logos_signup"); + validCard = false; + if (e.currentTarget.value.match(reVisa)) { + $el.find("#overlay_left").css('width', "0px"); + return $el.find("#overlay_right").css('width', "75%"); + } else if (e.currentTarget.value.match(reMaster)) { + $el.find("#overlay_left").css('width', "25%"); + return $el.find("#overlay_right").css('width', "50%"); + } else if (e.currentTarget.value.match(reAmerica)) { + $el.find("#overlay_left").css('width', "75%"); + $el.find("#overlay_right").css('width', "0px"); + return console.log("amex"); + } else if (e.currentTarget.value.match(reDiscover)) { + $el.find("#overlay_left").css('width', "50%"); + return $el.find("#overlay_right").css('width', "25%"); + } else { + $el.find("#overlay_left").css('width', "0px"); + return $el.find("#overlay_right").css('width', "0px"); + } + }; + return ClientsSignUpView; + })(); +}).call(this); +}, "views/clients/trip_detail": function(exports, require, module) {(function() { + var clientsTripDetailTemplate; + var __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }, __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + clientsTripDetailTemplate = require('templates/clients/trip_detail'); + exports.TripDetailView = (function() { + __extends(TripDetailView, UberView); + function TripDetailView() { + this.resendReceipt = __bind(this.resendReceipt, this); + TripDetailView.__super__.constructor.apply(this, arguments); + } + TripDetailView.prototype.id = 'trip_detail_view'; + TripDetailView.prototype.className = 'view_container'; + TripDetailView.prototype.events = { + 'click a#fare_review': 'showFareReview', + 'click #fare_review_hide': 'hideFareReview', + 'submit #form_review_form': 'submitFareReview', + 'click #submit_fare_review': 'submitFareReview', + 'click .resendReceipt': 'resendReceipt' + }; + TripDetailView.prototype.render = function(id) { + if (id == null) { + id = 'invalid'; + } + this.ReadUserInfo(); + this.HideSpinner(); + this.model = new app.models.trip({ + id: id + }); + this.model.fetch({ + data: { + relationships: 'points,driver,city.country' + }, + dataType: 'json', + success: __bind(function() { + var trip; + trip = this.model; + $(this.el).html(clientsTripDetailTemplate({ + trip: trip + })); + this.RequireMaps(__bind(function() { + var bounds, endPos, map, myOptions, path, polyline, startPos; + bounds = new google.maps.LatLngBounds(); + path = []; + _.each(this.model.get('points'), __bind(function(point) { + path.push(new google.maps.LatLng(point.lat, point.lng)); + return bounds.extend(_.last(path)); + }, this)); + myOptions = { + zoom: 12, + center: path[0], + mapTypeId: google.maps.MapTypeId.ROADMAP, + zoomControl: false, + rotateControl: false, + panControl: false, + mapTypeControl: false, + scrollwheel: false + }; + map = new google.maps.Map(document.getElementById("trip_details_map"), myOptions); + map.fitBounds(bounds); + startPos = new google.maps.Marker({ + position: _.first(path), + map: map, + title: t("Trip started here"), + icon: 'https://uber-static.s3.amazonaws.com/marker_start.png' + }); + endPos = new google.maps.Marker({ + position: _.last(path), + map: map, + title: t("Trip ended here"), + icon: 'https://uber-static.s3.amazonaws.com/marker_end.png' + }); + startPos.setMap(map); + endPos.setMap(map); + polyline = new google.maps.Polyline({ + path: path, + strokeColor: '#003F87', + strokeOpacity: 1, + strokeWeight: 5 + }); + return polyline.setMap(map); + }, this)); + return this.HideSpinner(); + }, this) + }); + this.ShowSpinner('load'); + this.delegateEvents(); + return this; + }; + TripDetailView.prototype.showFareReview = function(e) { + e.preventDefault(); + $('#fare_review_box').slideDown(); + return $('#fare_review').hide(); + }; + TripDetailView.prototype.hideFareReview = function(e) { + e.preventDefault(); + $('#fare_review_box').slideUp(); + return $('#fare_review').show(); + }; + TripDetailView.prototype.submitFareReview = function(e) { + var attrs, errorMessage, id, options; + e.preventDefault(); + errorMessage = $(".error_message"); + errorMessage.hide(); + id = $("#tripid").val(); + this.model = new app.models.trip({ + id: id + }); + attrs = { + note: $('#form_review_message').val(), + note_type: 'client_fare_review' + }; + options = { + success: __bind(function(response) { + $(".success_message").fadeIn(); + return $("#fare_review_form_wrapper").slideUp(); + }, this), + error: __bind(function(error) { + return errorMessage.fadeIn(); + }, this) + }; + return this.model.save(attrs, options); + }; + TripDetailView.prototype.resendReceipt = function(e) { + var $e; + e.preventDefault(); + $e = $(e.currentTarget); + this.$(".resendReceiptSuccess").empty().show(); + this.$(".resentReceiptError").empty().show(); + e.preventDefault(); + $('#spinner').show(); + return $.ajax('/api/trips/func/resend_receipt', { + data: { + token: $.cookie('token'), + trip_id: this.model.id + }, + type: 'POST', + complete: __bind(function(xhr) { + var response; + response = JSON.parse(xhr.responseText); + $('#spinner').hide(); + switch (xhr.status) { + case 200: + this.$(".resendReceiptSuccess").html("Receipt has been emailed"); + return this.$(".resendReceiptSuccess").fadeOut(2000); + default: + this.$(".resendReceiptError").html("Receipt has failed to be emailed"); + return this.$(".resendReceiptError").fadeOut(2000); + } + }, this) + }); + }; + return TripDetailView; + })(); +}).call(this); +}, "views/shared/menu": function(exports, require, module) {(function() { + var menuTemplate; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + menuTemplate = require('templates/shared/menu'); + exports.SharedMenuView = (function() { + __extends(SharedMenuView, Backbone.View); + function SharedMenuView() { + SharedMenuView.__super__.constructor.apply(this, arguments); + } + SharedMenuView.prototype.id = 'menu_view'; + SharedMenuView.prototype.render = function() { + var type; + if ($.cookie('token') === null) { + type = 'guest'; + } else { + type = 'client'; + } + $(this.el).html(menuTemplate({ + type: type + })); + return this; + }; + return SharedMenuView; + })(); +}).call(this); +}, "web-lib/collections/countries": function(exports, require, module) {(function() { + var UberCollection; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + UberCollection = require('web-lib/uber_collection').UberCollection; + exports.CountriesCollection = (function() { + __extends(CountriesCollection, UberCollection); + function CountriesCollection() { + CountriesCollection.__super__.constructor.apply(this, arguments); + } + CountriesCollection.prototype.model = app.models.country; + CountriesCollection.prototype.url = '/countries'; + return CountriesCollection; + })(); +}).call(this); +}, "web-lib/collections/vehicle_types": function(exports, require, module) {(function() { + var UberCollection, vehicleType, _ref; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + UberCollection = require('web-lib/uber_collection').UberCollection; + vehicleType = (typeof app !== "undefined" && app !== null ? (_ref = app.models) != null ? _ref.vehicleType : void 0 : void 0) || require('models/vehicle_type').VehicleType; + exports.VehicleTypesCollection = (function() { + __extends(VehicleTypesCollection, UberCollection); + function VehicleTypesCollection() { + VehicleTypesCollection.__super__.constructor.apply(this, arguments); + } + VehicleTypesCollection.prototype.model = vehicleType; + VehicleTypesCollection.prototype.url = '/vehicle_types'; + VehicleTypesCollection.prototype.defaultColumns = ['id', 'created_at', 'updated_at', 'deleted_at', 'created_by_user_id', 'updated_by_user_id', 'city_id', 'type', 'make', 'model', 'capacity', 'minimum_year', 'actions']; + VehicleTypesCollection.prototype.tableColumns = function(cols) { + var actions, c, capacity, city_id, columnValues, created_at, created_by_user_id, deleted_at, headerRow, id, make, minimum_year, model, type, updated_at, updated_by_user_id, _i, _len; + id = { + sTitle: 'Id' + }; + created_at = { + sTitle: 'Created At (UTC)', + 'sType': 'string' + }; + updated_at = { + sTitle: 'Updated At (UTC)', + 'sType': 'string' + }; + deleted_at = { + sTitle: 'Deleted At (UTC)', + 'sType': 'string' + }; + created_by_user_id = { + sTitle: 'Created By' + }; + updated_by_user_id = { + sTitle: 'Updated By' + }; + city_id = { + sTitle: 'City' + }; + type = { + sTitle: 'Type' + }; + make = { + sTitle: 'Make' + }; + model = { + sTitle: 'Model' + }; + capacity = { + sTitle: 'Capacity' + }; + minimum_year = { + sTitle: 'Min. Year' + }; + actions = { + sTitle: 'Actions' + }; + columnValues = { + id: id, + created_at: created_at, + updated_at: updated_at, + deleted_at: deleted_at, + created_by_user_id: created_by_user_id, + updated_by_user_id: updated_by_user_id, + city_id: city_id, + type: type, + make: make, + model: model, + capacity: capacity, + minimum_year: minimum_year, + actions: actions + }; + headerRow = []; + for (_i = 0, _len = cols.length; _i < _len; _i++) { + c = cols[_i]; + if (columnValues[c]) { + headerRow.push(columnValues[c]); + } + } + return headerRow; + }; + return VehicleTypesCollection; + })(); +}).call(this); +}, "web-lib/helpers": function(exports, require, module) {(function() { + var __indexOf = Array.prototype.indexOf || function(item) { + for (var i = 0, l = this.length; i < l; i++) { + if (this[i] === item) return i; + } + return -1; + }, __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }; + exports.helpers = { + pin: function(num, color) { + if (color == null) { + color = 'FF0000'; + } + return ""; + }, + reverseGeocode: function(latitude, longitude) { + if (latitude && longitude) { + return "" + latitude + ", " + longitude + ""; + } else { + return ''; + } + }, + linkedName: function(model) { + var first_name, id, last_name, role, url; + role = model.role || model.get('role'); + id = model.id || model.get('id'); + first_name = model.first_name || model.get('first_name'); + last_name = model.last_name || model.get('last_name'); + url = "/" + role + "s/" + id; + return "" + first_name + " " + last_name + ""; + }, + linkedVehicle: function(vehicle, vehicleType) { + return " " + (vehicleType != null ? vehicleType.get('make') : void 0) + " " + (vehicleType != null ? vehicleType.get('model') : void 0) + " " + (vehicle.get('year')) + " "; + }, + linkedUserId: function(userType, userId) { + return "" + userType + " " + userId + ""; + }, + timeDelta: function(start, end) { + var delta; + if (typeof start === 'string') { + start = this.parseDate(start); + } + if (typeof end === 'string') { + end = this.parseDate(end); + } + if (end && start) { + delta = end.getTime() - start.getTime(); + return this.formatSeconds(delta / 1000); + } else { + return '00:00'; + } + }, + formatSeconds: function(s) { + var minutes, seconds; + s = Math.floor(s); + minutes = Math.floor(s / 60); + seconds = s - minutes * 60; + return "" + (this.leadingZero(minutes)) + ":" + (this.leadingZero(seconds)); + }, + formatCurrency: function(strValue, reverseSign, currency) { + var currency_locale, lc, mf; + if (reverseSign == null) { + reverseSign = false; + } + if (currency == null) { + currency = null; + } + strValue = String(strValue); + if (reverseSign) { + strValue = ~strValue.indexOf('-') ? strValue.split('-').join('') : ['-', strValue].join(''); + } + currency_locale = i18n.currencyToLocale[currency]; + try { + if (!(currency_locale != null) || currency_locale === i18n.locale) { + return i18n.jsworld.mf.format(strValue); + } else { + lc = new jsworld.Locale(POSIX_LC[currency_locale]); + mf = new jsworld.MonetaryFormatter(lc); + return mf.format(strValue); + } + } catch (error) { + i18n.log(error); + return strValue; + } + }, + formatTripFare: function(trip, type) { + var _ref, _ref2; + if (type == null) { + type = "fare"; + } + if (!trip.get('fare')) { + return 'n/a'; + } + if (((_ref = trip.get('fare_breakdown_local')) != null ? _ref.currency : void 0) != null) { + return app.helpers.formatCurrency(trip.get("" + type + "_local"), false, (_ref2 = trip.get('fare_breakdown_local')) != null ? _ref2.currency : void 0); + } else if (trip.get("" + type + "_string") != null) { + return trip.get("" + type + "_string"); + } else if (trip.get("" + type + "_local") != null) { + return trip.get("" + type + "_local"); + } else { + return 'n/a'; + } + }, + formatPhoneNumber: function(phoneNumber, countryCode) { + if (countryCode == null) { + countryCode = "+1"; + } + if (phoneNumber != null) { + phoneNumber = String(phoneNumber); + switch (countryCode) { + case '+1': + return countryCode + ' ' + phoneNumber.substring(0, 3) + '-' + phoneNumber.substring(3, 6) + '-' + phoneNumber.substring(6, 10); + case '+33': + return countryCode + ' ' + phoneNumber.substring(0, 1) + ' ' + phoneNumber.substring(1, 3) + ' ' + phoneNumber.substring(3, 5) + ' ' + phoneNumber.substring(5, 7) + ' ' + phoneNumber.substring(7, 9); + default: + countryCode + phoneNumber; + } + } + return "" + countryCode + " " + phoneNumber; + }, + parseDate: function(d, cityTime, tz) { + var city_filter, parsed, _ref; + if (cityTime == null) { + cityTime = true; + } + if (tz == null) { + tz = null; + } + if (((_ref = !d.substr(-6, 1)) === '+' || _ref === '-') || d.length === 19) { + d += '+00:00'; + } + if (/(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2})/.test(d)) { + parsed = d.match(/(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2}):(\d{2})/); + d = new Date(); + d.setUTCFullYear(parsed[1]); + d.setUTCMonth(parsed[2] - 1); + d.setUTCDate(parsed[3]); + d.setUTCHours(parsed[4]); + d.setUTCMinutes(parsed[5]); + d.setUTCSeconds(parsed[6]); + } else { + d = Date.parse(d); + } + if (typeof d === 'number') { + d = new Date(d); + } + d = new timezoneJS.Date(d.getUTCFullYear(), d.getUTCMonth(), d.getUTCDate(), d.getUTCHours(), d.getUTCMinutes(), d.getUTCSeconds(), 'Etc/UTC'); + if (tz) { + d.convertToTimezone(tz); + } else if (cityTime) { + city_filter = $.cookie('city_filter'); + if (city_filter) { + tz = $("#city_filter option[value=" + city_filter + "]").attr('data-timezone'); + if (tz) { + d.convertToTimezone(tz); + } + } + } + return d; + }, + dateToTimezone: function(d) { + var city_filter, tz; + d = new timezoneJS.Date(d.getUTCFullYear(), d.getUTCMonth(), d.getUTCDate(), d.getUTCHours(), d.getUTCMinutes(), d.getUTCSeconds(), 'Etc/UTC'); + city_filter = $.cookie('city_filter'); + if (city_filter) { + tz = $("#city_filter option[value=" + city_filter + "]").attr('data-timezone'); + d.convertToTimezone(tz); + } + return d; + }, + fixAMPM: function(d, formatted) { + if (d.hours >= 12) { + return formatted.replace(/\b[AP]M\b/, 'PM'); + } else { + return formatted.replace(/\b[AP]M\b/, 'AM'); + } + }, + formatDate: function(d, time, timezone) { + var formatted; + if (time == null) { + time = true; + } + if (timezone == null) { + timezone = null; + } + d = this.parseDate(d, true, timezone); + formatted = time ? ("" + (i18n.jsworld.dtf.formatDate(d)) + " ") + this.formatTime(d, d.getTimezoneInfo()) : i18n.jsworld.dtf.formatDate(d); + return this.fixAMPM(d, formatted); + }, + formatDateLong: function(d, time, timezone) { + if (time == null) { + time = true; + } + if (timezone == null) { + timezone = null; + } + d = this.parseDate(d, true, timezone); + timezone = d.getTimezoneInfo().tzAbbr; + if (time) { + return (i18n.jsworld.dtf.formatDateTime(d)) + (" " + timezone); + } else { + return i18n.jsworld.dtf.formatDate(d); + } + }, + formatTimezoneJSDate: function(d) { + var day, hours, jsDate, minutes, month, year; + year = d.getFullYear(); + month = this.leadingZero(d.getMonth()); + day = this.leadingZero(d.getDate()); + hours = this.leadingZero(d.getHours()); + minutes = this.leadingZero(d.getMinutes()); + jsDate = new Date(year, month, day, hours, minutes, 0); + return jsDate.toDateString(); + }, + formatTime: function(d, timezone) { + var formatted; + if (timezone == null) { + timezone = null; + } + formatted = ("" + (i18n.jsworld.dtf.formatTime(d))) + (timezone != null ? " " + (timezone != null ? timezone.tzAbbr : void 0) : ""); + return this.fixAMPM(d, formatted); + }, + formatISODate: function(d) { + var pad; + pad = function(n) { + if (n < 10) { + return '0' + n; + } + return n; + }; + return d.getUTCFullYear() + '-' + pad(d.getUTCMonth() + 1) + '-' + pad(d.getUTCDate()) + 'T' + pad(d.getUTCHours()) + ':' + pad(d.getUTCMinutes()) + ':' + pad(d.getUTCSeconds()) + 'Z'; + }, + formatExpDate: function(d) { + var month, year; + d = this.parseDate(d); + year = d.getFullYear(); + month = this.leadingZero(d.getMonth() + 1); + return "" + year + "-" + month; + }, + formatLatLng: function(lat, lng, precision) { + if (precision == null) { + precision = 8; + } + return parseFloat(lat).toFixed(precision) + ',' + parseFloat(lng).toFixed(precision); + }, + leadingZero: function(num) { + if (num < 10) { + return "0" + num; + } else { + return num; + } + }, + roundNumber: function(num, dec) { + return Math.round(num * Math.pow(10, dec)) / Math.pow(10, dec); + }, + notesToHTML: function(notes) { + var i, note, notesHTML, _i, _len; + notesHTML = ''; + i = 1; + if (notes) { + for (_i = 0, _len = notes.length; _i < _len; _i++) { + note = notes[_i]; + notesHTML += "" + note['userid'] + "     " + (this.formatDate(note['created_at'])) + "

" + note['note'] + "

"; + notesHTML += "
"; + } + } + return notesHTML.replace("'", '"e'); + }, + formatPhone: function(n) { + var parts, phone, regexObj; + n = "" + n; + regexObj = /^(?:\+?1[-. ]?)?(?:\(?([0-9]{3})\)?[-. ]?)?([0-9]{3})[-. ]?([0-9]{4})$/; + if (regexObj.test(n)) { + parts = n.match(regexObj); + phone = ""; + if (parts[1]) { + phone += "(" + parts[1] + ") "; + } + phone += "" + parts[2] + "-" + parts[3]; + } else { + phone = n; + } + return phone; + }, + usStates: ['Alabama', 'Alaska', 'Arizona', 'Arkansas', 'California', 'Colorado', 'Connecticut', 'Delaware', 'District of Columbia', 'Florida', 'Georgia', 'Hawaii', 'Idaho', 'Illinois', 'Indiana', 'Iowa', 'Kansas', 'Kentucky', 'Louisiana', 'Maine', 'Maryland', 'Massachusetts', 'Michigan', 'Minnesota', 'Mississippi', 'Missouri', 'Montana', 'Nebraska', 'Nevada', 'New Hampshire', 'New Jersey', 'New Mexico', 'New York', 'North Carolina', 'North Dakota', 'Ohio', 'Oklahoma', 'Oregon', 'Pennsylvania', 'Rhode Island', 'South Carolina', 'South Dakota', 'Tennessee', 'Texas', 'Utah', 'Vermont', 'Virginia', 'Washington', 'West Virginia', 'Wisconsin', 'Wyoming'], + onboardingPages: ['applied', 'ready_to_interview', 'pending_interview', 'interviewed', 'accepted', 'ready_to_onboard', 'pending_onboarding', 'active', 'waitlisted', 'rejected'], + driverBreadCrumb: function(loc, model) { + var onboardingPage, out, _i, _len, _ref; + out = "Drivers > "; + if (!(model != null)) { + out += ""; + } else { + out += "" + (this.onboardingUrlToName(model.get('driver_status'))) + ""; + out += " > " + (this.linkedName(model)) + " (" + (model.get('role')) + ") #" + (model.get('id')); + } + return out; + }, + onboardingUrlToName: function(url) { + return url != null ? url.replace(/_/g, " ").replace(/(^|\s)([a-z])/g, function(m, p1, p2) { + return p1 + p2.toUpperCase(); + }) : void 0; + }, + formatVehicle: function(vehicle) { + if (vehicle.get('make') && vehicle.get('model') && vehicle.get('license_plate')) { + return "" + (vehicle.get('make')) + " " + (vehicle.get('model')) + " (" + (vehicle.get('license_plate')) + ")"; + } + }, + docArbitraryFields: function(docName, cityDocs) { + var doc, field, out, _i, _j, _len, _len2, _ref; + out = ""; + for (_i = 0, _len = cityDocs.length; _i < _len; _i++) { + doc = cityDocs[_i]; + if (doc.name === docName && __indexOf.call(_.keys(doc), "metaFields") >= 0) { + _ref = doc.metaFields; + for (_j = 0, _len2 = _ref.length; _j < _len2; _j++) { + field = _ref[_j]; + out += "" + field.label + ":
"; + } + } + } + return out; + }, + capitaliseFirstLetter: function(string) { + return string.charAt(0).toUpperCase() + string.slice(1); + }, + createDocUploadForm: function(docName, driverId, vehicleId, cityMeta, vehicleName, expirationRequired) { + var ddocs, expDropdowns, pdocs, vdocs; + if (driverId == null) { + driverId = "None"; + } + if (vehicleId == null) { + vehicleId = "None"; + } + if (cityMeta == null) { + cityMeta = []; + } + if (vehicleName == null) { + vehicleName = false; + } + if (expirationRequired == null) { + expirationRequired = false; + } + ddocs = cityMeta["driverRequiredDocs"] || []; + pdocs = cityMeta["partnerRequiredDocs"] || []; + vdocs = cityMeta["vehicleRequiredDocs"] || []; + expDropdowns = "Expiration Date:\n -\n"; + return " \n
\n \n \n \n\n
\n " + (vehicleName ? vehicleName : "") + " " + docName + "\n
\n\n
\n \n
\n\n
\n " + (expirationRequired ? expDropdowns : "") + "\n
\n\n
\n " + (app.helpers.docArbitraryFields(docName, _.union(ddocs, pdocs, vdocs))) + "\n
\n\n
\n \n
\n\n
\n"; + }, + countrySelector: function(name, options) { + var countries, countryCodePrefix, defaultOptions; + if (options == null) { + options = {}; + } + defaultOptions = { + selectedKey: 'telephone_code', + selectedValue: '+1', + silent: false + }; + _.extend(defaultOptions, options); + options = defaultOptions; + countries = new app.collections.countries(); + countries.fetch({ + data: { + limit: 300 + }, + success: function(countries) { + var $option, $select, country, selected, _i, _len, _ref; + selected = false; + _ref = countries.models || []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + country = _ref[_i]; + $select = $("select[name=" + name + "]"); + $option = $('').val(country.id).attr('data-iso2', country.get('iso2')).attr('data-prefix', country.get('telephone_code')).html(country.get('name')); + if (country.get(options.selectedKey) === options.selectedValue && !selected) { + selected = true; + $option.attr('selected', 'selected'); + } + $select.append($option); + } + if (selected && !options.silent) { + return $select.val(options.selected).trigger('change'); + } + } + }); + countryCodePrefix = options.countryCodePrefix ? "data-country-code-prefix='" + options.countryCodePrefix + "'" : ''; + return ""; + }, + missingDocsOnDriver: function(driver) { + var city, docsReq, documents, partnerDocs; + city = driver.get('city'); + documents = driver.get('documents'); + if ((city != null) && (documents != null)) { + docsReq = _.pluck(city != null ? city.get('meta')["driverRequiredDocs"] : void 0, "name"); + if (driver.get('role') === "partner") { + partnerDocs = _.pluck(city != null ? city.get('meta')["partnerRequiredDocs"] : void 0, "name"); + docsReq = _.union(docsReq, partnerDocs); + } + return _.reject(docsReq, __bind(function(doc) { + return __indexOf.call((documents != null ? documents.pluck("name") : void 0) || [], doc) >= 0; + }, this)); + } else { + return []; + } + } + }; +}).call(this); +}, "web-lib/i18n": function(exports, require, module) {(function() { + exports.i18n = { + defaultLocale: 'en_US', + cookieName: '_LOCALE_', + locales: { + 'en_US': "English (US)", + 'fr_FR': "Français" + }, + currencyToLocale: { + 'USD': 'en_US', + 'EUR': 'fr_FR' + }, + logglyKey: 'd2d5a9bc-7ebe-4538-a180-81e62c705b1b', + logglyHost: 'https://logs.loggly.com', + init: function() { + this.castor = new window.loggly({ + url: this.logglyHost + '/inputs/' + this.logglyKey + '?rt=1', + level: 'error' + }); + this.setLocale($.cookie(this.cookieName) || this.defaultLocale); + window.t = _.bind(this.t, this); + this.loadLocaleTranslations(this.locale); + if (!(this[this.defaultLocale] != null)) { + return this.loadLocaleTranslations(this.defaultLocale); + } + }, + loadLocaleTranslations: function(locale) { + var loadPaths, path, _i, _len, _results; + loadPaths = ['web-lib/translations/' + locale, 'web-lib/translations/' + locale.slice(0, 2), 'translations/' + locale, 'translations/' + locale.slice(0, 2)]; + _results = []; + for (_i = 0, _len = loadPaths.length; _i < _len; _i++) { + path = loadPaths[_i]; + locale = path.substring(path.lastIndexOf('/') + 1); + if (this[locale] == null) { + this[locale] = {}; + } + _results.push((function() { + try { + return _.extend(this[locale], require(path).translations); + } catch (error) { + + } + }).call(this)); + } + return _results; + }, + getLocale: function() { + return this.locale; + }, + setLocale: function(locale) { + var message, parts, _ref; + parts = locale.split('_'); + this.locale = parts[0].toLowerCase(); + if (parts.length > 1) { + this.locale += "_" + (parts[1].toUpperCase()); + } + if (this.locale) { + $.cookie(this.cookieName, this.locale, { + path: '/', + domain: '.uber.com' + }); + } + try { + ((_ref = this.jsworld) != null ? _ref : this.jsworld = {}).lc = new jsworld.Locale(POSIX_LC[this.locale]); + this.jsworld.mf = new jsworld.MonetaryFormatter(this.jsworld.lc); + this.jsworld.nf = new jsworld.NumericFormatter(this.jsworld.lc); + this.jsworld.dtf = new jsworld.DateTimeFormatter(this.jsworld.lc); + this.jsworld.np = new jsworld.NumericParser(this.jsworld.lc); + this.jsworld.mp = new jsworld.MonetaryParser(this.jsworld.lc); + return this.jsworld.dtp = new jsworld.DateTimeParser(this.jsworld.lc); + } catch (error) { + message = 'JsWorld error with locale: ' + this.locale; + return this.log({ + message: message, + error: error + }); + } + }, + getTemplate: function(id) { + var _ref, _ref2; + return ((_ref = this[this.locale]) != null ? _ref[id] : void 0) || ((_ref2 = this[this.locale.slice(0, 2)]) != null ? _ref2[id] : void 0); + }, + getTemplateDefault: function(id) { + var _ref, _ref2; + return ((_ref = this[this.defaultLocale]) != null ? _ref[id] : void 0) || ((_ref2 = this[this.defaultLocale.slice(0, 2)]) != null ? _ref2[id] : void 0); + }, + getTemplateOrDefault: function(id) { + return this.getTemplate(id) || this.getTemplateDefault(id); + }, + t: function(id, vars) { + var errStr, locale, template; + if (vars == null) { + vars = {}; + } + locale = this.getLocale(); + template = this.getTemplate(id); + if (template == null) { + if (/dev|test/.test(window.location.host)) { + template = "(?) " + id; + } else { + template = this.getTemplateDefault(id); + } + errStr = "Missing [" + locale + "] translation for [" + id + "] at [" + window.location.hash + "] - Default template is [" + template + "]"; + this.log({ + error: errStr, + locale: locale, + id: id, + defaultTemplate: template + }); + } + if (template) { + return _.template(template, vars); + } else { + return id; + } + }, + log: function(error) { + if (/dev/.test(window.location.host)) { + if ((typeof console !== "undefined" && console !== null ? console.log : void 0) != null) { + return console.log(error); + } + } else { + _.extend(error, { + host: window.location.host, + hash: window.location.hash + }); + return this.castor.error(JSON.stringify(error)); + } + } + }; +}).call(this); +}, "web-lib/mixins/i18n_phone_form": function(exports, require, module) {(function() { + exports.i18nPhoneForm = { + _events: { + 'change select[data-country-code-prefix]': 'setCountryCodePrefix' + }, + setCountryCodePrefix: function(e) { + var $el, prefix; + $el = $(e.currentTarget); + prefix = $el.find('option:selected').attr('data-prefix'); + return $("#" + ($el.attr('data-country-code-prefix'))).text(prefix); + } + }; +}).call(this); +}, "web-lib/models/country": function(exports, require, module) {(function() { + var UberModel; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + UberModel = require('web-lib/uber_model').UberModel; + exports.Country = (function() { + __extends(Country, UberModel); + function Country() { + Country.__super__.constructor.apply(this, arguments); + } + Country.prototype.url = function() { + if (this.id) { + return "/countries/" + this.id; + } else { + return '/countries'; + } + }; + return Country; + })(); +}).call(this); +}, "web-lib/models/vehicle_type": function(exports, require, module) {(function() { + var UberModel; + var __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }, __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + UberModel = require('web-lib/uber_model').UberModel; + exports.VehicleType = (function() { + __extends(VehicleType, UberModel); + function VehicleType() { + this.toString = __bind(this.toString, this); + VehicleType.__super__.constructor.apply(this, arguments); + } + VehicleType.prototype.endpoint = 'vehicle_types'; + VehicleType.prototype.toTableRow = function(cols) { + var actions, c, capacity, city_id, columnValues, created_at, created_by_user_id, deleted_at, id, make, minimum_year, model, rows, type, updated_at, updated_by_user_id, _i, _len, _ref; + id = "" + (this.get('id')) + ""; + if (this.get('created_at')) { + created_at = app.helpers.formatDate(this.get('created_at')); + } + if (this.get('updated_at')) { + updated_at = app.helpers.formatDate(this.get('updated_at')); + } + if (this.get('deleted_at')) { + deleted_at = app.helpers.formatDate(this.get('deleted_at')); + } + created_by_user_id = "" + (this.get('created_by_user_id')) + ""; + updated_by_user_id = "" + (this.get('updated_by_user_id')) + ""; + city_id = (_ref = this.get('city')) != null ? _ref.get('display_name') : void 0; + type = this.get('type'); + make = this.get('make'); + model = this.get('model'); + capacity = this.get('capacity'); + minimum_year = this.get('minimum_year'); + actions = "Show"; + if (!this.get('deleted_at')) { + actions += " Edit"; + actions += " Delete"; + } + columnValues = { + id: id, + created_at: created_at, + updated_at: updated_at, + deleted_at: deleted_at, + created_by_user_id: created_by_user_id, + updated_by_user_id: updated_by_user_id, + city_id: city_id, + type: type, + make: make, + model: model, + capacity: capacity, + minimum_year: minimum_year, + actions: actions + }; + rows = []; + for (_i = 0, _len = cols.length; _i < _len; _i++) { + c = cols[_i]; + rows.push(columnValues[c] ? columnValues[c] : '-'); + } + return rows; + }; + VehicleType.prototype.toString = function() { + return this.get('make') + ' ' + this.get('model') + ' ' + this.get('type') + (" (" + (this.get('capacity')) + ")"); + }; + return VehicleType; + })(); +}).call(this); +}, "web-lib/templates/footer": function(exports, require, module) {module.exports = function(__obj) { + if (!__obj) __obj = {}; + var __out = [], __capture = function(callback) { + var out = __out, result; + __out = []; + callback.call(this); + result = __out.join(''); + __out = out; + return __safe(result); + }, __sanitize = function(value) { + if (value && value.ecoSafe) { + return value; + } else if (typeof value !== 'undefined' && value != null) { + return __escape(value); + } else { + return ''; + } + }, __safe, __objSafe = __obj.safe, __escape = __obj.escape; + __safe = __obj.safe = function(value) { + if (value && value.ecoSafe) { + return value; + } else { + if (!(typeof value !== 'undefined' && value != null)) value = ''; + var result = new String(value); + result.ecoSafe = true; + return result; + } + }; + if (!__escape) { + __escape = __obj.escape = function(value) { + return ('' + value) + .replace(/&/g, '&') + .replace(//g, '>') + .replace(/"/g, '"'); + }; + } + (function() { + (function() { + var locale, title, _ref; + __out.push('
\n \n
\n
\n \n
\n
\n \n
\n
\n \n
\n
\n

'); + __out.push(t("Copyright © Uber Technologies, Inc.")); + __out.push('

\n

\n '); + __out.push(__sanitize(t('Language:'))); + __out.push('\n '); + _ref = typeof i18n !== "undefined" && i18n !== null ? i18n.locales : void 0; + for (locale in _ref) { + title = _ref[locale]; + __out.push('\n '); + if (locale === (typeof i18n !== "undefined" && i18n !== null ? i18n.getLocale() : void 0)) { + __out.push('\n '); + __out.push(__sanitize(title)); + __out.push('\n '); + } else { + __out.push('\n '); + __out.push(__sanitize(title)); + __out.push('\n '); + } + __out.push('\n '); + } + __out.push('\n

\n
\n'); + }).call(this); + + }).call(__obj); + __obj.safe = __objSafe, __obj.escape = __escape; + return __out.join(''); +}}, "web-lib/translations/en": function(exports, require, module) {(function() { + exports.translations = { + "Info": "Info", + "Learn More": "Learn More", + "Pricing": "Pricing", + "FAQ": "FAQ", + "Support": "Support", + "Support & FAQ": "Support & FAQ", + "Contact Us": "Contact Us", + "Jobs": "Jobs", + "Phones": "Phones", + "Text Message": "Text Message", + "iPhone": "iPhone", + "Android": "Android", + "Drivers": "Drivers", + "Apply": "Apply", + "Sign In": "Sign In", + "Social": "Social", + "Twitter": "Twitter", + "Facebook": "Facebook", + "Blog": "Blog", + "Legal": "Legal", + "Company_Footer": "Company", + "Privacy Policy": "Privacy Policy", + "Terms": "Terms", + "Copyright © Uber Technologies, Inc.": "Copyright © Uber Technologies, Inc.", + "Language:": "Language:", + "Apply to Drive": "Apply to Drive", + "Expiration": "Expiration", + "Fare": "Fare", + "Driver": "Driver ", + "Dashboard": "Dashboard", + "Forgot Password": "Forgot Password", + "Trip Details": "Trip Details", + "Save": "Save", + "Cancel": "Cancel", + "Edit": "Edit", + "Password": "Password", + "First Name": "First Name", + "Last Name": "Last Name", + "Email Address": "Email Address", + "Submit": "Submit", + "Mobile Number": "Mobile Number", + "Zip Code": "Zip Code", + "Sign Out": "Sign Out", + "Confirm Email Message": "Attempting to confirm email...", + "Upload": "Upload", + "Rating": "Rating", + "Pickup Time": "Pickup Time", + "2011": "2011", + "2012": "2012", + "2013": "2013", + "2014": "2014", + "2015": "2015", + "2016": "2016", + "2017": "2017", + "2018": "2018", + "2019": "2019", + "2020": "2020", + "2021": "2021", + "2022": "2022", + "01": "01", + "02": "02", + "03": "03", + "04": "04", + "05": "05", + "06": "06", + "07": "07", + "08": "08", + "09": "09", + "10": "10", + "11": "11", + "12": "12" + }; +}).call(this); +}, "web-lib/translations/fr": function(exports, require, module) {(function() { + exports.translations = { + "Info": "Info", + "Learn More": "En Savoir Plus", + "Pricing": "Calcul du Prix", + "Support & FAQ": "Aide & FAQ", + "Contact Us": "Contactez Nous", + "Jobs": "Emplois", + "Phones": "Téléphones", + "Text Message": "SMS", + "iPhone": "iPhone", + "Android": "Android", + "Apply to Drive": "Candidature Chauffeur", + "Sign In": "Connexion", + "Social": "Contact", + "Twitter": "Twitter", + "Facebook": "Facebook", + "Blog": "Blog", + "Privacy Policy": "Protection des Données Personelles", + "Terms": "Conditions Générales", + "Copyright © Uber Technologies, Inc.": "© Uber, Inc.", + "Language:": "Langue:", + "Forgot Password": "Mot de passe oublié", + "Company_Footer": "À Propos d'Uber", + "Expiration": "Expiration", + "Fare": "Tarif", + "Driver": "Chauffeur", + "Drivers": "Chauffeurs", + "Dashboard": "Tableau de bord", + "Forgot Password": "Mot de passe oublié", + "Forgot Password?": "Mot de passe oublié?", + "Trip Details": "Détails de la course", + "Save": "Enregistrer", + "Cancel": "Annuler", + "Edit": "Modifier", + "Password": "Mot de passe", + "First Name": "Prénom", + "Last Name": "Nom", + "Email Address": "E-mail", + "Submit": "Soumettre", + "Mobile Number": "Téléphone Portable", + "Zip Code": "Code Postal", + "Sign Out": "Se déconnecter", + "Confirm Email Message": "E-mail de confirmation", + "Upload": "Télécharger", + "Rating": "Notation", + "Pickup Time": "Heure de prise en charge", + "2011": "2011", + "2012": "2012", + "2013": "2013", + "2014": "2014", + "2015": "2015", + "2016": "2016", + "2017": "2017", + "2018": "2018", + "2019": "2019", + "2020": "2020", + "2021": "2021", + "2022": "2022", + "01": "01", + "02": "02", + "03": "03", + "04": "04", + "05": "05", + "06": "06", + "07": "07", + "08": "08", + "09": "09", + "10": "10", + "11": "11", + "12": "12" + }; +}).call(this); +}, "web-lib/uber_collection": function(exports, require, module) {(function() { + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + exports.UberCollection = (function() { + __extends(UberCollection, Backbone.Collection); + function UberCollection() { + UberCollection.__super__.constructor.apply(this, arguments); + } + UberCollection.prototype.parse = function(data) { + var model, tmp, _i, _in, _len, _out; + _in = data.resources || data; + _out = []; + if (data.meta) { + this.meta = data.meta; + } + for (_i = 0, _len = _in.length; _i < _len; _i++) { + model = _in[_i]; + tmp = new this.model; + tmp.set(tmp.parse(model)); + _out.push(tmp); + } + return _out; + }; + UberCollection.prototype.isRenderable = function() { + if (this.models.length) { + return true; + } + }; + UberCollection.prototype.toTableRows = function(cols) { + var tableRows; + tableRows = []; + _.each(this.models, function(model) { + return tableRows.push(model.toTableRow(cols)); + }); + return tableRows; + }; + return UberCollection; + })(); +}).call(this); +}, "web-lib/uber_model": function(exports, require, module) {(function() { + var __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }, __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }, __indexOf = Array.prototype.indexOf || function(item) { + for (var i = 0, l = this.length; i < l; i++) { + if (this[i] === item) return i; + } + return -1; + }; + exports.UberModel = (function() { + __extends(UberModel, Backbone.Model); + function UberModel() { + this.refetch = __bind(this.refetch, this); + this.fetch = __bind(this.fetch, this); + this.save = __bind(this.save, this); + this.parse = __bind(this.parse, this); + UberModel.__super__.constructor.apply(this, arguments); + } + UberModel.prototype.endpoint = 'set_api_endpoint_in_subclass'; + UberModel.prototype.refetchOptions = {}; + UberModel.prototype.url = function(type) { + var endpoint_path; + endpoint_path = "/" + this.endpoint; + if (this.get('id')) { + return endpoint_path + ("/" + (this.get('id'))); + } else { + return endpoint_path; + } + }; + UberModel.prototype.isRenderable = function() { + var i, key, value, _ref; + i = 0; + _ref = this.attributes; + for (key in _ref) { + if (!__hasProp.call(_ref, key)) continue; + value = _ref[key]; + if (this.attributes.hasOwnProperty(key)) { + i += 1; + } + if (i > 1) { + return true; + } + } + return !(i === 1); + }; + UberModel.prototype.parse = function(response) { + var attrs, key, model, models, _i, _j, _k, _len, _len2, _len3, _ref, _ref2; + if (typeof response === 'object') { + _ref = _.intersection(_.keys(app.models), _.keys(response)); + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + key = _ref[_i]; + if (response[key]) { + attrs = this.parse(response[key]); + if (typeof attrs === 'object') { + response[key] = new app.models[key](attrs); + } + } + } + _ref2 = _.intersection(_.keys(app.collections), _.keys(response)); + for (_j = 0, _len2 = _ref2.length; _j < _len2; _j++) { + key = _ref2[_j]; + models = response[key]; + if (_.isArray(models)) { + response[key] = new app.collections[key]; + for (_k = 0, _len3 = models.length; _k < _len3; _k++) { + model = models[_k]; + attrs = app.collections[key].prototype.model.prototype.parse(model); + response[key].add(new response[key].model(attrs)); + } + } + } + } + return response; + }; + UberModel.prototype.save = function(attributes, options) { + var attr, _i, _j, _len, _len2, _ref, _ref2; + if (options == null) { + options = {}; + } + _ref = _.intersection(_.keys(app.models), _.keys(this.attributes)); + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + attr = _ref[_i]; + if (typeof this.get(attr) === "object") { + this.unset(attr, { + silent: true + }); + } + } + _ref2 = _.intersection(_.keys(app.collections), _.keys(this.attributes)); + for (_j = 0, _len2 = _ref2.length; _j < _len2; _j++) { + attr = _ref2[_j]; + if (typeof this.get(attr) === "object") { + this.unset(attr, { + silent: true + }); + } + } + if ((options != null) && options.diff && (attributes != null) && attributes !== {}) { + attributes['id'] = this.get('id'); + attributes['token'] = this.get('token'); + this.clear({ + 'silent': true + }); + this.set(attributes, { + silent: true + }); + } + if (__indexOf.call(_.keys(options), "data") < 0 && __indexOf.call(_.keys(this.refetchOptions || {}), "data") >= 0) { + options.data = this.refetchOptions.data; + } + return Backbone.Model.prototype.save.call(this, attributes, options); + }; + UberModel.prototype.fetch = function(options) { + this.refetchOptions = options; + return Backbone.Model.prototype.fetch.call(this, options); + }; + UberModel.prototype.refetch = function() { + return this.fetch(this.refetchOptions); + }; + return UberModel; + })(); +}).call(this); +}, "web-lib/uber_router": function(exports, require, module) {(function() { + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + exports.UberRouter = (function() { + __extends(UberRouter, Backbone.Router); + function UberRouter() { + UberRouter.__super__.constructor.apply(this, arguments); + } + UberRouter.prototype.datePickers = function(format) { + if (format == null) { + format = "%Z-%m-%dT%H:%i:%s%:"; + } + $('.datepicker').AnyTime_noPicker(); + return $('.datepicker').AnyTime_picker({ + 'format': format, + 'formatUtcOffset': '%@' + }); + }; + UberRouter.prototype.autoGrowInput = function() { + return $('.editable input').autoGrowInput(); + }; + UberRouter.prototype.windowTitle = function(title) { + return $(document).attr('title', title); + }; + return UberRouter; + })(); +}).call(this); +}, "web-lib/uber_show_view": function(exports, require, module) {(function() { + var UberView; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }, __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }; + UberView = require('web-lib/uber_view').UberView; + exports.UberShowView = (function() { + __extends(UberShowView, UberView); + function UberShowView() { + UberShowView.__super__.constructor.apply(this, arguments); + } + UberShowView.prototype.view = 'show'; + UberShowView.prototype.events = { + 'click #edit': 'edit', + 'submit form': 'save', + 'click .cancel': 'cancel' + }; + UberShowView.prototype.errors = null; + UberShowView.prototype.showTemplate = null; + UberShowView.prototype.editTemplate = null; + UberShowView.prototype.initialize = function() { + if (this.init_hook) { + this.init_hook(); + } + _.bindAll(this, 'render'); + return this.model.bind('change', this.render); + }; + UberShowView.prototype.render = function() { + var $el; + $el = $(this.el); + this.selectView(); + if (this.view === 'show') { + $el.html(this.showTemplate({ + model: this.model + })); + } else if (this.view === 'edit') { + $el.html(this.editTemplate({ + model: this.model, + errors: this.errors || {}, + collections: this.collections || {} + })); + } else { + $el.html(this.newTemplate({ + model: this.model, + errors: this.errors || {}, + collections: this.collections || {} + })); + } + if (this.render_hook) { + this.render_hook(); + } + this.errors = null; + this.userIdsToLinkedNames(); + this.datePickers(); + return this.place(); + }; + UberShowView.prototype.selectView = function() { + var url; + if (this.options.urlRendering) { + url = window.location.hash; + if (url.match(/\/new/)) { + return this.view = 'new'; + } else if (url.match(/\/edit/)) { + return this.view = 'edit'; + } else { + return this.view = 'show'; + } + } + }; + UberShowView.prototype.edit = function(e) { + e.preventDefault(); + if (this.options.urlRendering) { + window.location.hash = '#/' + this.model.endpoint + '/' + this.model.get('id') + '/edit'; + } else { + this.view = 'edit'; + } + return this.model.change(); + }; + UberShowView.prototype.save = function(e) { + var attributes, ele, form_attrs, _i, _len, _ref; + e.preventDefault(); + attributes = $(e.currentTarget).serializeToJson(); + form_attrs = {}; + _ref = $('input[type="radio"]'); + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + ele = _ref[_i]; + if ($(ele).is(':checked')) { + form_attrs[$(ele).attr('name')] = $(ele).attr('value'); + } + } + attributes = _.extend(attributes, form_attrs); + if (this.relationships) { + attributes = _.extend(attributes, { + relationships: this.relationships + }); + } + if (this.filter_attributes != null) { + this.filter_attributes(attributes); + } + return this.model.save(attributes, { + silent: true, + success: __bind(function(model) { + if (this.options.urlRendering) { + window.location.hash = '#/' + this.model.endpoint + '/' + this.model.get('id'); + } else { + this.view = 'show'; + } + return this.flash('success', "Uber save!"); + }, this), + statusCode: { + 406: __bind(function(xhr) { + this.errors = JSON.parse(xhr.responseText); + return this.flash('error', 'That was not Uber.'); + }, this) + }, + error: __bind(function(model, xhr) { + var code, message, responseJSON, responseText; + code = xhr.status; + responseText = xhr.responseText; + if (responseText) { + responseJSON = JSON.parse(responseText); + } + if (responseJSON && (typeof responseJSON === 'object') && (responseJSON.hasOwnProperty('error'))) { + message = responseJSON.error; + } + return this.flash('error', (code || 'Unknown') + ' error' + (': ' + message || '')); + }, this), + complete: __bind(function() { + return this.model.change(); + }, this) + }); + }; + UberShowView.prototype.cancel = function(e) { + e.preventDefault(); + if (this.options.urlRendering) { + window.location.hash = '#/' + this.model.endpoint + '/' + this.model.get('id'); + } else { + this.view = 'show'; + } + return this.model.fetch({ + silent: true, + complete: __bind(function() { + return this.model.change(); + }, this) + }); + }; + return UberShowView; + })(); +}).call(this); +}, "web-lib/uber_sync": function(exports, require, module) {(function() { + var methodType; + var __indexOf = Array.prototype.indexOf || function(item) { + for (var i = 0, l = this.length; i < l; i++) { + if (this[i] === item) return i; + } + return -1; + }; + methodType = { + create: 'POST', + update: 'PUT', + "delete": 'DELETE', + read: 'GET' + }; + exports.UberSync = function(method, model, options) { + var token; + options.type = methodType[method]; + options.url = _.isString(this.url) ? '/api' + this.url : '/api' + this.url(options.type); + options.data = _.extend({}, options.data); + if (__indexOf.call(_.keys(options.data), "city_id") < 0) { + if ($.cookie('city_filter')) { + _.extend(options.data, { + city_id: $.cookie('city_filter') + }); + } + } else { + delete options.data['city_id']; + } + if (options.type === 'POST' || options.type === 'PUT') { + _.extend(options.data, model.toJSON()); + } + token = $.cookie('token') ? $.cookie('token') : typeof USER !== "undefined" && USER !== null ? USER.get('token') : ""; + _.extend(options.data, { + token: token + }); + if (method === "delete") { + options.contentType = 'application/json'; + options.data = JSON.stringify(options.data); + } + return $.ajax(options); + }; +}).call(this); +}, "web-lib/uber_view": function(exports, require, module) {(function() { + var __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }, __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + exports.UberView = (function() { + __extends(UberView, Backbone.View); + function UberView() { + this.processDocumentUpload = __bind(this.processDocumentUpload, this); + UberView.__super__.constructor.apply(this, arguments); + } + UberView.prototype.className = 'view_container'; + UberView.prototype.hashId = function() { + return parseInt(location.hash.split('/')[2]); + }; + UberView.prototype.place = function(content) { + var $target; + $target = this.options.scope ? this.options.scope.find(this.options.selector) : $(this.options.selector); + $target[this.options.method || 'html'](content || this.el); + this.delegateEvents(); + $('#spinner').hide(); + return this; + }; + UberView.prototype.mixin = function(m, args) { + var events, self; + if (args == null) { + args = {}; + } + self = this; + events = m._events; + _.extend(this, m); + if (m.initialize) { + m.initialize(self, args); + } + return _.each(_.keys(events), function(key) { + var event, func, selector, split; + split = key.split(' '); + event = split[0]; + selector = split[1]; + func = events[key]; + return $(self.el).find(selector).live(event, function(e) { + return self[func](e); + }); + }); + }; + UberView.prototype.datePickers = function(format) { + if (format == null) { + format = "%Z-%m-%dT%H:%i:%s%:"; + } + $('.datepicker').AnyTime_noPicker(); + return $('.datepicker').AnyTime_picker({ + 'format': format, + 'formatUtcOffset': '%@' + }); + }; + UberView.prototype.dataTable = function(collection, selector, options, params, cols) { + var defaults; + if (selector == null) { + selector = 'table'; + } + if (options == null) { + options = {}; + } + if (params == null) { + params = {}; + } + if (cols == null) { + cols = []; + } + $(selector).empty(); + if (!cols.length) { + cols = collection.defaultColumns; + } + defaults = { + aoColumns: collection.tableColumns(cols), + bDestroy: true, + bSort: false, + bProcessing: true, + bFilter: false, + bServerSide: true, + bPaginate: true, + bScrollInfinite: true, + bScrollCollapse: true, + sScrollY: '600px', + iDisplayLength: 50, + fnServerData: function(source, data, callback) { + var defaultParams; + defaultParams = { + limit: data[4].value, + offset: data[3].value + }; + return collection.fetch({ + data: _.extend(defaultParams, params), + success: function() { + return callback({ + aaData: collection.toTableRows(cols), + iTotalRecords: collection.meta.count, + iTotalDisplayRecords: collection.meta.count + }); + }, + error: function() { + return new Error({ + message: 'Loading error.' + }); + } + }); + }, + fnRowCallback: function(nRow, aData, iDisplayIndex, iDisplayIndexFull) { + $('[data-tooltip]', nRow).qtip({ + content: { + attr: 'data-tooltip' + }, + style: { + classes: "ui-tooltip-light ui-tooltip-rounded ui-tooltip-shadow" + } + }); + return nRow; + } + }; + return $(this.el).find(selector).dataTable(_.extend(defaults, options)); + }; + UberView.prototype.dataTableLocal = function(collection, selector, options, params, cols) { + var $dataTable, defaults; + if (selector == null) { + selector = 'table'; + } + if (options == null) { + options = {}; + } + if (params == null) { + params = {}; + } + if (cols == null) { + cols = []; + } + $(selector).empty(); + if (!cols.length || cols.length === 0) { + cols = collection.defaultColumns; + } + defaults = { + aaData: collection.toTableRows(cols), + aoColumns: collection.tableColumns(cols), + bDestroy: true, + bSort: false, + bProcessing: true, + bFilter: false, + bScrollInfinite: true, + bScrollCollapse: true, + sScrollY: '600px', + iDisplayLength: -1 + }; + $dataTable = $(this.el).find(selector).dataTable(_.extend(defaults, options)); + _.delay(__bind(function() { + if ($dataTable && $dataTable.length > 0) { + return $dataTable.fnAdjustColumnSizing(); + } + }, this), 1); + return $dataTable; + }; + UberView.prototype.reverseGeocode = function() { + var $el; + return ''; + $el = $(this.el); + return this.requireMaps(function() { + var geocoder; + geocoder = new google.maps.Geocoder(); + return $el.find('[data-point]').each(function() { + var $this, latLng, point; + $this = $(this); + point = JSON.parse($this.attr('data-point')); + latLng = new google.maps.LatLng(point.latitude, point.longitude); + return geocoder.geocode({ + latLng: latLng + }, function(data, status) { + if (status === google.maps.GeocoderStatus.OK) { + return $this.text(data[0].formatted_address); + } + }); + }); + }); + }; + UberView.prototype.userIdsToLinkedNames = function() { + var $el; + $el = $(this.el); + return $el.find('a[data-user-id][data-user-type]').each(function() { + var $this, user, userType; + $this = $(this); + userType = $this.attr('data-user-type') === 'user' ? 'client' : $this.attr('data-user-type'); + user = new app.models[userType]({ + id: $this.attr('data-user-id') + }); + return user.fetch({ + success: function(user) { + return $this.html(app.helpers.linkedName(user)).attr('href', "!/" + user.role + "s/" + user.id); + }, + error: function() { + if ($this.attr('data-user-type') === 'user') { + user = new app.models['driver']({ + id: $this.attr('data-user-id') + }); + return user.fetch({ + success: function(user) { + return $this.html(app.helpers.linkedName(user)).attr('href', "!/driver/" + user.id); + } + }); + } + } + }); + }); + }; + UberView.prototype.selectedCity = function() { + var $selected, city, cityFilter; + cityFilter = $.cookie('city_filter'); + $selected = $("#city_filter option[value=" + cityFilter + "]"); + if (city_filter && $selected.length) { + return city = { + lat: parseFloat($selected.attr('data-lat')), + lng: parseFloat($selected.attr('data-lng')), + timezone: $selected.attr('data-timezone') + }; + } else { + return city = { + lat: 37.775, + lng: -122.45, + timezone: 'Etc/UTC' + }; + } + }; + UberView.prototype.updateModel = function(e, success) { + var $el, attrs, model, self; + e.preventDefault(); + $el = $(e.currentTarget); + self = this; + model = new this.model.__proto__.constructor({ + id: this.model.id + }); + attrs = {}; + $el.find('[name]').each(function() { + var $this; + $this = $(this); + return attrs["" + ($this.attr('name'))] = $this.val(); + }); + self.model.set(attrs); + $el.find('span.error').text(''); + return model.save(attrs, { + complete: function(xhr) { + var response; + response = JSON.parse(xhr.responseText); + switch (xhr.status) { + case 200: + self.model = model; + $el.find('[name]').val(''); + if (success) { + return success(); + } + break; + case 406: + return _.each(response, function(error, field) { + return $el.find("[name=" + field + "]").parent().find('span.error').text(error); + }); + default: + return this.unanticipatedError(response); + } + } + }); + }; + UberView.prototype.autoUpdateModel = function(e) { + var $el, arg, model, self, val; + $el = $(e.currentTarget); + val = $el.val(); + self = this; + if (val !== this.model.get($el.attr('id'))) { + arg = {}; + arg[$el.attr('id')] = $el.is(':checkbox') ? $el.is(':checked') ? 1 : 0 : val; + $('.editable span').empty(); + this.model.set(arg); + model = new this.model.__proto__.constructor({ + id: this.model.id + }); + return model.save(arg, { + complete: function(xhr) { + var key, response, _i, _len, _ref, _results; + response = JSON.parse(xhr.responseText); + switch (xhr.status) { + case 200: + self.flash('success', 'Saved!'); + return $el.blur(); + case 406: + self.flash('error', 'That was not Uber.'); + _ref = _.keys(response); + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + key = _ref[_i]; + _results.push($el.parent().find('span').html(response[key])); + } + return _results; + break; + default: + return self.unanticipatedError; + } + } + }); + } + }; + UberView.prototype.unanticipatedError = function(response) { + return self.flash('error', response); + }; + UberView.prototype.flash = function(type, text) { + var $banner; + $banner = $("." + type); + $banner.find('p').text(text).end().css('border', '1px solid #999').animate({ + top: 0 + }, 500); + return setTimeout(function() { + return $banner.animate({ + top: -$banner.outerHeight() + }, 500); + }, 3000); + }; + UberView.prototype.requireMaps = function(callback) { + if (typeof google !== 'undefined' && google.maps) { + return callback(); + } else { + return $.getScript("https://www.google.com/jsapi?key=" + CONFIG.googleJsApiKey, function() { + return google.load('maps', 3, { + callback: callback, + other_params: 'sensor=false&language=en' + }); + }); + } + }; + UberView.prototype.select_drop_down = function(model, key) { + var value; + value = model.get(key); + if (value) { + return $("select[id='" + key + "'] option[value='" + value + "']").attr('selected', 'selected'); + } + }; + UberView.prototype.processDocumentUpload = function(e) { + var $fi, $form, arbData, curDate, data, expDate, expM, expY, expiration, fileElementId, invalid; + e.preventDefault(); + $form = $(e.currentTarget); + $fi = $("input[type=file]", $form); + $(".validationError").removeClass("validationError"); + if (!$fi.val()) { + return $fi.addClass("validationError"); + } else { + fileElementId = $fi.attr('id'); + expY = $("select[name=expiration-year]", $form).val(); + expM = $("select[name=expiration-month]", $form).val(); + invalid = false; + if (expY && expM) { + expDate = new Date(expY, expM, 28); + curDate = new Date(); + if (expDate < curDate) { + invalid = true; + $(".expiration", $form).addClass("validationError"); + } + expiration = "" + expY + "-" + expM + "-28T23:59:59Z"; + } + arbData = {}; + $(".arbitraryField", $form).each(__bind(function(i, e) { + arbData[$(e).attr('name')] = $(e).val(); + if ($(e).val() === "") { + invalid = true; + return $(e).addClass("validationError"); + } + }, this)); + if (!invalid) { + data = { + token: $.cookie('token') || USER.get('token'), + name: $("input[name=fileName]", $form).val(), + meta: escape(JSON.stringify(arbData)), + user_id: $("input[name=driver_id]", $form).val(), + vehicle_id: $("input[name=vehicle_id]", $form).val() + }; + if (expiration) { + data['expiration'] = expiration; + } + $("#spinner").show(); + return $.ajaxFileUpload({ + url: '/api/documents', + secureuri: false, + fileElementId: fileElementId, + data: data, + complete: __bind(function(resp, status) { + var key, _i, _len, _ref, _results; + $("#spinner").hide(); + if (status === "success") { + if (this.model) { + this.model.refetch(); + } else { + USER.refetch(); + } + } + if (status === "error") { + _ref = _.keys(resp); + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + key = _ref[_i]; + _results.push($("*[name=" + key + "]", $form).addClass("validationError")); + } + return _results; + } + }, this) + }); + } + } + }; + return UberView; + })(); +}).call(this); +}, "web-lib/views/footer": function(exports, require, module) {(function() { + var footerTemplate; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + footerTemplate = require('web-lib/templates/footer'); + exports.SharedFooterView = (function() { + __extends(SharedFooterView, Backbone.View); + function SharedFooterView() { + SharedFooterView.__super__.constructor.apply(this, arguments); + } + SharedFooterView.prototype.id = 'footer_view'; + SharedFooterView.prototype.events = { + 'click .language': 'intl_set_cookie_locale' + }; + SharedFooterView.prototype.render = function() { + $(this.el).html(footerTemplate()); + this.delegateEvents(); + return this; + }; + SharedFooterView.prototype.intl_set_cookie_locale = function(e) { + var _ref; + i18n.setLocale(e != null ? (_ref = e.srcElement) != null ? _ref.id : void 0 : void 0); + return location.reload(); + }; + return SharedFooterView; + })(); +}).call(this); +}}); diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/embed-tokens.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/embed-tokens.js new file mode 100644 index 0000000..61307ee --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/embed-tokens.js @@ -0,0 +1,15 @@ +#! /usr/bin/env node + +global.sys = require(/^v0\.[012]/.test(process.version) ? "sys" : "util"); +var fs = require("fs"); +var uglify = require("uglify-js"), // symlink ~/.node_libraries/uglify-js.js to ../uglify-js.js + jsp = uglify.parser, + pro = uglify.uglify; + +var code = fs.readFileSync("embed-tokens.js", "utf8").replace(/^#.*$/mg, ""); +var ast = jsp.parse(code, null, true); + +// trololo +function fooBar() {} + +console.log(sys.inspect(ast, null, null)); diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/goto.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/goto.js new file mode 100644 index 0000000..945960c --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/goto.js @@ -0,0 +1,26 @@ +function unique(arqw) { + var a = [], i, j + outer: for (i = 0; i < arqw.length; i++) { + for (j = 0; j < a.length; j++) { + if (a[j] == arqw[i]) { + continue outer + } + } + a[a.length] = arqw[i] + } + return a +} + + +function unique(arqw) { + var crap = [], i, j + outer: for (i = 0; i < arqw.length; i++) { + for (j = 0; j < crap.length; j++) { + if (crap[j] == arqw[i]) { + continue outer + } + } + crap[crap.length] = arqw[i] + } + return crap +} diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/goto2.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/goto2.js new file mode 100644 index 0000000..d13b2bc --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/goto2.js @@ -0,0 +1,8 @@ +function q(qooo) { + var a; + foo: for(;;) { + a++; + if (something) break foo; + return qooo; + } +} diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/hoist.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/hoist.js new file mode 100644 index 0000000..4bf2b94 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/hoist.js @@ -0,0 +1,33 @@ +function foo(arg1, arg2, arg3, arg4, arg5, arg6) { + var a = 5; + { + var d = 10, mak = 20, buz = 30; + var q = buz * 2; + } + if (moo) { + var a, b, c; + } + for (var arg1 = 0, d = 20; arg1 < 10; ++arg1) + console.log(arg3); + for (var i in mak) {} + for (j in d) {} + var d; + + function test() { + + }; + + //test(); + + (function moo(first, second){ + console.log(first); + })(1); + + (function moo(first, second){ + console.log(moo()); + })(1); +} + + +var foo; +var bar; diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/instrument.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/instrument.js new file mode 100644 index 0000000..c6a9d79 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/instrument.js @@ -0,0 +1,97 @@ +// sample on how to use the parser and walker API to instrument some code + +var jsp = require("uglify-js").parser; +var pro = require("uglify-js").uglify; + +function instrument(code) { + var ast = jsp.parse(code, false, true); // true for the third arg specifies that we want + // to have start/end tokens embedded in the + // statements + var w = pro.ast_walker(); + + // we're gonna need this to push elements that we're currently looking at, to avoid + // endless recursion. + var analyzing = []; + function do_stat() { + var ret; + if (this[0].start && analyzing.indexOf(this) < 0) { + // without the `analyzing' hack, w.walk(this) would re-enter here leading + // to infinite recursion + analyzing.push(this); + ret = [ "splice", // XXX: "block" is safer + [ [ "stat", + [ "call", [ "name", "trace" ], + [ [ "string", this[0].toString() ], + [ "num", this[0].start.line ], + [ "num", this[0].start.col ], + [ "num", this[0].end.line ], + [ "num", this[0].end.col ]]]], + w.walk(this) ]]; + analyzing.pop(this); + } + return ret; + }; + var new_ast = w.with_walkers({ + "stat" : do_stat, + "label" : do_stat, + "break" : do_stat, + "continue" : do_stat, + "debugger" : do_stat, + "var" : do_stat, + "const" : do_stat, + "return" : do_stat, + "throw" : do_stat, + "try" : do_stat, + "defun" : do_stat, + "if" : do_stat, + "while" : do_stat, + "do" : do_stat, + "for" : do_stat, + "for-in" : do_stat, + "switch" : do_stat, + "with" : do_stat + }, function(){ + return w.walk(ast); + }); + return pro.gen_code(new_ast, { beautify: true }); +} + + + + +////// test code follows. + +var code = instrument(test.toString()); +console.log(code); + +function test() { + // simple stats + a = 5; + c += a + b; + "foo"; + + // var + var foo = 5; + const bar = 6, baz = 7; + + // switch block. note we can't track case lines the same way. + switch ("foo") { + case "foo": + return 1; + case "bar": + return 2; + } + + // for/for in + for (var i = 0; i < 5; ++i) { + console.log("Hello " + i); + } + for (var i in [ 1, 2, 3]) { + console.log(i); + } + + // note however that the following is broken. I guess we + // should add the block brackets in this case... + for (var i = 0; i < 5; ++i) + console.log("foo"); +} diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/instrument2.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/instrument2.js new file mode 100644 index 0000000..6aee5f3 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/instrument2.js @@ -0,0 +1,138 @@ +// sample on how to use the parser and walker API to instrument some code + +var jsp = require("uglify-js").parser; +var pro = require("uglify-js").uglify; + +function instrument(code) { + var ast = jsp.parse(code, false, true); // true for the third arg specifies that we want + // to have start/end tokens embedded in the + // statements + var w = pro.ast_walker(); + + function trace (line, comment) { + var code = pro.gen_code(line, { beautify: true }); + var data = line[0] + + var args = [] + if (!comment) comment = "" + if (typeof data === "object") { + code = code.split(/\n/).shift() + args = [ [ "string", data.toString() ], + [ "string", code ], + [ "num", data.start.line ], + [ "num", data.start.col ], + [ "num", data.end.line ], + [ "num", data.end.col ]] + } else { + args = [ [ "string", data ], + [ "string", code ]] + + } + return [ "call", [ "name", "trace" ], args ]; + } + + // we're gonna need this to push elements that we're currently looking at, to avoid + // endless recursion. + var analyzing = []; + function do_stat() { + var ret; + if (this[0].start && analyzing.indexOf(this) < 0) { + // without the `analyzing' hack, w.walk(this) would re-enter here leading + // to infinite recursion + analyzing.push(this); + ret = [ "splice", + [ [ "stat", trace(this) ], + w.walk(this) ]]; + analyzing.pop(this); + } + return ret; + } + + function do_cond(c, t, f) { + return [ this[0], w.walk(c), + ["seq", trace(t), w.walk(t) ], + ["seq", trace(f), w.walk(f) ]]; + } + + function do_binary(c, l, r) { + if (c !== "&&" && c !== "||") { + return [this[0], c, w.walk(l), w.walk(r)]; + } + return [ this[0], c, + ["seq", trace(l), w.walk(l) ], + ["seq", trace(r), w.walk(r) ]]; + } + + var new_ast = w.with_walkers({ + "stat" : do_stat, + "label" : do_stat, + "break" : do_stat, + "continue" : do_stat, + "debugger" : do_stat, + "var" : do_stat, + "const" : do_stat, + "return" : do_stat, + "throw" : do_stat, + "try" : do_stat, + "defun" : do_stat, + "if" : do_stat, + "while" : do_stat, + "do" : do_stat, + "for" : do_stat, + "for-in" : do_stat, + "switch" : do_stat, + "with" : do_stat, + "conditional" : do_cond, + "binary" : do_binary + }, function(){ + return w.walk(ast); + }); + return pro.gen_code(new_ast, { beautify: true }); +} + + +////// test code follows. + +var code = instrument(test.toString()); +console.log(code); + +function test() { + // simple stats + a = 5; + c += a + b; + "foo"; + + // var + var foo = 5; + const bar = 6, baz = 7; + + // switch block. note we can't track case lines the same way. + switch ("foo") { + case "foo": + return 1; + case "bar": + return 2; + } + + // for/for in + for (var i = 0; i < 5; ++i) { + console.log("Hello " + i); + } + for (var i in [ 1, 2, 3]) { + console.log(i); + } + + for (var i = 0; i < 5; ++i) + console.log("foo"); + + for (var i = 0; i < 5; ++i) { + console.log("foo"); + } + + var k = plurp() ? 1 : 0; + var x = a ? doX(y) && goZoo("zoo") + : b ? blerg({ x: y }) + : null; + + var x = X || Y; +} diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/liftvars.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/liftvars.js new file mode 100644 index 0000000..2f4b7fe --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/liftvars.js @@ -0,0 +1,8 @@ +var UNUSED_VAR1 = 19; + +function main() { + var unused_var2 = 20; + alert(100); +} + +main(); diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/test.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/test.js new file mode 100644 index 0000000..f295fba --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/test.js @@ -0,0 +1,30 @@ +#! /usr/bin/env node + +global.sys = require(/^v0\.[012]/.test(process.version) ? "sys" : "util"); +var fs = require("fs"); +var uglify = require("uglify-js"), // symlink ~/.node_libraries/uglify-js.js to ../uglify-js.js + jsp = uglify.parser, + pro = uglify.uglify; + +var code = fs.readFileSync("hoist.js", "utf8"); +var ast = jsp.parse(code); + +ast = pro.ast_lift_variables(ast); + +var w = pro.ast_walker(); +ast = w.with_walkers({ + "function": function() { + var node = w.dive(this); // walk depth first + console.log(pro.gen_code(node, { beautify: true })); + return node; + }, + "name": function(name) { + return [ this[0], "X" ]; + } +}, function(){ + return w.walk(ast); +}); + +console.log(pro.gen_code(ast, { + beautify: true +})); diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/uglify-hangs.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/uglify-hangs.js new file mode 100644 index 0000000..0d5b7e0 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/uglify-hangs.js @@ -0,0 +1,3930 @@ +/** + * @fileoverview + * + * JsWorld + * + *

Javascript library for localised formatting and parsing of: + *

    + *
  • Numbers + *
  • Dates and times + *
  • Currency + *
+ * + *

The library classes are configured with standard POSIX locale definitions + * derived from Unicode's Common Locale Data Repository (CLDR). + * + *

Website: JsWorld + * + * @author Vladimir Dzhuvinov + * @version 2.5 (2011-12-23) + */ + + + +/** + * @namespace Namespace container for the JsWorld library objects. + */ +jsworld = {}; + + +/** + * @function + * + * @description Formats a JavaScript Date object as an ISO-8601 date/time + * string. + * + * @param {Date} [d] A valid JavaScript Date object. If undefined the + * current date/time will be used. + * @param {Boolean} [withTZ] Include timezone offset, default false. + * + * @returns {String} The date/time formatted as YYYY-MM-DD HH:MM:SS. + */ +jsworld.formatIsoDateTime = function(d, withTZ) { + + if (typeof d === "undefined") + d = new Date(); // now + + if (typeof withTZ === "undefined") + withTZ = false; + + var s = jsworld.formatIsoDate(d) + " " + jsworld.formatIsoTime(d); + + if (withTZ) { + + var diff = d.getHours() - d.getUTCHours(); + var hourDiff = Math.abs(diff); + + var minuteUTC = d.getUTCMinutes(); + var minute = d.getMinutes(); + + if (minute != minuteUTC && minuteUTC < 30 && diff < 0) + hourDiff--; + + if (minute != minuteUTC && minuteUTC > 30 && diff > 0) + hourDiff--; + + var minuteDiff; + if (minute != minuteUTC) + minuteDiff = ":30"; + else + minuteDiff = ":00"; + + var timezone; + if (hourDiff < 10) + timezone = "0" + hourDiff + minuteDiff; + + else + timezone = "" + hourDiff + minuteDiff; + + if (diff < 0) + timezone = "-" + timezone; + + else + timezone = "+" + timezone; + + s = s + timezone; + } + + return s; +}; + + +/** + * @function + * + * @description Formats a JavaScript Date object as an ISO-8601 date string. + * + * @param {Date} [d] A valid JavaScript Date object. If undefined the current + * date will be used. + * + * @returns {String} The date formatted as YYYY-MM-DD. + */ +jsworld.formatIsoDate = function(d) { + + if (typeof d === "undefined") + d = new Date(); // now + + var year = d.getFullYear(); + var month = d.getMonth() + 1; + var day = d.getDate(); + + return year + "-" + jsworld._zeroPad(month, 2) + "-" + jsworld._zeroPad(day, 2); +}; + + +/** + * @function + * + * @description Formats a JavaScript Date object as an ISO-8601 time string. + * + * @param {Date} [d] A valid JavaScript Date object. If undefined the current + * time will be used. + * + * @returns {String} The time formatted as HH:MM:SS. + */ +jsworld.formatIsoTime = function(d) { + + if (typeof d === "undefined") + d = new Date(); // now + + var hour = d.getHours(); + var minute = d.getMinutes(); + var second = d.getSeconds(); + + return jsworld._zeroPad(hour, 2) + ":" + jsworld._zeroPad(minute, 2) + ":" + jsworld._zeroPad(second, 2); +}; + + +/** + * @function + * + * @description Parses an ISO-8601 formatted date/time string to a JavaScript + * Date object. + * + * @param {String} isoDateTimeVal An ISO-8601 formatted date/time string. + * + *

Accepted formats: + * + *

    + *
  • YYYY-MM-DD HH:MM:SS + *
  • YYYYMMDD HHMMSS + *
  • YYYY-MM-DD HHMMSS + *
  • YYYYMMDD HH:MM:SS + *
+ * + * @returns {Date} The corresponding Date object. + * + * @throws Error on a badly formatted date/time string or on a invalid date. + */ +jsworld.parseIsoDateTime = function(isoDateTimeVal) { + + if (typeof isoDateTimeVal != "string") + throw "Error: The parameter must be a string"; + + // First, try to match "YYYY-MM-DD HH:MM:SS" format + var matches = isoDateTimeVal.match(/^(\d\d\d\d)-(\d\d)-(\d\d)[T ](\d\d):(\d\d):(\d\d)/); + + // If unsuccessful, try to match "YYYYMMDD HHMMSS" format + if (matches === null) + matches = isoDateTimeVal.match(/^(\d\d\d\d)(\d\d)(\d\d)[T ](\d\d)(\d\d)(\d\d)/); + + // ... try to match "YYYY-MM-DD HHMMSS" format + if (matches === null) + matches = isoDateTimeVal.match(/^(\d\d\d\d)-(\d\d)-(\d\d)[T ](\d\d)(\d\d)(\d\d)/); + + // ... try to match "YYYYMMDD HH:MM:SS" format + if (matches === null) + matches = isoDateTimeVal.match(/^(\d\d\d\d)-(\d\d)-(\d\d)[T ](\d\d):(\d\d):(\d\d)/); + + // Report bad date/time string + if (matches === null) + throw "Error: Invalid ISO-8601 date/time string"; + + // Force base 10 parse int as some values may have leading zeros! + // (to avoid implicit octal base conversion) + var year = parseInt(matches[1], 10); + var month = parseInt(matches[2], 10); + var day = parseInt(matches[3], 10); + + var hour = parseInt(matches[4], 10); + var mins = parseInt(matches[5], 10); + var secs = parseInt(matches[6], 10); + + // Simple value range check, leap years not checked + // Note: the originial ISO time spec for leap hours (24:00:00) and seconds (00:00:60) is not supported + if (month < 1 || month > 12 || + day < 1 || day > 31 || + hour < 0 || hour > 23 || + mins < 0 || mins > 59 || + secs < 0 || secs > 59 ) + + throw "Error: Invalid ISO-8601 date/time value"; + + var d = new Date(year, month - 1, day, hour, mins, secs); + + // Check if the input date was valid + // (JS Date does automatic forward correction) + if (d.getDate() != day || d.getMonth() +1 != month) + throw "Error: Invalid date"; + + return d; +}; + + +/** + * @function + * + * @description Parses an ISO-8601 formatted date string to a JavaScript + * Date object. + * + * @param {String} isoDateVal An ISO-8601 formatted date string. + * + *

Accepted formats: + * + *

    + *
  • YYYY-MM-DD + *
  • YYYYMMDD + *
+ * + * @returns {Date} The corresponding Date object. + * + * @throws Error on a badly formatted date string or on a invalid date. + */ +jsworld.parseIsoDate = function(isoDateVal) { + + if (typeof isoDateVal != "string") + throw "Error: The parameter must be a string"; + + // First, try to match "YYYY-MM-DD" format + var matches = isoDateVal.match(/^(\d\d\d\d)-(\d\d)-(\d\d)/); + + // If unsuccessful, try to match "YYYYMMDD" format + if (matches === null) + matches = isoDateVal.match(/^(\d\d\d\d)(\d\d)(\d\d)/); + + // Report bad date/time string + if (matches === null) + throw "Error: Invalid ISO-8601 date string"; + + // Force base 10 parse int as some values may have leading zeros! + // (to avoid implicit octal base conversion) + var year = parseInt(matches[1], 10); + var month = parseInt(matches[2], 10); + var day = parseInt(matches[3], 10); + + // Simple value range check, leap years not checked + if (month < 1 || month > 12 || + day < 1 || day > 31 ) + + throw "Error: Invalid ISO-8601 date value"; + + var d = new Date(year, month - 1, day); + + // Check if the input date was valid + // (JS Date does automatic forward correction) + if (d.getDate() != day || d.getMonth() +1 != month) + throw "Error: Invalid date"; + + return d; +}; + + +/** + * @function + * + * @description Parses an ISO-8601 formatted time string to a JavaScript + * Date object. + * + * @param {String} isoTimeVal An ISO-8601 formatted time string. + * + *

Accepted formats: + * + *

    + *
  • HH:MM:SS + *
  • HHMMSS + *
+ * + * @returns {Date} The corresponding Date object, with year, month and day set + * to zero. + * + * @throws Error on a badly formatted time string. + */ +jsworld.parseIsoTime = function(isoTimeVal) { + + if (typeof isoTimeVal != "string") + throw "Error: The parameter must be a string"; + + // First, try to match "HH:MM:SS" format + var matches = isoTimeVal.match(/^(\d\d):(\d\d):(\d\d)/); + + // If unsuccessful, try to match "HHMMSS" format + if (matches === null) + matches = isoTimeVal.match(/^(\d\d)(\d\d)(\d\d)/); + + // Report bad date/time string + if (matches === null) + throw "Error: Invalid ISO-8601 date/time string"; + + // Force base 10 parse int as some values may have leading zeros! + // (to avoid implicit octal base conversion) + var hour = parseInt(matches[1], 10); + var mins = parseInt(matches[2], 10); + var secs = parseInt(matches[3], 10); + + // Simple value range check, leap years not checked + if (hour < 0 || hour > 23 || + mins < 0 || mins > 59 || + secs < 0 || secs > 59 ) + + throw "Error: Invalid ISO-8601 time value"; + + return new Date(0, 0, 0, hour, mins, secs); +}; + + +/** + * @private + * + * @description Trims leading and trailing whitespace from a string. + * + *

Used non-regexp the method from http://blog.stevenlevithan.com/archives/faster-trim-javascript + * + * @param {String} str The string to trim. + * + * @returns {String} The trimmed string. + */ +jsworld._trim = function(str) { + + var whitespace = ' \n\r\t\f\x0b\xa0\u2000\u2001\u2002\u2003\u2004\u2005\u2006\u2007\u2008\u2009\u200a\u200b\u2028\u2029\u3000'; + + for (var i = 0; i < str.length; i++) { + + if (whitespace.indexOf(str.charAt(i)) === -1) { + str = str.substring(i); + break; + } + } + + for (i = str.length - 1; i >= 0; i--) { + if (whitespace.indexOf(str.charAt(i)) === -1) { + str = str.substring(0, i + 1); + break; + } + } + + return whitespace.indexOf(str.charAt(0)) === -1 ? str : ''; +}; + + + +/** + * @private + * + * @description Returns true if the argument represents a decimal number. + * + * @param {Number|String} arg The argument to test. + * + * @returns {Boolean} true if the argument represents a decimal number, + * otherwise false. + */ +jsworld._isNumber = function(arg) { + + if (typeof arg == "number") + return true; + + if (typeof arg != "string") + return false; + + // ensure string + var s = arg + ""; + + return (/^-?(\d+|\d*\.\d+)$/).test(s); +}; + + +/** + * @private + * + * @description Returns true if the argument represents a decimal integer. + * + * @param {Number|String} arg The argument to test. + * + * @returns {Boolean} true if the argument represents an integer, otherwise + * false. + */ +jsworld._isInteger = function(arg) { + + if (typeof arg != "number" && typeof arg != "string") + return false; + + // convert to string + var s = arg + ""; + + return (/^-?\d+$/).test(s); +}; + + +/** + * @private + * + * @description Returns true if the argument represents a decimal float. + * + * @param {Number|String} arg The argument to test. + * + * @returns {Boolean} true if the argument represents a float, otherwise false. + */ +jsworld._isFloat = function(arg) { + + if (typeof arg != "number" && typeof arg != "string") + return false; + + // convert to string + var s = arg + ""; + + return (/^-?\.\d+?$/).test(s); +}; + + +/** + * @private + * + * @description Checks if the specified formatting option is contained + * within the options string. + * + * @param {String} option The option to search for. + * @param {String} optionsString The options string. + * + * @returns {Boolean} true if the flag is found, else false + */ +jsworld._hasOption = function(option, optionsString) { + + if (typeof option != "string" || typeof optionsString != "string") + return false; + + if (optionsString.indexOf(option) != -1) + return true; + else + return false; +}; + + +/** + * @private + * + * @description String replacement function. + * + * @param {String} s The string to work on. + * @param {String} target The string to search for. + * @param {String} replacement The replacement. + * + * @returns {String} The new string. + */ +jsworld._stringReplaceAll = function(s, target, replacement) { + + var out; + + if (target.length == 1 && replacement.length == 1) { + // simple char/char case somewhat faster + out = ""; + + for (var i = 0; i < s.length; i++) { + + if (s.charAt(i) == target.charAt(0)) + out = out + replacement.charAt(0); + else + out = out + s.charAt(i); + } + + return out; + } + else { + // longer target and replacement strings + out = s; + + var index = out.indexOf(target); + + while (index != -1) { + + out = out.replace(target, replacement); + + index = out.indexOf(target); + } + + return out; + } +}; + + +/** + * @private + * + * @description Tests if a string starts with the specified substring. + * + * @param {String} testedString The string to test. + * @param {String} sub The string to match. + * + * @returns {Boolean} true if the test succeeds. + */ +jsworld._stringStartsWith = function (testedString, sub) { + + if (testedString.length < sub.length) + return false; + + for (var i = 0; i < sub.length; i++) { + if (testedString.charAt(i) != sub.charAt(i)) + return false; + } + + return true; +}; + + +/** + * @private + * + * @description Gets the requested precision from an options string. + * + *

Example: ".3" returns 3 decimal places precision. + * + * @param {String} optionsString The options string. + * + * @returns {integer Number} The requested precision, -1 if not specified. + */ +jsworld._getPrecision = function (optionsString) { + + if (typeof optionsString != "string") + return -1; + + var m = optionsString.match(/\.(\d)/); + if (m) + return parseInt(m[1], 10); + else + return -1; +}; + + +/** + * @private + * + * @description Takes a decimal numeric amount (optionally as string) and + * returns its integer and fractional parts packed into an object. + * + * @param {Number|String} amount The amount, e.g. "123.45" or "-56.78" + * + * @returns {object} Parsed amount object with properties: + * {String} integer : the integer part + * {String} fraction : the fraction part + */ +jsworld._splitNumber = function (amount) { + + if (typeof amount == "number") + amount = amount + ""; + + var obj = {}; + + // remove negative sign + if (amount.charAt(0) == "-") + amount = amount.substring(1); + + // split amount into integer and decimal parts + var amountParts = amount.split("."); + if (!amountParts[1]) + amountParts[1] = ""; // we need "" instead of null + + obj.integer = amountParts[0]; + obj.fraction = amountParts[1]; + + return obj; +}; + + +/** + * @private + * + * @description Formats the integer part using the specified grouping + * and thousands separator. + * + * @param {String} intPart The integer part of the amount, as string. + * @param {String} grouping The grouping definition. + * @param {String} thousandsSep The thousands separator. + * + * @returns {String} The formatted integer part. + */ +jsworld._formatIntegerPart = function (intPart, grouping, thousandsSep) { + + // empty separator string? no grouping? + // -> return immediately with no formatting! + if (thousandsSep == "" || grouping == "-1") + return intPart; + + // turn the semicolon-separated string of integers into an array + var groupSizes = grouping.split(";"); + + // the formatted output string + var out = ""; + + // the intPart string position to process next, + // start at string end, e.g. "10000000 0) { + + // get next group size (if any, otherwise keep last) + if (groupSizes.length > 0) + size = parseInt(groupSizes.shift(), 10); + + // int parse error? + if (isNaN(size)) + throw "Error: Invalid grouping"; + + // size is -1? -> no more grouping, so just copy string remainder + if (size == -1) { + out = intPart.substring(0, pos) + out; + break; + } + + pos -= size; // move to next sep. char. position + + // position underrun? -> just copy string remainder + if (pos < 1) { + out = intPart.substring(0, pos + size) + out; + break; + } + + // extract group and apply sep. char. + out = thousandsSep + intPart.substring(pos, pos + size) + out; + } + + return out; +}; + + +/** + * @private + * + * @description Formats the fractional part to the specified decimal + * precision. + * + * @param {String} fracPart The fractional part of the amount + * @param {integer Number} precision The desired decimal precision + * + * @returns {String} The formatted fractional part. + */ +jsworld._formatFractionPart = function (fracPart, precision) { + + // append zeroes up to precision if necessary + for (var i=0; fracPart.length < precision; i++) + fracPart = fracPart + "0"; + + return fracPart; +}; + + +/** + * @private + * + * @desription Converts a number to string and pad it with leading zeroes if the + * string is shorter than length. + * + * @param {integer Number} number The number value subjected to selective padding. + * @param {integer Number} length If the number has fewer digits than this length + * apply padding. + * + * @returns {String} The formatted string. + */ +jsworld._zeroPad = function(number, length) { + + // ensure string + var s = number + ""; + + while (s.length < length) + s = "0" + s; + + return s; +}; + + +/** + * @private + * @description Converts a number to string and pads it with leading spaces if + * the string is shorter than length. + * + * @param {integer Number} number The number value subjected to selective padding. + * @param {integer Number} length If the number has fewer digits than this length + * apply padding. + * + * @returns {String} The formatted string. + */ +jsworld._spacePad = function(number, length) { + + // ensure string + var s = number + ""; + + while (s.length < length) + s = " " + s; + + return s; +}; + + + +/** + * @class + * Represents a POSIX-style locale with its numeric, monetary and date/time + * properties. Also provides a set of locale helper methods. + * + *

The locale properties follow the POSIX standards: + * + *

+ * + * @public + * @constructor + * @description Creates a new locale object (POSIX-style) with the specified + * properties. + * + * @param {object} properties An object containing the raw locale properties: + * + * @param {String} properties.decimal_point + * + * A string containing the symbol that shall be used as the decimal + * delimiter (radix character) in numeric, non-monetary formatted + * quantities. This property cannot be omitted and cannot be set to the + * empty string. + * + * + * @param {String} properties.thousands_sep + * + * A string containing the symbol that shall be used as a separator for + * groups of digits to the left of the decimal delimiter in numeric, + * non-monetary formatted monetary quantities. + * + * + * @param {String} properties.grouping + * + * Defines the size of each group of digits in formatted non-monetary + * quantities. The operand is a sequence of integers separated by + * semicolons. Each integer specifies the number of digits in each group, + * with the initial integer defining the size of the group immediately + * preceding the decimal delimiter, and the following integers defining + * the preceding groups. If the last integer is not -1, then the size of + * the previous group (if any) shall be repeatedly used for the + * remainder of the digits. If the last integer is -1, then no further + * grouping shall be performed. + * + * + * @param {String} properties.int_curr_symbol + * + * The first three letters signify the ISO-4217 currency code, + * the fourth letter is the international symbol separation character + * (normally a space). + * + * + * @param {String} properties.currency_symbol + * + * The local shorthand currency symbol, e.g. "$" for the en_US locale + * + * + * @param {String} properties.mon_decimal_point + * + * The symbol to be used as the decimal delimiter (radix character) + * + * + * @param {String} properties.mon_thousands_sep + * + * The symbol to be used as a separator for groups of digits to the + * left of the decimal delimiter. + * + * + * @param {String} properties.mon_grouping + * + * A string that defines the size of each group of digits. The + * operand is a sequence of integers separated by semicolons (";"). + * Each integer specifies the number of digits in each group, with the + * initial integer defining the size of the group preceding the + * decimal delimiter, and the following integers defining the + * preceding groups. If the last integer is not -1, then the size of + * the previous group (if any) must be repeatedly used for the + * remainder of the digits. If the last integer is -1, then no + * further grouping is to be performed. + * + * + * @param {String} properties.positive_sign + * + * The string to indicate a non-negative monetary amount. + * + * + * @param {String} properties.negative_sign + * + * The string to indicate a negative monetary amount. + * + * + * @param {integer Number} properties.frac_digits + * + * An integer representing the number of fractional digits (those to + * the right of the decimal delimiter) to be written in a formatted + * monetary quantity using currency_symbol. + * + * + * @param {integer Number} properties.int_frac_digits + * + * An integer representing the number of fractional digits (those to + * the right of the decimal delimiter) to be written in a formatted + * monetary quantity using int_curr_symbol. + * + * + * @param {integer Number} properties.p_cs_precedes + * + * An integer set to 1 if the currency_symbol precedes the value for a + * monetary quantity with a non-negative value, and set to 0 if the + * symbol succeeds the value. + * + * + * @param {integer Number} properties.n_cs_precedes + * + * An integer set to 1 if the currency_symbol precedes the value for a + * monetary quantity with a negative value, and set to 0 if the symbol + * succeeds the value. + * + * + * @param {integer Number} properties.p_sep_by_space + * + * Set to a value indicating the separation of the currency_symbol, + * the sign string, and the value for a non-negative formatted monetary + * quantity: + * + *

0 No space separates the currency symbol and value.

+ * + *

1 If the currency symbol and sign string are adjacent, a space + * separates them from the value; otherwise, a space separates + * the currency symbol from the value.

+ * + *

2 If the currency symbol and sign string are adjacent, a space + * separates them; otherwise, a space separates the sign string + * from the value.

+ * + * + * @param {integer Number} properties.n_sep_by_space + * + * Set to a value indicating the separation of the currency_symbol, + * the sign string, and the value for a negative formatted monetary + * quantity. Rules same as for p_sep_by_space. + * + * + * @param {integer Number} properties.p_sign_posn + * + * An integer set to a value indicating the positioning of the + * positive_sign for a monetary quantity with a non-negative value: + * + *

0 Parentheses enclose the quantity and the currency_symbol.

+ * + *

1 The sign string precedes the quantity and the currency_symbol.

+ * + *

2 The sign string succeeds the quantity and the currency_symbol.

+ * + *

3 The sign string precedes the currency_symbol.

+ * + *

4 The sign string succeeds the currency_symbol.

+ * + * + * @param {integer Number} properties.n_sign_posn + * + * An integer set to a value indicating the positioning of the + * negative_sign for a negative formatted monetary quantity. Rules same + * as for p_sign_posn. + * + * + * @param {integer Number} properties.int_p_cs_precedes + * + * An integer set to 1 if the int_curr_symbol precedes the value for a + * monetary quantity with a non-negative value, and set to 0 if the + * symbol succeeds the value. + * + * + * @param {integer Number} properties.int_n_cs_precedes + * + * An integer set to 1 if the int_curr_symbol precedes the value for a + * monetary quantity with a negative value, and set to 0 if the symbol + * succeeds the value. + * + * + * @param {integer Number} properties.int_p_sep_by_space + * + * Set to a value indicating the separation of the int_curr_symbol, + * the sign string, and the value for a non-negative internationally + * formatted monetary quantity. Rules same as for p_sep_by_space. + * + * + * @param {integer Number} properties.int_n_sep_by_space + * + * Set to a value indicating the separation of the int_curr_symbol, + * the sign string, and the value for a negative internationally + * formatted monetary quantity. Rules same as for p_sep_by_space. + * + * + * @param {integer Number} properties.int_p_sign_posn + * + * An integer set to a value indicating the positioning of the + * positive_sign for a positive monetary quantity formatted with the + * international format. Rules same as for p_sign_posn. + * + * + * @param {integer Number} properties.int_n_sign_posn + * + * An integer set to a value indicating the positioning of the + * negative_sign for a negative monetary quantity formatted with the + * international format. Rules same as for p_sign_posn. + * + * + * @param {String[] | String} properties.abday + * + * The abbreviated weekday names, corresponding to the %a conversion + * specification. The property must be either an array of 7 strings or + * a string consisting of 7 semicolon-separated substrings, each + * surrounded by double-quotes. The first must be the abbreviated name + * of the day corresponding to Sunday, the second the abbreviated name + * of the day corresponding to Monday, and so on. + * + * + * @param {String[] | String} properties.day + * + * The full weekday names, corresponding to the %A conversion + * specification. The property must be either an array of 7 strings or + * a string consisting of 7 semicolon-separated substrings, each + * surrounded by double-quotes. The first must be the full name of the + * day corresponding to Sunday, the second the full name of the day + * corresponding to Monday, and so on. + * + * + * @param {String[] | String} properties.abmon + * + * The abbreviated month names, corresponding to the %b conversion + * specification. The property must be either an array of 12 strings or + * a string consisting of 12 semicolon-separated substrings, each + * surrounded by double-quotes. The first must be the abbreviated name + * of the first month of the year (January), the second the abbreviated + * name of the second month, and so on. + * + * + * @param {String[] | String} properties.mon + * + * The full month names, corresponding to the %B conversion + * specification. The property must be either an array of 12 strings or + * a string consisting of 12 semicolon-separated substrings, each + * surrounded by double-quotes. The first must be the full name of the + * first month of the year (January), the second the full name of the second + * month, and so on. + * + * + * @param {String} properties.d_fmt + * + * The appropriate date representation. The string may contain any + * combination of characters and conversion specifications (%). + * + * + * @param {String} properties.t_fmt + * + * The appropriate time representation. The string may contain any + * combination of characters and conversion specifications (%). + * + * + * @param {String} properties.d_t_fmt + * + * The appropriate date and time representation. The string may contain + * any combination of characters and conversion specifications (%). + * + * + * @param {String[] | String} properties.am_pm + * + * The appropriate representation of the ante-meridiem and post-meridiem + * strings, corresponding to the %p conversion specification. The property + * must be either an array of 2 strings or a string consisting of 2 + * semicolon-separated substrings, each surrounded by double-quotes. + * The first string must represent the ante-meridiem designation, the + * last string the post-meridiem designation. + * + * + * @throws @throws Error on a undefined or invalid locale property. + */ +jsworld.Locale = function(properties) { + + + /** + * @private + * + * @description Identifies the class for internal library purposes. + */ + this._className = "jsworld.Locale"; + + + /** + * @private + * + * @description Parses a day or month name definition list, which + * could be a ready JS array, e.g. ["Mon", "Tue", "Wed"...] or + * it could be a string formatted according to the classic POSIX + * definition e.g. "Mon";"Tue";"Wed";... + * + * @param {String[] | String} namesAn array or string defining + * the week/month names. + * @param {integer Number} expectedItems The number of expected list + * items, e.g. 7 for weekdays, 12 for months. + * + * @returns {String[]} The parsed (and checked) items. + * + * @throws Error on missing definition, unexpected item count or + * missing double-quotes. + */ + this._parseList = function(names, expectedItems) { + + var array = []; + + if (names == null) { + throw "Names not defined"; + } + else if (typeof names == "object") { + // we got a ready array + array = names; + } + else if (typeof names == "string") { + // we got the names in the classic POSIX form, do parse + array = names.split(";", expectedItems); + + for (var i = 0; i < array.length; i++) { + // check for and strip double quotes + if (array[i][0] == "\"" && array[i][array[i].length - 1] == "\"") + array[i] = array[i].slice(1, -1); + else + throw "Missing double quotes"; + } + } + else { + throw "Names must be an array or a string"; + } + + if (array.length != expectedItems) + throw "Expected " + expectedItems + " items, got " + array.length; + + return array; + }; + + + /** + * @private + * + * @description Validates a date/time format string, such as "H:%M:%S". + * Checks that the argument is of type "string" and is not empty. + * + * @param {String} formatString The format string. + * + * @returns {String} The validated string. + * + * @throws Error on null or empty string. + */ + this._validateFormatString = function(formatString) { + + if (typeof formatString == "string" && formatString.length > 0) + return formatString; + else + throw "Empty or no string"; + }; + + + // LC_NUMERIC + + if (properties == null || typeof properties != "object") + throw "Error: Invalid/missing locale properties"; + + + if (typeof properties.decimal_point != "string") + throw "Error: Invalid/missing decimal_point property"; + + this.decimal_point = properties.decimal_point; + + + if (typeof properties.thousands_sep != "string") + throw "Error: Invalid/missing thousands_sep property"; + + this.thousands_sep = properties.thousands_sep; + + + if (typeof properties.grouping != "string") + throw "Error: Invalid/missing grouping property"; + + this.grouping = properties.grouping; + + + // LC_MONETARY + + if (typeof properties.int_curr_symbol != "string") + throw "Error: Invalid/missing int_curr_symbol property"; + + if (! /[A-Za-z]{3}.?/.test(properties.int_curr_symbol)) + throw "Error: Invalid int_curr_symbol property"; + + this.int_curr_symbol = properties.int_curr_symbol; + + + if (typeof properties.currency_symbol != "string") + throw "Error: Invalid/missing currency_symbol property"; + + this.currency_symbol = properties.currency_symbol; + + + if (typeof properties.frac_digits != "number" && properties.frac_digits < 0) + throw "Error: Invalid/missing frac_digits property"; + + this.frac_digits = properties.frac_digits; + + + // may be empty string/null for currencies with no fractional part + if (properties.mon_decimal_point === null || properties.mon_decimal_point == "") { + + if (this.frac_digits > 0) + throw "Error: Undefined mon_decimal_point property"; + else + properties.mon_decimal_point = ""; + } + + if (typeof properties.mon_decimal_point != "string") + throw "Error: Invalid/missing mon_decimal_point property"; + + this.mon_decimal_point = properties.mon_decimal_point; + + + if (typeof properties.mon_thousands_sep != "string") + throw "Error: Invalid/missing mon_thousands_sep property"; + + this.mon_thousands_sep = properties.mon_thousands_sep; + + + if (typeof properties.mon_grouping != "string") + throw "Error: Invalid/missing mon_grouping property"; + + this.mon_grouping = properties.mon_grouping; + + + if (typeof properties.positive_sign != "string") + throw "Error: Invalid/missing positive_sign property"; + + this.positive_sign = properties.positive_sign; + + + if (typeof properties.negative_sign != "string") + throw "Error: Invalid/missing negative_sign property"; + + this.negative_sign = properties.negative_sign; + + + + if (properties.p_cs_precedes !== 0 && properties.p_cs_precedes !== 1) + throw "Error: Invalid/missing p_cs_precedes property, must be 0 or 1"; + + this.p_cs_precedes = properties.p_cs_precedes; + + + if (properties.n_cs_precedes !== 0 && properties.n_cs_precedes !== 1) + throw "Error: Invalid/missing n_cs_precedes, must be 0 or 1"; + + this.n_cs_precedes = properties.n_cs_precedes; + + + if (properties.p_sep_by_space !== 0 && + properties.p_sep_by_space !== 1 && + properties.p_sep_by_space !== 2) + throw "Error: Invalid/missing p_sep_by_space property, must be 0, 1 or 2"; + + this.p_sep_by_space = properties.p_sep_by_space; + + + if (properties.n_sep_by_space !== 0 && + properties.n_sep_by_space !== 1 && + properties.n_sep_by_space !== 2) + throw "Error: Invalid/missing n_sep_by_space property, must be 0, 1, or 2"; + + this.n_sep_by_space = properties.n_sep_by_space; + + + if (properties.p_sign_posn !== 0 && + properties.p_sign_posn !== 1 && + properties.p_sign_posn !== 2 && + properties.p_sign_posn !== 3 && + properties.p_sign_posn !== 4) + throw "Error: Invalid/missing p_sign_posn property, must be 0, 1, 2, 3 or 4"; + + this.p_sign_posn = properties.p_sign_posn; + + + if (properties.n_sign_posn !== 0 && + properties.n_sign_posn !== 1 && + properties.n_sign_posn !== 2 && + properties.n_sign_posn !== 3 && + properties.n_sign_posn !== 4) + throw "Error: Invalid/missing n_sign_posn property, must be 0, 1, 2, 3 or 4"; + + this.n_sign_posn = properties.n_sign_posn; + + + if (typeof properties.int_frac_digits != "number" && properties.int_frac_digits < 0) + throw "Error: Invalid/missing int_frac_digits property"; + + this.int_frac_digits = properties.int_frac_digits; + + + if (properties.int_p_cs_precedes !== 0 && properties.int_p_cs_precedes !== 1) + throw "Error: Invalid/missing int_p_cs_precedes property, must be 0 or 1"; + + this.int_p_cs_precedes = properties.int_p_cs_precedes; + + + if (properties.int_n_cs_precedes !== 0 && properties.int_n_cs_precedes !== 1) + throw "Error: Invalid/missing int_n_cs_precedes property, must be 0 or 1"; + + this.int_n_cs_precedes = properties.int_n_cs_precedes; + + + if (properties.int_p_sep_by_space !== 0 && + properties.int_p_sep_by_space !== 1 && + properties.int_p_sep_by_space !== 2) + throw "Error: Invalid/missing int_p_sep_by_spacev, must be 0, 1 or 2"; + + this.int_p_sep_by_space = properties.int_p_sep_by_space; + + + if (properties.int_n_sep_by_space !== 0 && + properties.int_n_sep_by_space !== 1 && + properties.int_n_sep_by_space !== 2) + throw "Error: Invalid/missing int_n_sep_by_space property, must be 0, 1, or 2"; + + this.int_n_sep_by_space = properties.int_n_sep_by_space; + + + if (properties.int_p_sign_posn !== 0 && + properties.int_p_sign_posn !== 1 && + properties.int_p_sign_posn !== 2 && + properties.int_p_sign_posn !== 3 && + properties.int_p_sign_posn !== 4) + throw "Error: Invalid/missing int_p_sign_posn property, must be 0, 1, 2, 3 or 4"; + + this.int_p_sign_posn = properties.int_p_sign_posn; + + + if (properties.int_n_sign_posn !== 0 && + properties.int_n_sign_posn !== 1 && + properties.int_n_sign_posn !== 2 && + properties.int_n_sign_posn !== 3 && + properties.int_n_sign_posn !== 4) + throw "Error: Invalid/missing int_n_sign_posn property, must be 0, 1, 2, 3 or 4"; + + this.int_n_sign_posn = properties.int_n_sign_posn; + + + // LC_TIME + + if (properties == null || typeof properties != "object") + throw "Error: Invalid/missing time locale properties"; + + + // parse the supported POSIX LC_TIME properties + + // abday + try { + this.abday = this._parseList(properties.abday, 7); + } + catch (error) { + throw "Error: Invalid abday property: " + error; + } + + // day + try { + this.day = this._parseList(properties.day, 7); + } + catch (error) { + throw "Error: Invalid day property: " + error; + } + + // abmon + try { + this.abmon = this._parseList(properties.abmon, 12); + } catch (error) { + throw "Error: Invalid abmon property: " + error; + } + + // mon + try { + this.mon = this._parseList(properties.mon, 12); + } catch (error) { + throw "Error: Invalid mon property: " + error; + } + + // d_fmt + try { + this.d_fmt = this._validateFormatString(properties.d_fmt); + } catch (error) { + throw "Error: Invalid d_fmt property: " + error; + } + + // t_fmt + try { + this.t_fmt = this._validateFormatString(properties.t_fmt); + } catch (error) { + throw "Error: Invalid t_fmt property: " + error; + } + + // d_t_fmt + try { + this.d_t_fmt = this._validateFormatString(properties.d_t_fmt); + } catch (error) { + throw "Error: Invalid d_t_fmt property: " + error; + } + + // am_pm + try { + var am_pm_strings = this._parseList(properties.am_pm, 2); + this.am = am_pm_strings[0]; + this.pm = am_pm_strings[1]; + } catch (error) { + // ignore empty/null string errors + this.am = ""; + this.pm = ""; + } + + + /** + * @public + * + * @description Returns the abbreviated name of the specified weekday. + * + * @param {integer Number} [weekdayNum] An integer between 0 and 6. Zero + * corresponds to Sunday, one to Monday, etc. If omitted the + * method will return an array of all abbreviated weekday + * names. + * + * @returns {String | String[]} The abbreviated name of the specified weekday + * or an array of all abbreviated weekday names. + * + * @throws Error on invalid argument. + */ + this.getAbbreviatedWeekdayName = function(weekdayNum) { + + if (typeof weekdayNum == "undefined" || weekdayNum === null) + return this.abday; + + if (! jsworld._isInteger(weekdayNum) || weekdayNum < 0 || weekdayNum > 6) + throw "Error: Invalid weekday argument, must be an integer [0..6]"; + + return this.abday[weekdayNum]; + }; + + + /** + * @public + * + * @description Returns the name of the specified weekday. + * + * @param {integer Number} [weekdayNum] An integer between 0 and 6. Zero + * corresponds to Sunday, one to Monday, etc. If omitted the + * method will return an array of all weekday names. + * + * @returns {String | String[]} The name of the specified weekday or an + * array of all weekday names. + * + * @throws Error on invalid argument. + */ + this.getWeekdayName = function(weekdayNum) { + + if (typeof weekdayNum == "undefined" || weekdayNum === null) + return this.day; + + if (! jsworld._isInteger(weekdayNum) || weekdayNum < 0 || weekdayNum > 6) + throw "Error: Invalid weekday argument, must be an integer [0..6]"; + + return this.day[weekdayNum]; + }; + + + /** + * @public + * + * @description Returns the abbreviated name of the specified month. + * + * @param {integer Number} [monthNum] An integer between 0 and 11. Zero + * corresponds to January, one to February, etc. If omitted the + * method will return an array of all abbreviated month names. + * + * @returns {String | String[]} The abbreviated name of the specified month + * or an array of all abbreviated month names. + * + * @throws Error on invalid argument. + */ + this.getAbbreviatedMonthName = function(monthNum) { + + if (typeof monthNum == "undefined" || monthNum === null) + return this.abmon; + + if (! jsworld._isInteger(monthNum) || monthNum < 0 || monthNum > 11) + throw "Error: Invalid month argument, must be an integer [0..11]"; + + return this.abmon[monthNum]; + }; + + + /** + * @public + * + * @description Returns the name of the specified month. + * + * @param {integer Number} [monthNum] An integer between 0 and 11. Zero + * corresponds to January, one to February, etc. If omitted the + * method will return an array of all month names. + * + * @returns {String | String[]} The name of the specified month or an array + * of all month names. + * + * @throws Error on invalid argument. + */ + this.getMonthName = function(monthNum) { + + if (typeof monthNum == "undefined" || monthNum === null) + return this.mon; + + if (! jsworld._isInteger(monthNum) || monthNum < 0 || monthNum > 11) + throw "Error: Invalid month argument, must be an integer [0..11]"; + + return this.mon[monthNum]; + }; + + + + /** + * @public + * + * @description Gets the decimal delimiter (radix) character for + * numeric quantities. + * + * @returns {String} The radix character. + */ + this.getDecimalPoint = function() { + + return this.decimal_point; + }; + + + /** + * @public + * + * @description Gets the local shorthand currency symbol. + * + * @returns {String} The currency symbol. + */ + this.getCurrencySymbol = function() { + + return this.currency_symbol; + }; + + + /** + * @public + * + * @description Gets the internaltion currency symbol (ISO-4217 code). + * + * @returns {String} The international currency symbol. + */ + this.getIntCurrencySymbol = function() { + + return this.int_curr_symbol.substring(0,3); + }; + + + /** + * @public + * + * @description Gets the position of the local (shorthand) currency + * symbol relative to the amount. Assumes a non-negative amount. + * + * @returns {Boolean} True if the symbol precedes the amount, false if + * the symbol succeeds the amount. + */ + this.currencySymbolPrecedes = function() { + + if (this.p_cs_precedes == 1) + return true; + else + return false; + }; + + + /** + * @public + * + * @description Gets the position of the international (ISO-4217 code) + * currency symbol relative to the amount. Assumes a non-negative + * amount. + * + * @returns {Boolean} True if the symbol precedes the amount, false if + * the symbol succeeds the amount. + */ + this.intCurrencySymbolPrecedes = function() { + + if (this.int_p_cs_precedes == 1) + return true; + else + return false; + + }; + + + /** + * @public + * + * @description Gets the decimal delimiter (radix) for monetary + * quantities. + * + * @returns {String} The radix character. + */ + this.getMonetaryDecimalPoint = function() { + + return this.mon_decimal_point; + }; + + + /** + * @public + * + * @description Gets the number of fractional digits for local + * (shorthand) symbol formatting. + * + * @returns {integer Number} The number of fractional digits. + */ + this.getFractionalDigits = function() { + + return this.frac_digits; + }; + + + /** + * @public + * + * @description Gets the number of fractional digits for + * international (ISO-4217 code) formatting. + * + * @returns {integer Number} The number of fractional digits. + */ + this.getIntFractionalDigits = function() { + + return this.int_frac_digits; + }; +}; + + + +/** + * @class + * Class for localised formatting of numbers. + * + *

See: + * POSIX LC_NUMERIC. + * + * + * @public + * @constructor + * @description Creates a new numeric formatter for the specified locale. + * + * @param {jsworld.Locale} locale A locale object specifying the required + * POSIX LC_NUMERIC formatting properties. + * + * @throws Error on constructor failure. + */ +jsworld.NumericFormatter = function(locale) { + + if (typeof locale != "object" || locale._className != "jsworld.Locale") + throw "Constructor error: You must provide a valid jsworld.Locale instance"; + + this.lc = locale; + + + /** + * @public + * + * @description Formats a decimal numeric value according to the preset + * locale. + * + * @param {Number|String} number The number to format. + * @param {String} [options] Options to modify the formatted output: + *

    + *
  • "^" suppress grouping + *
  • "+" force positive sign for positive amounts + *
  • "~" suppress positive/negative sign + *
  • ".n" specify decimal precision 'n' + *
+ * + * @returns {String} The formatted number. + * + * @throws "Error: Invalid input" on bad input. + */ + this.format = function(number, options) { + + if (typeof number == "string") + number = jsworld._trim(number); + + if (! jsworld._isNumber(number)) + throw "Error: The input is not a number"; + + var floatAmount = parseFloat(number, 10); + + // get the required precision + var reqPrecision = jsworld._getPrecision(options); + + // round to required precision + if (reqPrecision != -1) + floatAmount = Math.round(floatAmount * Math.pow(10, reqPrecision)) / Math.pow(10, reqPrecision); + + + // convert the float number to string and parse into + // object with properties integer and fraction + var parsedAmount = jsworld._splitNumber(String(floatAmount)); + + // format integer part with grouping chars + var formattedIntegerPart; + + if (floatAmount === 0) + formattedIntegerPart = "0"; + else + formattedIntegerPart = jsworld._hasOption("^", options) ? + parsedAmount.integer : + jsworld._formatIntegerPart(parsedAmount.integer, + this.lc.grouping, + this.lc.thousands_sep); + + // format the fractional part + var formattedFractionPart = + reqPrecision != -1 ? + jsworld._formatFractionPart(parsedAmount.fraction, reqPrecision) : + parsedAmount.fraction; + + + // join the integer and fraction parts using the decimal_point property + var formattedAmount = + formattedFractionPart.length ? + formattedIntegerPart + this.lc.decimal_point + formattedFractionPart : + formattedIntegerPart; + + // prepend sign? + if (jsworld._hasOption("~", options) || floatAmount === 0) { + // suppress both '+' and '-' signs, i.e. return abs value + return formattedAmount; + } + else { + if (jsworld._hasOption("+", options) || floatAmount < 0) { + if (floatAmount > 0) + // force '+' sign for positive amounts + return "+" + formattedAmount; + else if (floatAmount < 0) + // prepend '-' sign + return "-" + formattedAmount; + else + // zero case + return formattedAmount; + } + else { + // positive amount with no '+' sign + return formattedAmount; + } + } + }; +}; + + +/** + * @class + * Class for localised formatting of dates and times. + * + *

See: + * POSIX LC_TIME. + * + * @public + * @constructor + * @description Creates a new date/time formatter for the specified locale. + * + * @param {jsworld.Locale} locale A locale object specifying the required + * POSIX LC_TIME formatting properties. + * + * @throws Error on constructor failure. + */ +jsworld.DateTimeFormatter = function(locale) { + + + if (typeof locale != "object" || locale._className != "jsworld.Locale") + throw "Constructor error: You must provide a valid jsworld.Locale instance."; + + this.lc = locale; + + + /** + * @public + * + * @description Formats a date according to the preset locale. + * + * @param {Date|String} date A valid Date object instance or a string + * containing a valid ISO-8601 formatted date, e.g. "2010-31-03" + * or "2010-03-31 23:59:59". + * + * @returns {String} The formatted date + * + * @throws Error on invalid date argument + */ + this.formatDate = function(date) { + + var d = null; + + if (typeof date == "string") { + // assume ISO-8601 date string + try { + d = jsworld.parseIsoDate(date); + } catch (error) { + // try full ISO-8601 date/time string + d = jsworld.parseIsoDateTime(date); + } + } + else if (date !== null && typeof date == "object") { + // assume ready Date object + d = date; + } + else { + throw "Error: Invalid date argument, must be a Date object or an ISO-8601 date/time string"; + } + + return this._applyFormatting(d, this.lc.d_fmt); + }; + + + /** + * @public + * + * @description Formats a time according to the preset locale. + * + * @param {Date|String} date A valid Date object instance or a string + * containing a valid ISO-8601 formatted time, e.g. "23:59:59" + * or "2010-03-31 23:59:59". + * + * @returns {String} The formatted time. + * + * @throws Error on invalid date argument. + */ + this.formatTime = function(date) { + + var d = null; + + if (typeof date == "string") { + // assume ISO-8601 time string + try { + d = jsworld.parseIsoTime(date); + } catch (error) { + // try full ISO-8601 date/time string + d = jsworld.parseIsoDateTime(date); + } + } + else if (date !== null && typeof date == "object") { + // assume ready Date object + d = date; + } + else { + throw "Error: Invalid date argument, must be a Date object or an ISO-8601 date/time string"; + } + + return this._applyFormatting(d, this.lc.t_fmt); + }; + + + /** + * @public + * + * @description Formats a date/time value according to the preset + * locale. + * + * @param {Date|String} date A valid Date object instance or a string + * containing a valid ISO-8601 formatted date/time, e.g. + * "2010-03-31 23:59:59". + * + * @returns {String} The formatted time. + * + * @throws Error on invalid argument. + */ + this.formatDateTime = function(date) { + + var d = null; + + if (typeof date == "string") { + // assume ISO-8601 format + d = jsworld.parseIsoDateTime(date); + } + else if (date !== null && typeof date == "object") { + // assume ready Date object + d = date; + } + else { + throw "Error: Invalid date argument, must be a Date object or an ISO-8601 date/time string"; + } + + return this._applyFormatting(d, this.lc.d_t_fmt); + }; + + + /** + * @private + * + * @description Apples formatting to the Date object according to the + * format string. + * + * @param {Date} d A valid Date instance. + * @param {String} s The formatting string with '%' placeholders. + * + * @returns {String} The formatted string. + */ + this._applyFormatting = function(d, s) { + + s = s.replace(/%%/g, '%'); + s = s.replace(/%a/g, this.lc.abday[d.getDay()]); + s = s.replace(/%A/g, this.lc.day[d.getDay()]); + s = s.replace(/%b/g, this.lc.abmon[d.getMonth()]); + s = s.replace(/%B/g, this.lc.mon[d.getMonth()]); + s = s.replace(/%d/g, jsworld._zeroPad(d.getDate(), 2)); + s = s.replace(/%e/g, jsworld._spacePad(d.getDate(), 2)); + s = s.replace(/%F/g, d.getFullYear() + + "-" + + jsworld._zeroPad(d.getMonth()+1, 2) + + "-" + + jsworld._zeroPad(d.getDate(), 2)); + s = s.replace(/%h/g, this.lc.abmon[d.getMonth()]); // same as %b + s = s.replace(/%H/g, jsworld._zeroPad(d.getHours(), 2)); + s = s.replace(/%I/g, jsworld._zeroPad(this._hours12(d.getHours()), 2)); + s = s.replace(/%k/g, d.getHours()); + s = s.replace(/%l/g, this._hours12(d.getHours())); + s = s.replace(/%m/g, jsworld._zeroPad(d.getMonth()+1, 2)); + s = s.replace(/%n/g, "\n"); + s = s.replace(/%M/g, jsworld._zeroPad(d.getMinutes(), 2)); + s = s.replace(/%p/g, this._getAmPm(d.getHours())); + s = s.replace(/%P/g, this._getAmPm(d.getHours()).toLocaleLowerCase()); // safe? + s = s.replace(/%R/g, jsworld._zeroPad(d.getHours(), 2) + + ":" + + jsworld._zeroPad(d.getMinutes(), 2)); + s = s.replace(/%S/g, jsworld._zeroPad(d.getSeconds(), 2)); + s = s.replace(/%T/g, jsworld._zeroPad(d.getHours(), 2) + + ":" + + jsworld._zeroPad(d.getMinutes(), 2) + + ":" + + jsworld._zeroPad(d.getSeconds(), 2)); + s = s.replace(/%w/g, this.lc.day[d.getDay()]); + s = s.replace(/%y/g, new String(d.getFullYear()).substring(2)); + s = s.replace(/%Y/g, d.getFullYear()); + + s = s.replace(/%Z/g, ""); // to do: ignored until a reliable TMZ method found + + s = s.replace(/%[a-zA-Z]/g, ""); // ignore all other % sequences + + return s; + }; + + + /** + * @private + * + * @description Does 24 to 12 hour conversion. + * + * @param {integer Number} hour24 Hour [0..23]. + * + * @returns {integer Number} Corresponding hour [1..12]. + */ + this._hours12 = function(hour24) { + + if (hour24 === 0) + return 12; // 00h is 12AM + + else if (hour24 > 12) + return hour24 - 12; // 1PM to 11PM + + else + return hour24; // 1AM to 12PM + }; + + + /** + * @private + * + * @description Gets the appropriate localised AM or PM string depending + * on the day hour. Special cases: midnight is 12AM, noon is 12PM. + * + * @param {integer Number} hour24 Hour [0..23]. + * + * @returns {String} The corresponding localised AM or PM string. + */ + this._getAmPm = function(hour24) { + + if (hour24 < 12) + return this.lc.am; + else + return this.lc.pm; + }; +}; + + + +/** + * @class Class for localised formatting of currency amounts. + * + *

See: + * POSIX LC_MONETARY. + * + * @public + * @constructor + * @description Creates a new monetary formatter for the specified locale. + * + * @param {jsworld.Locale} locale A locale object specifying the required + * POSIX LC_MONETARY formatting properties. + * @param {String} [currencyCode] Set the currency explicitly by + * passing its international ISO-4217 code, e.g. "USD", "EUR", "GBP". + * Use this optional parameter to override the default local currency + * @param {String} [altIntSymbol] Non-local currencies are formatted + * with their international ISO-4217 code to prevent ambiguity. + * Use this optional argument to force a different symbol, such as the + * currency's shorthand sign. This is mostly useful when the shorthand + * sign is both internationally recognised and identifies the currency + * uniquely (e.g. the Euro sign). + * + * @throws Error on constructor failure. + */ +jsworld.MonetaryFormatter = function(locale, currencyCode, altIntSymbol) { + + if (typeof locale != "object" || locale._className != "jsworld.Locale") + throw "Constructor error: You must provide a valid jsworld.Locale instance"; + + this.lc = locale; + + /** + * @private + * @description Lookup table to determine the fraction digits for a + * specific currency; most currencies subdivide at 1/100 (2 fractional + * digits), so we store only those that deviate from the default. + * + *

The data is from Unicode's CLDR version 1.7.0. The two currencies + * with non-decimal subunits (MGA and MRO) are marked as having no + * fractional digits as well as all currencies that have no subunits + * in circulation. + * + *

It is "hard-wired" for referential convenience and is only looked + * up when an overriding currencyCode parameter is supplied. + */ + this.currencyFractionDigits = { + "AFN" : 0, "ALL" : 0, "AMD" : 0, "BHD" : 3, "BIF" : 0, + "BYR" : 0, "CLF" : 0, "CLP" : 0, "COP" : 0, "CRC" : 0, + "DJF" : 0, "GNF" : 0, "GYD" : 0, "HUF" : 0, "IDR" : 0, + "IQD" : 0, "IRR" : 0, "ISK" : 0, "JOD" : 3, "JPY" : 0, + "KMF" : 0, "KRW" : 0, "KWD" : 3, "LAK" : 0, "LBP" : 0, + "LYD" : 3, "MGA" : 0, "MMK" : 0, "MNT" : 0, "MRO" : 0, + "MUR" : 0, "OMR" : 3, "PKR" : 0, "PYG" : 0, "RSD" : 0, + "RWF" : 0, "SLL" : 0, "SOS" : 0, "STD" : 0, "SYP" : 0, + "TND" : 3, "TWD" : 0, "TZS" : 0, "UGX" : 0, "UZS" : 0, + "VND" : 0, "VUV" : 0, "XAF" : 0, "XOF" : 0, "XPF" : 0, + "YER" : 0, "ZMK" : 0 + }; + + + // optional currencyCode argument? + if (typeof currencyCode == "string") { + // user wanted to override the local currency + this.currencyCode = currencyCode.toUpperCase(); + + // must override the frac digits too, for some + // currencies have 0, 2 or 3! + var numDigits = this.currencyFractionDigits[this.currencyCode]; + if (typeof numDigits != "number") + numDigits = 2; // default for most currencies + this.lc.frac_digits = numDigits; + this.lc.int_frac_digits = numDigits; + } + else { + // use local currency + this.currencyCode = this.lc.int_curr_symbol.substring(0,3).toUpperCase(); + } + + // extract intl. currency separator + this.intSep = this.lc.int_curr_symbol.charAt(3); + + // flag local or intl. sign formatting? + if (this.currencyCode == this.lc.int_curr_symbol.substring(0,3)) { + // currency matches the local one? -> + // formatting with local symbol and parameters + this.internationalFormatting = false; + this.curSym = this.lc.currency_symbol; + } + else { + // currency doesn't match the local -> + + // do we have an overriding currency symbol? + if (typeof altIntSymbol == "string") { + // -> force formatting with local parameters, using alt symbol + this.curSym = altIntSymbol; + this.internationalFormatting = false; + } + else { + // -> force formatting with intl. sign and parameters + this.internationalFormatting = true; + } + } + + + /** + * @public + * + * @description Gets the currency symbol used in formatting. + * + * @returns {String} The currency symbol. + */ + this.getCurrencySymbol = function() { + + return this.curSym; + }; + + + /** + * @public + * + * @description Gets the position of the currency symbol relative to + * the amount. Assumes a non-negative amount and local formatting. + * + * @param {String} intFlag Optional flag to force international + * formatting by passing the string "i". + * + * @returns {Boolean} True if the symbol precedes the amount, false if + * the symbol succeeds the amount. + */ + this.currencySymbolPrecedes = function(intFlag) { + + if (typeof intFlag == "string" && intFlag == "i") { + // international formatting was forced + if (this.lc.int_p_cs_precedes == 1) + return true; + else + return false; + + } + else { + // check whether local formatting is on or off + if (this.internationalFormatting) { + if (this.lc.int_p_cs_precedes == 1) + return true; + else + return false; + } + else { + if (this.lc.p_cs_precedes == 1) + return true; + else + return false; + } + } + }; + + + /** + * @public + * + * @description Gets the decimal delimiter (radix) used in formatting. + * + * @returns {String} The radix character. + */ + this.getDecimalPoint = function() { + + return this.lc.mon_decimal_point; + }; + + + /** + * @public + * + * @description Gets the number of fractional digits. Assumes local + * formatting. + * + * @param {String} intFlag Optional flag to force international + * formatting by passing the string "i". + * + * @returns {integer Number} The number of fractional digits. + */ + this.getFractionalDigits = function(intFlag) { + + if (typeof intFlag == "string" && intFlag == "i") { + // international formatting was forced + return this.lc.int_frac_digits; + } + else { + // check whether local formatting is on or off + if (this.internationalFormatting) + return this.lc.int_frac_digits; + else + return this.lc.frac_digits; + } + }; + + + /** + * @public + * + * @description Formats a monetary amount according to the preset + * locale. + * + * 

+	 * For local currencies the native shorthand symbol will be used for
+	 * formatting.
+	 * Example:
+	 *        locale is en_US
+	 *        currency is USD
+	 *        -> the "$" symbol will be used, e.g. $123.45
+	 *        
+	 * For non-local currencies the international ISO-4217 code will be
+	 * used for formatting.
+	 * Example:
+	 *       locale is en_US (which has USD as currency)
+	 *       currency is EUR
+	 *       -> the ISO three-letter code will be used, e.g. EUR 123.45
+	 *
+	 * If the currency is non-local, but an alternative currency symbol was
+	 * provided, this will be used instead.
+	 * Example
+	 *       locale is en_US (which has USD as currency)
+	 *       currency is EUR
+	 *       an alternative symbol is provided - "€"
+	 *       -> the alternative symbol will be used, e.g. €123.45
+	 *
+ * + * @param {Number|String} amount The amount to format as currency. + * @param {String} [options] Options to modify the formatted output: + *
'; +html += '
Enter Your Password
'; +html += '
'; +html += '
Password:


'; +html += '
'; +html += '
'; +html += '

'; +html += ''; +html += ''; +html += ''; +html += '
' + large_icon_button('x', 'Cancel', "clear_login()") + ' ' + large_icon_button('check', 'Login', 'do_effect_login()') + '
'; +html += '
'; +html += ''; +session.hooks.keys[ENTER_KEY] = 'do_effect_login'; +session.hooks.keys[ESC_KEY] = 'clear_login'; +safe_focus( 'fe_lp_password' ); +show_popup_dialog(450, 225, html); +} +function clear_login() { +hide_popup_dialog(); +Nav.prev(); +} +function do_login() { +if ($('fe_username').value.match(/^\w+$/)) { +session.username = $('fe_username').value; +session.auto_login = $('fe_auto_login').checked; +do_login_prompt_2(); +return; +} +else { +do_openid_login(); +} +} +function do_openid_login() { +if (!$('fe_username').value) return; +session.openid_win = popup_window(''); +if (!session.openid_win) return; +session.open_id = $('fe_username').value; +session.auto_login = $('fe_auto_login') && $('fe_auto_login').checked; +hide_popup_dialog(); +show_progress_dialog(1, "Logging in..."); +session.hooks.before_error = 'close_openid_window'; +session.hooks.after_error = 'do_login_prompt'; +effect_api_send('openid_login', { +OpenID: session.open_id, +Infinite: session.auto_login ? 1 : 0 +}, 'do_openid_login_2'); +} +function close_openid_window() { +if (session.openid_win) { +session.openid_win.close(); +delete session.openid_win; +} +} +function do_openid_login_2(response) { +if (response.CheckURL) { +Debug.trace('openid', "Redirecting popup window to OpenID Check URL: " + response.CheckURL); +show_progress_dialog(1, "Waiting for popup window...", false, ['x', 'Cancel', 'do_login_prompt()']); +session.openid_win.location = response.CheckURL; +session.openid_win.focus(); +} +} +function receive_openid_response(iframe_response) { +var response = deep_copy_object(iframe_response); +Debug.trace('openid', "Received OpenID Response: " + dumper(response)); +hide_popup_dialog(); +if (response.Code) { +close_openid_window(); +return do_error( response.Description ); +} +delete session.hooks.before_error; +delete session.hooks.after_error; +if (response.SessionID) { +session.cookie.set( 'effect_session_id', response.SessionID ); +session.cookie.save(); +} +switch (response.Action) { +case 'popup': +show_progress_dialog(1, "Waiting for popup window...", false, ['x', 'Cancel', 'do_login_prompt()']); +Debug.trace('openid', "Redirecting popup window to OpenID Setup URL: " + response.SetupURL); +session.openid_win.location = response.SetupURL; +session.openid_win.focus(); +break; +case 'login': +close_openid_window(); +do_login_2(response); +break; +case 'register': +if (!response.Info) response.Info = {}; +close_openid_window(); +Debug.trace('openid', 'Original OpenID: ' + response.OpenID_Login); +Debug.trace('openid', 'Clean OpenID: ' + response.OpenID_Unique); +Debug.trace('openid', 'Registration Info: ' + dumper(response.Info)); +session.prereg = response.Info; +session.prereg.open_id_login = response.OpenID_Login; +session.prereg.open_id = response.OpenID_Unique; +if (session.user) { +if (!session.user.OpenIDs) session.user.OpenIDs = {}; +if (!session.user.OpenIDs.OpenID) session.user.OpenIDs.OpenID = []; +var dupe = find_object( session.user.OpenIDs.OpenID, { Unique: session.prereg.open_id } ); +if (dupe) return do_error("That OpenID is already registered and attached to your account. No need to add it again."); +session.user.OpenIDs.OpenID.push({ +Login: session.prereg.open_id_login, +Unique: session.prereg.open_id +}); +setTimeout( function() { +Nav.go('MyAccount', true); +do_message('success', 'Added new OpenID URL to account.'); +}, 1 ); +} +else { +setTimeout( function() { Nav.go('CreateAccount', true); }, 1 ); +} +break; +} +} +function do_effect_login() { +var password = $('fe_lp_password').value; +session.auto_login = $('fe_auto_login').checked; +hide_popup_dialog(); +show_progress_dialog(1, "Logging in..."); +session.hooks.after_error = 'do_login_prompt'; +effect_api_send('user_login', { +Username: session.username, +Password: password, +Infinite: session.auto_login ? 1 : 0 +}, 'do_login_2'); +} +function do_logout() { +effect_api_send('user_logout', {}, 'do_logout_2'); +} +function do_logout_2(response) { +hide_popup_dialog(); +show_default_login_status(); +delete session.hooks.after_error; +delete session.cookie.tree.effect_session_id; +session.cookie.save(); +session.storage = {}; +session.storage_dirty = false; +delete session.user; +delete session.first_login; +var old_username = session.username; +session.username = ''; +if (Nav.inited) { +Nav.go('Main'); +if (old_username) $GR.growl('success', "Logged out of account: " + old_username); +} +else { +Nav.init(); +} +} +function do_login_2(response, tx) { +if (response.FirstLogin) session.first_login = 1; +if (response.User.UserStorage) { +Debug.trace('Recovering site storage blob: session.storage = ' + response.User.UserStorage + ';'); +try { +eval( 'session.storage = ' + response.User.UserStorage + ';' ); +} +catch (e) { +Debug.trace("SITE STORAGE RECOVERY FAILED: " + e); +session.storage = {}; +} +delete response.User.UserStorage; +session.storage_dirty = false; +} +session.user = response.User; +session.username = session.user.Username; +hide_popup_dialog(); +delete session.hooks.after_error; +update_header(); +if (!tx || !tx._from_recover) $GR.growl('success', "Logged in as: " + session.username); +if (session.nav_after_login) { +Nav.go( session.nav_after_login ); +delete session.nav_after_login; +} +else if (Nav.currentAnchor().match(/^Login/)) { +Nav.go('Home'); +} +else { +Nav.refresh(); +} +Nav.init(); +} +function user_storage_mark() { +Debug.trace("Marking user storage as dirty"); +session.storage_dirty = true; +} +function user_storage_idle() { +if (session.storage_dirty && !session.mouseIsDown) { +user_storage_save(); +session.storage_dirty = false; +} +setTimeout( 'user_storage_idle()', 5000 ); +} +function user_storage_save() { +if (session.user) { +Debug.trace("Committing user storage blob"); +effect_api_send('update_user_storage', { Data: serialize(session.storage) }, 'user_storage_save_finish', { _silent: 1 } ); +} +} +function user_storage_save_finish(response, tx) { +} +function show_default_login_status() { +$('d_sidebar_wrapper_recent_games').hide(); +$('d_login_status').innerHTML = '
' + +'
' + +large_icon_button('key', "Login", '#Home') + '' + spacer(1,1) + '' + +'' + large_icon_button('user_add.png', "Signup", '#CreateAccount') + '
' + +'
'; +$('d_tagline').innerHTML = +'Login' + ' | ' + +'Create Account'; +} +function update_header() { +var html = ''; +html += '
'; +html += ''; +html += ''; +html += ''; +html += ''+spacer(2,2)+''; +html += session.user.FullName + '
'; +html += spacer(1,5) + '
'; +html += 'My Home  |  '; +html += 'Logout'; +html += '
'; +$('d_login_status').innerHTML = html; +$('d_tagline').innerHTML = +'Welcome '+session.user.FirstName+'' + ' | ' + +'My Home' + ' | ' + +'Logout'; +effect_api_get( 'get_user_games', { limit:5, offset:0 }, 'receive_sidebar_recent_games', { } ); +} +function receive_sidebar_recent_games(response, tx) { +var html = ''; +if (response.Rows && response.Rows.Row) { +var games = always_array( response.Rows.Row ); +for (var idx = 0, len = games.length; idx < len; idx++) { +var game = games[idx]; +html += '
'; +html += '
'+ww_fit_string(game.Title, 170, session.em_width, 1)+'
'; +html += '
'; +} +html += '
→ Create New Game...
'; +$('d_sidebar_recent_games').innerHTML = html; +$('d_sidebar_wrapper_recent_games').show(); +} +else { +$('d_sidebar_wrapper_recent_games').hide(); +} +} +function check_privilege(key) { +if (!session.user) return false; +if (session.user.Privileges.admin == 1) return true; +if (!key.toString().match(/^\//)) key = '/' + key; +var value = lookup_path(key, session.user.Privileges); +return( value && (value != 0) ); +} +function is_admin() { +return check_privilege('admin'); +} +function upgrade_flash_error() { +return alert("Sorry, file upload requires Adobe Flash Player 9 or higher."); +} +function cancel_user_image_manager() { +upload_destroy(); +hide_popup_dialog(); +delete session.hooks.keys[DELETE_KEY]; +} +function do_user_image_manager(callback) { +if (callback) session.uim_callback = callback; +else session.uim_callback = null; +session.temp_last_user_img = null; +session.temp_last_user_image_filename = ''; +var html = '
'; +html += '
Image Manager
'; +html += '
'; +html += ''; +html += '
'; +html += '
'; +html += ''; +html += ''; +html += ''; +html += ''; +html += ''; +html += '
' + large_icon_button('x', 'Cancel', 'cancel_user_image_manager()') + ' ' + large_icon_button('bullet_upload.png', 'Upload Files...', 'upload_basic()', 'b_upload_user_image') + ' ' + large_icon_button('check', 'Choose', 'do_choose_user_image()', 'btn_choose_user_image', '', 'disabled') + '
'; +html += '
'; +session.hooks.keys[ENTER_KEY] = 'do_choose_user_image'; +session.hooks.keys[ESC_KEY] = 'cancel_user_image_manager'; +session.hooks.keys[DELETE_KEY] = 'do_delete_selected_user_image'; +show_popup_dialog(500, 300, html); +var self = this; +setTimeout( function() { +prep_upload('b_upload_user_image', '/effect/api/upload_user_image', [self, 'do_upload_user_image_2'], ['Image Files', '*.jpg;*.jpe;*.jpeg;*.gif;*.png']); +}, 1 ); +var args = { +limit: 50, +offset: 0, +random: Math.random() +}; +effect_api_get( 'user_images_get', args, 'uim_populate_images', { } ); +} +function do_upload_user_image_2() { +effect_api_mod_touch('user_images_get'); +effect_api_send('user_get', { +Username: session.username +}, [this, 'do_upload_user_image_3']); +} +function do_upload_user_image_3(response) { +if (response.User.LastUploadError) return do_error( "Failed to upload image: " + response.User.LastUploadError ); +do_user_image_manager( session.uim_callback ); +} +function uim_populate_images(response, tx) { +var html = ''; +var base_url = '/effect/api/view/users/' + session.username + '/images'; +if (response.Rows && response.Rows.Row) { +var imgs = always_array( response.Rows.Row ); +for (var idx = 0, len = imgs.length; idx < len; idx++) { +var img = imgs[idx]; +var class_name = ((img.Filename == session.temp_last_user_image_filename) ? 'choose_item_selected' : 'choose_item'); +html += ''; +} +} +else { +html = ''; +} +$('d_user_image_list').innerHTML = html; +} +function do_select_user_image(img, filename) { +if (session.temp_last_user_img) session.temp_last_user_img.className = 'choose_item'; +img.className = 'choose_item_selected'; +$('btn_choose_user_image').removeClass('disabled'); +session.temp_last_user_img = img; +session.temp_last_user_image_filename = filename; +} +function do_delete_selected_user_image() { +if (session.temp_last_user_image_filename) { +effect_api_send('user_image_delete', { Filename: session.temp_last_user_image_filename }, 'do_delete_selected_user_image_finish', {}); +} +} +function do_delete_selected_user_image_finish(response, tx) { +try { $('d_user_image_list').removeChild( session.temp_last_user_img ); } catch(e) {;} +session.temp_last_user_img = null; +session.temp_last_user_image_filename = null; +} +function do_choose_user_image() { +if (!session.temp_last_user_image_filename) return; +if (session.uim_callback) { +fire_callback( session.uim_callback, session.temp_last_user_image_filename ); +} +cancel_user_image_manager(); +} +function user_image_thumbnail(filename, width, height, attribs) { +var username = session.username; +if (filename.match(/^(\w+)\/(.+)$/)) { +username = RegExp.$1; +filename = RegExp.$2; +} +var url = '/effect/api/view/users/' + username + '/images/' + filename.replace(/\.(\w+)$/, '_thumb.jpg'); +return ''; +} +function get_user_display(username, full_name, base_url) { +if (!base_url) base_url = ''; +return icon('user', full_name || username, base_url + '#User/' + username); +} +function get_game_tab_bar(game_id, cur_page_name) { +return tab_bar([ +['#Game/' + game_id, 'Game', 'controller.png'], +['#GameDisplay/' + game_id, 'Display', 'monitor.png'], +['#GameAssets/' + game_id, 'Assets', 'folder_page_white.png'], +['#GameObjects/' + game_id, 'Objects', 'bricks.png'], +['#GameAudio/' + game_id, 'Audio', 'sound.gif'], +['#GameKeys/' + game_id, 'Keyboard', 'keyboard.png'], +['#GameLevels/' + game_id, 'Levels', 'world.png'], +['#GamePublisher/' + game_id, 'Publish', 'cd.png'] +], cur_page_name); +} +function get_user_tab_bar(cur_page_name) { +var tabs = [ +['#Home', 'My Home', 'house.png'] +]; +tabs.push( ['#MyAccount', 'Edit Account', 'user_edit.png'] ); +tabs.push( ['#ArticleEdit', 'Post Article', 'page_white_edit.png'] ); +if (config.ProEnabled) { +tabs.push( ['#UserPayments', 'Payments', 'money.png'] ); +} +tabs.push( ['#UserLog', 'Security Log', 'application_view_detail.png'] ); +return tab_bar(tabs, cur_page_name); +} +function get_admin_tab_bar(cur_page_name) { +var tabs = []; +tabs.push( ['#Admin', 'Admin', 'lock.png'] ); +tabs.push( ['#TicketSearch/bugs', 'Bug Tracker', 'bug.png'] ); +tabs.push( ['#TicketSearch/helpdesk', 'Help Desk', 'telephone.png'] ); +tabs.push( ['#AdminReport', 'Reports', 'chart_pie.png'] ); +return tab_bar(tabs, cur_page_name); +} +function get_string(path, args) { +assert(window.config, "get_string() called before config loaded"); +if (!args) args = {}; +args.config = config; +args.session = session; +args.query = session.query; +var value = lookup_path(path, config.Strings); +return (typeof(value) == 'string') ? substitute(value, args) : value; +} +function normalize_dir_path(path) { +if (!path.match(/^\//)) path = '/' + path; +if (!path.match(/\/$/)) path += '/'; +return path; +} +function textedit_window_save(storage_key, filename, content, callback) { +if (!callback) callback = null; +effect_api_mod_touch('textedit'); +if (storage_key.match(/^\/games\/([a-z0-9][a-z0-9\-]*[a-z0-9])\/assets(.+)$/)) { +var game_id = RegExp.$1; +var path = RegExp.$2; +show_progress_dialog(1, "Saving file..."); +effect_api_send('asset_save_file_contents', { +GameID: game_id, +Path: path, +Filename: filename, +Content: content +}, 'textedit_window_save_finish', { _mode: 'asset', _game_id: game_id, _filename: filename, _callback: callback } ); +} +else { +show_progress_dialog(1, "Saving data..."); +effect_api_send('admin_save_file_contents', { +Path: storage_key, +Filename: filename, +Content: content +}, 'textedit_window_save_finish', { _mode: 'admin', _storage_key: storage_key, _filename: filename, _callback: callback } ); +} +} +function textedit_window_save_finish(response, tx) { +hide_progress_dialog(); +if (tx._mode == 'asset') { +do_message('success', "Saved asset: \""+tx._filename+"\""); +show_glog_widget(); +} +else { +do_message('success', "Saved data: \""+tx._storage_key+'/'+tx._filename+"\""); +} +if (tx._callback) tx._callback(); +} +function do_buy(args) { +$P().hide(); +$('d_page_loading').show(); +effect_api_send('create_order', args, 'do_buy_redirect', { _buy_args: args } ); +} +function do_buy_redirect(response, tx) { +var args = tx._buy_args; +$('fe_gco_title').value = args.Title || ''; +$('fe_gco_desc').value = args.Desc || ''; +$('fe_gco_price').value = args.Price || ''; +$('fe_gco_after').value = args.After || ''; +$('fe_gco_unique_id').value = response.OrderID; +Debug.trace('payment', "Redirecting to Google Checkout"); +setTimeout( function() { $('BB_BuyButtonForm').submit(); }, 1 ); +} +function show_glog_widget(game_id) { +if (!game_id) game_id = session.glog_game_id; +if (!game_id) { +$('glog_widget').hide(); +return; +} +if (game_id != session.glog_game_id) { +$('glog_widget').hide(); +session.glog_game_id = game_id; +update_glog_widget(game_id); +} +else { +$('glog_widget').show(); +setTimeout( function() { update_glog_widget(game_id); }, 500 ); +} +} +function update_glog_widget(game_id) { +effect_api_get('game_get_log', { +id: game_id, +offset: 0, +limit: 1, +rand: Math.random() +}, 'receive_glog_data', { _game_id: game_id }); +} +function receive_glog_data(response, tx) { +var game_id = tx._game_id; +if (response && response.Rows && response.Rows.Row) { +var rows = always_array( response.Rows.Row ); +var row = rows[0]; +var html = ''; +html += '
'; +html += '
Latest Game Activity
'; +html += '
View Log
'; +html += '
Post Message
'; +html += '
'; +html += '
'; +html += ''; +html += ''; +html += ''; +html += '
' + get_buddy_icon_display(row.Username, 1, 0) + ''; +html += '
' + icon( get_icon_for_glog_type(row.Type), ''+row.Message+'' ) + '
'; +html += '
' + get_relative_date(row.Date, true) + '
'; +html += '
'; +$('glog_widget').innerHTML = html; +$('glog_widget').show(); +} +} +function show_glog_post_dialog(game_id) { +hide_popup_dialog(); +delete session.progress; +var html = ''; +html += '
'; +html += '\n \n \n \n'); + }; + __out.push('\n\n'); + __out.push(require('templates/clients/modules/sub_header').call(this, { + heading: t("Ride Request") + })); + __out.push('\n\n\n
\n
\n
\n
\n \n \n \n \n
\n\n
'; +html += '
Post Game Log Message
'; +html += '
'; +html += ''; +html += '
Enter your log message here. Plain text only please.
'; +html += '
'; +html += '

'; +html += ''; +html += ''; +html += ''; +html += '
' + large_icon_button('x', 'Cancel', "hide_popup_dialog()") + ' ' + large_icon_button('check', 'Post Message', "glog_post('"+game_id+"')") + '
'; +html += '
'; +html += ''; +session.hooks.keys[ESC_KEY] = 'hide_popup_dialog'; +safe_focus( 'fe_glog_body' ); +show_popup_dialog(500, 175, html); +} +function glog_post(game_id) { +var msg = trim( $('fe_glog_body').value ); +if (msg) { +hide_popup_dialog(); +effect_api_send('game_post_log', { +GameID: game_id, +Message: msg +}, [this, 'glog_post_finish'], { _game_id: game_id }); +} +} +function glog_post_finish(response, tx) { +show_glog_widget( tx._game_id ); +} +function hide_glog_widget() { +$('glog_widget').hide(); +} +function get_icon_for_glog_type(type) { +var icon = 'page_white.png'; +switch (type) { +case 'asset': icon = 'folder_page_white.png'; break; +case 'game': icon = 'controller.png'; break; +case 'member': icon = 'user'; break; +case 'comment': icon = 'comment.png'; break; +case 'level': icon = 'world.png'; break; +case 'sprite': icon = 'cog.png'; break; +case 'tile': icon = 'brick.png'; break; +case 'tileset': icon = 'color_swatch.png'; break; +case 'rev': icon = 'cd.png'; break; +case 'revision': icon = 'cd.png'; break; +case 'font': icon = 'style.png'; break; +case 'key': icon = 'keyboard.png'; break; +case 'audio': icon = 'sound'; break; +case 'payment': icon = 'money.png'; break; +case 'env': icon = 'weather.png'; break; +case 'environment': icon = 'weather.png'; break; +} +return icon; +} +function effect_load_script(url) { +Debug.trace('api', 'Loading script: ' + url); +load_script(url); +} +function effect_api_get_ie(cmd, params, userData) { +if (!session.api_state_ie) session.api_state_ie = {}; +var unique_id = get_unique_id(); +session.api_state_ie[unique_id] = userData; +params.format = 'js'; +params.onafter = 'effect_api_response_ie(' + unique_id + ', response);'; +var url = '/effect/api/' + cmd + composeQueryString(params); +Debug.trace('api', "Sending MSIE HTTP GET: " + url); +load_script(url); +} +function effect_api_response_ie(unique_id, tree) { +Debug.trace('api', "Got response from MSIE HTTP GET"); +var tx = session.api_state_ie[unique_id]; +delete session.api_state_ie[unique_id]; +if (tree.Code == 'session') { +do_logout_2(); +return; +} +if (tree.Code == 'access') { +do_notice("Access Denied", tree.Description, 'do_not_pass_go'); +return; +} +if (tree.Code != 0) { +if (tx._on_error) return fire_callback( tx._on_error, tree, tx ); +return do_error( tree.Description ); +} +if (tree.SessionID) { +if (tree.SessionID == '_DELETE_') { +delete session.cookie.tree.effect_session_id; +} +else { +session.cookie.set( 'effect_session_id', tree.SessionID ); +} +session.cookie.save(); +} +if (tx._api_callback) { +fire_callback( tx._api_callback, tree, tx ); +} +} +function effect_api_get(cmd, params, callback, userData) { +if (!userData) userData = {}; +userData._api_callback = callback; +if (!session.api_mod_cache[cmd] && session.username) session.api_mod_cache[cmd] = hires_time_now(); +if (!params.mod && session.api_mod_cache[cmd]) params.mod = session.api_mod_cache[cmd]; +if (ie) return effect_api_get_ie(cmd, params, userData); +var url = '/effect/api/' + cmd + composeQueryString(params); +Debug.trace('api', "Sending HTTP GET: " + url); +ajax.get( url, 'effect_api_response', userData ); +} +function effect_api_send(cmd, xml, callback, userData) { +if (!userData) userData = {}; +userData._api_callback = callback; +var data = compose_xml('EffectRequest', xml); +Debug.trace('api', "Sending API Command: " + cmd + ": " + data); +ajax.send({ +method: 'POST', +url: '/effect/api/' + cmd, +data: data, +headers: { 'Content-Type': 'text/xml' } +}, 'effect_api_response', userData); +} +function effect_api_response(tx) { +Debug.trace('api', "HTTP " + tx.response.code + ": " + tx.response.data); +if (tx.response.code == 999) { +if (tx.request._auto_retry) { +session.net_error = false; +show_progress_dialog(1, "Trying to reestablish connection..."); +session.net_error = true; +setTimeout( function() { ajax.send(tx.request); }, 1000 ); +return; +} +else return do_error( "HTTP ERROR: " + tx.response.code + ": " + tx.response.data + ' (URL: ' + tx.request.url + ')' ); +} +if (session.net_error) { +hide_progress_dialog(); +session.net_error = false; +} +if (tx.response.code != 200) { +if (tx._silent) return; +else return do_error( "HTTP ERROR: " + tx.response.code + ": " + tx.response.data + ' (URL: ' + tx.request.url + ')' ); +} +var tree = null; +if (!tx._raw) { +var parser = new XML({ +preserveAttributes: true, +text: tx.response.data +}); +if (parser.getLastError()) return do_error("XML PARSE ERROR: " + parser.getLastError()); +tree = parser.getTree(); +if (tree.Code == 'session') { +do_logout_2(); +return; +} +if (tree.Code == 'access') { +do_notice("Access Denied", tree.Description, 'do_not_pass_go'); +return; +} +if (tree.Code != 0) { +if (tx._on_error) return fire_callback( tx._on_error, tree, tx ); +return do_error( tree.Description ); +} +if (tree.SessionID) { +if (tree.SessionID == '_DELETE_') { +delete session.cookie.tree.effect_session_id; +} +else { +session.cookie.set( 'effect_session_id', tree.SessionID ); +} +session.cookie.save(); +} +} +if (tx._api_callback) { +fire_callback( tx._api_callback, tree, tx ); +} +} +function effect_api_mod_touch() { +for (var idx = 0, len = arguments.length; idx < len; idx++) { +session.api_mod_cache[ arguments[idx] ] = hires_time_now(); +} +} +function do_not_pass_go() { +Nav.go('Main'); +} +var Nav = { +loc: '', +old_loc: '', +inited: false, +nodes: [], +init: function() { +if (!this.inited) { +this.inited = true; +this.loc = 'init'; +this.monitor(); +} +}, +monitor: function() { +var parts = window.location.href.split(/\#/); +var anchor = parts[1]; +if (!anchor) anchor = 'Main'; +var full_anchor = '' + anchor; +var sub_anchor = ''; +anchor = anchor.replace(/\%7C/, '|'); +if (anchor.match(/\|(\w+)$/)) { +sub_anchor = RegExp.$1.toLowerCase(); +anchor = anchor.replace(/\|(\w+)$/, ''); +} +if ((anchor != this.loc) && !anchor.match(/^_/)) { +Debug.trace('nav', "Caught navigation anchor: " + full_anchor); +var page_name = ''; +var page_args = null; +if (full_anchor.match(/^\w+\?.+/)) { +parts = full_anchor.split(/\?/); +page_name = parts[0]; +page_args = parseQueryString( parts[1] ); +} +else if (full_anchor.match(/^(\w+)\/(.*)$/)) { +page_name = RegExp.$1; +page_args = RegExp.$2; +} +else { +parts = full_anchor.split(/\//); +page_name = parts[0]; +page_args = parts.slice(1); +} +Debug.trace('nav', "Calling page: " + page_name + ": " + serialize(page_args)); +hide_popup_dialog(); +var result = page_manager.click( page_name, page_args ); +if (result) { +if (window.pageTracker && (this.loc != 'init')) { +setTimeout( function() { pageTracker._trackPageview('/effect/' + anchor); }, 1000 ); +} +this.old_loc = this.loc; +if (this.old_loc == 'init') this.old_loc = 'Main'; +this.loc = anchor; +} +else { +this.go( this.loc ); +} +} +else if (sub_anchor != this.sub_anchor) { +Debug.trace('nav', "Caught sub-anchor: " + sub_anchor); +$P().gosub( sub_anchor ); +} +this.sub_anchor = sub_anchor; +setTimeout( 'Nav.monitor()', 100 ); +}, +go: function(anchor, force) { +anchor = anchor.replace(/^\#/, ''); +if (force) this.loc = 'init'; +window.location.href = '#' + anchor; +}, +prev: function() { +this.go( this.old_loc || 'Main' ); +}, +refresh: function() { +this.loc = 'refresh'; +}, +bar: function() { +var nodes = arguments; +var html = ''; +for (var idx = 0, len = nodes.length; idx < len; idx++) { +var node = nodes[idx]; +if (node) this.nodes[idx] = node; +else node = this.nodes[idx]; +if (node != '_ignore_') { +html += ''; +} +} +html += '
'; +$('d_nav_bar').innerHTML = html; +}, +title: function(name) { +if (name) document.title = name + ' | EffectGames.com'; +else document.title = 'EffectGames.com'; +}, +currentAnchor: function() { +var parts = window.location.href.split(/\#/); +var anchor = parts[1] || ''; +var sub_anchor = ''; +anchor = anchor.replace(/\%7C/, '|'); +if (anchor.match(/\|(\w+)$/)) { +sub_anchor = RegExp.$1.toLowerCase(); +anchor = anchor.replace(/\|(\w+)$/, ''); +} +return anchor; +} +}; +var Blog = { +edit_caption: '
*Bold*  |Italic|  {monospace}  [http://link]  Formatting Guide...
', +search: function(args) { +if (!args.mode) args.mode = 'and'; +if (!args.offset) args.offset = 0; +if (!args.limit) args.limit = 10; +if (!args.format) args.format = 'xml'; +var query_args = copy_object( args ); +delete query_args.callback; +effect_api_get( 'article_search', query_args, [this, 'search_response'], { _search_args: args } ); +}, +get_article_preview: function(row, args) { +var html = ''; +Debug.trace('blog', 'Row: ' + dumper(row)); +html += '
'; +var ext_article_url = 'http://' + location.hostname + '/effect/article.psp.html' + row.Path + '/' + row.ArticleID; +var article_url = '#Article' + row.Path + '/' + row.ArticleID; +html += '
' + row.Title + '
'; +if (!args.title_only) { +html += '
'; +html += row.Preview; +html += '  ' + (args.link_title || 'Read Full Story...') + ''; +html += '
'; +html += ''; +html += '
'; +var elem_class = args.footer_element_class || 'blog_preview_footer_element'; +if ((session.username == row.Username) || is_admin()) { +html += '
' + +icon('page_white_edit.png', "Edit", '#ArticleEdit?path=' + row.Path + '&id=' + row.ArticleID) + '
'; +} +html += '
' + get_user_display(row.Username) + '
'; +html += '
' + icon('calendar', get_short_date_time(row.Published)) + '
'; +html += '
' + icon('talk', row.Comments) + '
'; +if (0 && row.Tags) html += '
' + icon('note.png', make_tag_links(row.Tags, 3)) + '
'; +html += '
' + icon('facebook.png', 'Facebook', "window.open('http://www.facebook.com/sharer.php?u="+encodeURIComponent(ext_article_url)+'&t='+encodeURIComponent(row.Title)+"','sharer','toolbar=0,status=0,width=626,height=436')", "Share on Facebook") + '
'; +html += '
' + icon('twitter.png', 'Twitter', "window.open('http://twitter.com/home?status=Reading%20" + encodeURIComponent(row.Title) + "%3A%20" + encodeURIComponent(ext_article_url)+"')", "Share on Twitter") + '
'; +html += ''; +html += '
'; +html += '
'; +} +html += '
'; +return html; +}, +search_response: function(response, tx) { +var args = tx._search_args; +if (args.callback) return fire_callback(args.callback, response, args); +var div = $(args.target); +assert(div, "Could not find target DIV: " + args.target); +var html = ''; +if (response.Rows && response.Rows.Row) { +var rows = always_array( response.Rows.Row ); +for (var idx = 0, len = rows.length; idx < len; idx++) { +var row = rows[idx]; +html += this.get_article_preview( row, args ); +} +if (args.more && (rows.length == args.limit)) { +html += large_icon_button('page_white_put.png', 'More...', "Blog.more(this, "+encode_object(args)+")") + '
'; +html += spacer(1,15) + '
'; +} +if (args.after) html += args.after; +} +else if (response.Code != 0) { +html = 'Search Error: ' . response.Code + ': ' + response.Description; +} +else { +html = args.none_found_msg || 'No articles found.'; +} +div.innerHTML = html; +}, +more: function(div, args) { +args.offset += args.limit; +Debug.trace('blog', "More Args: " + dumper(args)); +div.innerHTML = ''; +effect_api_get( 'article_search', args, [this, 'more_response'], { _search_args: args, _div: div } ); +}, +more_response: function(response, tx) { +var args = tx._search_args; +var button = tx._div; +var html = ''; +if (response.Rows && response.Rows.Row) { +var rows = always_array( response.Rows.Row ); +for (var idx = 0, len = rows.length; idx < len; idx++) { +var row = rows[idx]; +html += this.get_article_preview( row, args ); +} +if (args.more && (rows.length == args.limit)) { +html += large_icon_button('page_white_put.png', 'More...', "Blog.more(this, "+encode_object(args)+")") + '
'; +html += spacer(1,15) + '
'; +} +} +else if (response.Code != 0) { +html = 'Search Error: ' . response.Code + ': ' + response.Description; +} +else { +html = args.none_found_msg || 'No more articles found.'; +} +var div = document.createElement('div'); +div.innerHTML = html; +button.parentNode.replaceChild( div, button ); +} +}; +function make_tag_links(csv, max, base_url) { +if (!base_url) base_url = ''; +var tags = csv.split(/\,\s*/); +var append = ''; +if (max && (tags.length > max)) { +tags.length = max; +append = '...'; +} +var html = ''; +for (var idx = 0, len = tags.length; idx < len; idx++) { +html += ''+tags[idx]+''; +if (idx < len - 1) html += ', '; +} +html += append; +return html; +} +function get_url_friendly_title(title) { +title = title.toString().replace(/\W+/g, '_'); +if (title.length > 40) title = title.substring(0, 40); +title = title.replace(/^_+/, ''); +title = title.replace(/_+$/, ''); +return title; +} +function get_full_url(url) { +if (url.match(/^\#/)) { +var parts = window.location.href.split(/\#/); +url = parts[0] + url; +} +return url; +} +var Comments = { +comments_per_page: 10, +get: function(page_id) { +var html = ''; +html += '
'; +html += '
Comments'; +html += '
'; +html += '
'; +html += '
'; +setTimeout( function() { Comments.search({ page_id: page_id }); }, 1 ); +return html; +}, +search: function(args) { +if (!args.limit) args.limit = this.comments_per_page; +if (!args.offset) args.offset = 0; +assert(args.page_id, "Comments.search: No page_id specified"); +args.format = 'xml'; +this.last_search = args; +effect_api_get( 'comments_get', args, [this, 'search_response'], { _search_args: args } ); +}, +research: function(offset) { +var args = this.last_search; +if (!args) return; +args.offset = offset; +effect_api_get( 'comments_get', args, [this, 'search_response'], { _search_args: args } ); +}, +search_response: function(response, tx) { +this.comments = []; +var args = tx._search_args; +if (args.callback) return fire_callback(args.callback, response, args); +var html = ''; +html += '
' + +large_icon_button( 'comment_edit.png', 'Post Comment...', "Comments.add('"+args.page_id+"')" ) + '
'; +if (args.page_id.match(/^Article\//)) { +html += '
' + icon('feed.png', 'RSS', '/effect/api/comment_feed/' + args.page_id + '.rss', 'Comments RSS Feed') + '
'; +} +if (response.Items && response.Items.Item && response.List && response.List.length) { +html += ''; +html += '
'; +var items = this.comments = always_array( response.Items.Item ); +for (var idx = 0, len = items.length; idx < len; idx++) { +var item = items[idx]; +var extra_classes = (args.highlight && (args.highlight == item.ID)) ? ' highlight' : ''; +html += '
'; +html += '
'; +if (item.Username) html += ''; +html += '' + item.Name.toString().toUpperCase() + ''; +if (item.Username) html += ''; +html += ', ' + get_short_date_time(item.Date) + '
'; +html += '
'; +html += this.get_comment_controls( args.page_id, item ); +html += '
'; +html += '
'; +html += '
' + item.Comment + '
'; +html += '
'; +html += ''; +if (item.LastReply && ((item.LastReply >= time_now() - (86400 * 7)) || (session.username && (session.username == item.Username)))) { +setTimeout( "Comments.show_replies('"+args.page_id+"','"+item.ID+"')", 1 ); +} +} +} +else { +} +$( 'd_comments_' + args.page_id ).innerHTML = html; +}, +get_control: function(icon, code, text, status_text) { +if (!icon.match(/\.\w+$/)) icon += '.gif'; +return '' + code_link(code, text, status_text) + ''; +}, +get_comment_controls: function(page_id, comment) { +var html = ''; +var spacer_txt = '  |  '; +if (session.user) { +html += this.get_control('comment', "Comments.reply('"+page_id+"','"+comment.ID+"')", 'Reply') + spacer_txt; +} +if (comment.Replies) { +if (comment._replies_visible) html += this.get_control('magnify_minus', "Comments.hide_replies('"+page_id+"','"+comment.ID+"')", 'Hide Replies'); +else html += this.get_control('magnify_plus', "Comments.show_replies('"+page_id+"','"+comment.ID+"')", 'Show Replies ('+comment.Replies+')'); +if (session.user) html += spacer_txt; +} +if (session.user) { +html += this.get_control( +'star', +"Comments.like('"+page_id+"','"+comment.ID+"')", +'Like' + (comment.Like ? (' ('+comment.Like+')') : ''), +comment.Like ? (comment.Like + ' ' + ((comment.Like == 1) ? 'person likes this' : 'people like this')) : 'I like this comment' +) + spacer_txt; +if (is_admin()) html += this.get_control('trash', "Comments._delete('"+page_id+"','"+comment.ID+"')", 'Delete') + spacer_txt; +html += this.get_control('warning', "Comments.report('"+page_id+"','"+comment.ID+"')", 'Report Abuse'); +} +return html; +}, +reply: function(page_id, comment_id) { +hide_popup_dialog(); +delete session.progress; +var comment = find_object( this.comments, { ID: comment_id } ); +var html = ''; +html += '
'; +html += '\n \n \n \n \n \n \n \n \n \n '); + }, this); + __out.push('\n\n
\n
'; +html += '
Reply to Comment by "'+comment.Name+'"
'; +html += '
'; +var name = this.get_name(); +html += '

Posted by: ' + name; +if (!session.user) html += ' → Create Account'; +html += '


'; +html += ''; +html += Blog.edit_caption; +html += '
'; +html += '

'; +html += ''; +html += ''; +html += ''; +html += '
' + large_icon_button('x', 'Cancel', "hide_popup_dialog()") + ' ' + large_icon_button('check', 'Post Reply', "Comments.post_reply('"+page_id+"','"+comment_id+"')") + '
'; +html += '
'; +html += ''; +session.hooks.keys[ESC_KEY] = 'hide_popup_dialog'; +safe_focus( 'fe_comment_body' ); +show_popup_dialog(600, 300, html); +}, +post_reply: function(page_id, comment_id) { +var value = $('fe_comment_body').value; +if (!value) return; +hide_popup_dialog(); +show_progress_dialog(1, "Posting reply..."); +var name = this.get_name(); +effect_api_mod_touch('comment_replies_get'); +effect_api_send('comment_post_reply', { +PageID: page_id, +CommentID: comment_id, +Username: session.username || '', +Name: name, +Comment: value, +PageURL: location.href +}, [this, 'post_reply_finish'], { _page_id: page_id, _comment_id: comment_id } ); +}, +post_reply_finish: function(response, tx) { +hide_popup_dialog(); +var page_id = tx._page_id; +var comment_id = tx._comment_id; +var comment = find_object( this.comments, { ID: comment_id } ); +do_message('success', "Comment reply posted successfully."); +this.show_replies(page_id, comment_id); +if (!comment.Replies) comment.Replies = 1; else comment.Replies++; +$('d_comment_controls_'+comment_id).innerHTML = this.get_comment_controls( page_id, comment ); +}, +show_replies: function(page_id, comment_id) { +var comment = find_object( this.comments, { ID: comment_id } ); +if (!comment._replies_visible) { +$('d_comment_replies_' + comment_id).show().innerHTML = ''; +} +var args = { page_id: page_id, comment_id: comment_id, offset: 0, limit: 100 }; +effect_api_get( 'comment_replies_get', args, [this, 'receive_replies_response'], { _search_args: args } ); +}, +receive_replies_response: function(response, tx) { +var page_id = tx._search_args.page_id; +var comment_id = tx._search_args.comment_id; +var comment = find_object( this.comments, { ID: comment_id } ); +var html = ''; +var replies = always_array( response.Items.Item ); +for (var idx = 0, len = replies.length; idx < len; idx++) { +var reply = replies[idx]; +html += get_chat_balloon( +(reply.Username == session.username) ? 'blue' : 'grey', +reply.Username, +reply.Comment.replace(/^]*?>(.+)<\/div>$/i, '$1') +); +} +$('d_comment_replies_' + comment_id).innerHTML = html; +if (!comment._replies_visible) { +$('d_comment_replies_' + comment_id).hide(); +animate_div_visibility( 'd_comment_replies_' + comment_id, true ); +} +comment._replies_visible = true; +$('d_comment_controls_'+comment_id).innerHTML = this.get_comment_controls( page_id, comment ); +}, +hide_replies: function(page_id, comment_id) { +var comment = find_object( this.comments, { ID: comment_id } ); +if (comment._replies_visible) { +animate_div_visibility( 'd_comment_replies_' + comment_id, false ); +comment._replies_visible = false; +$('d_comment_controls_'+comment_id).innerHTML = this.get_comment_controls( page_id, comment ); +} +}, +like: function(page_id, comment_id) { +effect_api_mod_touch('comments_get'); +effect_api_send('comment_like', { +PageID: page_id, +CommentID: comment_id +}, [this, 'like_finish'], { _page_id: page_id, _comment_id: comment_id, _on_error: [this, 'like_error'] } ); +}, +like_error: function(response, tx) { +if (response.Code == 'comment_already_like') do_message('error', "You already like this comment."); +else do_error( response.Description ); +}, +like_finish: function(resopnse, tx) { +var page_id = tx._page_id; +var comment_id = tx._comment_id; +var comment = find_object( this.comments, { ID: comment_id } ); +do_message('success', "You now like this comment."); +if (!comment.Like) comment.Like = 1; else comment.Like++; +$('d_comment_controls_'+comment_id).innerHTML = this.get_comment_controls( page_id, comment ); +}, +add: function(page_id) { +hide_popup_dialog(); +delete session.progress; +var html = ''; +html += '
'; +html += '", "" ], + legend: [ 1, "
", "
" ], + thead: [ 1, "
'; +html += '
Post New Comment
'; +html += '
'; +var name = this.get_name(); +html += '

Posted by: ' + name; +if (!session.user) html += ' → Create Account'; +html += '


'; +html += ''; +html += Blog.edit_caption; +html += '
'; +html += '

'; +html += ''; +html += ''; +html += ''; +html += '
' + large_icon_button('x', 'Cancel', "hide_popup_dialog()") + ' ' + large_icon_button('check', 'Post Comment', "Comments.post('"+page_id+"')") + '
'; +html += '
'; +html += ''; +session.hooks.keys[ESC_KEY] = 'hide_popup_dialog'; +safe_focus( 'fe_comment_body' ); +show_popup_dialog(600, 300, html); +}, +report: function(page_id, comment_id) { +if (confirm('Are you sure you want to report this comment to the site administrators as abusive and/or spam?')) { +effect_api_send('comment_report_abuse', { +PageID: page_id, +CommentID: comment_id +}, [this, 'report_finish'], { _page_id: page_id, _comment_id: comment_id } ); +} +}, +report_finish: function(response, tx) { +do_message('success', 'Your abuse report has been received, and will be evaluated by the site administrators.'); +}, +_delete: function(page_id, comment_id) { +if (confirm('Are you sure you want to permanently delete this comment?')) { +effect_api_mod_touch('comments_get'); +effect_api_send('comment_delete', { +PageID: page_id, +CommentID: comment_id +}, [this, 'delete_finish'], { _page_id: page_id, _comment_id: comment_id } ); +} +}, +delete_finish: function(response, tx) { +do_message('success', 'The comment was deleted successfully.'); +var page_id = tx._page_id; +this.search({ page_id: page_id }); +}, +get_name: function() { +var name = '(Anonymous)'; +if (session.user) { +if (get_bool_pref('public_profile')) name = session.user.FullName; +else name = session.username; +} +return name; +}, +post: function(page_id) { +var value = $('fe_comment_body').value; +if (!value) return; +hide_popup_dialog(); +show_progress_dialog(1, "Posting comment..."); +var name = this.get_name(); +effect_api_mod_touch('comments_get'); +effect_api_send('comment_post', { +PageID: page_id, +Username: session.username || '', +Name: name, +Comment: value +}, [this, 'post_finish'], { _page_id: page_id } ); +}, +post_finish: function(response, tx) { +hide_popup_dialog(); +var comment_id = response.CommentID; +var page_id = tx._page_id; +this.search({ page_id: page_id, highlight: comment_id }); +} +}; +Class.create( 'Menu', { +id: '', +menu: null, +__construct: function(id) { +this.id = id; +}, +load: function() { +if (!this.menu) { +this.menu = $(this.id); +assert( !!this.menu, "Could not locate DOM element: " + this.id ); +} +}, +get_value: function() { +this.load(); +return this.menu.options[this.menu.selectedIndex].value; +}, +set_value: function(value, auto_add) { +value = str_value(value); +this.load(); +for (var idx = 0, len = this.menu.options.length; idx < len; idx++) { +if (this.menu.options[idx].value == value) { +this.menu.selectedIndex = idx; +return true; +} +} +if (auto_add) { +this.menu.options[this.menu.options.length] = new Option(value, value); +this.menu.selectedIndex = this.menu.options.length - 1; +return true; +} +return false; +}, +disable: function() { +this.load(); +this.menu.disabled = true; +this.menu.setAttribute( 'disabled', 'disabled' ); +}, +enable: function() { +this.load(); +this.menu.setAttribute( 'disabled', '' ); +this.menu.disabled = false; +}, +populate: function(items, sel_value) { +this.load(); +this.menu.options.length = 0; +for (var idx = 0, len = items.length; idx < len; idx++) { +var item = items[idx]; +var item_name = ''; +var item_value = ''; +if (isa_hash(item)) { +item_name = item.label; +item_value = item.data; +} +else if (isa_array(item)) { +item_name = item[0]; +item_value = item[1]; +} +else { +item_name = item_value = item; +} +this.menu.options[ this.menu.options.length ] = new Option( item_name, item_value ); +if (item_value == sel_value) this.menu.selectedIndex = idx; +} +} +} ); +Class.subclass( Menu, 'MultiMenu', { +__static: { +toggle_type: function(id) { +var menu = $(id); +assert(menu, "Could not find menu in DOM: " + id); +if (menu.disabled) return; +var obj = MenuManager.find(id); +assert(obj, "Could not find menu in MenuManager: " + id); +var div = $( 'd_inner_' + id ); +var ic = $( 'ic_' + id ); +var is_multiple = (ic.src.indexOf('contract') > -1); +obj.multi = !is_multiple; +var multiple_tag = !is_multiple ? +' multiple="multiple" size=5' : ''; +var items = []; +for (var idx = 0; idx < menu.options.length; idx++) { +var option = menu.options[idx]; +array_push( items, { +value: option.value, +text: option.text, +selected: option.selected +}); +} +var html = ''; +html += ''; +div.innerHTML = html; +ic.src = images_uri + '/menu_' + (is_multiple ? 'expand' : 'contract') + '.gif'; +obj.menu = null; +} +}, +attribs: null, +multi: false, +toggle: true, +__construct: function(id, attribs) { +this.id = id; +if (attribs) this.attribs = attribs; +}, +get_html: function(items, selected_csv, attribs) { +if (!items) items = []; +if (!selected_csv) selected_csv = ''; +if (attribs) this.attribs = attribs; +var selected = csv_to_hash(selected_csv); +this.menu = null; +if (num_keys(selected) > 1) this.multi = true; +var html = '
'; +html += ''; +html += ''; +html += ''; +if (this.toggle) html += ''; +html += '
' + spacer(1,1) + '
'+spacer(1,2)+'
'; +html += '
'; +return html; +}, +get_value: function() { +this.load(); +var value = ''; +for (var idx = 0; idx < this.menu.options.length; idx++) { +var option = this.menu.options[idx]; +if (option.selected && option.value.length) { +if (value.length > 0) value += ','; +value += option.value; +} +} +return value; +}, +set_value: function(value, auto_add) { +value = '' + value; +this.load(); +if (!value) { +value = ''; +for (var idx = 0; idx < this.menu.options.length; idx++) { +var option = this.menu.options[idx]; +option.selected = (option.value == value); +} +return; +} +var selected = csv_to_hash(value); +if ((num_keys(selected) > 1) && !this.multi) { +MultiMenu.toggle_type(this.id); +var self = this; +setTimeout( function() { +self.set_value(value, auto_add); +}, 1 ); +return; +} +for (var idx = 0; idx < this.menu.options.length; idx++) { +var option = this.menu.options[idx]; +option.selected = selected[option.value] ? true : false; +} +}, +populate: function(items, value) { +this.load(); +this.menu.options.length = 0; +if (!value) value = ''; +var selected = csv_to_hash(value); +for (var idx = 0, len = items.length; idx < len; idx++) { +var item = items[idx]; +var item_name = ''; +var item_value = ''; +if (isa_hash(item)) { +item_name = item.label; +item_value = item.data; +} +else if (isa_array(item)) { +item_name = item[0]; +item_value = item[1]; +} +else { +item_name = item_value = item; +} +var opt = new Option( item_name, item_value ); +this.menu.options[ this.menu.options.length ] = opt; +opt.selected = selected[item_value] ? true : false; +} +}, +collapse: function() { +if (this.multi) MultiMenu.toggle_type(this.id); +}, +expand: function() { +if (!this.multi) MultiMenu.toggle_type(this.id); +} +} ); +Class.create( 'MenuManager', { +__static: { +menus: {}, +register: function(menu) { +this.menus[ menu.id ] = menu; +return menu; +}, +find: function(id) { +return this.menus[id]; +} +} +} ); +Class.create( 'GrowlManager', { +lifetime: 10, +marginRight: 0, +marginTop: 0, +__construct: function() { +this.growls = []; +}, +growl: function(type, msg) { +if (find_object(this.growls, { type: type, msg: msg })) return; +var div = $(document.createElement('div')); +div.className = 'growl_message ' + type; +div.setOpacity(0.0); +div.innerHTML = '
' + msg + '
' + spacer(1,5) + '
'; +$('d_growl_wrapper').insertBefore( div, $('d_growl_top').nextSibling ); +var growl = { id:get_unique_id(), type: type, msg: msg, opacity:0.0, start:hires_time_now(), div:div }; +this.growls.push(growl); +this.handle_resize(); +this.animate(growl); +var self = this; +div.onclick = function() { +delete_object(self.growls, { id: growl.id }); +$('d_growl_wrapper').removeChild( div ); +}; +}, +animate: function(growl) { +if (growl.deleted) return; +var now = hires_time_now(); +var div = growl.div; +if (now - growl.start <= 0.5) { +div.setOpacity( tweenFrame(0.0, 1.0, (now - growl.start) * 2, 'EaseOut', 'Quadratic') ); +} +else if (now - growl.start <= this.lifetime) { +if (!growl._fully_opaque) { +div.setOpacity( 1.0 ); +growl._fully_opaque = true; +} +} +else if (now - growl.start <= this.lifetime + 1.0) { +div.setOpacity( tweenFrame(1.0, 0.0, (now - growl.start) - this.lifetime, 'EaseOut', 'Quadratic') ); +} +else { +delete_object(this.growls, { id: growl.id }); +$('d_growl_wrapper').removeChild( div ); +return; +} +var self = this; +setTimeout( function() { self.animate(growl); }, 33 ); +}, +handle_resize: function() { +var div = $('d_growl_wrapper'); +if (this.growls.length) { +var size = getInnerWindowSize(); +div.style.top = '' + (10 + this.marginTop) + 'px'; +div.style.left = '' + Math.floor((size.width - 310) - this.marginRight) + 'px'; +} +else { +div.style.left = '-2000px'; +} +} +} ); +window.$GR = new GrowlManager(); +if (window.addEventListener) { +window.addEventListener( "resize", function() { +$GR.handle_resize(); +}, false ); +} +else if (window.attachEvent && !ie6) { +window.attachEvent("onresize", function() { +$GR.handle_resize(); +}); +} +Class.create( 'Effect.Page', { +ID: '', +data: null, +active: false, +__construct: function(config) { +if (!config) return; +this.data = {}; +if (!config) config = {}; +for (var key in config) this[key] = config[key]; +this.div = $('page_' + this.ID); +assert(this.div, "Cannot find page div: page_" + this.ID); +}, +onInit: function() { +}, +onActivate: function() { +return true; +}, +onDeactivate: function() { +return true; +}, +show: function() { +this.div.show(); +}, +hide: function() { +this.div.hide(); +}, +gosub: function(anchor) { +} +} ); +Class.require( 'Effect.Page' ); +Class.create( 'Effect.PageManager', { +pages: null, +current_page_id: '', +on_demand: {}, +__construct: function(page_list) { +this.pages = []; +this.page_list = page_list; +for (var idx = 0, len = page_list.length; idx < len; idx++) { +Debug.trace( 'page', "Initializing page: " + page_list[idx].ID ); +if (Effect.Page[ page_list[idx].ID ]) { +var page = new Effect.Page[ page_list[idx].ID ]( page_list[idx] ); +page.onInit(); +this.pages.push(page); +} +else { +Debug.trace( 'page', 'Page ' + page_list[idx].ID + ' will be loaded on-demand' ); +} +} +}, +find: function(id) { +var page = find_object( this.pages, { ID: id } ); +if (!page) Debug.trace('PageManager', "Could not find page: " + id); +return page; +}, +notify_load: function(file, id) { +for (var idx = 0, len = this.page_list.length; idx < len; idx++) { +var page_config = this.page_list[idx]; +if (page_config.File == file) { +Debug.trace( 'page', "Initializing page on-demand: " + page_config.ID ); +var page = new Effect.Page[ page_config.ID ]( page_config ); +page.onInit(); +this.pages.push(page); +} +} +var self = this; +setTimeout( function() { +var result = self.activate(id, self.temp_args); +delete self.temp_args; +$('d_page_loading').hide(); +if (!result) { +$('page_'+id).hide(); +self.current_page_id = ''; +} +}, 1 ); +}, +activate: function(id, args) { +if (!find_object( this.pages, { ID: id } )) { +var page_config = find_object( this.page_list, { ID: id } ); +assert(!!page_config, "Page config not found: " + id ); +Debug.trace('page', "Loading file on-demand: " + page_config.File + " for page: " + id); +var url = '/effect/api/load_page/' + page_config.File + '?onafter=' + escape('page_manager.notify_load(\''+page_config.File+'\',\''+id+'\')'); +if (page_config.Requires) { +var files = page_config.Requires.split(/\,\s*/); +for (var idx = 0, len = files.length; idx < len; idx++) { +var filename = files[idx]; +if (!this.on_demand[filename]) { +Debug.trace('page', "Also loading file: " + filename); +url += '&file=' + filename; +this.on_demand[filename] = 1; +} +} +} +$('d_page_loading').show(); +this.temp_args = args; +load_script( url ); +return true; +} +$('page_'+id).show(); +var page = this.find(id); +page.active = true; +if (!args) args = []; +if (!isa_array(args)) args = [ args ]; +var result = page.onActivate.apply(page, args); +if (typeof(result) == 'boolean') return result; +else return alert("Page " + id + " onActivate did not return a boolean!"); +}, +deactivate: function(id, new_id) { +var page = this.find(id); +var result = page.onDeactivate(new_id); +if (result) { +$('page_'+id).hide(); +page.active = false; +} +return result; +}, +click: function(id, args) { +Debug.trace('page', "Switching pages to: " + id); +var old_id = this.current_page_id; +if (this.current_page_id) { +var result = this.deactivate( this.current_page_id, id ); +if (!result) return false; +} +this.current_page_id = id; +this.old_page_id = old_id; +window.scrollTo( 0, 0 ); +var result = this.activate(id, args); +if (!result) { +$('page_'+id).hide(); +this.current_page_id = ''; +} +return true; +} +} ); +Class.subclass( Effect.Page, "Effect.Page.Main", { +inited: false, +onActivate: function() { +Nav.bar( ['Main', 'EffectGames.com'] ); +Nav.title(''); +$('d_blog_news').innerHTML = loading_image(); +$('d_blog_community').innerHTML = loading_image(); +$('d_blog_featured').innerHTML = loading_image(); +Blog.search({ +stag: 'featured_game', +limit: 4, +full: 1, +callback: [this, 'receive_featured_games'] +}); +effect_api_get( 'get_site_info', { cat: 'pop_pub_games' }, [this, 'receive_pop_pub_games'], { } ); +Blog.search({ +stag: 'front_page', +limit: 5, +target: 'd_blog_news', +more: 1 +}); +Blog.search({ +path: '/community', +limit: 5, +target: 'd_blog_community', +more: 1 +}); +if (!this.inited) { +this.inited = true; +config.Strings.MainSlideshow.Slide = always_array( config.Strings.MainSlideshow.Slide ); +this.slide_idx = 0; +this.num_slides = config.Strings.MainSlideshow.Slide.length; +this.slide_div_num = 0; +this.slide_dir = 1; +this.bk_pos = -340; +this.bk_pos_target = -340; +this.slide_images = []; +for (var idx = 0, len = this.num_slides; idx < len; idx++) { +var url = images_uri + '/' + config.Strings.MainSlideshow.Slide[idx].Photo; +this.slide_images[idx] = new Image(); +this.slide_images[idx].src = png(url, true); +} +} +this.height_target = 470; +this.height_start = $('d_header').offsetHeight; +this.time_start = hires_time_now(); +this.duration = 0.75; +if (!this.timer) this.timer = setTimeout( '$P("Main").animate_mhs()', 33 ); +if (session.user) $('d_blurb_main').hide(); +else { +$('d_blurb_main').innerHTML = get_string('/Main/Blurb'); +$('d_blurb_main').show(); +} +return true; +}, +receive_pop_pub_games: function(response, tx) { +var html = ''; +if (response.Data && response.Data.Games && response.Data.Games.Game) { +var games = always_array( response.Data.Games.Game ); +for (var idx = 0, len = Math.min(games.length, 16); idx < len; idx++) { +var game = games[idx]; +html += '
' + +(game.Logo ? +user_image_thumbnail(game.Logo, 80, 60) : +'' +) + '
' + ww_fit_box(game.Title, 80, 2, session.em_width, 1) + '
'; +} +html += '
'; +} +else { +html += 'No active public games found! Why not create a new one?'; +} +$('d_main_pop_pub_games').innerHTML = html; +}, +receive_featured_games: function(response, tx) { +var html = ''; +if (response.Rows && response.Rows.Row) { +html += ''; +var rows = always_array( response.Rows.Row ); +for (var idx = 0, len = rows.length; idx < len; idx++) { +var row = rows[idx]; +var image_url = row.Params.featured_image; +if (image_url && image_url.match(/^(\w+)\/(\w+\.\w+)$/)) { +image_url = '/effect/api/view/users/' + RegExp.$1 + '/images/' + RegExp.$2; +} +if (idx % 2 == 0) html += ''; +html += ''; +if (idx % 2 == 1) html += ''; +} +if (rows.length % 2 == 1) { +html += ''; +html += ''; +} +html += '
'; +html += ''; +html += ''; +html += ''; +html += ''; +html += ''; +html += '
'; +html += '
'; +html += '
'; +html += '
'; +html += '		' + spacer(10,1) + ''; +html += '
' + row.Title + '
'; +html += '
' + row.HTML + '
'; +html += '		' + spacer(15,1) + '
'; +html += spacer(1,20); +html += '
'; +} +$('d_blog_featured').innerHTML = html; +}, +animate_mhs: function() { +var now = hires_time_now(); +if (now - this.time_start >= this.duration) { +$('d_header').style.height = '' + this.height_target + 'px'; +$('d_shadow').style.height = '' + this.height_target + 'px'; +delete this.timer; +} +else { +var height = tweenFrame(this.height_start, this.height_target, (now - this.time_start) / this.duration, 'EaseOut', 'Circular'); +$('d_header').style.height = '' + height + 'px'; +$('d_shadow').style.height = '' + height + 'px'; +this.timer = setTimeout( '$P("Main").animate_mhs()', 33 ); +} +}, +onDeactivate: function() { +$('d_blog_news').innerHTML = ''; +$('d_blog_community').innerHTML = ''; +this.height_target = 75; +this.height_start = $('d_header').offsetHeight; +this.time_start = hires_time_now(); +if (!this.timer) this.timer = setTimeout( '$P("Main").animate_mhs()', 33 ); +return true; +}, +draw_slide: function() { +if (this.slide_timer) return; +var slide = config.Strings.MainSlideshow.Slide[ this.slide_idx ]; +this.old_photo = $('d_header_slideshow_photo_' + this.slide_div_num); +this.old_text = $('d_header_slideshow_text_' + this.slide_div_num); +this.slide_div_num = 1 - this.slide_div_num; +this.new_photo = $('d_header_slideshow_photo_' + this.slide_div_num); +this.new_text = $('d_header_slideshow_text_' + this.slide_div_num); +this.new_photo.style.backgroundImage = 'url('+png(images_uri+'/'+slide.Photo, true)+')'; +this.new_photo.setOpacity(0.0); +var html = ''; +html += slide.Text; +this.slide_width = this.new_text.offsetWidth; +this.new_text.innerHTML = html; +if (this.slide_dir == 1) this.new_text.style.left = '' + this.slide_width + 'px'; +else this.new_text.style.left = '-' + this.slide_width + 'px'; +this.slide_time_start = hires_time_now(); +this.slide_timer = setTimeout( '$P("Main").animate_mhs_slide()', 33 ); +}, +animate_mhs_slide: function() { +var now = hires_time_now(); +if (now - this.slide_time_start >= this.duration) { +this.new_text.style.left = '0px'; +this.old_text.style.left = '-' + this.slide_width + 'px'; +this.new_photo.setOpacity( 1.0 ); +this.old_photo.setOpacity( 0.0 ); +delete this.slide_timer; +this.bk_pos = this.bk_pos_target; +} +else { +var value = tweenFrame(0.0, 1.0, (now - this.slide_time_start) / this.duration, 'EaseOut', 'Circular'); +if (this.slide_dir == 1) { +this.new_text.style.left = '' + Math.floor( this.slide_width - (this.slide_width * value) ) + 'px'; +this.old_text.style.left = '-' + Math.floor( this.slide_width * value ) + 'px'; +} +else { +this.new_text.style.left = '-' + Math.floor( this.slide_width - (this.slide_width * value) ) + 'px'; +this.old_text.style.left = '' + Math.floor( this.slide_width * value ) + 'px'; +} +this.new_photo.setOpacity( value ); +this.old_photo.setOpacity( 1.0 - value ); +var bkp = Math.floor( this.bk_pos + ((this.bk_pos_target - this.bk_pos) * value) ); +$('d_header').style.backgroundPosition = '' + bkp + 'px 0px'; +this.slide_timer = setTimeout( '$P("Main").animate_mhs_slide()', 33 ); +} +}, +prev_slide: function() { +this.bk_pos_target += 200; +this.slide_idx--; +if (this.slide_idx < 0) this.slide_idx += this.num_slides; +this.slide_dir = -1; +this.draw_slide(); +}, +next_slide: function() { +this.bk_pos_target -= 200; +this.slide_idx++; +if (this.slide_idx >= this.num_slides) this.slide_idx -= this.num_slides; +this.slide_dir = 1; +this.draw_slide(); +} +} ); +Class.subclass( Effect.Page, "Effect.Page.PublicGameList", { +onActivate: function() { +Nav.bar( +['Main', 'EffectGames.com'], +['PublicGameList', "All Public Games"] +); +Nav.title( "List of All Public Game Projects" ); +effect_api_get( 'get_site_info', { cat: 'all_pub_games' }, [this, 'receive_all_pub_games'], { } ); +this.div.innerHTML = loading_image(); +return true; +}, +onDeactivate: function() { +this.div.innerHTML = ''; +return true; +}, +receive_all_pub_games: function(response, tx) { +var html = ''; +html += '

List of All Public Game Projects

'; +html += '
This is the complete list of public games currently being built by our users, presented in alphabetical order. Maybe they could use some help! Check out the game project pages and see (requires user account).
'; +if (response.Data && response.Data.Games && response.Data.Games.Game) { +var games = always_array( response.Data.Games.Game ); +for (var idx = 0, len = games.length; idx < len; idx++) { +var game = games[idx]; +html += '
' + +(game.Logo ? +user_image_thumbnail(game.Logo, 80, 60) : +'' +) + '
' + ww_fit_box(game.Title, 80, 2, session.em_width, 1) + '
'; +} +html += '
'; +} +else { +html += 'No public games found! Why not create a new one?'; +} +this.div.innerHTML = html; +} +} ); +Class.subclass( Effect.Page, "Effect.Page.Search", { +onActivate: function(args) { +if (!args) args = {}; +var search_text = args.q; +var start = args.s || 0; +if (!start) start = 0; +var title = 'Search results for "'+search_text+'"'; +Nav.bar( +['Main', 'EffectGames.com'], +['Search?q=' + escape(search_text), "Search Results"] +); +Nav.title( title ); +this.last_search_text = search_text; +$('d_article_search').innerHTML = loading_image(); +load_script( 'http://www.google.com/uds/GwebSearch?callback=receive_google_search_results&context=0&lstkp=0&rsz=large&hl=en&source=gsc&gss=.com&sig=&q='+escape(search_text)+'%20site%3Ahttp%3A%2F%2Fwww.effectgames.com%2F&key=notsupplied&v=1.0&start='+start+'&nocache=' + (new Date()).getTime() ); +$('h_article_search').innerHTML = title; +return true; +}, +onDeactivate: function(new_page) { +$('fe_search_bar').value = ''; +$('d_article_search').innerHTML = ''; +return true; +} +} ); +function do_search_bar() { +var search_text = $('fe_search_bar').value; +if (search_text.length) { +Nav.go('Search?q=' + escape(search_text)); +} +} +function receive_google_search_results(context, response) { +var html = ''; +html += '
Powered by
'; +if (response.results.length) { +for (var idx = 0, len = response.results.length; idx < len; idx++) { +var row = response.results[idx]; +var url = row.unescapedUrl.replace(/^.+article\.psp\.html/, '#Article'); +html += '
'; +html += '
'+row.title+'
'; +html += '
' + row.content + '
'; +html += '
'; +} +} +else { +html += 'No results found.'; +} +if (response.cursor.pages) { +html += '
Page: '; +for (var idx = 0, len = response.cursor.pages.length; idx < len; idx++) { +html += ''; +var page = response.cursor.pages[idx]; +var url = '#Search?q=' + escape($P('Search').last_search_text) + '&s=' + page.start; +if (response.cursor.currentPageIndex != idx) html += ''; +else html += ''; +html += page.label; +if (response.cursor.currentPageIndex != idx) html += ''; +else html += ''; +html += ''; +} +html += '
'; +} +$('d_article_search').innerHTML = html; +} + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/index.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/index.js new file mode 100644 index 0000000..8b164a4 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/index.js @@ -0,0 +1 @@ +exports.ZeParser = require('./ZeParser').ZeParser; diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/package.json b/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/package.json new file mode 100644 index 0000000..66a8ba2 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/package.json @@ -0,0 +1,28 @@ +{ + "author": { + "name": "Peter van der Zee", + "url": "http://qfox.nl/" + }, + "name": "zeparser", + "description": "My JavaScript parser", + "version": "0.0.5", + "homepage": "https://github.com/qfox/ZeParser/", + "repository": { + "type": "git", + "url": "git://github.com/qfox/ZeParser.git" + }, + "main": "./index", + "engines": { + "node": "*" + }, + "dependencies": {}, + "devDependencies": {}, + "readme": "This is a JavaScript parser.\nhttp://github.com/qfox/ZeParser\n(c) Peter van der Zee\nhttp://qfox.nl\n\n\nBenchmark\nhttp://qfox.github.com/ZeParser/benchmark.html\n\nThe Tokenizer is used by the parser. The parser tells the tokenizer whether the next token may be a regular expression or not. Without the parser, the tokenizer will fail if regular expression literals are used in the input.\n\nUsage:\nZeParser.parse(input);\n\nReturns a \"parse tree\" which is a tree of an array of arrays with tokens (regular objects) as leafs. Meta information embedded as properties (of the arrays and the tokens).\n\nZeParser.createParser(input);\n\nReturns a new ZeParser instance which has already parsed the input. Amongst others, the ZeParser instance will have the properties .tree, .wtree and .btree.\n\n.tree is the parse tree mentioned above.\n.wtree (\"white\" tree) is a regular array with all the tokens encountered (including whitespace, line terminators and comments)\n.btree (\"black\" tree) is just like .wtree but without the whitespace, line terminators and comments. This is what the specification would call the \"token stream\".\n\nI'm aware that the naming convention is a bit awkward. It's a tradeoff between short and descriptive. The streams are used quite often in the analysis.\n\nTokens are regular objects with several properties. Amongst them are .tokposw and .tokposw, they correspond with their own position in the .wtree and .btree.\n\nThe parser has two modes for parsing: simple and extended. Simple mode is mainly for just parsing and returning the streams and a simple parse tree. There's not so much meta information here and this mode is mainly built for speed. The other mode has everything required for Zeon to do its job. This mode is toggled by the instance property .ast, which is true by default :)\n\nNon-factory example:\n\nvar input = \"foo\";\nvar tree = []; // this should probably be refactored away some day\nvar tokenizer = new Tokenizer(input); // dito\nvar parser = new ZeParser(input, tokenizer, tree);\nparser.parse(); // returns tree..., should never throw errors\n", + "readmeFilename": "README", + "_id": "zeparser@0.0.5", + "dist": { + "shasum": "35fec2dafd5c59e91b89cd2ae44780089219e9e5" + }, + "_from": "zeparser@0.0.5", + "_resolved": "https://registry.npmjs.org/zeparser/-/zeparser-0.0.5.tgz" +} diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/test-parser.html b/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/test-parser.html new file mode 100644 index 0000000..0c37bb3 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/test-parser.html @@ -0,0 +1,26 @@ + + + + Parser Test Suite Page + + + + (c) qfox.nl
+ Parser test suite
+
Running...
+ + + + + + + \ No newline at end of file diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/test-tokenizer.html b/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/test-tokenizer.html new file mode 100644 index 0000000..141b5c1 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/test-tokenizer.html @@ -0,0 +1,23 @@ + + + + Tokenizer Test Suite Page + + + + (c) qfox.nl
+ + + + + + \ No newline at end of file diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/tests.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/tests.js new file mode 100644 index 0000000..8a4138b --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/node_modules/zeparser/tests.js @@ -0,0 +1,478 @@ +// tests for both the tokenizer and parser. Parser test results could be checked tighter. +// api: [input, token-output-count, ?regex-hints, desc] +// regex-hints are for tokenizer, will tell for each token whether it might parse regex or not (parser's job) +var Tests = [ + +["var abc;", 4, "Variable Declaration"], +["var abc = 5;", 8, "Variable Declaration, Assignment"], +["/* */", 1, "Block Comment"], +["/** **/", 1, "JSDoc-style Comment"], +["var f = function(){;};", 13, "Assignment, Function Expression"], +["hi; // moo", 4, "Trailing Line Comment"], +["hi; // moo\n;", 6, "Trailing Line Comment, Linefeed, `;`"], +["var varwithfunction;", 4, "Variable Declaration, Identifier Containing Reserved Words, `;`"], +["a + b;", 6, "Addition/Concatenation"], + +["'a'", 1, "Single-Quoted String"], +["'a';", 2, "Single-Quoted String, `;`"], // Taken from the parser test suite. + +["'a\\n'", 1, "Single-Quoted String With Escaped Linefeed"], +["'a\\n';", 2, "Single-Quoted String With Escaped Linefeed, `;`"], // Taken from the parser test suite. + +["\"a\"", 1, "Double-Quoted String"], +["\"a\";", 2, "Double-Quoted String, `;`"], // Taken from the parser test suite. + +["\"a\\n\"", 1, "Double-Quoted String With Escaped Linefeed"], +["\"a\\n\";", 2, "Double-Quoted String With Escaped Linefeed, `;`"], // Taken from the parser test suite. + +["500", 1, "Integer"], +["500;", 2, "Integer, `;`"], // Taken from the parser test suite. + +["500.", 1, "Double With Trailing Decimal Point"], +["500.;", 2, "Double With Trailing Decimal Point"], // Taken from the parser test suite. + +["500.432", 1, "Double With Decimal Component"], +["500.432;", 2, "Double With Decimal Component, `;`"], // Taken from the parser test suite. + +[".432432", 1, "Number, 0 < Double < 1"], +[".432432;", 2, "Number, 0 < Double < 1, `;`"], // Taken from the parser test suite. + +["(a,b,c)", 7, "Parentheses, Comma-separated identifiers"], +["(a,b,c);", 8, "Parentheses, Comma-separated identifiers, `;`"], // Taken from the parser test suite. + +["[1,2,abc]", 7, "Array literal"], +["[1,2,abc];", 8, "Array literal, `;`"], // Taken from the parser test suite. + +["{a:1,\"b\":2,c:c}", 13, "Object literal"], +["var o = {a:1,\"b\":2,c:c};", 20, "Assignment, Object Literal, `;`"], // Taken from the parser test suite. + +["var x;\nvar y;", 9, "2 Variable Declarations, Multiple lines"], +["var x;\nfunction n(){ }", 13, "Variable, Linefeed, Function Declaration"], +["var x;\nfunction n(abc){ }", 14, "Variable, Linefeed, Function Declaration With One Argument"], +["var x;\nfunction n(abc, def){ }", 17, "Variable, Linefeed, Function Declaration With Multiple Arguments"], +["function n(){ \"hello\"; }", 11, "Function Declaration, Body"], + +["/a/;", 2, [true, false], "RegExp Literal, `;`"], +["/a/b;", 2, [true, true], "RegExp Literal, Flags, `;`"], +["++x;", 3, "Unary Increment, Prefix, `;`"], +[" / /;", 3, [true, true, false], "RegExp, Leading Whitespace, `;`"], +["/ / / / /", 5, [true, false, false, false, true], "RegExp Containing One Space, Space, Division, Space, RegExp Containing One Space"], + +// Taken from the parser test suite. + +["\"var\";", 2, "Keyword String, `;`"], +["\"variable\";", 2, "String Beginning With Keyword, `;`"], +["\"somevariable\";", 2, "String Containing Keyword, `;`"], +["\"somevar\";", 2, "String Ending With Keyword, `;`"], + +["var varwithfunction;", 4, "Keywords should not be matched in identifiers"], + +["var o = {a:1};", 12, "Object Literal With Unquoted Property"], +["var o = {\"b\":2};", 12, "Object Literal With Quoted Property"], +["var o = {c:c};", 12, "Object Literal With Equivalent Property Name and Identifier"], + +["/a/ / /b/;", 6, [true, true, false, false, true, false], "RegExp, Division, RegExp, `;`"], +["a/b/c;", 6, "Triple Division (Identifier / Identifier / Identifier)"], + +["+function(){/regex/;};", 9, [false, false, false, false, false, true, false, false, false], "Unary `+` Operator, Function Expression Containing RegExp and Semicolon, `;`"], + +// Line Terminators. +["\r\n", 1, "CRLF Line Ending = 1 Linefeed"], +["\r", 1, "CR Line Ending = 1 Linefeed"], +["\n", 1, "LF Line Ending = 1 Linefeed"], +["\r\n\n\u2028\u2029\r", 5, "Various Line Terminators"], + +// Whitespace. +["a \t\u000b\u000c\u00a0\uFFFFb", 8, "Whitespace"], + +// Comments. +["//foo!@#^&$1234\nbar;", 4, "Line Comment, Linefeed, Identifier, `;`"], +["/* abcd!@#@$* { } && null*/;", 2, "Single-Line Block Comment, `;`"], +["/*foo\nbar*/;", 2, "Multi-Line Block Comment, `;`"], +["/*x*x*/;", 2, "Block Comment With Asterisks, `;`"], +["/**/;", 2, "Empty Comment, `;`"], + +// Identifiers. +["x;", 2, "Single-Character Identifier, `;`"], +["_x;", 2, "Identifier With Leading `_`, `;`"], +["xyz;", 2, "Identifier With Letters Only, `;`"], +["$x;", 2, "Identifier With Leading `$`, `;`"], +["x5;", 2, "Identifier With Number As Second Character, `;`"], +["x_y;", 2, "Identifier Containing `_`, `;`"], +["x+5;", 4, "Identifier, Binary `+` Operator, Identifier, `;`"], +["xyz123;", 2, "Alphanumeric Identifier, `;`"], +["x1y1z1;", 2, "Alternating Alphanumeric Identifier, `;`"], +["foo\\u00d8bar;", 2, "Identifier With Unicode Escape Sequence (`\\uXXXX`), `;`"], +["f\u00d8\u00d8bar;", 2, "Identifier With Embedded Unicode Character"], + +// Numbers. +["5;", 2, "Integer, `;`"], +["5.5;", 2, "Double, `;`"], +["0;", 2, "Integer Zero, `;`"], +["0.0;", 2, "Double Zero, `;`"], +["0.001;", 2, "0 < Decimalized Double < 1, `;`"], +["1.e2;", 2, "Integer With Decimal and Exponential Component (`e`), `;`"], +["1.e-2;", 2, "Integer With Decimal and Negative Exponential Component, `;`"], +["1.E2;", 2, "Integer With Decimal and Uppercase Exponential Component (`E`), `;`"], +["1.E-2;", 2, "Integer With Decimal and Uppercase Negative Exponential Component, `;`"], +[".5;", 2, "0 < Double < 1, `;`"], +[".5e3;", 2, "(0 < Double < 1) With Exponential Component"], +[".5e-3;", 2, "(0 < Double < 1) With Negative Exponential Component"], +["0.5e3;", 2, "(0 < Decimalized Double < 1) With Exponential Component"], +["55;", 2, "Two-Digit Integer, `;`"], +["123;", 2, "Three-Digit Integer, `;`"], +["55.55;", 2, "Two-Digit Double, `;`"], +["55.55e10;", 2, "Two-Digit Double With Exponential Component, `;`"], +["123.456;", 2, "Three-Digit Double, `;`"], +["1+e;", 4, "Additive Expression, `;`"], +["0x01;", 2, "Hexadecimal `1` With 1 Leading Zero, `;`"], +["0xcafe;", 2, "Hexadecimal `51966`, `;`"], +["0x12345678;", 2, "Hexadecimal `305419896`, `;`"], +["0x1234ABCD;", 2, "Hexadecimal `305441741` With Uppercase Letters, `;`"], +["0x0001;", 2, "Hexadecimal `1` with 3 Leading Zeros, `;`"], + +// Strings. +["\"foo\";", 2, "Multi-Character Double-Quoted String, `;`"], +["\"a\\n\";", 2, "Double-Quoted String Containing Linefeed, `;`"], +["\'foo\';", 2, "Single-Quoted String, `;`"], +["'a\\n';", 2, "Single-Quoted String Containing Linefeed, `;`"], +["\"x\";", 2, "Single-Character Double-Quoted String, `;`"], +["'';", 2, "Empty Single-Quoted String, `;`"], +["\"foo\\tbar\";", 2, "Double-Quoted String With Tab Character, `;`"], +["\"!@#$%^&*()_+{}[]\";", 2, "Double-Quoted String Containing Punctuators, `;`"], +["\"/*test*/\";", 2, "Double-Quoted String Containing Block Comment, `;`"], +["\"//test\";", 2, "Double-Quoted String Containing Line Comment, `;`"], +["\"\\\\\";", 2, "Double-Quoted String Containing Reverse Solidus, `;`"], +["\"\\u0001\";", 2, "Double-Quoted String Containing Numeric Unicode Escape Sequence, `;`"], +["\"\\uFEFF\";", 2, "Double-Quoted String Containing Alphanumeric Unicode Escape Sequence, `;`"], +["\"\\u10002\";", 2, "Double-Quoted String Containing 5-Digit Unicode Escape Sequence, `;`"], +["\"\\x55\";", 2, "Double-Quoted String Containing Hex Escape Sequence, `;`"], +["\"\\x55a\";", 2, "Double-Quoted String Containing Hex Escape Sequence and Additional Character, `;`"], +["\"a\\\\nb\";", 2, "Double-Quoted String Containing Escaped Linefeed, `;`"], +["\";\"", 1, "Double-Quoted String Containing `;`"], +["\"a\\\nb\";", 2, "Double-Quoted String Containing Reverse Solidus and Linefeed, `;`"], +["'\\\\'+ ''", 4, "Single-Quoted String Containing Reverse Solidus, `+`, Empty Single-Quoted String"], + +// `null`, `true`, and `false`. +["null;", 2, "`null`, `;`"], +["true;", 2, "`true`, `;`"], +["false;", 2, "`false`, `;`"], + +// RegExps +["/a/;", 2, [true, true], "Single-Character RegExp, `;`"], +["/abc/;", 2, [true, true], "Multi-Character RegExp, `;`"], +["/abc[a-z]*def/g;", 2, [true, true], "RegExp Containing Character Range and Quantifier, `;`"], +["/\\b/;", 2, [true, true], "RegExp Containing Control Character, `;`"], +["/[a-zA-Z]/;", 2, [true, true], "RegExp Containing Extended Character Range, `;`"], +["/foo(.*)/g;", 2, [true, false], "RegExp Containing Capturing Group and Quantifier, `;`"], + +// Array Literals. +["[];", 3, "Empty Array, `;`"], +["[\b\n\f\r\t\x20];", 9, "Array Containing Whitespace, `;`"], +["[1];", 4, "Array Containing 1 Element, `;`"], +["[1,2];", 6, "Array Containing 2 Elements, `;`"], +["[1,2,,];", 8, "Array Containing 2 Elisions, `;`"], +["[1,2,3];", 8, "Array Containing 3 Elements, `;`"], +["[1,2,3,,,];", 11, "Array Containing 3 Elisions, `;`"], + +// Object Literals. +["({x:5});", 8, "Object Literal Containing 1 Member; `;`"], +["({x:5,y:6});", 12, "Object Literal Containing 2 Members, `;`"], +["({x:5,});", 9, "Object Literal Containing 1 Member and Trailing Comma, `;`"], +["({if:5});", 8, "Object Literal Containing Reserved Word Property Name, `;`"], +["({ get x() {42;} });", 17, "Object Literal Containing Getter, `;`"], +["({ set y(a) {1;} });", 18, "Object Literal Containing Setter, `;`"], + +// Member Expressions. +["o.m;", 4, "Dot Member Accessor, `;`"], +["o['m'];", 5, "Square Bracket Member Accessor, `;`"], +["o['n']['m'];", 8, "Nested Square Bracket Member Accessor, `;`"], +["o.n.m;", 6, "Nested Dot Member Accessor, `;`"], +["o.if;", 4, "Dot Reserved Property Name Accessor, `;`"], + +// Function Calls. +["f();", 4, "Function Call Operator, `;`"], +["f(x);", 5, "Function Call Operator With 1 Argument, `;`"], +["f(x,y);", 7, "Function Call Operator With Multiple Arguments, `;`"], +["o.m();", 6, "Dot Member Accessor, Function Call, `;`"], +["o['m']();", 7, "Square Bracket Member Accessor, Function Call, `;`"], +["o.m(x);", 7, "Dot Member Accessor, Function Call With 1 Argument, `;`"], +["o['m'](x);", 8, "Square Bracket Member Accessor, Function Call With 1 Argument, `;`"], +["o.m(x,y);", 9, "Dot Member Accessor, Function Call With 2 Arguments, `;`"], +["o['m'](x,y);", 10, "Square Bracket Member Accessor, Function Call With 2 Arguments, `;`"], +["f(x)(y);", 8, "Nested Function Call With 1 Argument Each, `;`"], +["f().x;", 6, "Function Call, Dot Member Accessor, `;`"], + +// `eval` Function. +["eval('x');", 5, "`eval` Invocation With 1 Argument, `;`"], +["(eval)('x');", 7, "Direct `eval` Call Example, `;`"], +["(1,eval)('x');", 9, "Indirect `eval` Call Example, `;`"], +["eval(x,y);", 7, "`eval` Invocation With 2 Arguments, `;`"], + +// `new` Operator. +["new f();", 6, "`new` Operator, Function Call, `;`"], +["new o;", 4, "`new` Operator, Identifier, `;`"], +["new o.m;", 6, "`new` Operator, Dot Member Accessor, `;`"], +["new o.m(x);", 9, "`new` Operator, Dot Member Accessor, Function Call With 1 Argument, `;`"], +["new o.m(x,y);", 11, "``new` Operator, Dot Member Accessor, Function Call With 2 Arguments , `;`"], + +// Prefix and Postfix Increment. +["++x;", 3, "Prefix Increment, Identifier, `;`"], +["x++;", 3, "Identifier, Postfix Increment, `;`"], +["--x;", 3, "Prefix Decrement, Identifier, `;`"], +["x--;", 3, "Postfix Decrement, Identifier, `;`"], +["x ++;", 4, "Identifier, Space, Postfix Increment, `;`"], +["x /* comment */ ++;", 6, "Identifier, Block Comment, Postfix Increment, `;`"], +["++ /* comment */ x;", 6, "Prefix Increment, Block Comment, Identifier, `;`"], + +// Unary Operators. +["delete x;", 4, "`delete` Operator, Space, Identifier, `;`"], +["void x;", 4, "`void` Operator, Space, Identifier, `;`"], +["typeof x;", 4, "`typeof` Operator, Space, Identifier, `;`"], +["+x;", 3, "Unary `+` Operator, Identifier, `;`"], +["-x;", 3, "Unary Negation Operator, Identifier, `;`"], +["~x;", 3, "Bitwise NOT Operator, Identifier, `;`"], +["!x;", 3, "Logical NOT Operator, Identifier, `;`"], + +// Comma Operator. +["x, y;", 5, "Comma Operator"], + +// Miscellaneous. +["new Date++;", 5, "`new` Operator, Identifier, Postfix Increment, `;`"], +["+x++;", 4, "Unary `+`, Identifier, Postfix Increment, `;`"], + +// Expressions. +["1 * 2;", 6, "Integer, Multiplication, Integer, `;`"], +["1 / 2;", 6, "Integer, Division, Integer, `;`"], +["1 % 2;", 6, "Integer, Modulus, Integer, `;`"], +["1 + 2;", 6, "Integer, Addition, Integer, `;`"], +["1 - 2;", 6, "Integer, Subtraction, Integer, `;`"], +["1 << 2;", 6, "Integer, Bitwise Left Shift, Integer, `;`"], +["1 >>> 2;", 6, "Integer, Bitwise Zero-fill Right Shift, Integer, `;`"], +["1 >> 2;", 6, "Integer, Bitwise Sign-Propagating Right Shift, Integer, `;`"], +["1 * 2 + 3;", 10, "Order-of-Operations Expression, `;`"], +["(1+2)*3;", 8, "Parenthesized Additive Expression, Multiplication, `;`"], +["1*(2+3);", 8, "Multiplication, Parenthesized Additive Expression, `;`"], +["xy;", 4, "Greater-Than Relational Operator, `;`"], +["x<=y;", 4, "Less-Than-or-Equal-To Relational Operator, `;`"], +["x>=y;", 4, "Greater-Than-or-Equal-To Relational Operator, `;`"], +["x instanceof y;", 6, "`instanceof` Operator, `;`"], +["x in y;", 6, "`in` Operator, `;`"], +["x&y;", 4, "Bitwise AND Operator, `;`"], +["x^y;", 4, "Bitwise XOR Operator, `;`"], +["x|y;", 4, "Bitwise OR Operator, `;`"], +["x+y>>= y;", 6, "Bitwise Zero-Fill Right Shift Assignment, `;`"], +["x <<= y;", 6, "Bitwise Left Shift Assignment, `;`"], +["x += y;", 6, "Additive Assignment, `;`"], +["x -= y;", 6, "Subtractive Assignment, `;`"], +["x *= y;", 6, "Multiplicative Assignment, `;`"], +["x /= y;", 6, "Divisive Assignment, `;`"], +["x %= y;", 6, "Modulus Assignment, `;`"], +["x >>= y;", 6, "Bitwise Sign-Propagating Right Shift Assignment, `;`"], +["x &= y;", 6, "Bitwise AND Assignment, `;`"], +["x ^= y;", 6, "Bitwise XOR Assignment, `;`"], +["x |= y;", 6, "Bitwise OR Assignment, `;`"], + +// Blocks. +["{};", 3, "Empty Block, `;`"], +["{x;};", 5, "Block Containing 1 Identifier, `;`"], +["{x;y;};", 7, "Block Containing 2 Identifiers, `;`"], + +// Variable Declarations. +["var abc;", 4, "Variable Declaration"], +["var x,y;", 6, "Comma-Separated Variable Declarations, `;`"], +["var x=1,y=2;", 10, "Comma-Separated Variable Initializations, `;`"], +["var x,y=2;", 8, "Variable Declaration, Variable Initialization, `;`"], + +// Empty Statements. +[";", 1, "Empty Statement"], +["\n;", 2, "Linefeed, `;`"], + +// Expression Statements. +["x;", 2, "Identifier, `;`"], +["5;", 2, "Integer, `;`"], +["1+2;", 4, "Additive Statement, `;`"], + +// `if...else` Statements. +["if (c) x; else y;", 13, "Space-Delimited `if...else` Statement"], +["if (c) x;", 8, "Space-Delimited `if` Statement, `;`"], +["if (c) {} else {};", 14, "Empty Block-Delimited `if...else` Statement"], +["if (c1) if (c2) s1; else s2;", 19, "Nested `if...else` Statement Without Dangling `else`"], + +// `while` and `do...while` Loops. +["do s; while (e);", 11, "Space-Delimited `do...while` Loop"], +["do { s; } while (e);", 15, "Block-Delimited `do...while` Loop"], +["while (e) s;", 8, "Space-Delimited `while` Loop"], +["while (e) { s; };", 13, "Block-Delimited `while` Loop"], + +// `for` and `for...in` Loops. +["for (;;) ;", 8, "Infinite Space-Delimited `for` Loop"], +["for (;c;x++) x;", 12, "`for` Loop: Empty Initialization Condition; Space-Delimited Body"], +["for (i;i foo(new window[(['Active'].concat('Object').join('X'))])\n```\n\n## License\n\nLicensed under the MIT license.\n\n[socket.io]: http://socket.io/\n", + "readmeFilename": "Readme.md", + "_id": "active-x-obfuscator@0.0.1", + "dist": { + "shasum": "d9c2c348132d3f2c0968006c067ab895aee2203a" + }, + "_from": "active-x-obfuscator@0.0.1", + "_resolved": "https://registry.npmjs.org/active-x-obfuscator/-/active-x-obfuscator-0.0.1.tgz" +} diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/test.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/test.js new file mode 100644 index 0000000..e8fc807 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/active-x-obfuscator/test.js @@ -0,0 +1,53 @@ +var activeXObfuscator = require('./index'); +var assert = require('assert'); + +var OBFUSCATED_ACTIVE_X_OBJECT = activeXObfuscator.OBFUSCATED_ACTIVE_X_OBJECT; +var OBFUSCATED_ACTIVE_X = activeXObfuscator.OBFUSCATED_ACTIVE_X; + +var input = + "foo(new ActiveXObject('Microsoft.XMLHTTP'))"; +var expected = + "foo(new window[" + OBFUSCATED_ACTIVE_X_OBJECT + "]('Microsoft.XMLHTTP'))"; +assert.equal(activeXObfuscator(input), expected); + +var input = + "var foo = 'ActiveXObject';"; +var expected = + "var foo = " + OBFUSCATED_ACTIVE_X_OBJECT + ";"; +assert.equal(activeXObfuscator(input), expected); + +var input = + 'var foo = "ActiveXObject";'; +var expected = + "var foo = " + OBFUSCATED_ACTIVE_X_OBJECT + ";"; +assert.equal(activeXObfuscator(input), expected); + +var input = + 'var foo = o.ActiveXObject;'; +var expected = + "var foo = o[" + OBFUSCATED_ACTIVE_X_OBJECT + "];"; +assert.equal(activeXObfuscator(input), expected); + +var input = + 'var foo = "ActiveX";'; +var expected = + "var foo = " + OBFUSCATED_ACTIVE_X + ";"; +assert.equal(activeXObfuscator(input), expected); + +var input = + "var foo = 'ActiveX';"; +var expected = + "var foo = " + OBFUSCATED_ACTIVE_X + ";"; +assert.equal(activeXObfuscator(input), expected); + +var input = + "var foo; // ActiveX is cool"; +var expected = + "var foo; // Ac...eX is cool"; +assert.equal(activeXObfuscator(input), expected); + +var input = + "var foo = 'ActiveX is cool';"; +assert.throws(function() { + activeXObfuscator(input); +}, /Unknown ActiveX occurence/); diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/.npmignore b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/.npmignore new file mode 100644 index 0000000..d97eaa0 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/.npmignore @@ -0,0 +1,4 @@ +.DS_Store +.tmp*~ +*.local.* +.pinf-* \ No newline at end of file diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/README.html b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/README.html new file mode 100644 index 0000000..5f37ac0 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/README.html @@ -0,0 +1,981 @@ + + + + +UglifyJS – a JavaScript parser/compressor/beautifier + + + + + + + + + + + + + +
+ +
+ +
+

UglifyJS – a JavaScript parser/compressor/beautifier

+ + + + +
+

1 UglifyJS — a JavaScript parser/compressor/beautifier

+
+ + +

+This package implements a general-purpose JavaScript +parser/compressor/beautifier toolkit. It is developed on NodeJS, but it +should work on any JavaScript platform supporting the CommonJS module system +(and if your platform of choice doesn't support CommonJS, you can easily +implement it, or discard the exports.* lines from UglifyJS sources). +

+

+The tokenizer/parser generates an abstract syntax tree from JS code. You +can then traverse the AST to learn more about the code, or do various +manipulations on it. This part is implemented in parse-js.js and it's a +port to JavaScript of the excellent parse-js Common Lisp library from Marijn Haverbeke. +

+

+( See cl-uglify-js if you're looking for the Common Lisp version of +UglifyJS. ) +

+

+The second part of this package, implemented in process.js, inspects and +manipulates the AST generated by the parser to provide the following: +

+
    +
  • ability to re-generate JavaScript code from the AST. Optionally + indented—you can use this if you want to “beautify” a program that has + been compressed, so that you can inspect the source. But you can also run + our code generator to print out an AST without any whitespace, so you + achieve compression as well. + +
    • +
  • shorten variable names (usually to single characters). Our mangler will + analyze the code and generate proper variable names, depending on scope + and usage, and is smart enough to deal with globals defined elsewhere, or + with eval() calls or with{} statements. In short, if eval() or + with{} are used in some scope, then all variables in that scope and any + variables in the parent scopes will remain unmangled, and any references + to such variables remain unmangled as well. + +
    • +
  • various small optimizations that may lead to faster code but certainly + lead to smaller code. Where possible, we do the following: + +
      +
    • foo["bar"] ==> foo.bar + +
      • +
    • remove block brackets {} + +
      • +
    • join consecutive var declarations: + var a = 10; var b = 20; ==> var a=10,b=20; + +
      • +
    • resolve simple constant expressions: 1 +2 * 3 ==> 7. We only do the + replacement if the result occupies less bytes; for example 1/3 would + translate to 0.333333333333, so in this case we don't replace it. + +
      • +
    • consecutive statements in blocks are merged into a sequence; in many + cases, this leaves blocks with a single statement, so then we can remove + the block brackets. + +
      • +
    • various optimizations for IF statements: + +
        +
      • if (foo) bar(); else baz(); ==> foo?bar():baz(); +
        • +
      • if (!foo) bar(); else baz(); ==> foo?baz():bar(); +
        • +
      • if (foo) bar(); ==> foo&&bar(); +
        • +
      • if (!foo) bar(); ==> foo||bar(); +
        • +
      • if (foo) return bar(); else return baz(); ==> return foo?bar():baz(); +
        • +
      • if (foo) return bar(); else something(); ==> {if(foo)return bar();something()} + +
        • +
      + +
      • +
    • remove some unreachable code and warn about it (code that follows a + return, throw, break or continue statement, except + function/variable declarations). + +
      • +
    • act a limited version of a pre-processor (c.f. the pre-processor of + C/C++) to allow you to safely replace selected global symbols with + specified values. When combined with the optimisations above this can + make UglifyJS operate slightly more like a compilation process, in + that when certain symbols are replaced by constant values, entire code + blocks may be optimised away as unreachable. +
      • +
    + +
    • +
+ + + +
+ +
+

1.1 Unsafe transformations

+
+ + +

+The following transformations can in theory break code, although they're +probably safe in most practical cases. To enable them you need to pass the +--unsafe flag. +

+ +
+ +
+

1.1.1 Calls involving the global Array constructor

+
+ + +

+The following transformations occur: +

+ + + +
new Array(1, 2, 3, 4)  => [1,2,3,4]
+Array(a, b, c)         => [a,b,c]
+new Array(5)           => Array(5)
+new Array(a)           => Array(a)
+
+ + +

+These are all safe if the Array name isn't redefined. JavaScript does allow +one to globally redefine Array (and pretty much everything, in fact) but I +personally don't see why would anyone do that. +

+

+UglifyJS does handle the case where Array is redefined locally, or even +globally but with a function or var declaration. Therefore, in the +following cases UglifyJS doesn't touch calls or instantiations of Array: +

+ + + +
// case 1.  globally declared variable
+  var Array;
+  new Array(1, 2, 3);
+  Array(a, b);
+
+  // or (can be declared later)
+  new Array(1, 2, 3);
+  var Array;
+
+  // or (can be a function)
+  new Array(1, 2, 3);
+  function Array() { ... }
+
+// case 2.  declared in a function
+  (function(){
+    a = new Array(1, 2, 3);
+    b = Array(5, 6);
+    var Array;
+  })();
+
+  // or
+  (function(Array){
+    return Array(5, 6, 7);
+  })();
+
+  // or
+  (function(){
+    return new Array(1, 2, 3, 4);
+    function Array() { ... }
+  })();
+
+  // etc.
+
+ + +
+ +
+ +
+

1.1.2 obj.toString() ==> obj+“”

+
+ + +
+
+ +
+ +
+

1.2 Install (NPM)

+
+ + +

+UglifyJS is now available through NPM — npm install uglify-js should do +the job. +

+
+ +
+ +
+

1.3 Install latest code from GitHub

+
+ + + + + +
## clone the repository
+mkdir -p /where/you/wanna/put/it
+cd /where/you/wanna/put/it
+git clone git://github.com/mishoo/UglifyJS.git
+
+## make the module available to Node
+mkdir -p ~/.node_libraries/
+cd ~/.node_libraries/
+ln -s /where/you/wanna/put/it/UglifyJS/uglify-js.js
+
+## and if you want the CLI script too:
+mkdir -p ~/bin
+cd ~/bin
+ln -s /where/you/wanna/put/it/UglifyJS/bin/uglifyjs
+  # (then add ~/bin to your $PATH if it's not there already)
+
+ + +
+ +
+ +
+

1.4 Usage

+
+ + +

+There is a command-line tool that exposes the functionality of this library +for your shell-scripting needs: +

+ + + +
uglifyjs [ options... ] [ filename ]
+
+ + +

+filename should be the last argument and should name the file from which +to read the JavaScript code. If you don't specify it, it will read code +from STDIN. +

+

+Supported options: +

+
    +
  • -b or --beautify — output indented code; when passed, additional + options control the beautifier: + +
      +
    • -i N or --indent N — indentation level (number of spaces) + +
      • +
    • -q or --quote-keys — quote keys in literal objects (by default, + only keys that cannot be identifier names will be quotes). + +
      • +
    + +
    • +
  • --ascii — pass this argument to encode non-ASCII characters as + \uXXXX sequences. By default UglifyJS won't bother to do it and will + output Unicode characters instead. (the output is always encoded in UTF8, + but if you pass this option you'll only get ASCII). + +
    • +
  • -nm or --no-mangle — don't mangle names. + +
    • +
  • -nmf or --no-mangle-functions – in case you want to mangle variable + names, but not touch function names. + +
    • +
  • -ns or --no-squeeze — don't call ast_squeeze() (which does various + optimizations that result in smaller, less readable code). + +
    • +
  • -mt or --mangle-toplevel — mangle names in the toplevel scope too + (by default we don't do this). + +
    • +
  • --no-seqs — when ast_squeeze() is called (thus, unless you pass + --no-squeeze) it will reduce consecutive statements in blocks into a + sequence. For example, "a = 10; b = 20; foo();" will be written as + "a=10,b=20,foo();". In various occasions, this allows us to discard the + block brackets (since the block becomes a single statement). This is ON + by default because it seems safe and saves a few hundred bytes on some + libs that I tested it on, but pass --no-seqs to disable it. + +
    • +
  • --no-dead-code — by default, UglifyJS will remove code that is + obviously unreachable (code that follows a return, throw, break or + continue statement and is not a function/variable declaration). Pass + this option to disable this optimization. + +
    • +
  • -nc or --no-copyright — by default, uglifyjs will keep the initial + comment tokens in the generated code (assumed to be copyright information + etc.). If you pass this it will discard it. + +
    • +
  • -o filename or --output filename — put the result in filename. If + this isn't given, the result goes to standard output (or see next one). + +
    • +
  • --overwrite — if the code is read from a file (not from STDIN) and you + pass --overwrite then the output will be written in the same file. + +
    • +
  • --ast — pass this if you want to get the Abstract Syntax Tree instead + of JavaScript as output. Useful for debugging or learning more about the + internals. + +
    • +
  • -v or --verbose — output some notes on STDERR (for now just how long + each operation takes). + +
    • +
  • -d SYMBOL[=VALUE] or --define SYMBOL[=VALUE] — will replace + all instances of the specified symbol where used as an identifier + (except where symbol has properly declared by a var declaration or + use as function parameter or similar) with the specified value. This + argument may be specified multiple times to define multiple + symbols - if no value is specified the symbol will be replaced with + the value true, or you can specify a numeric value (such as + 1024), a quoted string value (such as ="object"= or + ='https://github.com'), or the name of another symbol or keyword (such as =null or document). + This allows you, for example, to assign meaningful names to key + constant values but discard the symbolic names in the uglified + version for brevity/efficiency, or when used wth care, allows + UglifyJS to operate as a form of conditional compilation + whereby defining appropriate values may, by dint of the constant + folding and dead code removal features above, remove entire + superfluous code blocks (e.g. completely remove instrumentation or + trace code for production use). + Where string values are being defined, the handling of quotes are + likely to be subject to the specifics of your command shell + environment, so you may need to experiment with quoting styles + depending on your platform, or you may find the option + --define-from-module more suitable for use. + +
    • +
  • -define-from-module SOMEMODULE — will load the named module (as + per the NodeJS require() function) and iterate all the exported + properties of the module defining them as symbol names to be defined + (as if by the --define option) per the name of each property + (i.e. without the module name prefix) and given the value of the + property. This is a much easier way to handle and document groups of + symbols to be defined rather than a large number of --define + options. + +
    • +
  • --unsafe — enable other additional optimizations that are known to be + unsafe in some contrived situations, but could still be generally useful. + For now only these: + +
      +
    • foo.toString() ==> foo+"" +
      • +
    • new Array(x,…) ==> [x,…] +
      • +
    • new Array(x) ==> Array(x) + +
      • +
    + +
    • +
  • --max-line-len (default 32K characters) — add a newline after around + 32K characters. I've seen both FF and Chrome croak when all the code was + on a single line of around 670K. Pass –max-line-len 0 to disable this + safety feature. + +
    • +
  • --reserved-names — some libraries rely on certain names to be used, as + pointed out in issue #92 and #81, so this option allow you to exclude such + names from the mangler. For example, to keep names require and $super + intact you'd specify –reserved-names "require,$super". + +
    • +
  • --inline-script – when you want to include the output literally in an + HTML <script> tag you can use this option to prevent </script from + showing up in the output. + +
    • +
  • --lift-vars – when you pass this, UglifyJS will apply the following + transformations (see the notes in API, ast_lift_variables): + +
      +
    • put all var declarations at the start of the scope +
      • +
    • make sure a variable is declared only once +
      • +
    • discard unused function arguments +
      • +
    • discard unused inner (named) functions +
      • +
    • finally, try to merge assignments into that one var declaration, if + possible. +
      • +
    + +
    • +
+ + + +
+ +
+

1.4.1 API

+
+ + +

+To use the library from JavaScript, you'd do the following (example for +NodeJS): +

+ + + +
var jsp = require("uglify-js").parser;
+var pro = require("uglify-js").uglify;
+
+var orig_code = "... JS code here";
+var ast = jsp.parse(orig_code); // parse code and get the initial AST
+ast = pro.ast_mangle(ast); // get a new AST with mangled names
+ast = pro.ast_squeeze(ast); // get an AST with compression optimizations
+var final_code = pro.gen_code(ast); // compressed code here
+
+ + +

+The above performs the full compression that is possible right now. As you +can see, there are a sequence of steps which you can apply. For example if +you want compressed output but for some reason you don't want to mangle +variable names, you would simply skip the line that calls +pro.ast_mangle(ast). +

+

+Some of these functions take optional arguments. Here's a description: +

+
    +
  • jsp.parse(code, strict_semicolons) – parses JS code and returns an AST. + strict_semicolons is optional and defaults to false. If you pass + true then the parser will throw an error when it expects a semicolon and + it doesn't find it. For most JS code you don't want that, but it's useful + if you want to strictly sanitize your code. + +
    • +
  • pro.ast_lift_variables(ast) – merge and move var declarations to the + scop of the scope; discard unused function arguments or variables; discard + unused (named) inner functions. It also tries to merge assignments + following the var declaration into it. + +

    + If your code is very hand-optimized concerning var declarations, this + lifting variable declarations might actually increase size. For me it + helps out. On jQuery it adds 865 bytes (243 after gzip). YMMV. Also + note that (since it's not enabled by default) this operation isn't yet + heavily tested (please report if you find issues!). +

    +

    + Note that although it might increase the image size (on jQuery it gains + 865 bytes, 243 after gzip) it's technically more correct: in certain + situations, dead code removal might drop variable declarations, which + would not happen if the variables are lifted in advance. +

    +

    + Here's an example of what it does: +

    • +
+ + + + + +
function f(a, b, c, d, e) {
+    var q;
+    var w;
+    w = 10;
+    q = 20;
+    for (var i = 1; i < 10; ++i) {
+        var boo = foo(a);
+    }
+    for (var i = 0; i < 1; ++i) {
+        var boo = bar(c);
+    }
+    function foo(){ ... }
+    function bar(){ ... }
+    function baz(){ ... }
+}
+
+// transforms into ==>
+
+function f(a, b, c) {
+    var i, boo, w = 10, q = 20;
+    for (i = 1; i < 10; ++i) {
+        boo = foo(a);
+    }
+    for (i = 0; i < 1; ++i) {
+        boo = bar(c);
+    }
+    function foo() { ... }
+    function bar() { ... }
+}
+
+ + +
    +
  • pro.ast_mangle(ast, options) – generates a new AST containing mangled + (compressed) variable and function names. It supports the following + options: + +
      +
    • toplevel – mangle toplevel names (by default we don't touch them). +
      • +
    • except – an array of names to exclude from compression. +
      • +
    • defines – an object with properties named after symbols to + replace (see the --define option for the script) and the values + representing the AST replacement value. + +
      • +
    + +
    • +
  • pro.ast_squeeze(ast, options) – employs further optimizations designed + to reduce the size of the code that gen_code would generate from the + AST. Returns a new AST. options can be a hash; the supported options + are: + +
      +
    • make_seqs (default true) which will cause consecutive statements in a + block to be merged using the "sequence" (comma) operator + +
      • +
    • dead_code (default true) which will remove unreachable code. + +
      • +
    + +
    • +
  • pro.gen_code(ast, options) – generates JS code from the AST. By + default it's minified, but using the options argument you can get nicely + formatted output. options is, well, optional :-) and if you pass it it + must be an object and supports the following properties (below you can see + the default values): + +
      +
    • beautify: false – pass true if you want indented output +
      • +
    • indent_start: 0 (only applies when beautify is true) – initial + indentation in spaces +
      • +
    • indent_level: 4 (only applies when beautify is true) -- + indentation level, in spaces (pass an even number) +
      • +
    • quote_keys: false – if you pass true it will quote all keys in + literal objects +
      • +
    • space_colon: false (only applies when beautify is true) – wether + to put a space before the colon in object literals +
      • +
    • ascii_only: false – pass true if you want to encode non-ASCII + characters as \uXXXX. +
      • +
    • inline_script: false – pass true to escape occurrences of + </script in strings +
      • +
    + +
    • +
+ + +
+ +
+ +
+

1.4.2 Beautifier shortcoming – no more comments

+
+ + +

+The beautifier can be used as a general purpose indentation tool. It's +useful when you want to make a minified file readable. One limitation, +though, is that it discards all comments, so you don't really want to use it +to reformat your code, unless you don't have, or don't care about, comments. +

+

+In fact it's not the beautifier who discards comments — they are dumped at +the parsing stage, when we build the initial AST. Comments don't really +make sense in the AST, and while we could add nodes for them, it would be +inconvenient because we'd have to add special rules to ignore them at all +the processing stages. +

+
+ +
+ +
+

1.4.3 Use as a code pre-processor

+
+ + +

+The --define option can be used, particularly when combined with the +constant folding logic, as a form of pre-processor to enable or remove +particular constructions, such as might be used for instrumenting +development code, or to produce variations aimed at a specific +platform. +

+

+The code below illustrates the way this can be done, and how the +symbol replacement is performed. +

+ + + +
CLAUSE1: if (typeof DEVMODE === 'undefined') {
+    DEVMODE = true;
+}
+
+CLAUSE2: function init() {
+    if (DEVMODE) {
+        console.log("init() called");
+    }
+    ....
+    DEVMODE &amp;&amp; console.log("init() complete");
+}
+
+CLAUSE3: function reportDeviceStatus(device) {
+    var DEVMODE = device.mode, DEVNAME = device.name;
+    if (DEVMODE === 'open') {
+        ....
+    }
+}
+
+ + +

+When the above code is normally executed, the undeclared global +variable DEVMODE will be assigned the value true (see CLAUSE1) +and so the init() function (CLAUSE2) will write messages to the +console log when executed, but in CLAUSE3 a locally declared +variable will mask access to the DEVMODE global symbol. +

+

+If the above code is processed by UglifyJS with an argument of +--define DEVMODE=false then UglifyJS will replace DEVMODE with the +boolean constant value false within CLAUSE1 and CLAUSE2, but it +will leave CLAUSE3 as it stands because there DEVMODE resolves to +a validly declared variable. +

+

+And more so, the constant-folding features of UglifyJS will recognise +that the if condition of CLAUSE1 is thus always false, and so will +remove the test and body of CLAUSE1 altogether (including the +otherwise slightly problematical statement false = true; which it +will have formed by replacing DEVMODE in the body). Similarly, +within CLAUSE2 both calls to console.log() will be removed +altogether. +

+

+In this way you can mimic, to a limited degree, the functionality of +the C/C++ pre-processor to enable or completely remove blocks +depending on how certain symbols are defined - perhaps using UglifyJS +to generate different versions of source aimed at different +environments +

+

+It is recommmended (but not made mandatory) that symbols designed for +this purpose are given names consisting of UPPER_CASE_LETTERS to +distinguish them from other (normal) symbols and avoid the sort of +clash that CLAUSE3 above illustrates. +

+
+
+ +
+ +
+

1.5 Compression – how good is it?

+
+ + +

+Here are updated statistics. (I also updated my Google Closure and YUI +installations). +

+

+We're still a lot better than YUI in terms of compression, though slightly +slower. We're still a lot faster than Closure, and compression after gzip +is comparable. +

+ + ++ + + + + + + + + + +
FileUglifyJSUglifyJS+gzipClosureClosure+gzipYUIYUI+gzip
jquery-1.6.2.js91001 (0:01.59)3189690678 (0:07.40)31979101527 (0:01.82)34646
paper.js142023 (0:01.65)43334134301 (0:07.42)42495173383 (0:01.58)48785
prototype.js88544 (0:01.09)2668086955 (0:06.97)2632692130 (0:00.79)28624
thelib-full.js (DynarchLIB)251939 (0:02.55)72535249911 (0:09.05)72696258869 (0:01.94)76584
+ + +
+ +
+ +
+

1.6 Bugs?

+
+ + +

+Unfortunately, for the time being there is no automated test suite. But I +ran the compressor manually on non-trivial code, and then I tested that the +generated code works as expected. A few hundred times. +

+

+DynarchLIB was started in times when there was no good JS minifier. +Therefore I was quite religious about trying to write short code manually, +and as such DL contains a lot of syntactic hacks1 such as “foo == bar ? a += 10 : b = 20”, though the more readable version would clearly be to use +“if/else”. +

+

+Since the parser/compressor runs fine on DL and jQuery, I'm quite confident +that it's solid enough for production use. If you can identify any bugs, +I'd love to hear about them (use the Google Group or email me directly). +

+
+ +
+ +
+

1.7 Links

+
+ + + + + +
+ +
+ +
+

1.8 License

+
+ + +

+UglifyJS is released under the BSD license: +

+ + + +
Copyright 2010 (c) Mihai Bazon <mihai.bazon@gmail.com>
+Based on parse-js (http://marijn.haverbeke.nl/parse-js/).
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+
+    * Redistributions of source code must retain the above
+      copyright notice, this list of conditions and the following
+      disclaimer.
+
+    * Redistributions in binary form must reproduce the above
+      copyright notice, this list of conditions and the following
+      disclaimer in the documentation and/or other materials
+      provided with the distribution.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDER “AS IS” AND ANY
+EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
+PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER BE
+LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY,
+OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO,
+PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR
+PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR
+TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF
+THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF
+SUCH DAMAGE.
+
+ + +
+

Footnotes:

+
+

1 I even reported a few bugs and suggested some fixes in the original + parse-js library, and Marijn pushed fixes literally in minutes. +

+
+
+ +
+
+
+ +
+

Date: 2011-12-09 14:59:08 EET

+

Author: Mihai Bazon

+

Org version 7.7 with Emacs version 23

+Validate XHTML 1.0 + +
+ + diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/README.org b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/README.org new file mode 100644 index 0000000..4d01fdf --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/README.org @@ -0,0 +1,574 @@ +#+TITLE: UglifyJS -- a JavaScript parser/compressor/beautifier +#+KEYWORDS: javascript, js, parser, compiler, compressor, mangle, minify, minifier +#+DESCRIPTION: a JavaScript parser/compressor/beautifier in JavaScript +#+STYLE: +#+AUTHOR: Mihai Bazon +#+EMAIL: mihai.bazon@gmail.com + +* UglifyJS --- a JavaScript parser/compressor/beautifier + +This package implements a general-purpose JavaScript +parser/compressor/beautifier toolkit. It is developed on [[http://nodejs.org/][NodeJS]], but it +should work on any JavaScript platform supporting the CommonJS module system +(and if your platform of choice doesn't support CommonJS, you can easily +implement it, or discard the =exports.*= lines from UglifyJS sources). + +The tokenizer/parser generates an abstract syntax tree from JS code. You +can then traverse the AST to learn more about the code, or do various +manipulations on it. This part is implemented in [[../lib/parse-js.js][parse-js.js]] and it's a +port to JavaScript of the excellent [[http://marijn.haverbeke.nl/parse-js/][parse-js]] Common Lisp library from [[http://marijn.haverbeke.nl/][Marijn +Haverbeke]]. + +( See [[http://github.com/mishoo/cl-uglify-js][cl-uglify-js]] if you're looking for the Common Lisp version of +UglifyJS. ) + +The second part of this package, implemented in [[../lib/process.js][process.js]], inspects and +manipulates the AST generated by the parser to provide the following: + +- ability to re-generate JavaScript code from the AST. Optionally + indented---you can use this if you want to “beautify” a program that has + been compressed, so that you can inspect the source. But you can also run + our code generator to print out an AST without any whitespace, so you + achieve compression as well. + +- shorten variable names (usually to single characters). Our mangler will + analyze the code and generate proper variable names, depending on scope + and usage, and is smart enough to deal with globals defined elsewhere, or + with =eval()= calls or =with{}= statements. In short, if =eval()= or + =with{}= are used in some scope, then all variables in that scope and any + variables in the parent scopes will remain unmangled, and any references + to such variables remain unmangled as well. + +- various small optimizations that may lead to faster code but certainly + lead to smaller code. Where possible, we do the following: + + - foo["bar"] ==> foo.bar + + - remove block brackets ={}= + + - join consecutive var declarations: + var a = 10; var b = 20; ==> var a=10,b=20; + + - resolve simple constant expressions: 1 +2 * 3 ==> 7. We only do the + replacement if the result occupies less bytes; for example 1/3 would + translate to 0.333333333333, so in this case we don't replace it. + + - consecutive statements in blocks are merged into a sequence; in many + cases, this leaves blocks with a single statement, so then we can remove + the block brackets. + + - various optimizations for IF statements: + + - if (foo) bar(); else baz(); ==> foo?bar():baz(); + - if (!foo) bar(); else baz(); ==> foo?baz():bar(); + - if (foo) bar(); ==> foo&&bar(); + - if (!foo) bar(); ==> foo||bar(); + - if (foo) return bar(); else return baz(); ==> return foo?bar():baz(); + - if (foo) return bar(); else something(); ==> {if(foo)return bar();something()} + + - remove some unreachable code and warn about it (code that follows a + =return=, =throw=, =break= or =continue= statement, except + function/variable declarations). + + - act a limited version of a pre-processor (c.f. the pre-processor of + C/C++) to allow you to safely replace selected global symbols with + specified values. When combined with the optimisations above this can + make UglifyJS operate slightly more like a compilation process, in + that when certain symbols are replaced by constant values, entire code + blocks may be optimised away as unreachable. + +** <> + +The following transformations can in theory break code, although they're +probably safe in most practical cases. To enable them you need to pass the +=--unsafe= flag. + +*** Calls involving the global Array constructor + +The following transformations occur: + +#+BEGIN_SRC js +new Array(1, 2, 3, 4) => [1,2,3,4] +Array(a, b, c) => [a,b,c] +new Array(5) => Array(5) +new Array(a) => Array(a) +#+END_SRC + +These are all safe if the Array name isn't redefined. JavaScript does allow +one to globally redefine Array (and pretty much everything, in fact) but I +personally don't see why would anyone do that. + +UglifyJS does handle the case where Array is redefined locally, or even +globally but with a =function= or =var= declaration. Therefore, in the +following cases UglifyJS *doesn't touch* calls or instantiations of Array: + +#+BEGIN_SRC js +// case 1. globally declared variable + var Array; + new Array(1, 2, 3); + Array(a, b); + + // or (can be declared later) + new Array(1, 2, 3); + var Array; + + // or (can be a function) + new Array(1, 2, 3); + function Array() { ... } + +// case 2. declared in a function + (function(){ + a = new Array(1, 2, 3); + b = Array(5, 6); + var Array; + })(); + + // or + (function(Array){ + return Array(5, 6, 7); + })(); + + // or + (function(){ + return new Array(1, 2, 3, 4); + function Array() { ... } + })(); + + // etc. +#+END_SRC + +*** =obj.toString()= ==> =obj+“”= + +** Install (NPM) + +UglifyJS is now available through NPM --- =npm install uglify-js= should do +the job. + +** Install latest code from GitHub + +#+BEGIN_SRC sh +## clone the repository +mkdir -p /where/you/wanna/put/it +cd /where/you/wanna/put/it +git clone git://github.com/mishoo/UglifyJS.git + +## make the module available to Node +mkdir -p ~/.node_libraries/ +cd ~/.node_libraries/ +ln -s /where/you/wanna/put/it/UglifyJS/uglify-js.js + +## and if you want the CLI script too: +mkdir -p ~/bin +cd ~/bin +ln -s /where/you/wanna/put/it/UglifyJS/bin/uglifyjs + # (then add ~/bin to your $PATH if it's not there already) +#+END_SRC + +** Usage + +There is a command-line tool that exposes the functionality of this library +for your shell-scripting needs: + +#+BEGIN_SRC sh +uglifyjs [ options... ] [ filename ] +#+END_SRC + +=filename= should be the last argument and should name the file from which +to read the JavaScript code. If you don't specify it, it will read code +from STDIN. + +Supported options: + +- =-b= or =--beautify= --- output indented code; when passed, additional + options control the beautifier: + + - =-i N= or =--indent N= --- indentation level (number of spaces) + + - =-q= or =--quote-keys= --- quote keys in literal objects (by default, + only keys that cannot be identifier names will be quotes). + +- =--ascii= --- pass this argument to encode non-ASCII characters as + =\uXXXX= sequences. By default UglifyJS won't bother to do it and will + output Unicode characters instead. (the output is always encoded in UTF8, + but if you pass this option you'll only get ASCII). + +- =-nm= or =--no-mangle= --- don't mangle names. + +- =-nmf= or =--no-mangle-functions= -- in case you want to mangle variable + names, but not touch function names. + +- =-ns= or =--no-squeeze= --- don't call =ast_squeeze()= (which does various + optimizations that result in smaller, less readable code). + +- =-mt= or =--mangle-toplevel= --- mangle names in the toplevel scope too + (by default we don't do this). + +- =--no-seqs= --- when =ast_squeeze()= is called (thus, unless you pass + =--no-squeeze=) it will reduce consecutive statements in blocks into a + sequence. For example, "a = 10; b = 20; foo();" will be written as + "a=10,b=20,foo();". In various occasions, this allows us to discard the + block brackets (since the block becomes a single statement). This is ON + by default because it seems safe and saves a few hundred bytes on some + libs that I tested it on, but pass =--no-seqs= to disable it. + +- =--no-dead-code= --- by default, UglifyJS will remove code that is + obviously unreachable (code that follows a =return=, =throw=, =break= or + =continue= statement and is not a function/variable declaration). Pass + this option to disable this optimization. + +- =-nc= or =--no-copyright= --- by default, =uglifyjs= will keep the initial + comment tokens in the generated code (assumed to be copyright information + etc.). If you pass this it will discard it. + +- =-o filename= or =--output filename= --- put the result in =filename=. If + this isn't given, the result goes to standard output (or see next one). + +- =--overwrite= --- if the code is read from a file (not from STDIN) and you + pass =--overwrite= then the output will be written in the same file. + +- =--ast= --- pass this if you want to get the Abstract Syntax Tree instead + of JavaScript as output. Useful for debugging or learning more about the + internals. + +- =-v= or =--verbose= --- output some notes on STDERR (for now just how long + each operation takes). + +- =-d SYMBOL[=VALUE]= or =--define SYMBOL[=VALUE]= --- will replace + all instances of the specified symbol where used as an identifier + (except where symbol has properly declared by a var declaration or + use as function parameter or similar) with the specified value. This + argument may be specified multiple times to define multiple + symbols - if no value is specified the symbol will be replaced with + the value =true=, or you can specify a numeric value (such as + =1024=), a quoted string value (such as ="object"= or + ='https://github.com'=), or the name of another symbol or keyword + (such as =null= or =document=). + This allows you, for example, to assign meaningful names to key + constant values but discard the symbolic names in the uglified + version for brevity/efficiency, or when used wth care, allows + UglifyJS to operate as a form of *conditional compilation* + whereby defining appropriate values may, by dint of the constant + folding and dead code removal features above, remove entire + superfluous code blocks (e.g. completely remove instrumentation or + trace code for production use). + Where string values are being defined, the handling of quotes are + likely to be subject to the specifics of your command shell + environment, so you may need to experiment with quoting styles + depending on your platform, or you may find the option + =--define-from-module= more suitable for use. + +- =-define-from-module SOMEMODULE= --- will load the named module (as + per the NodeJS =require()= function) and iterate all the exported + properties of the module defining them as symbol names to be defined + (as if by the =--define= option) per the name of each property + (i.e. without the module name prefix) and given the value of the + property. This is a much easier way to handle and document groups of + symbols to be defined rather than a large number of =--define= + options. + +- =--unsafe= --- enable other additional optimizations that are known to be + unsafe in some contrived situations, but could still be generally useful. + For now only these: + + - foo.toString() ==> foo+"" + - new Array(x,...) ==> [x,...] + - new Array(x) ==> Array(x) + +- =--max-line-len= (default 32K characters) --- add a newline after around + 32K characters. I've seen both FF and Chrome croak when all the code was + on a single line of around 670K. Pass --max-line-len 0 to disable this + safety feature. + +- =--reserved-names= --- some libraries rely on certain names to be used, as + pointed out in issue #92 and #81, so this option allow you to exclude such + names from the mangler. For example, to keep names =require= and =$super= + intact you'd specify --reserved-names "require,$super". + +- =--inline-script= -- when you want to include the output literally in an + HTML =\n\n\n\n\n
\n\n
\n\n
\n

UglifyJS – a JavaScript parser/compressor/beautifier

\n\n\n\n\n
\n

1 UglifyJS — a JavaScript parser/compressor/beautifier

\n
\n\n\n

\nThis package implements a general-purpose JavaScript\nparser/compressor/beautifier toolkit. It is developed on NodeJS, but it\nshould work on any JavaScript platform supporting the CommonJS module system\n(and if your platform of choice doesn't support CommonJS, you can easily\nimplement it, or discard the exports.* lines from UglifyJS sources).\n

\n

\nThe tokenizer/parser generates an abstract syntax tree from JS code. You\ncan then traverse the AST to learn more about the code, or do various\nmanipulations on it. This part is implemented in parse-js.js and it's a\nport to JavaScript of the excellent parse-js Common Lisp library from Marijn Haverbeke.\n

\n

\n( See cl-uglify-js if you're looking for the Common Lisp version of\nUglifyJS. )\n

\n

\nThe second part of this package, implemented in process.js, inspects and\nmanipulates the AST generated by the parser to provide the following:\n

\n
    \n
  • ability to re-generate JavaScript code from the AST. Optionally\n indented—you can use this if you want to “beautify” a program that has\n been compressed, so that you can inspect the source. But you can also run\n our code generator to print out an AST without any whitespace, so you\n achieve compression as well.\n\n
    • \n
  • shorten variable names (usually to single characters). Our mangler will\n analyze the code and generate proper variable names, depending on scope\n and usage, and is smart enough to deal with globals defined elsewhere, or\n with eval() calls or with{} statements. In short, if eval() or\n with{} are used in some scope, then all variables in that scope and any\n variables in the parent scopes will remain unmangled, and any references\n to such variables remain unmangled as well.\n\n
    • \n
  • various small optimizations that may lead to faster code but certainly\n lead to smaller code. Where possible, we do the following:\n\n
      \n
    • foo[\"bar\"] ==> foo.bar\n\n
      • \n
    • remove block brackets {}\n\n
      • \n
    • join consecutive var declarations:\n var a = 10; var b = 20; ==> var a=10,b=20;\n\n
      • \n
    • resolve simple constant expressions: 1 +2 * 3 ==> 7. We only do the\n replacement if the result occupies less bytes; for example 1/3 would\n translate to 0.333333333333, so in this case we don't replace it.\n\n
      • \n
    • consecutive statements in blocks are merged into a sequence; in many\n cases, this leaves blocks with a single statement, so then we can remove\n the block brackets.\n\n
      • \n
    • various optimizations for IF statements:\n\n
        \n
      • if (foo) bar(); else baz(); ==> foo?bar():baz();\n
        • \n
      • if (!foo) bar(); else baz(); ==> foo?baz():bar();\n
        • \n
      • if (foo) bar(); ==> foo&&bar();\n
        • \n
      • if (!foo) bar(); ==> foo||bar();\n
        • \n
      • if (foo) return bar(); else return baz(); ==> return foo?bar():baz();\n
        • \n
      • if (foo) return bar(); else something(); ==> {if(foo)return bar();something()}\n\n
        • \n
      \n\n
      • \n
    • remove some unreachable code and warn about it (code that follows a\n return, throw, break or continue statement, except\n function/variable declarations).\n\n
      • \n
    • act a limited version of a pre-processor (c.f. the pre-processor of\n C/C++) to allow you to safely replace selected global symbols with\n specified values. When combined with the optimisations above this can\n make UglifyJS operate slightly more like a compilation process, in\n that when certain symbols are replaced by constant values, entire code\n blocks may be optimised away as unreachable.\n
      • \n
    \n\n
    • \n
\n\n\n\n
\n\n
\n

1.1 Unsafe transformations

\n
\n\n\n

\nThe following transformations can in theory break code, although they're\nprobably safe in most practical cases. To enable them you need to pass the\n--unsafe flag.\n

\n\n
\n\n
\n

1.1.1 Calls involving the global Array constructor

\n
\n\n\n

\nThe following transformations occur:\n

\n\n\n\n
new Array(1, 2, 3, 4)  => [1,2,3,4]\nArray(a, b, c)         => [a,b,c]\nnew Array(5)           => Array(5)\nnew Array(a)           => Array(a)\n
\n\n\n

\nThese are all safe if the Array name isn't redefined. JavaScript does allow\none to globally redefine Array (and pretty much everything, in fact) but I\npersonally don't see why would anyone do that.\n

\n

\nUglifyJS does handle the case where Array is redefined locally, or even\nglobally but with a function or var declaration. Therefore, in the\nfollowing cases UglifyJS doesn't touch calls or instantiations of Array:\n

\n\n\n\n
// case 1.  globally declared variable\n  var Array;\n  new Array(1, 2, 3);\n  Array(a, b);\n\n  // or (can be declared later)\n  new Array(1, 2, 3);\n  var Array;\n\n  // or (can be a function)\n  new Array(1, 2, 3);\n  function Array() { ... }\n\n// case 2.  declared in a function\n  (function(){\n    a = new Array(1, 2, 3);\n    b = Array(5, 6);\n    var Array;\n  })();\n\n  // or\n  (function(Array){\n    return Array(5, 6, 7);\n  })();\n\n  // or\n  (function(){\n    return new Array(1, 2, 3, 4);\n    function Array() { ... }\n  })();\n\n  // etc.\n
\n\n\n
\n\n
\n\n
\n

1.1.2 obj.toString() ==> obj+“”

\n
\n\n\n
\n
\n\n
\n\n
\n

1.2 Install (NPM)

\n
\n\n\n

\nUglifyJS is now available through NPM — npm install uglify-js should do\nthe job.\n

\n
\n\n
\n\n
\n

1.3 Install latest code from GitHub

\n
\n\n\n\n\n\n
## clone the repository\nmkdir -p /where/you/wanna/put/it\ncd /where/you/wanna/put/it\ngit clone git://github.com/mishoo/UglifyJS.git\n\n## make the module available to Node\nmkdir -p ~/.node_libraries/\ncd ~/.node_libraries/\nln -s /where/you/wanna/put/it/UglifyJS/uglify-js.js\n\n## and if you want the CLI script too:\nmkdir -p ~/bin\ncd ~/bin\nln -s /where/you/wanna/put/it/UglifyJS/bin/uglifyjs\n  # (then add ~/bin to your $PATH if it's not there already)\n
\n\n\n
\n\n
\n\n
\n

1.4 Usage

\n
\n\n\n

\nThere is a command-line tool that exposes the functionality of this library\nfor your shell-scripting needs:\n

\n\n\n\n
uglifyjs [ options... ] [ filename ]\n
\n\n\n

\nfilename should be the last argument and should name the file from which\nto read the JavaScript code. If you don't specify it, it will read code\nfrom STDIN.\n

\n

\nSupported options:\n

\n
    \n
  • -b or --beautify — output indented code; when passed, additional\n options control the beautifier:\n\n
      \n
    • -i N or --indent N — indentation level (number of spaces)\n\n
      • \n
    • -q or --quote-keys — quote keys in literal objects (by default,\n only keys that cannot be identifier names will be quotes).\n\n
      • \n
    \n\n
    • \n
  • --ascii — pass this argument to encode non-ASCII characters as\n \\uXXXX sequences. By default UglifyJS won't bother to do it and will\n output Unicode characters instead. (the output is always encoded in UTF8,\n but if you pass this option you'll only get ASCII).\n\n
    • \n
  • -nm or --no-mangle — don't mangle names.\n\n
    • \n
  • -nmf or --no-mangle-functions – in case you want to mangle variable\n names, but not touch function names.\n\n
    • \n
  • -ns or --no-squeeze — don't call ast_squeeze() (which does various\n optimizations that result in smaller, less readable code).\n\n
    • \n
  • -mt or --mangle-toplevel — mangle names in the toplevel scope too\n (by default we don't do this).\n\n
    • \n
  • --no-seqs — when ast_squeeze() is called (thus, unless you pass\n --no-squeeze) it will reduce consecutive statements in blocks into a\n sequence. For example, \"a = 10; b = 20; foo();\" will be written as\n \"a=10,b=20,foo();\". In various occasions, this allows us to discard the\n block brackets (since the block becomes a single statement). This is ON\n by default because it seems safe and saves a few hundred bytes on some\n libs that I tested it on, but pass --no-seqs to disable it.\n\n
    • \n
  • --no-dead-code — by default, UglifyJS will remove code that is\n obviously unreachable (code that follows a return, throw, break or\n continue statement and is not a function/variable declaration). Pass\n this option to disable this optimization.\n\n
    • \n
  • -nc or --no-copyright — by default, uglifyjs will keep the initial\n comment tokens in the generated code (assumed to be copyright information\n etc.). If you pass this it will discard it.\n\n
    • \n
  • -o filename or --output filename — put the result in filename. If\n this isn't given, the result goes to standard output (or see next one).\n\n
    • \n
  • --overwrite — if the code is read from a file (not from STDIN) and you\n pass --overwrite then the output will be written in the same file.\n\n
    • \n
  • --ast — pass this if you want to get the Abstract Syntax Tree instead\n of JavaScript as output. Useful for debugging or learning more about the\n internals.\n\n
    • \n
  • -v or --verbose — output some notes on STDERR (for now just how long\n each operation takes).\n\n
    • \n
  • -d SYMBOL[=VALUE] or --define SYMBOL[=VALUE] — will replace\n all instances of the specified symbol where used as an identifier\n (except where symbol has properly declared by a var declaration or\n use as function parameter or similar) with the specified value. This\n argument may be specified multiple times to define multiple\n symbols - if no value is specified the symbol will be replaced with\n the value true, or you can specify a numeric value (such as\n 1024), a quoted string value (such as =\"object\"= or\n ='https://github.com'), or the name of another symbol or keyword (such as =null or document).\n This allows you, for example, to assign meaningful names to key\n constant values but discard the symbolic names in the uglified\n version for brevity/efficiency, or when used wth care, allows\n UglifyJS to operate as a form of conditional compilation\n whereby defining appropriate values may, by dint of the constant\n folding and dead code removal features above, remove entire\n superfluous code blocks (e.g. completely remove instrumentation or\n trace code for production use).\n Where string values are being defined, the handling of quotes are\n likely to be subject to the specifics of your command shell\n environment, so you may need to experiment with quoting styles\n depending on your platform, or you may find the option\n --define-from-module more suitable for use.\n\n
    • \n
  • -define-from-module SOMEMODULE — will load the named module (as\n per the NodeJS require() function) and iterate all the exported\n properties of the module defining them as symbol names to be defined\n (as if by the --define option) per the name of each property\n (i.e. without the module name prefix) and given the value of the\n property. This is a much easier way to handle and document groups of\n symbols to be defined rather than a large number of --define\n options.\n\n
    • \n
  • --unsafe — enable other additional optimizations that are known to be\n unsafe in some contrived situations, but could still be generally useful.\n For now only these:\n\n
      \n
    • foo.toString() ==> foo+\"\"\n
      • \n
    • new Array(x,…) ==> [x,…]\n
      • \n
    • new Array(x) ==> Array(x)\n\n
      • \n
    \n\n
    • \n
  • --max-line-len (default 32K characters) — add a newline after around\n 32K characters. I've seen both FF and Chrome croak when all the code was\n on a single line of around 670K. Pass –max-line-len 0 to disable this\n safety feature.\n\n
    • \n
  • --reserved-names — some libraries rely on certain names to be used, as\n pointed out in issue #92 and #81, so this option allow you to exclude such\n names from the mangler. For example, to keep names require and $super\n intact you'd specify –reserved-names \"require,$super\".\n\n
    • \n
  • --inline-script – when you want to include the output literally in an\n HTML <script> tag you can use this option to prevent </script from\n showing up in the output.\n\n
    • \n
  • --lift-vars – when you pass this, UglifyJS will apply the following\n transformations (see the notes in API, ast_lift_variables):\n\n
      \n
    • put all var declarations at the start of the scope\n
      • \n
    • make sure a variable is declared only once\n
      • \n
    • discard unused function arguments\n
      • \n
    • discard unused inner (named) functions\n
      • \n
    • finally, try to merge assignments into that one var declaration, if\n possible.\n
      • \n
    \n\n
    • \n
\n\n\n\n
\n\n
\n

1.4.1 API

\n
\n\n\n

\nTo use the library from JavaScript, you'd do the following (example for\nNodeJS):\n

\n\n\n\n
var jsp = require(\"uglify-js\").parser;\nvar pro = require(\"uglify-js\").uglify;\n\nvar orig_code = \"... JS code here\";\nvar ast = jsp.parse(orig_code); // parse code and get the initial AST\nast = pro.ast_mangle(ast); // get a new AST with mangled names\nast = pro.ast_squeeze(ast); // get an AST with compression optimizations\nvar final_code = pro.gen_code(ast); // compressed code here\n
\n\n\n

\nThe above performs the full compression that is possible right now. As you\ncan see, there are a sequence of steps which you can apply. For example if\nyou want compressed output but for some reason you don't want to mangle\nvariable names, you would simply skip the line that calls\npro.ast_mangle(ast).\n

\n

\nSome of these functions take optional arguments. Here's a description:\n

\n
    \n
  • jsp.parse(code, strict_semicolons) – parses JS code and returns an AST.\n strict_semicolons is optional and defaults to false. If you pass\n true then the parser will throw an error when it expects a semicolon and\n it doesn't find it. For most JS code you don't want that, but it's useful\n if you want to strictly sanitize your code.\n\n
    • \n
  • pro.ast_lift_variables(ast) – merge and move var declarations to the\n scop of the scope; discard unused function arguments or variables; discard\n unused (named) inner functions. It also tries to merge assignments\n following the var declaration into it.\n\n

    \n If your code is very hand-optimized concerning var declarations, this\n lifting variable declarations might actually increase size. For me it\n helps out. On jQuery it adds 865 bytes (243 after gzip). YMMV. Also\n note that (since it's not enabled by default) this operation isn't yet\n heavily tested (please report if you find issues!).\n

    \n

    \n Note that although it might increase the image size (on jQuery it gains\n 865 bytes, 243 after gzip) it's technically more correct: in certain\n situations, dead code removal might drop variable declarations, which\n would not happen if the variables are lifted in advance.\n

    \n

    \n Here's an example of what it does:\n

    • \n
\n\n\n\n\n\n
function f(a, b, c, d, e) {\n    var q;\n    var w;\n    w = 10;\n    q = 20;\n    for (var i = 1; i < 10; ++i) {\n        var boo = foo(a);\n    }\n    for (var i = 0; i < 1; ++i) {\n        var boo = bar(c);\n    }\n    function foo(){ ... }\n    function bar(){ ... }\n    function baz(){ ... }\n}\n\n// transforms into ==>\n\nfunction f(a, b, c) {\n    var i, boo, w = 10, q = 20;\n    for (i = 1; i < 10; ++i) {\n        boo = foo(a);\n    }\n    for (i = 0; i < 1; ++i) {\n        boo = bar(c);\n    }\n    function foo() { ... }\n    function bar() { ... }\n}\n
\n\n\n
    \n
  • pro.ast_mangle(ast, options) – generates a new AST containing mangled\n (compressed) variable and function names. It supports the following\n options:\n\n
      \n
    • toplevel – mangle toplevel names (by default we don't touch them).\n
      • \n
    • except – an array of names to exclude from compression.\n
      • \n
    • defines – an object with properties named after symbols to\n replace (see the --define option for the script) and the values\n representing the AST replacement value.\n\n
      • \n
    \n\n
    • \n
  • pro.ast_squeeze(ast, options) – employs further optimizations designed\n to reduce the size of the code that gen_code would generate from the\n AST. Returns a new AST. options can be a hash; the supported options\n are:\n\n
      \n
    • make_seqs (default true) which will cause consecutive statements in a\n block to be merged using the \"sequence\" (comma) operator\n\n
      • \n
    • dead_code (default true) which will remove unreachable code.\n\n
      • \n
    \n\n
    • \n
  • pro.gen_code(ast, options) – generates JS code from the AST. By\n default it's minified, but using the options argument you can get nicely\n formatted output. options is, well, optional :-) and if you pass it it\n must be an object and supports the following properties (below you can see\n the default values):\n\n
      \n
    • beautify: false – pass true if you want indented output\n
      • \n
    • indent_start: 0 (only applies when beautify is true) – initial\n indentation in spaces\n
      • \n
    • indent_level: 4 (only applies when beautify is true) --\n indentation level, in spaces (pass an even number)\n
      • \n
    • quote_keys: false – if you pass true it will quote all keys in\n literal objects\n
      • \n
    • space_colon: false (only applies when beautify is true) – wether\n to put a space before the colon in object literals\n
      • \n
    • ascii_only: false – pass true if you want to encode non-ASCII\n characters as \\uXXXX.\n
      • \n
    • inline_script: false – pass true to escape occurrences of\n </script in strings\n
      • \n
    \n\n
    • \n
\n\n\n
\n\n
\n\n
\n

1.4.2 Beautifier shortcoming – no more comments

\n
\n\n\n

\nThe beautifier can be used as a general purpose indentation tool. It's\nuseful when you want to make a minified file readable. One limitation,\nthough, is that it discards all comments, so you don't really want to use it\nto reformat your code, unless you don't have, or don't care about, comments.\n

\n

\nIn fact it's not the beautifier who discards comments — they are dumped at\nthe parsing stage, when we build the initial AST. Comments don't really\nmake sense in the AST, and while we could add nodes for them, it would be\ninconvenient because we'd have to add special rules to ignore them at all\nthe processing stages.\n

\n
\n\n
\n\n
\n

1.4.3 Use as a code pre-processor

\n
\n\n\n

\nThe --define option can be used, particularly when combined with the\nconstant folding logic, as a form of pre-processor to enable or remove\nparticular constructions, such as might be used for instrumenting\ndevelopment code, or to produce variations aimed at a specific\nplatform.\n

\n

\nThe code below illustrates the way this can be done, and how the\nsymbol replacement is performed.\n

\n\n\n\n
CLAUSE1: if (typeof DEVMODE === 'undefined') {\n    DEVMODE = true;\n}\n\nCLAUSE2: function init() {\n    if (DEVMODE) {\n        console.log(\"init() called\");\n    }\n    ....\n    DEVMODE &amp;&amp; console.log(\"init() complete\");\n}\n\nCLAUSE3: function reportDeviceStatus(device) {\n    var DEVMODE = device.mode, DEVNAME = device.name;\n    if (DEVMODE === 'open') {\n        ....\n    }\n}\n
\n\n\n

\nWhen the above code is normally executed, the undeclared global\nvariable DEVMODE will be assigned the value true (see CLAUSE1)\nand so the init() function (CLAUSE2) will write messages to the\nconsole log when executed, but in CLAUSE3 a locally declared\nvariable will mask access to the DEVMODE global symbol.\n

\n

\nIf the above code is processed by UglifyJS with an argument of\n--define DEVMODE=false then UglifyJS will replace DEVMODE with the\nboolean constant value false within CLAUSE1 and CLAUSE2, but it\nwill leave CLAUSE3 as it stands because there DEVMODE resolves to\na validly declared variable.\n

\n

\nAnd more so, the constant-folding features of UglifyJS will recognise\nthat the if condition of CLAUSE1 is thus always false, and so will\nremove the test and body of CLAUSE1 altogether (including the\notherwise slightly problematical statement false = true; which it\nwill have formed by replacing DEVMODE in the body). Similarly,\nwithin CLAUSE2 both calls to console.log() will be removed\naltogether.\n

\n

\nIn this way you can mimic, to a limited degree, the functionality of\nthe C/C++ pre-processor to enable or completely remove blocks\ndepending on how certain symbols are defined - perhaps using UglifyJS\nto generate different versions of source aimed at different\nenvironments\n

\n

\nIt is recommmended (but not made mandatory) that symbols designed for\nthis purpose are given names consisting of UPPER_CASE_LETTERS to\ndistinguish them from other (normal) symbols and avoid the sort of\nclash that CLAUSE3 above illustrates.\n

\n
\n
\n\n
\n\n
\n

1.5 Compression – how good is it?

\n
\n\n\n

\nHere are updated statistics. (I also updated my Google Closure and YUI\ninstallations).\n

\n

\nWe're still a lot better than YUI in terms of compression, though slightly\nslower. We're still a lot faster than Closure, and compression after gzip\nis comparable.\n

\n\n\n\n\n\n\n\n\n\n\n\n\n\n
FileUglifyJSUglifyJS+gzipClosureClosure+gzipYUIYUI+gzip
jquery-1.6.2.js91001 (0:01.59)3189690678 (0:07.40)31979101527 (0:01.82)34646
paper.js142023 (0:01.65)43334134301 (0:07.42)42495173383 (0:01.58)48785
prototype.js88544 (0:01.09)2668086955 (0:06.97)2632692130 (0:00.79)28624
thelib-full.js (DynarchLIB)251939 (0:02.55)72535249911 (0:09.05)72696258869 (0:01.94)76584
\n\n\n
\n\n
\n\n
\n

1.6 Bugs?

\n
\n\n\n

\nUnfortunately, for the time being there is no automated test suite. But I\nran the compressor manually on non-trivial code, and then I tested that the\ngenerated code works as expected. A few hundred times.\n

\n

\nDynarchLIB was started in times when there was no good JS minifier.\nTherefore I was quite religious about trying to write short code manually,\nand as such DL contains a lot of syntactic hacks1 such as “foo == bar ? a\n= 10 : b = 20”, though the more readable version would clearly be to use\n“if/else”.\n

\n

\nSince the parser/compressor runs fine on DL and jQuery, I'm quite confident\nthat it's solid enough for production use. If you can identify any bugs,\nI'd love to hear about them (use the Google Group or email me directly).\n

\n
\n\n
\n\n
\n

1.7 Links

\n
\n\n\n\n\n\n
\n\n
\n\n
\n

1.8 License

\n
\n\n\n

\nUglifyJS is released under the BSD license:\n

\n\n\n\n
Copyright 2010 (c) Mihai Bazon <mihai.bazon@gmail.com>\nBased on parse-js (http://marijn.haverbeke.nl/parse-js/).\n\nRedistribution and use in source and binary forms, with or without\nmodification, are permitted provided that the following conditions\nare met:\n\n    * Redistributions of source code must retain the above\n      copyright notice, this list of conditions and the following\n      disclaimer.\n\n    * Redistributions in binary form must reproduce the above\n      copyright notice, this list of conditions and the following\n      disclaimer in the documentation and/or other materials\n      provided with the distribution.\n\nTHIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDER “AS IS” AND ANY\nEXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\nIMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR\nPURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER BE\nLIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY,\nOR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO,\nPROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR\nPROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY\nTHEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR\nTORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF\nTHE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF\nSUCH DAMAGE.\n
\n\n\n
\n

Footnotes:

\n
\n

1 I even reported a few bugs and suggested some fixes in the original\n parse-js library, and Marijn pushed fixes literally in minutes.\n

\n
\n
\n\n
\n
\n
\n\n
\n

Date: 2011-12-09 14:59:08 EET

\n

Author: Mihai Bazon

\n

Org version 7.7 with Emacs version 23

\nValidate XHTML 1.0\n\n
\n\n\n", + "readmeFilename": "README.html", + "_id": "uglify-js@1.2.5", + "dist": { + "shasum": "c399ef36f5b5b07a3840db33d4eacdbecdc0c268" + }, + "_from": "uglify-js@1.2.5", + "_resolved": "https://registry.npmjs.org/uglify-js/-/uglify-js-1.2.5.tgz" +} diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/package.json~ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/package.json~ new file mode 100644 index 0000000..e4cb23d --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/package.json~ @@ -0,0 +1,24 @@ +{ + "name" : "uglify-js", + + "description" : "JavaScript parser and compressor/beautifier toolkit", + + "author" : { + "name" : "Mihai Bazon", + "email" : "mihai.bazon@gmail.com", + "url" : "http://mihai.bazon.net/blog" + }, + + "version" : "1.2.3", + + "main" : "./uglify-js.js", + + "bin" : { + "uglifyjs" : "./bin/uglifyjs" + }, + + "repository": { + "type": "git", + "url": "git@github.com:mishoo/UglifyJS.git" + } +} diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/beautify.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/beautify.js new file mode 100644 index 0000000..f19369e --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/beautify.js @@ -0,0 +1,28 @@ +#! /usr/bin/env node + +global.sys = require("sys"); +var fs = require("fs"); + +var jsp = require("../lib/parse-js"); +var pro = require("../lib/process"); + +var filename = process.argv[2]; +fs.readFile(filename, "utf8", function(err, text){ + try { + var ast = time_it("parse", function(){ return jsp.parse(text); }); + ast = time_it("mangle", function(){ return pro.ast_mangle(ast); }); + ast = time_it("squeeze", function(){ return pro.ast_squeeze(ast); }); + var gen = time_it("generate", function(){ return pro.gen_code(ast, false); }); + sys.puts(gen); + } catch(ex) { + sys.debug(ex.stack); + sys.debug(sys.inspect(ex)); + sys.debug(JSON.stringify(ex)); + } +}); + +function time_it(name, cont) { + var t1 = new Date().getTime(); + try { return cont(); } + finally { sys.debug("// " + name + ": " + ((new Date().getTime() - t1) / 1000).toFixed(3) + " sec."); } +}; diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/testparser.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/testparser.js new file mode 100644 index 0000000..02c19a9 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/testparser.js @@ -0,0 +1,403 @@ +#! /usr/bin/env node + +var parseJS = require("../lib/parse-js"); +var sys = require("sys"); + +// write debug in a very straightforward manner +var debug = function(){ + sys.log(Array.prototype.slice.call(arguments).join(', ')); +}; + +ParserTestSuite(function(i, input, desc){ + try { + parseJS.parse(input); + debug("ok " + i + ": " + desc); + } catch(e){ + debug("FAIL " + i + " " + desc + " (" + e + ")"); + } +}); + +function ParserTestSuite(callback){ + var inps = [ + ["var abc;", "Regular variable statement w/o assignment"], + ["var abc = 5;", "Regular variable statement with assignment"], + ["/* */;", "Multiline comment"], + ['/** **/;', 'Double star multiline comment'], + ["var f = function(){;};", "Function expression in var assignment"], + ['hi; // moo\n;', 'single line comment'], + ['var varwithfunction;', 'Dont match keywords as substrings'], // difference between `var withsomevar` and `"str"` (local search and lits) + ['a + b;', 'addition'], + ["'a';", 'single string literal'], + ["'a\\n';", 'single string literal with escaped return'], + ['"a";', 'double string literal'], + ['"a\\n";', 'double string literal with escaped return'], + ['"var";', 'string is a keyword'], + ['"variable";', 'string starts with a keyword'], + ['"somevariable";', 'string contains a keyword'], + ['"somevar";', 'string ends with a keyword'], + ['500;', 'int literal'], + ['500.;', 'float literal w/o decimals'], + ['500.432;', 'float literal with decimals'], + ['.432432;', 'float literal w/o int'], + ['(a,b,c);', 'parens and comma'], + ['[1,2,abc];', 'array literal'], + ['var o = {a:1};', 'object literal unquoted key'], + ['var o = {"b":2};', 'object literal quoted key'], // opening curly may not be at the start of a statement... + ['var o = {c:c};', 'object literal keyname is identifier'], + ['var o = {a:1,"b":2,c:c};', 'object literal combinations'], + ['var x;\nvar y;', 'two lines'], + ['var x;\nfunction n(){; }', 'function def'], + ['var x;\nfunction n(abc){; }', 'function def with arg'], + ['var x;\nfunction n(abc, def){ ;}', 'function def with args'], + ['function n(){ "hello"; }', 'function def with body'], + ['/a/;', 'regex literal'], + ['/a/b;', 'regex literal with flag'], + ['/a/ / /b/;', 'regex div regex'], + ['a/b/c;', 'triple division looks like regex'], + ['+function(){/regex/;};', 'regex at start of function body'], + // http://code.google.com/p/es-lab/source/browse/trunk/tests/parser/parsertests.js?r=86 + // http://code.google.com/p/es-lab/source/browse/trunk/tests/parser/parsertests.js?r=430 + + // first tests for the lexer, should also parse as program (when you append a semi) + + // comments + ['//foo!@#^&$1234\nbar;', 'single line comment'], + ['/* abcd!@#@$* { } && null*/;', 'single line multi line comment'], + ['/*foo\nbar*/;','multi line comment'], + ['/*x*x*/;','multi line comment with *'], + ['/**/;','empty comment'], + // identifiers + ["x;",'1 identifier'], + ["_x;",'2 identifier'], + ["xyz;",'3 identifier'], + ["$x;",'4 identifier'], + ["x$;",'5 identifier'], + ["_;",'6 identifier'], + ["x5;",'7 identifier'], + ["x_y;",'8 identifier'], + ["x+5;",'9 identifier'], + ["xyz123;",'10 identifier'], + ["x1y1z1;",'11 identifier'], + ["foo\\u00D8bar;",'12 identifier unicode escape'], + //["foo�bar;",'13 identifier unicode embedded (might fail)'], + // numbers + ["5;", '1 number'], + ["5.5;", '2 number'], + ["0;", '3 number'], + ["0.0;", '4 number'], + ["0.001;", '5 number'], + ["1.e2;", '6 number'], + ["1.e-2;", '7 number'], + ["1.E2;", '8 number'], + ["1.E-2;", '9 number'], + [".5;", '10 number'], + [".5e3;", '11 number'], + [".5e-3;", '12 number'], + ["0.5e3;", '13 number'], + ["55;", '14 number'], + ["123;", '15 number'], + ["55.55;", '16 number'], + ["55.55e10;", '17 number'], + ["123.456;", '18 number'], + ["1+e;", '20 number'], + ["0x01;", '22 number'], + ["0XCAFE;", '23 number'], + ["0x12345678;", '24 number'], + ["0x1234ABCD;", '25 number'], + ["0x0001;", '26 number'], + // strings + ["\"foo\";", '1 string'], + ["\'foo\';", '2 string'], + ["\"x\";", '3 string'], + ["\'\';", '4 string'], + ["\"foo\\tbar\";", '5 string'], + ["\"!@#$%^&*()_+{}[]\";", '6 string'], + ["\"/*test*/\";", '7 string'], + ["\"//test\";", '8 string'], + ["\"\\\\\";", '9 string'], + ["\"\\u0001\";", '10 string'], + ["\"\\uFEFF\";", '11 string'], + ["\"\\u10002\";", '12 string'], + ["\"\\x55\";", '13 string'], + ["\"\\x55a\";", '14 string'], + ["\"a\\\\nb\";", '15 string'], + ['";"', '16 string: semi in a string'], + ['"a\\\nb";', '17 string: line terminator escape'], + // literals + ["null;", "null"], + ["true;", "true"], + ["false;", "false"], + // regex + ["/a/;", "1 regex"], + ["/abc/;", "2 regex"], + ["/abc[a-z]*def/g;", "3 regex"], + ["/\\b/;", "4 regex"], + ["/[a-zA-Z]/;", "5 regex"], + + // program tests (for as far as they havent been covered above) + + // regexp + ["/foo(.*)/g;", "another regexp"], + // arrays + ["[];", "1 array"], + ["[ ];", "2 array"], + ["[1];", "3 array"], + ["[1,2];", "4 array"], + ["[1,2,,];", "5 array"], + ["[1,2,3];", "6 array"], + ["[1,2,3,,,];", "7 array"], + // objects + ["{};", "1 object"], + ["({x:5});", "2 object"], + ["({x:5,y:6});", "3 object"], + ["({x:5,});", "4 object"], + ["({if:5});", "5 object"], + ["({ get x() {42;} });", "6 object"], + ["({ set y(a) {1;} });", "7 object"], + // member expression + ["o.m;", "1 member expression"], + ["o['m'];", "2 member expression"], + ["o['n']['m'];", "3 member expression"], + ["o.n.m;", "4 member expression"], + ["o.if;", "5 member expression"], + // call and invoke expressions + ["f();", "1 call/invoke expression"], + ["f(x);", "2 call/invoke expression"], + ["f(x,y);", "3 call/invoke expression"], + ["o.m();", "4 call/invoke expression"], + ["o['m'];", "5 call/invoke expression"], + ["o.m(x);", "6 call/invoke expression"], + ["o['m'](x);", "7 call/invoke expression"], + ["o.m(x,y);", "8 call/invoke expression"], + ["o['m'](x,y);", "9 call/invoke expression"], + ["f(x)(y);", "10 call/invoke expression"], + ["f().x;", "11 call/invoke expression"], + + // eval + ["eval('x');", "1 eval"], + ["(eval)('x');", "2 eval"], + ["(1,eval)('x');", "3 eval"], + ["eval(x,y);", "4 eval"], + // new expression + ["new f();", "1 new expression"], + ["new o;", "2 new expression"], + ["new o.m;", "3 new expression"], + ["new o.m(x);", "4 new expression"], + ["new o.m(x,y);", "5 new expression"], + // prefix/postfix + ["++x;", "1 pre/postfix"], + ["x++;", "2 pre/postfix"], + ["--x;", "3 pre/postfix"], + ["x--;", "4 pre/postfix"], + ["x ++;", "5 pre/postfix"], + ["x /* comment */ ++;", "6 pre/postfix"], + ["++ /* comment */ x;", "7 pre/postfix"], + // unary operators + ["delete x;", "1 unary operator"], + ["void x;", "2 unary operator"], + ["+ x;", "3 unary operator"], + ["-x;", "4 unary operator"], + ["~x;", "5 unary operator"], + ["!x;", "6 unary operator"], + // meh + ["new Date++;", "new date ++"], + ["+x++;", " + x ++"], + // expression expressions + ["1 * 2;", "1 expression expressions"], + ["1 / 2;", "2 expression expressions"], + ["1 % 2;", "3 expression expressions"], + ["1 + 2;", "4 expression expressions"], + ["1 - 2;", "5 expression expressions"], + ["1 << 2;", "6 expression expressions"], + ["1 >>> 2;", "7 expression expressions"], + ["1 >> 2;", "8 expression expressions"], + ["1 * 2 + 3;", "9 expression expressions"], + ["(1+2)*3;", "10 expression expressions"], + ["1*(2+3);", "11 expression expressions"], + ["xy;", "13 expression expressions"], + ["x<=y;", "14 expression expressions"], + ["x>=y;", "15 expression expressions"], + ["x instanceof y;", "16 expression expressions"], + ["x in y;", "17 expression expressions"], + ["x&y;", "18 expression expressions"], + ["x^y;", "19 expression expressions"], + ["x|y;", "20 expression expressions"], + ["x+y>>= y;", "1 assignment"], + ["x <<= y;", "2 assignment"], + ["x = y;", "3 assignment"], + ["x += y;", "4 assignment"], + ["x /= y;", "5 assignment"], + // comma + ["x, y;", "comma"], + // block + ["{};", "1 block"], + ["{x;};", "2 block"], + ["{x;y;};", "3 block"], + // vars + ["var x;", "1 var"], + ["var x,y;", "2 var"], + ["var x=1,y=2;", "3 var"], + ["var x,y=2;", "4 var"], + // empty + [";", "1 empty"], + ["\n;", "2 empty"], + // expression statement + ["x;", "1 expression statement"], + ["5;", "2 expression statement"], + ["1+2;", "3 expression statement"], + // if + ["if (c) x; else y;", "1 if statement"], + ["if (c) x;", "2 if statement"], + ["if (c) {} else {};", "3 if statement"], + ["if (c1) if (c2) s1; else s2;", "4 if statement"], + // while + ["do s; while (e);", "1 while statement"], + ["do { s; } while (e);", "2 while statement"], + ["while (e) s;", "3 while statement"], + ["while (e) { s; };", "4 while statement"], + // for + ["for (;;) ;", "1 for statement"], + ["for (;c;x++) x;", "2 for statement"], + ["for (i;i> 1; +var c = 8 >>> 1; \ No newline at end of file diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue34.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue34.js new file mode 100644 index 0000000..022f7a3 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue34.js @@ -0,0 +1,3 @@ +var a = {}; +a["this"] = 1; +a["that"] = 2; \ No newline at end of file diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue4.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue4.js new file mode 100644 index 0000000..0b76103 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue4.js @@ -0,0 +1,3 @@ +var a = 2e3; +var b = 2e-3; +var c = 2e-5; \ No newline at end of file diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue48.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue48.js new file mode 100644 index 0000000..031e85b --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue48.js @@ -0,0 +1 @@ +var s, i; s = ''; i = 0; \ No newline at end of file diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue50.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue50.js new file mode 100644 index 0000000..060f9df --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue50.js @@ -0,0 +1,9 @@ +function bar(a) { + try { + foo(); + } catch(e) { + alert("Exception caught (foo not defined)"); + } + alert(a); // 10 in FF, "[object Error]" in IE +} +bar(10); diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue53.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue53.js new file mode 100644 index 0000000..4f8b32f --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue53.js @@ -0,0 +1 @@ +x = (y, z) diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue54.1.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue54.1.js new file mode 100644 index 0000000..967052e --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue54.1.js @@ -0,0 +1,3 @@ +foo.toString(); +a.toString(16); +b.toString.call(c); diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue68.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue68.js new file mode 100644 index 0000000..14054d0 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue68.js @@ -0,0 +1,5 @@ +function f() { + if (a) return; + g(); + function g(){} +}; diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue69.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue69.js new file mode 100644 index 0000000..d25ecd6 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue69.js @@ -0,0 +1 @@ +[(a,b)] diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue9.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue9.js new file mode 100644 index 0000000..6158861 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/issue9.js @@ -0,0 +1,4 @@ +var a = { + a: 1, + b: 2, // <-- trailing comma +}; diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/mangle.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/mangle.js new file mode 100644 index 0000000..c271a26 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/mangle.js @@ -0,0 +1,5 @@ +(function() { + var x = function fun(a, fun, b) { + return fun; + }; +}()); diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/null_string.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/null_string.js new file mode 100644 index 0000000..a675b1c --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/null_string.js @@ -0,0 +1 @@ +var nullString = "\0" \ No newline at end of file diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/strict-equals.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/strict-equals.js new file mode 100644 index 0000000..b631f4c --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/strict-equals.js @@ -0,0 +1,3 @@ +typeof a === 'string' +b + "" !== c + "" +d < e === f < g diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/var.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/var.js new file mode 100644 index 0000000..746ea98 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/var.js @@ -0,0 +1,3 @@ +// var declarations after each other should be combined +var a = 1; +var b = 2; \ No newline at end of file diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/whitespace.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/whitespace.js new file mode 100644 index 0000000..6a15c46 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/whitespace.js @@ -0,0 +1,21 @@ +function id(a) { + // Form-Feed + // Vertical Tab + // No-Break Space + ᠎// Mongolian Vowel Separator +  // En quad +  // Em quad +  // En space +  // Em space +  // Three-Per-Em Space +  // Four-Per-Em Space +  // Six-Per-Em Space +  // Figure Space +  // Punctuation Space +  // Thin Space +  // Hair Space +  // Narrow No-Break Space +  // Medium Mathematical Space + 　// Ideographic Space + return a; +} diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/with.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/with.js new file mode 100644 index 0000000..de266ed --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/compress/test/with.js @@ -0,0 +1,2 @@ +with({}) { +}; diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/scripts.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/scripts.js new file mode 100644 index 0000000..5d334ff --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/test/unit/scripts.js @@ -0,0 +1,55 @@ +var fs = require('fs'), + uglify = require('../../uglify-js'), + jsp = uglify.parser, + nodeunit = require('nodeunit'), + path = require('path'), + pro = uglify.uglify; + +var Script = process.binding('evals').Script; + +var scriptsPath = __dirname; + +function compress(code) { + var ast = jsp.parse(code); + ast = pro.ast_mangle(ast); + ast = pro.ast_squeeze(ast, { no_warnings: true }); + ast = pro.ast_squeeze_more(ast); + return pro.gen_code(ast); +}; + +var testDir = path.join(scriptsPath, "compress", "test"); +var expectedDir = path.join(scriptsPath, "compress", "expected"); + +function getTester(script) { + return function(test) { + var testPath = path.join(testDir, script); + var expectedPath = path.join(expectedDir, script); + var content = fs.readFileSync(testPath, 'utf-8'); + var outputCompress = compress(content); + + // Check if the noncompressdata is larger or same size as the compressed data + test.ok(content.length >= outputCompress.length); + + // Check that a recompress gives the same result + var outputReCompress = compress(content); + test.equal(outputCompress, outputReCompress); + + // Check if the compressed output is what is expected + var expected = fs.readFileSync(expectedPath, 'utf-8'); + test.equal(outputCompress, expected.replace(/(\r?\n)+$/, "")); + + test.done(); + }; +}; + +var tests = {}; + +var scripts = fs.readdirSync(testDir); +for (var i in scripts) { + var script = scripts[i]; + if (/\.js$/.test(script)) { + tests[script] = getTester(script); + } +} + +module.exports = nodeunit.testCase(tests); diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/269.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/269.js new file mode 100644 index 0000000..256ad1c --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/269.js @@ -0,0 +1,13 @@ +var jsp = require("uglify-js").parser; +var pro = require("uglify-js").uglify; + +var test_code = "var JSON;JSON||(JSON={});"; + +var ast = jsp.parse(test_code, false, false); +var nonembed_token_code = pro.gen_code(ast); +ast = jsp.parse(test_code, false, true); +var embed_token_code = pro.gen_code(ast); + +console.log("original: " + test_code); +console.log("no token: " + nonembed_token_code); +console.log(" token: " + embed_token_code); diff --git a/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/app.js b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/app.js new file mode 100644 index 0000000..912a9f9 --- /dev/null +++ b/node_modules/socket.io/node_modules/socket.io-client/node_modules/uglify-js/tmp/app.js @@ -0,0 +1,22315 @@ +/* Modernizr 2.0.6 (Custom Build) | MIT & BSD + * Build: http://www.modernizr.com/download/#-iepp + */ +;window.Modernizr=function(a,b,c){function w(a,b){return!!~(""+a).indexOf(b)}function v(a,b){return typeof a===b}function u(a,b){return t(prefixes.join(a+";")+(b||""))}function t(a){j.cssText=a}var d="2.0.6",e={},f=b.documentElement,g=b.head||b.getElementsByTagName("head")[0],h="modernizr",i=b.createElement(h),j=i.style,k,l=Object.prototype.toString,m={},n={},o={},p=[],q,r={}.hasOwnProperty,s;!v(r,c)&&!v(r.call,c)?s=function(a,b){return r.call(a,b)}:s=function(a,b){return b in a&&v(a.constructor.prototype[b],c)};for(var x in m)s(m,x)&&(q=x.toLowerCase(),e[q]=m[x](),p.push((e[q]?"":"no-")+q));t(""),i=k=null,a.attachEvent&&function(){var a=b.createElement("div");a.innerHTML="";return a.childNodes.length!==1}()&&function(a,b){function s(a){var b=-1;while(++b to avoid XSS via location.hash (#9521) + quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Check for digits + rdigit = /\d/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Matches dashed string for camelizing + rdashAlpha = /-([a-z]|[0-9])/ig, + rmsPrefix = /^-ms-/, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return ( letter + "" ).toUpperCase(); + }, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // The deferred used on DOM ready + readyList, + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = quickExpr.exec( selector ); + } + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = (context ? context.ownerDocument || context : document); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = (ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return (context || rootjQuery).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if (selector.selector !== undefined) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.6.3", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = this.constructor(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + (this.selector ? " " : "") + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // Add the callback + readyList.done( fn ); + + return this; + }, + + eq: function( i ) { + return i === -1 ? + this.slice( i ) : + this.slice( i, +i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + // Either a released hold or an DOMready/load event and not yet ready + if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).unbind( "ready" ); + } + } + }, + + bindReady: function() { + if ( readyList ) { + return; + } + + readyList = jQuery._Deferred(); + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNaN: function( obj ) { + return obj == null || !rdigit.test( obj ) || isNaN( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + try { + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw msg; + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return (new Function( "return " + data ))(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction( object ); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { + break; + } + } + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // The extra typeof function check is to prevent crashes + // in Safari 2 (See: #3039) + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type( array ); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array ) { + if ( !array ) { + return -1; + } + + if ( indexOf ) { + return indexOf.call( array, elem ); + } + + for ( var i = 0, length = array.length; i < length; i++ ) { + if ( array[ i ] === elem ) { + return i; + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + if ( typeof context === "string" ) { + var tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + var args = slice.call( arguments, 2 ), + proxy = function() { + return fn.apply( context, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can optionally be executed if it's a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return (new Date()).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + sub: function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +// IE doesn't match non-breaking spaces with \s +if ( rnotwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +return jQuery; + +})(); + + +var // Promise methods + promiseMethods = "done fail isResolved isRejected promise then always pipe".split( " " ), + // Static reference to slice + sliceDeferred = [].slice; + +jQuery.extend({ + // Create a simple deferred (one callbacks list) + _Deferred: function() { + var // callbacks list + callbacks = [], + // stored [ context , args ] + fired, + // to avoid firing when already doing so + firing, + // flag to know if the deferred has been cancelled + cancelled, + // the deferred itself + deferred = { + + // done( f1, f2, ...) + done: function() { + if ( !cancelled ) { + var args = arguments, + i, + length, + elem, + type, + _fired; + if ( fired ) { + _fired = fired; + fired = 0; + } + for ( i = 0, length = args.length; i < length; i++ ) { + elem = args[ i ]; + type = jQuery.type( elem ); + if ( type === "array" ) { + deferred.done.apply( deferred, elem ); + } else if ( type === "function" ) { + callbacks.push( elem ); + } + } + if ( _fired ) { + deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] ); + } + } + return this; + }, + + // resolve with given context and args + resolveWith: function( context, args ) { + if ( !cancelled && !fired && !firing ) { + // make sure args are available (#8421) + args = args || []; + firing = 1; + try { + while( callbacks[ 0 ] ) { + callbacks.shift().apply( context, args ); + } + } + finally { + fired = [ context, args ]; + firing = 0; + } + } + return this; + }, + + // resolve with this as context and given arguments + resolve: function() { + deferred.resolveWith( this, arguments ); + return this; + }, + + // Has this deferred been resolved? + isResolved: function() { + return !!( firing || fired ); + }, + + // Cancel + cancel: function() { + cancelled = 1; + callbacks = []; + return this; + } + }; + + return deferred; + }, + + // Full fledged deferred (two callbacks list) + Deferred: function( func ) { + var deferred = jQuery._Deferred(), + failDeferred = jQuery._Deferred(), + promise; + // Add errorDeferred methods, then and promise + jQuery.extend( deferred, { + then: function( doneCallbacks, failCallbacks ) { + deferred.done( doneCallbacks ).fail( failCallbacks ); + return this; + }, + always: function() { + return deferred.done.apply( deferred, arguments ).fail.apply( this, arguments ); + }, + fail: failDeferred.done, + rejectWith: failDeferred.resolveWith, + reject: failDeferred.resolve, + isRejected: failDeferred.isResolved, + pipe: function( fnDone, fnFail ) { + return jQuery.Deferred(function( newDefer ) { + jQuery.each( { + done: [ fnDone, "resolve" ], + fail: [ fnFail, "reject" ] + }, function( handler, data ) { + var fn = data[ 0 ], + action = data[ 1 ], + returned; + if ( jQuery.isFunction( fn ) ) { + deferred[ handler ](function() { + returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise().then( newDefer.resolve, newDefer.reject ); + } else { + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); + } + }); + } else { + deferred[ handler ]( newDefer[ action ] ); + } + }); + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + if ( obj == null ) { + if ( promise ) { + return promise; + } + promise = obj = {}; + } + var i = promiseMethods.length; + while( i-- ) { + obj[ promiseMethods[i] ] = deferred[ promiseMethods[i] ]; + } + return obj; + } + }); + // Make sure only one callback list will be used + deferred.done( failDeferred.cancel ).fail( deferred.cancel ); + // Unexpose cancel + delete deferred.cancel; + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + return deferred; + }, + + // Deferred helper + when: function( firstParam ) { + var args = arguments, + i = 0, + length = args.length, + count = length, + deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? + firstParam : + jQuery.Deferred(); + function resolveFunc( i ) { + return function( value ) { + args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + if ( !( --count ) ) { + // Strange bug in FF4: + // Values changed onto the arguments object sometimes end up as undefined values + // outside the $.when method. Cloning the object into a fresh array solves the issue + deferred.resolveWith( deferred, sliceDeferred.call( args, 0 ) ); + } + }; + } + if ( length > 1 ) { + for( ; i < length; i++ ) { + if ( args[ i ] && jQuery.isFunction( args[ i ].promise ) ) { + args[ i ].promise().then( resolveFunc(i), deferred.reject ); + } else { + --count; + } + } + if ( !count ) { + deferred.resolveWith( deferred, args ); + } + } else if ( deferred !== firstParam ) { + deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); + } + return deferred.promise(); + } +}); + + + +jQuery.support = (function() { + + var div = document.createElement( "div" ), + documentElement = document.documentElement, + all, + a, + select, + opt, + input, + marginDiv, + support, + fragment, + body, + testElementParent, + testElement, + testElementStyle, + tds, + events, + eventName, + i, + isSupported; + + // Preliminary tests + div.setAttribute("className", "t"); + div.innerHTML = "
a"; + + + all = div.getElementsByTagName( "*" ); + a = div.getElementsByTagName( "a" )[ 0 ]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return {}; + } + + // First batch of supports tests + select = document.createElement( "select" ); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName( "input" )[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName( "tbody" ).length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName( "link" ).length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute( "href" ) === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55$/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent( "onclick" ); + } + + // Check if a radio maintains it's value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute("type", "radio"); + support.radioValue = input.value === "t"; + + input.setAttribute("checked", "checked"); + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.firstChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + div.innerHTML = ""; + + // Figure out if the W3C box model works as expected + div.style.width = div.style.paddingLeft = "1px"; + + body = document.getElementsByTagName( "body" )[ 0 ]; + // We use our own, invisible, body unless the body is already present + // in which case we use a div (#9239) + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + jQuery.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + support.boxModel = div.offsetWidth === 2; + + if ( "zoom" in div.style ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "
"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); + } + + div.innerHTML = "
t
"; + tds = div.getElementsByTagName( "td" ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE < 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + div.innerHTML = ""; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + if ( document.defaultView && document.defaultView.getComputedStyle ) { + marginDiv = document.createElement( "div" ); + marginDiv.style.width = "0"; + marginDiv.style.marginRight = "0"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + ( parseInt( ( document.defaultView.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; + } + + // Remove the body element we added + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + // Technique from Juriy Zaytsev + // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for( i in { + submit: 1, + change: 1, + focusin: 1 + } ) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + // Null connected elements to avoid leaks in IE + testElement = fragment = select = opt = body = marginDiv = div = input = null; + + return support; +})(); + +// Keep track of boxModel +jQuery.boxModel = jQuery.support.boxModel; + + + + +var rbrace = /^(?:\{.*\}|\[.*\])$/, + rmultiDash = /([a-z])([A-Z])/g; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || (pvt && id && (cache[ id ] && !cache[ id ][ internalKey ]))) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ jQuery.expando ] = id = ++jQuery.uuid; + } else { + id = jQuery.expando; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery + // metadata on plain JS objects when the object is serialized using + // JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ][ internalKey ] = jQuery.extend(cache[ id ][ internalKey ], name); + } else { + cache[ id ] = jQuery.extend(cache[ id ], name); + } + } + + thisCache = cache[ id ]; + + // Internal jQuery data is stored in a separate object inside the object's data + // cache in order to avoid key collisions between internal data and user-defined + // data + if ( pvt ) { + if ( !thisCache[ internalKey ] ) { + thisCache[ internalKey ] = {}; + } + + thisCache = thisCache[ internalKey ]; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // TODO: This is a hack for 1.5 ONLY. It will be removed in 1.6. Users should + // not attempt to inspect the internal events object using jQuery.data, as this + // internal data object is undocumented and subject to change. + if ( name === "events" && !thisCache[name] ) { + return thisCache[ internalKey ] && thisCache[ internalKey ].events; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, + + // Reference to internal data cache key + internalKey = jQuery.expando, + + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + + // See jQuery.data for more information + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ]; + + if ( thisCache ) { + + // Support interoperable removal of hyphenated or camelcased keys + if ( !thisCache[ name ] ) { + name = jQuery.camelCase( name ); + } + + delete thisCache[ name ]; + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !isEmptyDataObject(thisCache) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( pvt ) { + delete cache[ id ][ internalKey ]; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject(cache[ id ]) ) { + return; + } + } + + var internalCache = cache[ id ][ internalKey ]; + + // Browsers that fail expando deletion also refuse to delete expandos on + // the window, but it will allow it on all other JS objects; other browsers + // don't care + // Ensure that `cache` is not a window object #10080 + if ( jQuery.support.deleteExpando || !cache.setInterval ) { + delete cache[ id ]; + } else { + cache[ id ] = null; + } + + // We destroyed the entire user cache at once because it's faster than + // iterating through each key, but we need to continue to persist internal + // data if it existed + if ( internalCache ) { + cache[ id ] = {}; + // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery + // metadata on plain JS objects when the object is serialized using + // JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + + cache[ id ][ internalKey ] = internalCache; + + // Otherwise, we need to eliminate the expando on the node to avoid + // false lookups in the cache for entries that no longer exist + } else if ( isNode ) { + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( jQuery.support.deleteExpando ) { + delete elem[ jQuery.expando ]; + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } else { + elem[ jQuery.expando ] = null; + } + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + data = jQuery.data( this[0] ); + + if ( this[0].nodeType === 1 ) { + var attr = this[0].attributes, name; + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( this[0], name, data[ name ] ); + } + } + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var $this = jQuery( this ), + args = [ parts[0], value ]; + + $this.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + $this.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + var name = "data-" + key.replace( rmultiDash, "$1-$2" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + !jQuery.isNaN( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// TODO: This is a hack for 1.5 ONLY to allow objects with a single toJSON +// property to be considered empty objects; this property always exists in +// order to make sure JSON.stringify does not expose internal metadata +function isEmptyDataObject( obj ) { + for ( var name in obj ) { + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} + + + + +function handleQueueMarkDefer( elem, type, src ) { + var deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + defer = jQuery.data( elem, deferDataKey, undefined, true ); + if ( defer && + ( src === "queue" || !jQuery.data( elem, queueDataKey, undefined, true ) ) && + ( src === "mark" || !jQuery.data( elem, markDataKey, undefined, true ) ) ) { + // Give room for hard-coded callbacks to fire first + // and eventually mark/queue something else on the element + setTimeout( function() { + if ( !jQuery.data( elem, queueDataKey, undefined, true ) && + !jQuery.data( elem, markDataKey, undefined, true ) ) { + jQuery.removeData( elem, deferDataKey, true ); + defer.resolve(); + } + }, 0 ); + } +} + +jQuery.extend({ + + _mark: function( elem, type ) { + if ( elem ) { + type = (type || "fx") + "mark"; + jQuery.data( elem, type, (jQuery.data(elem,type,undefined,true) || 0) + 1, true ); + } + }, + + _unmark: function( force, elem, type ) { + if ( force !== true ) { + type = elem; + elem = force; + force = false; + } + if ( elem ) { + type = type || "fx"; + var key = type + "mark", + count = force ? 0 : ( (jQuery.data( elem, key, undefined, true) || 1 ) - 1 ); + if ( count ) { + jQuery.data( elem, key, count, true ); + } else { + jQuery.removeData( elem, key, true ); + handleQueueMarkDefer( elem, type, "mark" ); + } + } + }, + + queue: function( elem, type, data ) { + if ( elem ) { + type = (type || "fx") + "queue"; + var q = jQuery.data( elem, type, undefined, true ); + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !q || jQuery.isArray(data) ) { + q = jQuery.data( elem, type, jQuery.makeArray(data), true ); + } else { + q.push( data ); + } + } + return q || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(), + defer; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift("inprogress"); + } + + fn.call(elem, function() { + jQuery.dequeue(elem, type); + }); + } + + if ( !queue.length ) { + jQuery.removeData( elem, type + "queue", true ); + handleQueueMarkDefer( elem, type, "queue" ); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function() { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; + type = type || "fx"; + + return this.queue( type, function() { + var elem = this; + setTimeout(function() { + jQuery.dequeue( elem, type ); + }, time ); + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, object ) { + if ( typeof type !== "string" ) { + object = type; + type = undefined; + } + type = type || "fx"; + var defer = jQuery.Deferred(), + elements = this, + i = elements.length, + count = 1, + deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + tmp; + function resolve() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + } + while( i-- ) { + if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || + ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || + jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && + jQuery.data( elements[ i ], deferDataKey, jQuery._Deferred(), true ) )) { + count++; + tmp.done( resolve ); + } + } + resolve(); + return defer.promise(); + } +}); + + + + +var rclass = /[\n\t\r]/g, + rspace = /\s+/, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + nodeHook, boolHook; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.prop ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classNames, i, l, elem, className, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + classNames = (value || "").split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + className = (" " + elem.className + " ").replace( rclass, " " ); + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[ c ] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " "; + for ( var i = 0, l = this.length; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return undefined; + } + + var isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var self = jQuery(this), val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, + index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attrFix: { + // Always normalize to ensure hook usage + tabindex: "tabIndex" + }, + + attr: function( elem, name, value, pass ) { + var nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return undefined; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( !("getAttribute" in elem) ) { + return jQuery.prop( elem, name, value ); + } + + var ret, hooks, + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // Normalize the name if needed + if ( notxml ) { + name = jQuery.attrFix[ name ] || name; + + hooks = jQuery.attrHooks[ name ]; + + if ( !hooks ) { + // Use boolHook for boolean attributes + if ( rboolean.test( name ) ) { + hooks = boolHook; + + // Use nodeHook if available( IE6/7 ) + } else if ( nodeHook ) { + hooks = nodeHook; + } + } + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return undefined; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, "" + value ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, name ) { + var propName; + if ( elem.nodeType === 1 ) { + name = jQuery.attrFix[ name ] || name; + + jQuery.attr( elem, name, "" ); + elem.removeAttribute( name ); + + // Set corresponding property to false for boolean attributes + if ( rboolean.test( name ) && (propName = jQuery.propFix[ name ] || name) in elem ) { + elem[ propName ] = false; + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return undefined; + } + + var ret, hooks, + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return (elem[ name ] = value); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Add the tabindex propHook to attrHooks for back-compat +jQuery.attrHooks.tabIndex = jQuery.propHooks.tabIndex; + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + // Fall back to attribute presence where some booleans are not supported + var attrNode; + return jQuery.prop( elem, name ) === true || ( attrNode = elem.getAttributeNode( name ) ) && attrNode.nodeValue !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !jQuery.support.getSetAttribute ) { + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + // Return undefined if nodeValue is empty string + return ret && ret.nodeValue !== "" ? + ret.nodeValue : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); + } + return (ret.nodeValue = value + ""); + } + }; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return (elem.style.cssText = "" + value); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return (elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0); + } + } + }); +}); + + + + +var rnamespaces = /\.(.*)$/, + rformElems = /^(?:textarea|input|select)$/i, + rperiod = /\./g, + rspaces = / /g, + rescape = /[^\w\s.|`]/g, + fcleanup = function( nm ) { + return nm.replace(rescape, "\\$&"); + }; + +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function( elem, types, handler, data ) { + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } else if ( !handler ) { + // Fixes bug #7229. Fix recommended by jdalton + return; + } + + var handleObjIn, handleObj; + + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure + var elemData = jQuery._data( elem ); + + // If no elemData is found then we must be trying to bind to one of the + // banned noData elements + if ( !elemData ) { + return; + } + + var events = elemData.events, + eventHandle = elemData.handle; + + if ( !events ) { + elemData.events = events = {}; + } + + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.handle.apply( eventHandle.elem, arguments ) : + undefined; + }; + } + + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native events in IE. + eventHandle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = types.split(" "); + + var type, i = 0, namespaces; + + while ( (type = types[ i++ ]) ) { + handleObj = handleObjIn ? + jQuery.extend({}, handleObjIn) : + { handler: handler, data: data }; + + // Namespaced event handlers + if ( type.indexOf(".") > -1 ) { + namespaces = type.split("."); + type = namespaces.shift(); + handleObj.namespace = namespaces.slice(0).sort().join("."); + + } else { + namespaces = []; + handleObj.namespace = ""; + } + + handleObj.type = type; + if ( !handleObj.guid ) { + handleObj.guid = handler.guid; + } + + // Get the current list of functions bound to this event + var handlers = events[ type ], + special = jQuery.event.special[ type ] || {}; + + // Init the event handler queue + if ( !handlers ) { + handlers = events[ type ] = []; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add the function to the element's handler list + handlers.push( handleObj ); + + // Keep track of which events have been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, pos ) { + // don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } + + var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ), + events = elemData && elemData.events; + + if ( !elemData || !events ) { + return; + } + + // types is actually an event object here + if ( types && types.type ) { + handler = types.handler; + types = types.type; + } + + // Unbind all events for the element + if ( !types || typeof types === "string" && types.charAt(0) === "." ) { + types = types || ""; + + for ( type in events ) { + jQuery.event.remove( elem, type + types ); + } + + return; + } + + // Handle multiple events separated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + types = types.split(" "); + + while ( (type = types[ i++ ]) ) { + origType = type; + handleObj = null; + all = type.indexOf(".") < 0; + namespaces = []; + + if ( !all ) { + // Namespaced event handlers + namespaces = type.split("."); + type = namespaces.shift(); + + namespace = new RegExp("(^|\\.)" + + jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + eventType = events[ type ]; + + if ( !eventType ) { + continue; + } + + if ( !handler ) { + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( all || namespace.test( handleObj.namespace ) ) { + jQuery.event.remove( elem, origType, handleObj.handler, j ); + eventType.splice( j--, 1 ); + } + } + + continue; + } + + special = jQuery.event.special[ type ] || {}; + + for ( j = pos || 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( handler.guid === handleObj.guid ) { + // remove the given handler for the given type + if ( all || namespace.test( handleObj.namespace ) ) { + if ( pos == null ) { + eventType.splice( j--, 1 ); + } + + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + + if ( pos != null ) { + break; + } + } + } + + // remove generic event handler if no more handlers exist + if ( eventType.length === 0 || pos != null && eventType.length === 1 ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + ret = null; + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + var handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + delete elemData.events; + delete elemData.handle; + + if ( jQuery.isEmptyObject( elemData ) ) { + jQuery.removeData( elem, undefined, true ); + } + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Event object or event type + var type = event.type || event, + namespaces = [], + exclusive; + + if ( type.indexOf("!") >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf(".") >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.exclusive = exclusive; + event.namespace = namespaces.join("."); + event.namespace_re = new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)"); + + // triggerHandler() and global events don't bubble or run the default action + if ( onlyHandlers || !elem ) { + event.preventDefault(); + event.stopPropagation(); + } + + // Handle a global trigger + if ( !elem ) { + // TODO: Stop taunting the data cache; remove global events and always attach to document + jQuery.each( jQuery.cache, function() { + // internalKey variable is just used to make it easier to find + // and potentially change this stuff later; currently it just + // points to jQuery.expando + var internalKey = jQuery.expando, + internalCache = this[ internalKey ]; + if ( internalCache && internalCache.events && internalCache.events[ type ] ) { + jQuery.event.trigger( event, data, internalCache.handle.elem ); + } + }); + return; + } + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + event.target = elem; + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + var cur = elem, + // IE doesn't like method names with a colon (#3533, #8272) + ontype = type.indexOf(":") < 0 ? "on" + type : ""; + + // Fire event on the current element, then bubble up the DOM tree + do { + var handle = jQuery._data( cur, "handle" ); + + event.currentTarget = cur; + if ( handle ) { + handle.apply( cur, data ); + } + + // Trigger an inline bound script + if ( ontype && jQuery.acceptData( cur ) && cur[ ontype ] && cur[ ontype ].apply( cur, data ) === false ) { + event.result = false; + event.preventDefault(); + } + + // Bubble up to document, then to window + cur = cur.parentNode || cur.ownerDocument || cur === event.target.ownerDocument && window; + } while ( cur && !event.isPropagationStopped() ); + + // If nobody prevented the default action, do it now + if ( !event.isDefaultPrevented() ) { + var old, + special = jQuery.event.special[ type ] || {}; + + if ( (!special._default || special._default.call( elem.ownerDocument, event ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction)() check here because IE6/7 fails that test. + // IE<9 dies on focus to hidden element (#1486), may want to revisit a try/catch. + try { + if ( ontype && elem[ type ] ) { + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + jQuery.event.triggered = type; + elem[ type ](); + } + } catch ( ieError ) {} + + if ( old ) { + elem[ ontype ] = old; + } + + jQuery.event.triggered = undefined; + } + } + + return event.result; + }, + + handle: function( event ) { + event = jQuery.event.fix( event || window.event ); + // Snapshot the handlers list since a called handler may add/remove events. + var handlers = ((jQuery._data( this, "events" ) || {})[ event.type ] || []).slice(0), + run_all = !event.exclusive && !event.namespace, + args = Array.prototype.slice.call( arguments, 0 ); + + // Use the fix-ed Event rather than the (read-only) native event + args[0] = event; + event.currentTarget = this; + + for ( var j = 0, l = handlers.length; j < l; j++ ) { + var handleObj = handlers[ j ]; + + // Triggered event must 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event. + if ( run_all || event.namespace_re.test( handleObj.namespace ) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handleObj.handler; + event.data = handleObj.data; + event.handleObj = handleObj; + + var ret = handleObj.handler.apply( this, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + return event.result; + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ) { + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) { + // Fixes #1925 where srcElement might not be defined either + event.target = event.srcElement || document; + } + + // check if target is a textnode (safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) { + event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement; + } + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var eventDocument = event.target.ownerDocument || document, + doc = eventDocument.documentElement, + body = eventDocument.body; + + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0); + } + + // Add which for key events + if ( event.which == null && (event.charCode != null || event.keyCode != null) ) { + event.which = event.charCode != null ? event.charCode : event.keyCode; + } + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) { + event.metaKey = event.ctrlKey; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button !== undefined ) { + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + } + + return event; + }, + + // Deprecated, use jQuery.guid instead + guid: 1E8, + + // Deprecated, use jQuery.proxy instead + proxy: jQuery.proxy, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady, + teardown: jQuery.noop + }, + + live: { + add: function( handleObj ) { + jQuery.event.add( this, + liveConvert( handleObj.origType, handleObj.selector ), + jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) ); + }, + + remove: function( handleObj ) { + jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj ); + } + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + } +}; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !this.preventDefault ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function( event ) { + + // Check if mouse(over|out) are still within the same parent element + var related = event.relatedTarget, + inside = false, + eventType = event.type; + + event.type = event.data; + + if ( related !== this ) { + + if ( related ) { + inside = jQuery.contains( this, related ); + } + + if ( !inside ) { + + jQuery.event.handle.apply( this, arguments ); + + event.type = eventType; + } + } +}, + +// In case of event delegation, we only need to rename the event.type, +// liveHandler will take care of the rest. +delegate = function( event ) { + event.type = event.data; + jQuery.event.handle.apply( this, arguments ); +}; + +// Create mouseenter and mouseleave events +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + setup: function( data ) { + jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig ); + }, + teardown: function( data ) { + jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement ); + } + }; +}); + +// submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function( data, namespaces ) { + if ( !jQuery.nodeName( this, "form" ) ) { + jQuery.event.add(this, "click.specialSubmit", function( e ) { + var elem = e.target, + type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; + + if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { + trigger( "submit", this, arguments ); + } + }); + + jQuery.event.add(this, "keypress.specialSubmit", function( e ) { + var elem = e.target, + type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; + + if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { + trigger( "submit", this, arguments ); + } + }); + + } else { + return false; + } + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialSubmit" ); + } + }; + +} + +// change delegation, happens here so we have bind. +if ( !jQuery.support.changeBubbles ) { + + var changeFilters, + + getVal = function( elem ) { + var type = jQuery.nodeName( elem, "input" ) ? elem.type : "", + val = elem.value; + + if ( type === "radio" || type === "checkbox" ) { + val = elem.checked; + + } else if ( type === "select-multiple" ) { + val = elem.selectedIndex > -1 ? + jQuery.map( elem.options, function( elem ) { + return elem.selected; + }).join("-") : + ""; + + } else if ( jQuery.nodeName( elem, "select" ) ) { + val = elem.selectedIndex; + } + + return val; + }, + + testChange = function testChange( e ) { + var elem = e.target, data, val; + + if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) { + return; + } + + data = jQuery._data( elem, "_change_data" ); + val = getVal(elem); + + // the current data will be also retrieved by beforeactivate + if ( e.type !== "focusout" || elem.type !== "radio" ) { + jQuery._data( elem, "_change_data", val ); + } + + if ( data === undefined || val === data ) { + return; + } + + if ( data != null || val ) { + e.type = "change"; + e.liveFired = undefined; + jQuery.event.trigger( e, arguments[1], elem ); + } + }; + + jQuery.event.special.change = { + filters: { + focusout: testChange, + + beforedeactivate: testChange, + + click: function( e ) { + var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; + + if ( type === "radio" || type === "checkbox" || jQuery.nodeName( elem, "select" ) ) { + testChange.call( this, e ); + } + }, + + // Change has to be called before submit + // Keydown will be called before keypress, which is used in submit-event delegation + keydown: function( e ) { + var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; + + if ( (e.keyCode === 13 && !jQuery.nodeName( elem, "textarea" ) ) || + (e.keyCode === 32 && (type === "checkbox" || type === "radio")) || + type === "select-multiple" ) { + testChange.call( this, e ); + } + }, + + // Beforeactivate happens also before the previous element is blurred + // with this event you can't trigger a change event, but you can store + // information + beforeactivate: function( e ) { + var elem = e.target; + jQuery._data( elem, "_change_data", getVal(elem) ); + } + }, + + setup: function( data, namespaces ) { + if ( this.type === "file" ) { + return false; + } + + for ( var type in changeFilters ) { + jQuery.event.add( this, type + ".specialChange", changeFilters[type] ); + } + + return rformElems.test( this.nodeName ); + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialChange" ); + + return rformElems.test( this.nodeName ); + } + }; + + changeFilters = jQuery.event.special.change.filters; + + // Handle when the input is .focus()'d + changeFilters.focus = changeFilters.beforeactivate; +} + +function trigger( type, elem, args ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + // Don't pass args or remember liveFired; they apply to the donor event. + var event = jQuery.extend( {}, args[ 0 ] ); + event.type = type; + event.originalEvent = {}; + event.liveFired = undefined; + jQuery.event.handle.call( elem, event ); + if ( event.isDefaultPrevented() ) { + args[ 0 ].preventDefault(); + } +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + + function handler( donor ) { + // Donor event is always a native one; fix it and switch its type. + // Let focusin/out handler cancel the donor focus/blur event. + var e = jQuery.event.fix( donor ); + e.type = fix; + e.originalEvent = {}; + jQuery.event.trigger( e, null, e.target ); + if ( e.isDefaultPrevented() ) { + donor.preventDefault(); + } + } + }); +} + +jQuery.each(["bind", "one"], function( i, name ) { + jQuery.fn[ name ] = function( type, data, fn ) { + var handler; + + // Handle object literals + if ( typeof type === "object" ) { + for ( var key in type ) { + this[ name ](key, data, type[key], fn); + } + return this; + } + + if ( arguments.length === 2 || data === false ) { + fn = data; + data = undefined; + } + + if ( name === "one" ) { + handler = function( event ) { + jQuery( this ).unbind( event, handler ); + return fn.apply( this, arguments ); + }; + handler.guid = fn.guid || jQuery.guid++; + } else { + handler = fn; + } + + if ( type === "unload" && name !== "one" ) { + this.one( type, data, fn ); + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.add( this[i], type, handler, data ); + } + } + + return this; + }; +}); + +jQuery.fn.extend({ + unbind: function( type, fn ) { + // Handle object literals + if ( typeof type === "object" && !type.preventDefault ) { + for ( var key in type ) { + this.unbind(key, type[key]); + } + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.remove( this[i], type, fn ); + } + } + + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.live( types, data, fn, selector ); + }, + + undelegate: function( selector, types, fn ) { + if ( arguments.length === 0 ) { + return this.unbind( "live" ); + + } else { + return this.die( types, null, fn, selector ); + } + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +var liveMap = { + focus: "focusin", + blur: "focusout", + mouseenter: "mouseover", + mouseleave: "mouseout" +}; + +jQuery.each(["live", "die"], function( i, name ) { + jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) { + var type, i = 0, match, namespaces, preType, + selector = origSelector || this.selector, + context = origSelector ? this : jQuery( this.context ); + + if ( typeof types === "object" && !types.preventDefault ) { + for ( var key in types ) { + context[ name ]( key, data, types[key], selector ); + } + + return this; + } + + if ( name === "die" && !types && + origSelector && origSelector.charAt(0) === "." ) { + + context.unbind( origSelector ); + + return this; + } + + if ( data === false || jQuery.isFunction( data ) ) { + fn = data || returnFalse; + data = undefined; + } + + types = (types || "").split(" "); + + while ( (type = types[ i++ ]) != null ) { + match = rnamespaces.exec( type ); + namespaces = ""; + + if ( match ) { + namespaces = match[0]; + type = type.replace( rnamespaces, "" ); + } + + if ( type === "hover" ) { + types.push( "mouseenter" + namespaces, "mouseleave" + namespaces ); + continue; + } + + preType = type; + + if ( liveMap[ type ] ) { + types.push( liveMap[ type ] + namespaces ); + type = type + namespaces; + + } else { + type = (liveMap[ type ] || type) + namespaces; + } + + if ( name === "live" ) { + // bind live handler + for ( var j = 0, l = context.length; j < l; j++ ) { + jQuery.event.add( context[j], "live." + liveConvert( type, selector ), + { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } ); + } + + } else { + // unbind live handler + context.unbind( "live." + liveConvert( type, selector ), fn ); + } + } + + return this; + }; +}); + +function liveHandler( event ) { + var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret, + elems = [], + selectors = [], + events = jQuery._data( this, "events" ); + + // Make sure we avoid non-left-click bubbling in Firefox (#3861) and disabled elements in IE (#6911) + if ( event.liveFired === this || !events || !events.live || event.target.disabled || event.button && event.type === "click" ) { + return; + } + + if ( event.namespace ) { + namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.liveFired = this; + + var live = events.live.slice(0); + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) { + selectors.push( handleObj.selector ); + + } else { + live.splice( j--, 1 ); + } + } + + match = jQuery( event.target ).closest( selectors, event.currentTarget ); + + for ( i = 0, l = match.length; i < l; i++ ) { + close = match[i]; + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) && !close.elem.disabled ) { + elem = close.elem; + related = null; + + // Those two events require additional checking + if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) { + event.type = handleObj.preType; + related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0]; + + // Make sure not to accidentally match a child element with the same selector + if ( related && jQuery.contains( elem, related ) ) { + related = elem; + } + } + + if ( !related || related !== elem ) { + elems.push({ elem: elem, handleObj: handleObj, level: close.level }); + } + } + } + } + + for ( i = 0, l = elems.length; i < l; i++ ) { + match = elems[i]; + + if ( maxLevel && match.level > maxLevel ) { + break; + } + + event.currentTarget = match.elem; + event.data = match.handleObj.data; + event.handleObj = match.handleObj; + + ret = match.handleObj.origHandler.apply( match.elem, arguments ); + + if ( ret === false || event.isPropagationStopped() ) { + maxLevel = match.level; + + if ( ret === false ) { + stop = false; + } + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + + return stop; +} + +function liveConvert( type, selector ) { + return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspaces, "&"); +} + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.bind( name, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } +}); + + + +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true, + rBackslash = /\\/g, + rNonWord = /\W/; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var match, + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + var left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace( rBackslash, "" ); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = typeof context.getElementsByTagName !== "undefined" ? + context.getElementsByTagName( "*" ) : + []; + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + var found, item, + filter = Expr.filter[ type ], + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw "Syntax error, unrecognized expression: " + msg; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + }, + type: function( elem ) { + return elem.getAttribute( "type" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !rNonWord.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( match[1] ); + } + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace( rBackslash, "" ) + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace( rBackslash, "" ); + }, + + TAG: function( match, curLoop ) { + return match[1].replace( rBackslash, "" ).toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + match[2] = match[2].replace(/^\+|\s*/g, ''); + + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1] = match[1].replace( rBackslash, "" ); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + // Handle if an un-quoted value was used + match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + var attr = elem.getAttribute( "type" ), type = elem.type; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); + }, + + radio: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; + }, + + checkbox: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; + }, + + file: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; + }, + + password: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; + }, + + submit: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "submit" === elem.type; + }, + + image: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; + }, + + reset: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "reset" === elem.type; + }, + + button: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && "button" === elem.type || name === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + }, + + focus: function( elem ) { + return elem === elem.ownerDocument.activeElement; + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( name ); + } + }, + + CHILD: function( elem, match ) { + var type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + var first = match[2], + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Utility function for retreiving the text value of an array of DOM nodes +Sizzle.getText = function( elems ) { + var ret = "", elem; + + for ( var i = 0; elems[i]; i++ ) { + elem = elems[i]; + + // Get the text from text nodes and CDATA nodes + if ( elem.nodeType === 3 || elem.nodeType === 4 ) { + ret += elem.nodeValue; + + // Traverse everything else, except comment nodes + } else if ( elem.nodeType !== 8 ) { + ret += Sizzle.getText( elem.childNodes ); + } + } + + return ret; +}; + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = ""; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = ""; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "

"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + // See if we find a selector to speed up + var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); + + if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { + // Speed-up: Sizzle("TAG") + if ( match[1] ) { + return makeArray( context.getElementsByTagName( query ), extra ); + + // Speed-up: Sizzle(".CLASS") + } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { + return makeArray( context.getElementsByClassName( match[2] ), extra ); + } + } + + if ( context.nodeType === 9 ) { + // Speed-up: Sizzle("body") + // The body element only exists once, optimize finding it + if ( query === "body" && context.body ) { + return makeArray( [ context.body ], extra ); + + // Speed-up: Sizzle("#ID") + } else if ( match && match[3] ) { + var elem = context.getElementById( match[3] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id === match[3] ) { + return makeArray( [ elem ], extra ); + } + + } else { + return makeArray( [], extra ); + } + } + + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var oldContext = context, + old = context.getAttribute( "id" ), + nid = old || id, + hasParent = context.parentNode, + relativeHierarchySelector = /^\s*[+~]/.test( query ); + + if ( !old ) { + context.setAttribute( "id", nid ); + } else { + nid = nid.replace( /'/g, "\\$&" ); + } + if ( relativeHierarchySelector && hasParent ) { + context = context.parentNode; + } + + try { + if ( !relativeHierarchySelector || hasParent ) { + return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); + } + + } catch(pseudoError) { + } finally { + if ( !old ) { + oldContext.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; + + if ( matches ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9 fails this) + var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + var ret = matches.call( node, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || !disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9, so check for that + node.document && node.document.nodeType !== 11 ) { + return ret; + } + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "
"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var self = this, + i, l; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + var ret = this.pushStack( "", "find", selector ), + length, n, r; + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( typeof selector === "string" ? + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + // Array + if ( jQuery.isArray( selectors ) ) { + var match, selector, + matches = {}, + level = 1; + + if ( cur && selectors.length ) { + for ( i = 0, l = selectors.length; i < l; i++ ) { + selector = selectors[i]; + + if ( !matches[ selector ] ) { + matches[ selector ] = POS.test( selector ) ? + jQuery( selector, context || this.context ) : + selector; + } + } + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( selector in matches ) { + match = matches[ selector ]; + + if ( match.jquery ? match.index( cur ) > -1 : jQuery( cur ).is( match ) ) { + ret.push({ selector: selector, elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + } + + return ret; + } + + // String + var pos = POS.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ), + // The variable 'args' was introduced in + // https://github.com/jquery/jquery/commit/52a0238 + // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed. + // http://code.google.com/p/v8/issues/detail?id=1050 + args = slice.call(arguments); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, args.join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return (elem === qualifier) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return (jQuery.inArray( elem, qualifier ) >= 0) === keep; + }); +} + + + + +var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /
", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + col: [ 2, "", "
" ], + area: [ 1, "", "" ], + _default: [ 0, "", "" ] + }; + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize and + + + */ + +(function() { + this.loggly = function(opts) { + this.user_agent = get_agent(); + this.browser_size = get_size(); + log_methods = {'error': 5, 'warn': 4, 'info': 3, 'debug': 2, 'log': 1}; + if (!opts.url) throw new Error("Please include a Loggly HTTP URL."); + if (!opts.level) { + this.level = log_methods['info']; + } else { + this.level = log_methods[opts.level]; + } + this.log = function(data) { + if (log_methods['log'] == this.level) { + opts.data = data; + janky(opts); + } + }; + this.debug = function(data) { + if (log_methods['debug'] >= this.level) { + opts.data = data; + janky(opts); + } + }; + this.info = function(data) { + if (log_methods['info'] >= this.level) { + opts.data = data; + janky(opts); + } + }; + this.warn = function(data) { + if (log_methods['warn'] >= this.level) { + opts.data = data; + janky(opts); + } + }; + this.error = function(data) { + if (log_methods['error'] >= this.level) { + opts.data = data; + janky(opts); + } + }; + }; + this.janky = function(opts) { + janky._form(function(iframe, form) { + form.setAttribute("action", opts.url); + form.setAttribute("method", "post"); + janky._input(iframe, form, opts.data); + form.submit(); + setTimeout(function(){ + document.body.removeChild(iframe); + }, 2000); + }); + }; + this.janky._form = function(cb) { + var iframe = document.createElement("iframe"); + document.body.appendChild(iframe); + iframe.style.display = "none"; + setTimeout(function() { + var form = iframe.contentWindow.document.createElement("form"); + iframe.contentWindow.document.body.appendChild(form); + cb(iframe, form); + }, 0); + }; + this.janky._input = function(iframe, form, data) { + var inp = iframe.contentWindow.document.createElement("input"); + inp.setAttribute("type", "hidden"); + inp.setAttribute("name", "source"); + inp.value = "castor " + data; + form.appendChild(inp); + }; + this.get_agent = function () { + return navigator.appCodeName + navigator.appName + navigator.appVersion; + }; + this.get_size = function () { + var width = 0; var height = 0; + if( typeof( window.innerWidth ) == 'number' ) { + width = window.innerWidth; height = window.innerHeight; + } else if( document.documentElement && ( document.documentElement.clientWidth || document.documentElement.clientHeight ) ) { + width = document.documentElement.clientWidth; height = document.documentElement.clientHeight; + } else if( document.body && ( document.body.clientWidth || document.body.clientHeight ) ) { + width = document.body.clientWidth; height = document.body.clientHeight; + } + return {'height': height, 'width': width}; + }; +})(); + + +jsworld={};jsworld.formatIsoDateTime=function(a,b){if(typeof a==="undefined")a=new Date;if(typeof b==="undefined")b=false;var c=jsworld.formatIsoDate(a)+" "+jsworld.formatIsoTime(a);if(b){var d=a.getHours()-a.getUTCHours();var e=Math.abs(d);var f=a.getUTCMinutes();var g=a.getMinutes();if(g!=f&&f<30&&d<0)e--;if(g!=f&&f>30&&d>0)e--;var h;if(g!=f)h=":30";else h=":00";var i;if(e<10)i="0"+e+h;else i=""+e+h;if(d<0)i="-"+i;else i="+"+i;c=c+i}return c};jsworld.formatIsoDate=function(a){if(typeof a==="undefined")a=new Date;var b=a.getFullYear();var c=a.getMonth()+1;var d=a.getDate();return b+"-"+jsworld._zeroPad(c,2)+"-"+jsworld._zeroPad(d,2)};jsworld.formatIsoTime=function(a){if(typeof a==="undefined")a=new Date;var b=a.getHours();var c=a.getMinutes();var d=a.getSeconds();return jsworld._zeroPad(b,2)+":"+jsworld._zeroPad(c,2)+":"+jsworld._zeroPad(d,2)};jsworld.parseIsoDateTime=function(a){if(typeof a!="string")throw"Error: The parameter must be a string";var b=a.match(/^(\d\d\d\d)-(\d\d)-(\d\d)[T ](\d\d):(\d\d):(\d\d)/);if(b===null)b=a.match(/^(\d\d\d\d)(\d\d)(\d\d)[T ](\d\d)(\d\d)(\d\d)/);if(b===null)b=a.match(/^(\d\d\d\d)-(\d\d)-(\d\d)[T ](\d\d)(\d\d)(\d\d)/);if(b===null)b=a.match(/^(\d\d\d\d)-(\d\d)-(\d\d)[T ](\d\d):(\d\d):(\d\d)/);if(b===null)throw"Error: Invalid ISO-8601 date/time string";var c=parseInt(b[1],10);var d=parseInt(b[2],10);var e=parseInt(b[3],10);var f=parseInt(b[4],10);var g=parseInt(b[5],10);var h=parseInt(b[6],10);if(d<1||d>12||e<1||e>31||f<0||f>23||g<0||g>59||h<0||h>59)throw"Error: Invalid ISO-8601 date/time value";var i=new Date(c,d-1,e,f,g,h);if(i.getDate()!=e||i.getMonth()+1!=d)throw"Error: Invalid date";return i};jsworld.parseIsoDate=function(a){if(typeof a!="string")throw"Error: The parameter must be a string";var b=a.match(/^(\d\d\d\d)-(\d\d)-(\d\d)/);if(b===null)b=a.match(/^(\d\d\d\d)(\d\d)(\d\d)/);if(b===null)throw"Error: Invalid ISO-8601 date string";var c=parseInt(b[1],10);var d=parseInt(b[2],10);var e=parseInt(b[3],10);if(d<1||d>12||e<1||e>31)throw"Error: Invalid ISO-8601 date value";var f=new Date(c,d-1,e);if(f.getDate()!=e||f.getMonth()+1!=d)throw"Error: Invalid date";return f};jsworld.parseIsoTime=function(a){if(typeof a!="string")throw"Error: The parameter must be a string";var b=a.match(/^(\d\d):(\d\d):(\d\d)/);if(b===null)b=a.match(/^(\d\d)(\d\d)(\d\d)/);if(b===null)throw"Error: Invalid ISO-8601 date/time string";var c=parseInt(b[1],10);var d=parseInt(b[2],10);var e=parseInt(b[3],10);if(c<0||c>23||d<0||d>59||e<0||e>59)throw"Error: Invalid ISO-8601 time value";return new Date(0,0,0,c,d,e)};jsworld._trim=function(a){var b=" \n\r\t\f \u2000\u2001\u2002\u2003\u2004\u2005\u2006\u2007\u2008\u2009\u200a\u200b\u2028\u2029\u3000";for(var c=0;c=0;c--){if(b.indexOf(a.charAt(c))===-1){a=a.substring(0,c+1);break}}return b.indexOf(a.charAt(0))===-1?a:""};jsworld._isNumber=function(a){if(typeof a=="number")return true;if(typeof a!="string")return false;var b=a+"";return/^-?(\d+|\d*\.\d+)$/.test(b)};jsworld._isInteger=function(a){if(typeof a!="number"&&typeof a!="string")return false;var b=a+"";return/^-?\d+$/.test(b)};jsworld._isFloat=function(a){if(typeof a!="number"&&typeof a!="string")return false;var b=a+"";return/^-?\.\d+?$/.test(b)};jsworld._hasOption=function(a,b){if(typeof a!="string"||typeof b!="string")return false;if(b.indexOf(a)!=-1)return true;else return false};jsworld._stringReplaceAll=function(a,b,c){var d;if(b.length==1&&c.length==1){d="";for(var e=0;e0){if(d.length>0)g=parseInt(d.shift(),10);if(isNaN(g))throw"Error: Invalid grouping";if(g==-1){e=a.substring(0,f)+e;break}f-=g;if(f<1){e=a.substring(0,f+g)+e;break}e=c+a.substring(f,f+g)+e}return e};jsworld._formatFractionPart=function(a,b){for(var c=0;a.length0)return a;else throw"Empty or no string"};if(a==null||typeof a!="object")throw"Error: Invalid/missing locale properties";if(typeof a.decimal_point!="string")throw"Error: Invalid/missing decimal_point property";this.decimal_point=a.decimal_point;if(typeof a.thousands_sep!="string")throw"Error: Invalid/missing thousands_sep property";this.thousands_sep=a.thousands_sep;if(typeof a.grouping!="string")throw"Error: Invalid/missing grouping property";this.grouping=a.grouping;if(typeof a.int_curr_symbol!="string")throw"Error: Invalid/missing int_curr_symbol property";if(!/[A-Za-z]{3}.?/.test(a.int_curr_symbol))throw"Error: Invalid int_curr_symbol property";this.int_curr_symbol=a.int_curr_symbol;if(typeof a.currency_symbol!="string")throw"Error: Invalid/missing currency_symbol property";this.currency_symbol=a.currency_symbol;if(typeof a.frac_digits!="number"&&a.frac_digits<0)throw"Error: Invalid/missing frac_digits property";this.frac_digits=a.frac_digits;if(a.mon_decimal_point===null||a.mon_decimal_point==""){if(this.frac_digits>0)throw"Error: Undefined mon_decimal_point property";else a.mon_decimal_point=""}if(typeof a.mon_decimal_point!="string")throw"Error: Invalid/missing mon_decimal_point property";this.mon_decimal_point=a.mon_decimal_point;if(typeof a.mon_thousands_sep!="string")throw"Error: Invalid/missing mon_thousands_sep property";this.mon_thousands_sep=a.mon_thousands_sep;if(typeof a.mon_grouping!="string")throw"Error: Invalid/missing mon_grouping property";this.mon_grouping=a.mon_grouping;if(typeof a.positive_sign!="string")throw"Error: Invalid/missing positive_sign property";this.positive_sign=a.positive_sign;if(typeof a.negative_sign!="string")throw"Error: Invalid/missing negative_sign property";this.negative_sign=a.negative_sign;if(a.p_cs_precedes!==0&&a.p_cs_precedes!==1)throw"Error: Invalid/missing p_cs_precedes property, must be 0 or 1";this.p_cs_precedes=a.p_cs_precedes;if(a.n_cs_precedes!==0&&a.n_cs_precedes!==1)throw"Error: Invalid/missing n_cs_precedes, must be 0 or 1";this.n_cs_precedes=a.n_cs_precedes;if(a.p_sep_by_space!==0&&a.p_sep_by_space!==1&&a.p_sep_by_space!==2)throw"Error: Invalid/missing p_sep_by_space property, must be 0, 1 or 2";this.p_sep_by_space=a.p_sep_by_space;if(a.n_sep_by_space!==0&&a.n_sep_by_space!==1&&a.n_sep_by_space!==2)throw"Error: Invalid/missing n_sep_by_space property, must be 0, 1, or 2";this.n_sep_by_space=a.n_sep_by_space;if(a.p_sign_posn!==0&&a.p_sign_posn!==1&&a.p_sign_posn!==2&&a.p_sign_posn!==3&&a.p_sign_posn!==4)throw"Error: Invalid/missing p_sign_posn property, must be 0, 1, 2, 3 or 4";this.p_sign_posn=a.p_sign_posn;if(a.n_sign_posn!==0&&a.n_sign_posn!==1&&a.n_sign_posn!==2&&a.n_sign_posn!==3&&a.n_sign_posn!==4)throw"Error: Invalid/missing n_sign_posn property, must be 0, 1, 2, 3 or 4";this.n_sign_posn=a.n_sign_posn;if(typeof a.int_frac_digits!="number"&&a.int_frac_digits<0)throw"Error: Invalid/missing int_frac_digits property";this.int_frac_digits=a.int_frac_digits;if(a.int_p_cs_precedes!==0&&a.int_p_cs_precedes!==1)throw"Error: Invalid/missing int_p_cs_precedes property, must be 0 or 1";this.int_p_cs_precedes=a.int_p_cs_precedes;if(a.int_n_cs_precedes!==0&&a.int_n_cs_precedes!==1)throw"Error: Invalid/missing int_n_cs_precedes property, must be 0 or 1";this.int_n_cs_precedes=a.int_n_cs_precedes;if(a.int_p_sep_by_space!==0&&a.int_p_sep_by_space!==1&&a.int_p_sep_by_space!==2)throw"Error: Invalid/missing int_p_sep_by_spacev, must be 0, 1 or 2";this.int_p_sep_by_space=a.int_p_sep_by_space;if(a.int_n_sep_by_space!==0&&a.int_n_sep_by_space!==1&&a.int_n_sep_by_space!==2)throw"Error: Invalid/missing int_n_sep_by_space property, must be 0, 1, or 2";this.int_n_sep_by_space=a.int_n_sep_by_space;if(a.int_p_sign_posn!==0&&a.int_p_sign_posn!==1&&a.int_p_sign_posn!==2&&a.int_p_sign_posn!==3&&a.int_p_sign_posn!==4)throw"Error: Invalid/missing int_p_sign_posn property, must be 0, 1, 2, 3 or 4";this.int_p_sign_posn=a.int_p_sign_posn;if(a.int_n_sign_posn!==0&&a.int_n_sign_posn!==1&&a.int_n_sign_posn!==2&&a.int_n_sign_posn!==3&&a.int_n_sign_posn!==4)throw"Error: Invalid/missing int_n_sign_posn property, must be 0, 1, 2, 3 or 4";this.int_n_sign_posn=a.int_n_sign_posn;if(a==null||typeof a!="object")throw"Error: Invalid/missing time locale properties";try{this.abday=this._parseList(a.abday,7)}catch(b){throw"Error: Invalid abday property: "+b}try{this.day=this._parseList(a.day,7)}catch(b){throw"Error: Invalid day property: "+b}try{this.abmon=this._parseList(a.abmon,12)}catch(b){throw"Error: Invalid abmon property: "+b}try{this.mon=this._parseList(a.mon,12)}catch(b){throw"Error: Invalid mon property: "+b}try{this.d_fmt=this._validateFormatString(a.d_fmt)}catch(b){throw"Error: Invalid d_fmt property: "+b}try{this.t_fmt=this._validateFormatString(a.t_fmt)}catch(b){throw"Error: Invalid t_fmt property: "+b}try{this.d_t_fmt=this._validateFormatString(a.d_t_fmt)}catch(b){throw"Error: Invalid d_t_fmt property: "+b}try{var c=this._parseList(a.am_pm,2);this.am=c[0];this.pm=c[1]}catch(b){this.am="";this.pm=""}this.getAbbreviatedWeekdayName=function(a){if(typeof a=="undefined"||a===null)return this.abday;if(!jsworld._isInteger(a)||a<0||a>6)throw"Error: Invalid weekday argument, must be an integer [0..6]";return this.abday[a]};this.getWeekdayName=function(a){if(typeof a=="undefined"||a===null)return this.day;if(!jsworld._isInteger(a)||a<0||a>6)throw"Error: Invalid weekday argument, must be an integer [0..6]";return this.day[a]};this.getAbbreviatedMonthName=function(a){if(typeof a=="undefined"||a===null)return this.abmon;if(!jsworld._isInteger(a)||a<0||a>11)throw"Error: Invalid month argument, must be an integer [0..11]";return this.abmon[a]};this.getMonthName=function(a){if(typeof a=="undefined"||a===null)return this.mon;if(!jsworld._isInteger(a)||a<0||a>11)throw"Error: Invalid month argument, must be an integer [0..11]";return this.mon[a]};this.getDecimalPoint=function(){return this.decimal_point};this.getCurrencySymbol=function(){return this.currency_symbol};this.getIntCurrencySymbol=function(){return this.int_curr_symbol.substring(0,3)};this.currencySymbolPrecedes=function(){if(this.p_cs_precedes==1)return true;else return false};this.intCurrencySymbolPrecedes=function(){if(this.int_p_cs_precedes==1)return true;else return false};this.getMonetaryDecimalPoint=function(){return this.mon_decimal_point};this.getFractionalDigits=function(){return this.frac_digits};this.getIntFractionalDigits=function(){return this.int_frac_digits}};jsworld.NumericFormatter=function(a){if(typeof a!="object"||a._className!="jsworld.Locale")throw"Constructor error: You must provide a valid jsworld.Locale instance";this.lc=a;this.format=function(a,b){if(typeof a=="string")a=jsworld._trim(a);if(!jsworld._isNumber(a))throw"Error: The input is not a number";var c=parseFloat(a,10);var d=jsworld._getPrecision(b);if(d!=-1)c=Math.round(c*Math.pow(10,d))/Math.pow(10,d);var e=jsworld._splitNumber(String(c));var f;if(c===0)f="0";else f=jsworld._hasOption("^",b)?e.integer:jsworld._formatIntegerPart(e.integer,this.lc.grouping,this.lc.thousands_sep);var g=d!=-1?jsworld._formatFractionPart(e.fraction,d):e.fraction;var h=g.length?f+this.lc.decimal_point+g:f;if(jsworld._hasOption("~",b)||c===0){return h}else{if(jsworld._hasOption("+",b)||c<0){if(c>0)return"+"+h;else if(c<0)return"-"+h;else return h}else{return h}}}};jsworld.DateTimeFormatter=function(a){if(typeof a!="object"||a._className!="jsworld.Locale")throw"Constructor error: You must provide a valid jsworld.Locale instance.";this.lc=a;this.formatDate=function(a){var b=null;if(typeof a=="string"){try{b=jsworld.parseIsoDate(a)}catch(c){b=jsworld.parseIsoDateTime(a)}}else if(a!==null&&typeof a=="object"){b=a}else{throw"Error: Invalid date argument, must be a Date object or an ISO-8601 date/time string"}return this._applyFormatting(b,this.lc.d_fmt)};this.formatTime=function(a){var b=null;if(typeof a=="string"){try{b=jsworld.parseIsoTime(a)}catch(c){b=jsworld.parseIsoDateTime(a)}}else if(a!==null&&typeof a=="object"){b=a}else{throw"Error: Invalid date argument, must be a Date object or an ISO-8601 date/time string"}return this._applyFormatting(b,this.lc.t_fmt)};this.formatDateTime=function(a){var b=null;if(typeof a=="string"){b=jsworld.parseIsoDateTime(a)}else if(a!==null&&typeof a=="object"){b=a}else{throw"Error: Invalid date argument, must be a Date object or an ISO-8601 date/time string"}return this._applyFormatting(b,this.lc.d_t_fmt)};this._applyFormatting=function(a,b){b=b.replace(/%%/g,"%");b=b.replace(/%a/g,this.lc.abday[a.getDay()]);b=b.replace(/%A/g,this.lc.day[a.getDay()]);b=b.replace(/%b/g,this.lc.abmon[a.getMonth()]);b=b.replace(/%B/g,this.lc.mon[a.getMonth()]);b=b.replace(/%d/g,jsworld._zeroPad(a.getDate(),2));b=b.replace(/%e/g,jsworld._spacePad(a.getDate(),2));b=b.replace(/%F/g,a.getFullYear()+"-"+jsworld._zeroPad(a.getMonth()+1,2)+"-"+jsworld._zeroPad(a.getDate(),2));b=b.replace(/%h/g,this.lc.abmon[a.getMonth()]);b=b.replace(/%H/g,jsworld._zeroPad(a.getHours(),2));b=b.replace(/%I/g,jsworld._zeroPad(this._hours12(a.getHours()),2));b=b.replace(/%k/g,a.getHours());b=b.replace(/%l/g,this._hours12(a.getHours()));b=b.replace(/%m/g,jsworld._zeroPad(a.getMonth()+1,2));b=b.replace(/%n/g,"\n");b=b.replace(/%M/g,jsworld._zeroPad(a.getMinutes(),2));b=b.replace(/%p/g,this._getAmPm(a.getHours()));b=b.replace(/%P/g,this._getAmPm(a.getHours()).toLocaleLowerCase());b=b.replace(/%R/g,jsworld._zeroPad(a.getHours(),2)+":"+jsworld._zeroPad(a.getMinutes(),2));b=b.replace(/%S/g,jsworld._zeroPad(a.getSeconds(),2));b=b.replace(/%T/g,jsworld._zeroPad(a.getHours(),2)+":"+jsworld._zeroPad(a.getMinutes(),2)+":"+jsworld._zeroPad(a.getSeconds(),2));b=b.replace(/%w/g,this.lc.day[a.getDay()]);b=b.replace(/%y/g,(new String(a.getFullYear())).substring(2));b=b.replace(/%Y/g,a.getFullYear());b=b.replace(/%Z/g,"");b=b.replace(/%[a-zA-Z]/g,"");return b};this._hours12=function(a){if(a===0)return 12;else if(a>12)return a-12;else return a};this._getAmPm=function(a){if(a===0||a>12)return this.lc.pm;else return this.lc.am}};jsworld.MonetaryFormatter=function(a,b,c){if(typeof a!="object"||a._className!="jsworld.Locale")throw"Constructor error: You must provide a valid jsworld.Locale instance";this.lc=a;this.currencyFractionDigits={AFN:0,ALL:0,AMD:0,BHD:3,BIF:0,BYR:0,CLF:0,CLP:0,COP:0,CRC:0,DJF:0,GNF:0,GYD:0,HUF:0,IDR:0,IQD:0,IRR:0,ISK:0,JOD:3,JPY:0,KMF:0,KRW:0,KWD:3,LAK:0,LBP:0,LYD:3,MGA:0,MMK:0,MNT:0,MRO:0,MUR:0,OMR:3,PKR:0,PYG:0,RSD:0,RWF:0,SLL:0,SOS:0,STD:0,SYP:0,TND:3,TWD:0,TZS:0,UGX:0,UZS:0,VND:0,VUV:0,XAF:0,XOF:0,XPF:0,YER:0,ZMK:0};if(typeof b=="string"){this.currencyCode=b.toUpperCase();var d=this.currencyFractionDigits[this.currencyCode];if(typeof d!="number")d=2;this.lc.frac_digits=d;this.lc.int_frac_digits=d}else{this.currencyCode=this.lc.int_curr_symbol.substring(0,3).toUpperCase()}this.intSep=this.lc.int_curr_symbol.charAt(3);if(this.currencyCode==this.lc.int_curr_symbol.substring(0,3)){this.internationalFormatting=false;this.curSym=this.lc.currency_symbol}else{if(typeof c=="string"){this.curSym=c;this.internationalFormatting=false}else{this.internationalFormatting=true}}this.getCurrencySymbol=function(){return this.curSym};this.currencySymbolPrecedes=function(a){if(typeof a=="string"&&a=="i"){if(this.lc.int_p_cs_precedes==1)return true;else return false}else{if(this.internationalFormatting){if(this.lc.int_p_cs_precedes==1)return true;else return false}else{if(this.lc.p_cs_precedes==1)return true;else return false}}};this.getDecimalPoint=function(){return this.lc.mon_decimal_point};this.getFractionalDigits=function(a){if(typeof a=="string"&&a=="i"){return this.lc.int_frac_digits}else{if(this.internationalFormatting)return this.lc.int_frac_digits;else return this.lc.frac_digits}};this.format=function(a,b){var c;if(typeof a=="string"){a=jsworld._trim(a);c=parseFloat(a);if(typeof c!="number"||isNaN(c))throw"Error: Amount string not a number"}else if(typeof a=="number"){c=a}else{throw"Error: Amount not a number"}var d=jsworld._getPrecision(b);if(d==-1){if(this.internationalFormatting||jsworld._hasOption("i",b))d=this.lc.int_frac_digits;else d=this.lc.frac_digits}c=Math.round(c*Math.pow(10,d))/Math.pow(10,d);var e=jsworld._splitNumber(String(c));var f;if(c===0)f="0";else f=jsworld._hasOption("^",b)?e.integer:jsworld._formatIntegerPart(e.integer,this.lc.mon_grouping,this.lc.mon_thousands_sep);var g;if(d==-1){if(this.internationalFormatting||jsworld._hasOption("i",b))g=jsworld._formatFractionPart(e.fraction,this.lc.int_frac_digits);else g=jsworld._formatFractionPart(e.fraction,this.lc.frac_digits)}else{g=jsworld._formatFractionPart(e.fraction,d)}var h;if(this.lc.frac_digits>0||g.length)h=f+this.lc.mon_decimal_point+g;else h=f;if(jsworld._hasOption("~",b)){return h}else{var i=jsworld._hasOption("!",b)?true:false;var j=c<0?"-":"+";if(this.internationalFormatting||jsworld._hasOption("i",b)){if(i)return this._formatAsInternationalCurrencyWithNoSym(j,h);else return this._formatAsInternationalCurrency(j,h)}else{if(i)return this._formatAsLocalCurrencyWithNoSym(j,h);else return this._formatAsLocalCurrency(j,h)}}};this._formatAsLocalCurrency=function(a,b){if(a=="+"){if(this.lc.p_sign_posn===0&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===0){return"("+b+this.curSym+")"}else if(this.lc.p_sign_posn===0&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===1){return"("+this.curSym+b+")"}else if(this.lc.p_sign_posn===0&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===0){return"("+b+" "+this.curSym+")"}else if(this.lc.p_sign_posn===0&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===1){return"("+this.curSym+" "+b+")"}else if(this.lc.p_sign_posn===1&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===0){return this.lc.positive_sign+b+this.curSym}else if(this.lc.p_sign_posn===1&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+this.curSym+b}else if(this.lc.p_sign_posn===1&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===0){return this.lc.positive_sign+b+" "+this.curSym}else if(this.lc.p_sign_posn===1&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+this.curSym+" "+b}else if(this.lc.p_sign_posn===1&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===0){return this.lc.positive_sign+" "+b+this.curSym}else if(this.lc.p_sign_posn===1&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+" "+this.curSym+b}else if(this.lc.p_sign_posn===2&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===0){return b+this.curSym+this.lc.positive_sign}else if(this.lc.p_sign_posn===2&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===1){return this.curSym+b+this.lc.positive_sign}else if(this.lc.p_sign_posn===2&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===0){return b+" "+this.curSym+this.lc.positive_sign}else if(this.lc.p_sign_posn===2&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===1){return this.curSym+" "+b+this.lc.positive_sign}else if(this.lc.p_sign_posn===2&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===0){return b+this.curSym+" "+this.lc.positive_sign}else if(this.lc.p_sign_posn===2&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===1){return this.curSym+b+" "+this.lc.positive_sign}else if(this.lc.p_sign_posn===3&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===0){return b+this.lc.positive_sign+this.curSym}else if(this.lc.p_sign_posn===3&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+this.curSym+b}else if(this.lc.p_sign_posn===3&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===0){return b+" "+this.lc.positive_sign+this.curSym}else if(this.lc.p_sign_posn===3&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+this.curSym+" "+b}else if(this.lc.p_sign_posn===3&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===0){return b+this.lc.positive_sign+" "+this.curSym}else if(this.lc.p_sign_posn===3&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+" "+this.curSym+b}else if(this.lc.p_sign_posn===4&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===0){return b+this.curSym+this.lc.positive_sign}else if(this.lc.p_sign_posn===4&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===1){return this.curSym+this.lc.positive_sign+b}else if(this.lc.p_sign_posn===4&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===0){return b+" "+this.curSym+this.lc.positive_sign}else if(this.lc.p_sign_posn===4&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===1){return this.curSym+this.lc.positive_sign+" "+b}else if(this.lc.p_sign_posn===4&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===0){return b+this.curSym+" "+this.lc.positive_sign}else if(this.lc.p_sign_posn===4&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===1){return this.curSym+" "+this.lc.positive_sign+b}}else if(a=="-"){if(this.lc.n_sign_posn===0&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===0){return"("+b+this.curSym+")"}else if(this.lc.n_sign_posn===0&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===1){return"("+this.curSym+b+")"}else if(this.lc.n_sign_posn===0&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===0){return"("+b+" "+this.curSym+")"}else if(this.lc.n_sign_posn===0&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===1){return"("+this.curSym+" "+b+")"}else if(this.lc.n_sign_posn===1&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===0){return this.lc.negative_sign+b+this.curSym}else if(this.lc.n_sign_posn===1&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+this.curSym+b}else if(this.lc.n_sign_posn===1&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===0){return this.lc.negative_sign+b+" "+this.curSym}else if(this.lc.n_sign_posn===1&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+this.curSym+" "+b}else if(this.lc.n_sign_posn===1&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===0){return this.lc.negative_sign+" "+b+this.curSym}else if(this.lc.n_sign_posn===1&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+" "+this.curSym+b}else if(this.lc.n_sign_posn===2&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===0){return b+this.curSym+this.lc.negative_sign}else if(this.lc.n_sign_posn===2&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===1){return this.curSym+b+this.lc.negative_sign}else if(this.lc.n_sign_posn===2&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===0){return b+" "+this.curSym+this.lc.negative_sign}else if(this.lc.n_sign_posn===2&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===1){return this.curSym+" "+b+this.lc.negative_sign}else if(this.lc.n_sign_posn===2&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===0){return b+this.curSym+" "+this.lc.negative_sign}else if(this.lc.n_sign_posn===2&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===1){return this.curSym+b+" "+this.lc.negative_sign}else if(this.lc.n_sign_posn===3&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===0){return b+this.lc.negative_sign+this.curSym}else if(this.lc.n_sign_posn===3&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+this.curSym+b}else if(this.lc.n_sign_posn===3&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===0){return b+" "+this.lc.negative_sign+this.curSym}else if(this.lc.n_sign_posn===3&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+this.curSym+" "+b}else if(this.lc.n_sign_posn===3&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===0){return b+this.lc.negative_sign+" "+this.curSym}else if(this.lc.n_sign_posn===3&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+" "+this.curSym+b}else if(this.lc.n_sign_posn===4&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===0){return b+this.curSym+this.lc.negative_sign}else if(this.lc.n_sign_posn===4&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===1){return this.curSym+this.lc.negative_sign+b}else if(this.lc.n_sign_posn===4&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===0){return b+" "+this.curSym+this.lc.negative_sign}else if(this.lc.n_sign_posn===4&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===1){return this.curSym+this.lc.negative_sign+" "+b}else if(this.lc.n_sign_posn===4&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===0){return b+this.curSym+" "+this.lc.negative_sign}else if(this.lc.n_sign_posn===4&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===1){return this.curSym+" "+this.lc.negative_sign+b}}throw"Error: Invalid POSIX LC MONETARY definition"};this._formatAsInternationalCurrency=function(a,b){if(a=="+"){if(this.lc.int_p_sign_posn===0&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===0){return"("+b+this.currencyCode+")"}else if(this.lc.int_p_sign_posn===0&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===1){return"("+this.currencyCode+b+")"}else if(this.lc.int_p_sign_posn===0&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===0){return"("+b+this.intSep+this.currencyCode+")"}else if(this.lc.int_p_sign_posn===0&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===1){return"("+this.currencyCode+this.intSep+b+")"}else if(this.lc.int_p_sign_posn===1&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===0){return this.lc.positive_sign+b+this.currencyCode}else if(this.lc.int_p_sign_posn===1&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+this.currencyCode+b}else if(this.lc.int_p_sign_posn===1&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===0){return this.lc.positive_sign+b+this.intSep+this.currencyCode}else if(this.lc.int_p_sign_posn===1&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+this.currencyCode+this.intSep+b}else if(this.lc.int_p_sign_posn===1&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===0){return this.lc.positive_sign+this.intSep+b+this.currencyCode}else if(this.lc.int_p_sign_posn===1&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+this.intSep+this.currencyCode+b}else if(this.lc.int_p_sign_posn===2&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===0){return b+this.currencyCode+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===2&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===1){return this.currencyCode+b+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===2&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===0){return b+this.intSep+this.currencyCode+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===2&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===1){return this.currencyCode+this.intSep+b+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===2&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===0){return b+this.currencyCode+this.intSep+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===2&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===1){return this.currencyCode+b+this.intSep+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===3&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===0){return b+this.lc.positive_sign+this.currencyCode}else if(this.lc.int_p_sign_posn===3&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+this.currencyCode+b}else if(this.lc.int_p_sign_posn===3&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===0){return b+this.intSep+this.lc.positive_sign+this.currencyCode}else if(this.lc.int_p_sign_posn===3&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+this.currencyCode+this.intSep+b}else if(this.lc.int_p_sign_posn===3&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===0){return b+this.lc.positive_sign+this.intSep+this.currencyCode}else if(this.lc.int_p_sign_posn===3&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+this.intSep+this.currencyCode+b}else if(this.lc.int_p_sign_posn===4&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===0){return b+this.currencyCode+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===4&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===1){return this.currencyCode+this.lc.positive_sign+b}else if(this.lc.int_p_sign_posn===4&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===0){return b+this.intSep+this.currencyCode+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===4&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===1){return this.currencyCode+this.lc.positive_sign+this.intSep+b}else if(this.lc.int_p_sign_posn===4&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===0){return b+this.currencyCode+this.intSep+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===4&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===1){return this.currencyCode+this.intSep+this.lc.positive_sign+b}}else if(a=="-"){if(this.lc.int_n_sign_posn===0&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===0){return"("+b+this.currencyCode+")"}else if(this.lc.int_n_sign_posn===0&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===1){return"("+this.currencyCode+b+")"}else if(this.lc.int_n_sign_posn===0&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===0){return"("+b+this.intSep+this.currencyCode+")"}else if(this.lc.int_n_sign_posn===0&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===1){return"("+this.currencyCode+this.intSep+b+")"}else if(this.lc.int_n_sign_posn===1&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===0){return this.lc.negative_sign+b+this.currencyCode}else if(this.lc.int_n_sign_posn===1&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+this.currencyCode+b}else if(this.lc.int_n_sign_posn===1&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===0){return this.lc.negative_sign+b+this.intSep+this.currencyCode}else if(this.lc.int_n_sign_posn===1&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+this.currencyCode+this.intSep+b}else if(this.lc.int_n_sign_posn===1&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===0){return this.lc.negative_sign+this.intSep+b+this.currencyCode}else if(this.lc.int_n_sign_posn===1&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+this.intSep+this.currencyCode+b}else if(this.lc.int_n_sign_posn===2&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===0){return b+this.currencyCode+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===2&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===1){return this.currencyCode+b+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===2&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===0){return b+this.intSep+this.currencyCode+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===2&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===1){return this.currencyCode+this.intSep+b+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===2&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===0){return b+this.currencyCode+this.intSep+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===2&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===1){return this.currencyCode+b+this.intSep+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===3&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===0){return b+this.lc.negative_sign+this.currencyCode}else if(this.lc.int_n_sign_posn===3&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+this.currencyCode+b}else if(this.lc.int_n_sign_posn===3&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===0){return b+this.intSep+this.lc.negative_sign+this.currencyCode}else if(this.lc.int_n_sign_posn===3&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+this.currencyCode+this.intSep+b}else if(this.lc.int_n_sign_posn===3&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===0){return b+this.lc.negative_sign+this.intSep+this.currencyCode}else if(this.lc.int_n_sign_posn===3&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+this.intSep+this.currencyCode+b}else if(this.lc.int_n_sign_posn===4&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===0){return b+this.currencyCode+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===4&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===1){return this.currencyCode+this.lc.negative_sign+b}else if(this.lc.int_n_sign_posn===4&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===0){return b+this.intSep+this.currencyCode+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===4&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===1){return this.currencyCode+this.lc.negative_sign+this.intSep+b}else if(this.lc.int_n_sign_posn===4&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===0){return b+this.currencyCode+this.intSep+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===4&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===1){return this.currencyCode+this.intSep+this.lc.negative_sign+b}}throw"Error: Invalid POSIX LC MONETARY definition"};this._formatAsLocalCurrencyWithNoSym=function(a,b){if(a=="+"){if(this.lc.p_sign_posn===0){return"("+b+")"}else if(this.lc.p_sign_posn===1&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===0){return this.lc.positive_sign+b}else if(this.lc.p_sign_posn===1&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+b}else if(this.lc.p_sign_posn===1&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===0){return this.lc.positive_sign+b}else if(this.lc.p_sign_posn===1&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+b}else if(this.lc.p_sign_posn===1&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===0){return this.lc.positive_sign+" "+b}else if(this.lc.p_sign_posn===1&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+" "+b}else if(this.lc.p_sign_posn===2&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===0){return b+this.lc.positive_sign}else if(this.lc.p_sign_posn===2&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===1){return b+this.lc.positive_sign}else if(this.lc.p_sign_posn===2&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===0){return b+" "+this.lc.positive_sign}else if(this.lc.p_sign_posn===2&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===1){return b+this.lc.positive_sign}else if(this.lc.p_sign_posn===2&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===0){return b+this.lc.positive_sign}else if(this.lc.p_sign_posn===2&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===1){return b+" "+this.lc.positive_sign}else if(this.lc.p_sign_posn===3&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===0){return b+this.lc.positive_sign}else if(this.lc.p_sign_posn===3&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+b}else if(this.lc.p_sign_posn===3&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===0){return b+" "+this.lc.positive_sign}else if(this.lc.p_sign_posn===3&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+" "+b}else if(this.lc.p_sign_posn===3&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===0){return b+this.lc.positive_sign}else if(this.lc.p_sign_posn===3&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+" "+b}else if(this.lc.p_sign_posn===4&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===0){return b+this.lc.positive_sign}else if(this.lc.p_sign_posn===4&&this.lc.p_sep_by_space===0&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+b}else if(this.lc.p_sign_posn===4&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===0){return b+" "+this.lc.positive_sign}else if(this.lc.p_sign_posn===4&&this.lc.p_sep_by_space===1&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+" "+b}else if(this.lc.p_sign_posn===4&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===0){return b+" "+this.lc.positive_sign}else if(this.lc.p_sign_posn===4&&this.lc.p_sep_by_space===2&&this.lc.p_cs_precedes===1){return this.lc.positive_sign+b}}else if(a=="-"){if(this.lc.n_sign_posn===0){return"("+b+")"}else if(this.lc.n_sign_posn===1&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===0){return this.lc.negative_sign+b}else if(this.lc.n_sign_posn===1&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+b}else if(this.lc.n_sign_posn===1&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===0){return this.lc.negative_sign+b}else if(this.lc.n_sign_posn===1&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+" "+b}else if(this.lc.n_sign_posn===1&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===0){return this.lc.negative_sign+" "+b}else if(this.lc.n_sign_posn===1&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+" "+b}else if(this.lc.n_sign_posn===2&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===0){return b+this.lc.negative_sign}else if(this.lc.n_sign_posn===2&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===1){return b+this.lc.negative_sign}else if(this.lc.n_sign_posn===2&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===0){return b+" "+this.lc.negative_sign}else if(this.lc.n_sign_posn===2&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===1){return b+this.lc.negative_sign}else if(this.lc.n_sign_posn===2&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===0){return b+" "+this.lc.negative_sign}else if(this.lc.n_sign_posn===2&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===1){return b+" "+this.lc.negative_sign}else if(this.lc.n_sign_posn===3&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===0){return b+this.lc.negative_sign}else if(this.lc.n_sign_posn===3&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+b}else if(this.lc.n_sign_posn===3&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===0){return b+" "+this.lc.negative_sign}else if(this.lc.n_sign_posn===3&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+" "+b}else if(this.lc.n_sign_posn===3&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===0){return b+this.lc.negative_sign}else if(this.lc.n_sign_posn===3&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+" "+b}else if(this.lc.n_sign_posn===4&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===0){return b+this.lc.negative_sign}else if(this.lc.n_sign_posn===4&&this.lc.n_sep_by_space===0&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+b}else if(this.lc.n_sign_posn===4&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===0){return b+" "+this.lc.negative_sign}else if(this.lc.n_sign_posn===4&&this.lc.n_sep_by_space===1&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+" "+b}else if(this.lc.n_sign_posn===4&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===0){return b+" "+this.lc.negative_sign}else if(this.lc.n_sign_posn===4&&this.lc.n_sep_by_space===2&&this.lc.n_cs_precedes===1){return this.lc.negative_sign+b}}throw"Error: Invalid POSIX LC MONETARY definition"};this._formatAsInternationalCurrencyWithNoSym=function(a,b){if(a=="+"){if(this.lc.int_p_sign_posn===0){return"("+b+")"}else if(this.lc.int_p_sign_posn===1&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===0){return this.lc.positive_sign+b}else if(this.lc.int_p_sign_posn===1&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+b}else if(this.lc.int_p_sign_posn===1&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===0){return this.lc.positive_sign+b}else if(this.lc.int_p_sign_posn===1&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+this.intSep+b}else if(this.lc.int_p_sign_posn===1&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===0){return this.lc.positive_sign+this.intSep+b}else if(this.lc.int_p_sign_posn===1&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+this.intSep+b}else if(this.lc.int_p_sign_posn===2&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===0){return b+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===2&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===1){return b+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===2&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===0){return b+this.intSep+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===2&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===1){return b+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===2&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===0){return b+this.intSep+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===2&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===1){return b+this.intSep+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===3&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===0){return b+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===3&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+b}else if(this.lc.int_p_sign_posn===3&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===0){return b+this.intSep+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===3&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+this.intSep+b}else if(this.lc.int_p_sign_posn===3&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===0){return b+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===3&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+this.intSep+b}else if(this.lc.int_p_sign_posn===4&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===0){return b+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===4&&this.lc.int_p_sep_by_space===0&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+b}else if(this.lc.int_p_sign_posn===4&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===0){return b+this.intSep+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===4&&this.lc.int_p_sep_by_space===1&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+this.intSep+b}else if(this.lc.int_p_sign_posn===4&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===0){return b+this.intSep+this.lc.positive_sign}else if(this.lc.int_p_sign_posn===4&&this.lc.int_p_sep_by_space===2&&this.lc.int_p_cs_precedes===1){return this.lc.positive_sign+b}}else if(a=="-"){if(this.lc.int_n_sign_posn===0){return"("+b+")"}else if(this.lc.int_n_sign_posn===1&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===0){return this.lc.negative_sign+b}else if(this.lc.int_n_sign_posn===1&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+b}else if(this.lc.int_n_sign_posn===1&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===0){return this.lc.negative_sign+b}else if(this.lc.int_n_sign_posn===1&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+this.intSep+b}else if(this.lc.int_n_sign_posn===1&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===0){return this.lc.negative_sign+this.intSep+b}else if(this.lc.int_n_sign_posn===1&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+this.intSep+b}else if(this.lc.int_n_sign_posn===2&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===0){return b+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===2&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===1){return b+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===2&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===0){return b+this.intSep+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===2&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===1){return b+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===2&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===0){return b+this.intSep+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===2&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===1){return b+this.intSep+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===3&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===0){return b+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===3&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+b}else if(this.lc.int_n_sign_posn===3&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===0){return b+this.intSep+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===3&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+this.intSep+b}else if(this.lc.int_n_sign_posn===3&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===0){return b+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===3&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+this.intSep+b}else if(this.lc.int_n_sign_posn===4&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===0){return b+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===4&&this.lc.int_n_sep_by_space===0&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+b}else if(this.lc.int_n_sign_posn===4&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===0){return b+this.intSep+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===4&&this.lc.int_n_sep_by_space===1&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+this.intSep+b}else if(this.lc.int_n_sign_posn===4&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===0){return b+this.intSep+this.lc.negative_sign}else if(this.lc.int_n_sign_posn===4&&this.lc.int_n_sep_by_space===2&&this.lc.int_n_cs_precedes===1){return this.lc.negative_sign+b}}throw"Error: Invalid POSIX LC_MONETARY definition"}};jsworld.NumericParser=function(a){if(typeof a!="object"||a._className!="jsworld.Locale")throw"Constructor error: You must provide a valid jsworld.Locale instance";this.lc=a;this.parse=function(a){if(typeof a!="string")throw"Parse error: Argument must be a string";var b=jsworld._trim(a);b=jsworld._stringReplaceAll(a,this.lc.thousands_sep,"");b=jsworld._stringReplaceAll(b,this.lc.decimal_point,".");if(jsworld._isNumber(b))return parseFloat(b,10);else throw"Parse error: Invalid number string"}};jsworld.DateTimeParser=function(a){if(typeof a!="object"||a._className!="jsworld.Locale")throw"Constructor error: You must provide a valid jsworld.Locale instance.";this.lc=a;this.parseTime=function(a){if(typeof a!="string")throw"Parse error: Argument must be a string";var b=this._extractTokens(this.lc.t_fmt,a);var c=false;if(b.hour!==null&&b.minute!==null&&b.second!==null){c=true}else if(b.hourAmPm!==null&&b.am!==null&&b.minute!==null&&b.second!==null){if(b.am){b.hour=parseInt(b.hourAmPm,10)}else{if(b.hourAmPm==12)b.hour=0;else b.hour=parseInt(b.hourAmPm,10)+12}c=true}if(c)return jsworld._zeroPad(b.hour,2)+":"+jsworld._zeroPad(b.minute,2)+":"+jsworld._zeroPad(b.second,2);else throw"Parse error: Invalid/ambiguous time string"};this.parseDate=function(a){if(typeof a!="string")throw"Parse error: Argument must be a string";var b=this._extractTokens(this.lc.d_fmt,a);var c=false;if(b.year!==null&&b.month!==null&&b.day!==null){c=true}if(c)return jsworld._zeroPad(b.year,4)+"-"+jsworld._zeroPad(b.month,2)+"-"+jsworld._zeroPad(b.day,2);else throw"Parse error: Invalid date string"};this.parseDateTime=function(a){if(typeof a!="string")throw"Parse error: Argument must be a string";var b=this._extractTokens(this.lc.d_t_fmt,a);var c=false;var d=false;if(b.hour!==null&&b.minute!==null&&b.second!==null){c=true}else if(b.hourAmPm!==null&&b.am!==null&&b.minute!==null&&b.second!==null){if(b.am){b.hour=parseInt(b.hourAmPm,10)}else{if(b.hourAmPm==12)b.hour=0;else b.hour=parseInt(b.hourAmPm,10)+12}c=true}if(b.year!==null&&b.month!==null&&b.day!==null){d=true}if(d&&c)return jsworld._zeroPad(b.year,4)+"-"+jsworld._zeroPad(b.month,2)+"-"+jsworld._zeroPad(b.day,2)+" "+jsworld._zeroPad(b.hour,2)+":"+jsworld._zeroPad(b.minute,2)+":"+jsworld._zeroPad(b.second,2);else throw"Parse error: Invalid/ambiguous date/time string"};this._extractTokens=function(a,b){var c={year:null,month:null,day:null,hour:null,hourAmPm:null,am:null,minute:null,second:null,weekday:null};while(a.length>0){if(a.charAt(0)=="%"&&a.charAt(1)!=""){var d=a.substring(0,2);if(d=="%%"){b=b.substring(1)}else if(d=="%a"){for(var e=0;e31)throw"Parse error: Unrecognised day of the month (%e)";b=b.substring(f.length)}else if(d=="%F"){if(/^\d\d\d\d/.test(b)){c.year=parseInt(b.substring(0,4),10);b=b.substring(4)}else{throw"Parse error: Unrecognised date (%F)"}if(jsworld._stringStartsWith(b,"-"))b=b.substring(1);else throw"Parse error: Unrecognised date (%F)";if(/^0[1-9]|1[0-2]/.test(b)){c.month=parseInt(b.substring(0,2),10);b=b.substring(2)}else throw"Parse error: Unrecognised date (%F)";if(jsworld._stringStartsWith(b,"-"))b=b.substring(1);else throw"Parse error: Unrecognised date (%F)";if(/^0[1-9]|[1-2][0-9]|3[0-1]/.test(b)){c.day=parseInt(b.substring(0,2),10);b=b.substring(2)}else throw"Parse error: Unrecognised date (%F)"}else if(d=="%H"){if(/^[0-1][0-9]|2[0-3]/.test(b)){c.hour=parseInt(b.substring(0,2),10);b=b.substring(2)}else throw"Parse error: Unrecognised hour (%H)"}else if(d=="%I"){if(/^0[1-9]|1[0-2]/.test(b)){c.hourAmPm=parseInt(b.substring(0,2),10);b=b.substring(2)}else throw"Parse error: Unrecognised hour (%I)"}else if(d=="%k"){var g=b.match(/^(\d{1,2})/);c.hour=parseInt(g,10);if(isNaN(c.hour)||c.hour<0||c.hour>23)throw"Parse error: Unrecognised hour (%k)";b=b.substring(g.length)}else if(d=="%l"){var g=b.match(/^(\d{1,2})/);c.hourAmPm=parseInt(g,10);if(isNaN(c.hourAmPm)||c.hourAmPm<1||c.hourAmPm>12)throw"Parse error: Unrecognised hour (%l)";b=b.substring(g.length)}else if(d=="%m"){if(/^0[1-9]|1[0-2]/.test(b)){c.month=parseInt(b.substring(0,2),10);b=b.substring(2)}else throw"Parse error: Unrecognised month (%m)"}else if(d=="%M"){if(/^[0-5][0-9]/.test(b)){c.minute=parseInt(b.substring(0,2),10);b=b.substring(2)}else throw"Parse error: Unrecognised minute (%M)"}else if(d=="%n"){if(b.charAt(0)=="\n")b=b.substring(1);else throw"Parse error: Unrecognised new line (%n)"}else if(d=="%p"){if(jsworld._stringStartsWith(b,this.lc.am)){c.am=true;b=b.substring(this.lc.am.length)}else if(jsworld._stringStartsWith(b,this.lc.pm)){c.am=false;b=b.substring(this.lc.pm.length)}else throw"Parse error: Unrecognised AM/PM value (%p)"}else if(d=="%P"){if(jsworld._stringStartsWith(b,this.lc.am.toLowerCase())){c.am=true;b=b.substring(this.lc.am.length)}else if(jsworld._stringStartsWith(b,this.lc.pm.toLowerCase())){c.am=false;b=b.substring(this.lc.pm.length)}else throw"Parse error: Unrecognised AM/PM value (%P)"}else if(d=="%R"){if(/^[0-1][0-9]|2[0-3]/.test(b)){c.hour=parseInt(b.substring(0,2),10);b=b.substring(2)}else throw"Parse error: Unrecognised time (%R)";if(jsworld._stringStartsWith(b,":"))b=b.substring(1);else throw"Parse error: Unrecognised time (%R)";if(/^[0-5][0-9]/.test(b)){c.minute=parseInt(b.substring(0,2),10);b=b.substring(2)}else throw"Parse error: Unrecognised time (%R)"}else if(d=="%S"){if(/^[0-5][0-9]/.test(b)){c.second=parseInt(b.substring(0,2),10);b=b.substring(2)}else throw"Parse error: Unrecognised second (%S)"}else if(d=="%T"){if(/^[0-1][0-9]|2[0-3]/.test(b)){c.hour=parseInt(b.substring(0,2),10);b=b.substring(2)}else throw"Parse error: Unrecognised time (%T)";if(jsworld._stringStartsWith(b,":"))b=b.substring(1);else throw"Parse error: Unrecognised time (%T)";if(/^[0-5][0-9]/.test(b)){c.minute=parseInt(b.substring(0,2),10);b=b.substring(2)}else throw"Parse error: Unrecognised time (%T)";if(jsworld._stringStartsWith(b,":"))b=b.substring(1);else throw"Parse error: Unrecognised time (%T)";if(/^[0-5][0-9]/.test(b)){c.second=parseInt(b.substring(0,2),10);b=b.substring(2)}else throw"Parse error: Unrecognised time (%T)"}else if(d=="%w"){if(/^\d/.test(b)){c.weekday=parseInt(b.substring(0,1),10);b=b.substring(1)}else throw"Parse error: Unrecognised weekday number (%w)"}else if(d=="%y"){if(/^\d\d/.test(b)){var h=parseInt(b.substring(0,2),10);if(h>50)c.year=1900+h;else c.year=2e3+h;b=b.substring(2)}else throw"Parse error: Unrecognised year (%y)"}else if(d=="%Y"){if(/^\d\d\d\d/.test(b)){c.year=parseInt(b.substring(0,4),10);b=b.substring(4)}else throw"Parse error: Unrecognised year (%Y)"}else if(d=="%Z"){if(a.length===0)break}a=a.substring(2)}else{if(a.charAt(0)!=b.charAt(0))throw'Parse error: Unexpected symbol "'+b.charAt(0)+'" in date/time string';a=a.substring(1);b=b.substring(1)}}return c}};jsworld.MonetaryParser=function(a){if(typeof a!="object"||a._className!="jsworld.Locale")throw"Constructor error: You must provide a valid jsworld.Locale instance";this.lc=a;this.parse=function(a){if(typeof a!="string")throw"Parse error: Argument must be a string";var b=this._detectCurrencySymbolType(a);var c,d;if(b=="local"){c="local";d=a.replace(this.lc.getCurrencySymbol(),"")}else if(b=="int"){c="int";d=a.replace(this.lc.getIntCurrencySymbol(),"")}else if(b=="none"){c="local";d=a}else throw"Parse error: Internal assert failure";d=jsworld._stringReplaceAll(d,this.lc.mon_thousands_sep,"");d=d.replace(this.lc.mon_decimal_point,".");d=d.replace(/\s*/g,"");d=this._removeLocalNonNegativeSign(d,c);d=this._normaliseNegativeSign(d,c);if(jsworld._isNumber(d))return parseFloat(d,10);else throw"Parse error: Invalid currency amount string"};this._detectCurrencySymbolType=function(a){if(this.lc.getCurrencySymbol().length>this.lc.getIntCurrencySymbol().length){if(a.indexOf(this.lc.getCurrencySymbol())!=-1)return"local";else if(a.indexOf(this.lc.getIntCurrencySymbol())!=-1)return"int";else return"none"}else{if(a.indexOf(this.lc.getIntCurrencySymbol())!=-1)return"int";else if(a.indexOf(this.lc.getCurrencySymbol())!=-1)return"local";else return"none"}};this._removeLocalNonNegativeSign=function(a,b){a=a.replace(this.lc.positive_sign,"");if((b=="local"&&this.lc.p_sign_posn===0||b=="int"&&this.lc.int_p_sign_posn===0)&&/\(\d+\.?\d*\)/.test(a)){a=a.replace("(","");a=a.replace(")","")}return a};this._normaliseNegativeSign=function(a,b){a=a.replace(this.lc.negative_sign,"-");if(b=="local"&&this.lc.n_sign_posn===0||b=="int"&&this.lc.int_n_sign_posn===0){if(/^\(\d+\.?\d*\)$/.test(a)){a=a.replace("(","");a=a.replace(")","");return"-"+a}}if(b=="local"&&this.lc.n_sign_posn==2||b=="int"&&this.lc.int_n_sign_posn==2){if(/^\d+\.?\d*-$/.test(a)){a=a.replace("-","");return"-"+a}}if(b=="local"&&this.lc.n_cs_precedes===0&&this.lc.n_sign_posn==3||b=="local"&&this.lc.n_cs_precedes===0&&this.lc.n_sign_posn==4||b=="int"&&this.lc.int_n_cs_precedes===0&&this.lc.int_n_sign_posn==3||b=="int"&&this.lc.int_n_cs_precedes===0&&this.lc.int_n_sign_posn==4){if(/^\d+\.?\d*-$/.test(a)){a=a.replace("-","");return"-"+a}}return a}} + + +if(typeof POSIX_LC == "undefined") var POSIX_LC = {}; + +POSIX_LC.en_US = { + "decimal_point" : ".", + "thousands_sep" : ",", + "grouping" : "3", + "abday" : ["Sun","Mon","Tue","Wed","Thu","Fri","Sat"], + "day" : ["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"], + "abmon" : ["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"], + "mon" : ["January","February","March","April","May","June","July","August","September","October","November","December"], + "d_fmt" : "%m/%e/%y", + "t_fmt" : "%I:%M:%S %p", + "d_t_fmt" : "%B %e, %Y %I:%M:%S %p %Z", + "am_pm" : ["AM","PM"], + "int_curr_symbol" : "USD ", + "currency_symbol" : "\u0024", + "mon_decimal_point" : ".", + "mon_thousands_sep" : ",", + "mon_grouping" : "3", + "positive_sign" : "", + "negative_sign" : "-", + "int_frac_digits" : 2, + "frac_digits" : 2, + "p_cs_precedes" : 1, + "n_cs_precedes" : 1, + "p_sep_by_space" : 0, + "n_sep_by_space" : 0, + "p_sign_posn" : 1, + "n_sign_posn" : 1, + "int_p_cs_precedes" : 1, + "int_n_cs_precedes" : 1, + "int_p_sep_by_space" : 0, + "int_n_sep_by_space" : 0, + "int_p_sign_posn" : 1, + "int_n_sign_posn" : 1 +} + +if(typeof POSIX_LC == "undefined") var POSIX_LC = {}; + +POSIX_LC.fr_FR = { + "decimal_point" : ",", + "thousands_sep" : "\u00a0", + "grouping" : "3", + "abday" : ["dim.","lun.","mar.", + "mer.","jeu.","ven.", + "sam."], + "day" : ["dimanche","lundi","mardi", + "mercredi","jeudi","vendredi", + "samedi"], + "abmon" : ["janv.","f\u00e9vr.","mars", + "avr.","mai","juin", + "juil.","ao\u00fbt","sept.", + "oct.","nov.","d\u00e9c."], + "mon" : ["janvier","f\u00e9vrier","mars", + "avril","mai","juin", + "juillet","ao\u00fbt","septembre", + "octobre","novembre","d\u00e9cembre"], + "d_fmt" : "%d/%m/%y", + "t_fmt" : "%H:%M:%S", + "d_t_fmt" : "%e %B %Y %H:%M:%S %Z", + "am_pm" : ["AM","PM"], + "int_curr_symbol" : "EUR ", + "currency_symbol" : "\u20ac", + "mon_decimal_point" : ",", + "mon_thousands_sep" : "\u00a0", + "mon_grouping" : "3", + "positive_sign" : "", + "negative_sign" : "-", + "int_frac_digits" : 2, + "frac_digits" : 2, + "p_cs_precedes" : 0, + "n_cs_precedes" : 0, + "p_sep_by_space" : 1, + "n_sep_by_space" : 1, + "p_sign_posn" : 1, + "n_sign_posn" : 1, + "int_p_cs_precedes" : 0, + "int_n_cs_precedes" : 0, + "int_p_sep_by_space" : 1, + "int_n_sep_by_space" : 1, + "int_p_sign_posn" : 1, + "int_n_sign_posn" : 1 +}; + +/** https://github.com/csnover/js-iso8601 */(function(n,f){var u=n.parse,c=[1,4,5,6,7,10,11];n.parse=function(t){var i,o,a=0;if(o=/^(\d{4}|[+\-]\d{6})(?:-(\d{2})(?:-(\d{2}))?)?(?:T(\d{2}):(\d{2})(?::(\d{2})(?:\.(\d{3}))?)?(?:(Z)|([+\-])(\d{2})(?::(\d{2}))?)?)?$/.exec(t)){for(var v=0,r;r=c[v];++v)o[r]=+o[r]||0;o[2]=(+o[2]||1)-1,o[3]=+o[3]||1,o[8]!=="Z"&&o[9]!==f&&(a=o[10]*60+o[11],o[9]==="+"&&(a=0-a)),i=n.UTC(o[1],o[2],o[3],o[4],o[5]+a,o[6],o[7])}else i=u?u(t):NaN;return i}})(Date) + +/*! + * geo-location-javascript v0.4.3 + * http://code.google.com/p/geo-location-javascript/ + * + * Copyright (c) 2009 Stan Wiechers + * Licensed under the MIT licenses. + * + * Revision: $Rev: 68 $: + * Author: $Author: whoisstan $: + * Date: $Date: 2010-02-15 13:42:19 +0100 (Mon, 15 Feb 2010) $: + */ +var geo_position_js=function() { + + var pub = {}; + var provider=null; + + pub.getCurrentPosition = function(successCallback,errorCallback,options) + { + provider.getCurrentPosition(successCallback, errorCallback,options); + } + + pub.init = function() + { + try + { + if (typeof(geo_position_js_simulator)!="undefined") + { + provider=geo_position_js_simulator; + } + else if (typeof(bondi)!="undefined" && typeof(bondi.geolocation)!="undefined") + { + provider=bondi.geolocation; + } + else if (typeof(navigator.geolocation)!="undefined") + { + provider=navigator.geolocation; + pub.getCurrentPosition = function(successCallback, errorCallback, options) + { + function _successCallback(p) + { + //for mozilla geode,it returns the coordinates slightly differently + if(typeof(p.latitude)!="undefined") + { + successCallback({timestamp:p.timestamp, coords: {latitude:p.latitude,longitude:p.longitude}}); + } + else + { + successCallback(p); + } + } + provider.getCurrentPosition(_successCallback,errorCallback,options); + } + } + else if(typeof(window.google)!="undefined" && typeof(google.gears)!="undefined") + { + provider=google.gears.factory.create('beta.geolocation'); + } + else if ( typeof(Mojo) !="undefined" && typeof(Mojo.Service.Request)!="Mojo.Service.Request") + { + provider=true; + pub.getCurrentPosition = function(successCallback, errorCallback, options) + { + + parameters={}; + if(options) + { + //http://developer.palm.com/index.php?option=com_content&view=article&id=1673#GPS-getCurrentPosition + if (options.enableHighAccuracy && options.enableHighAccuracy==true) + { + parameters.accuracy=1; + } + if (options.maximumAge) + { + parameters.maximumAge=options.maximumAge; + } + if (options.responseTime) + { + if(options.responseTime<5) + { + parameters.responseTime=1; + } + else if (options.responseTime<20) + { + parameters.responseTime=2; + } + else + { + parameters.timeout=3; + } + } + } + + + r=new Mojo.Service.Request('palm://com.palm.location', { + method:"getCurrentPosition", + parameters:parameters, + onSuccess: function(p){successCallback({timestamp:p.timestamp, coords: {latitude:p.latitude, longitude:p.longitude,heading:p.heading}});}, + onFailure: function(e){ + if (e.errorCode==1) + { + errorCallback({code:3,message:"Timeout"}); + } + else if (e.errorCode==2) + { + errorCallback({code:2,message:"Position Unavailable"}); + } + else + { + errorCallback({code:0,message:"Unknown Error: webOS-code"+errorCode}); + } + } + }); + } + + } + else if (typeof(device)!="undefined" && typeof(device.getServiceObject)!="undefined") + { + provider=device.getServiceObject("Service.Location", "ILocation"); + + //override default method implementation + pub.getCurrentPosition = function(successCallback, errorCallback, options) + { + function callback(transId, eventCode, result) { + if (eventCode == 4) + { + errorCallback({message:"Position unavailable", code:2}); + } + else + { + //no timestamp of location given? + successCallback({timestamp:null, coords: {latitude:result.ReturnValue.Latitude, longitude:result.ReturnValue.Longitude, altitude:result.ReturnValue.Altitude,heading:result.ReturnValue.Heading}}); + } + } + //location criteria + var criteria = new Object(); + criteria.LocationInformationClass = "BasicLocationInformation"; + //make the call + provider.ILocation.GetLocation(criteria,callback); + } + } + } + catch (e){ + alert("error="+e); + if(typeof(console)!="undefined") + { + console.log(e); + } + return false; + } + return provider!=null; + } + + + return pub; +}(); +// Couldn't get unminified version to work , go here for docs => https://github.com/iamnoah/writeCapture +(function(E,a){var j=a.document;function A(Q){var Z=j.createElement("div");j.body.insertBefore(Z,null);E.replaceWith(Z,'\n
\n
\n
\n \n\n
\n
\n \n
\n

'); + __out.push(__sanitize(t('Invite Link'))); + __out.push(' '); + __out.push(__sanitize(USER.referral_url)); + __out.push('

\n\n \n\n
\n\n'); + }).call(this); + + }).call(__obj); + __obj.safe = __objSafe, __obj.escape = __escape; + return __out.join(''); +}}, "templates/clients/login": function(exports, require, module) {module.exports = function(__obj) { + if (!__obj) __obj = {}; + var __out = [], __capture = function(callback) { + var out = __out, result; + __out = []; + callback.call(this); + result = __out.join(''); + __out = out; + return __safe(result); + }, __sanitize = function(value) { + if (value && value.ecoSafe) { + return value; + } else if (typeof value !== 'undefined' && value != null) { + return __escape(value); + } else { + return ''; + } + }, __safe, __objSafe = __obj.safe, __escape = __obj.escape; + __safe = __obj.safe = function(value) { + if (value && value.ecoSafe) { + return value; + } else { + if (!(typeof value !== 'undefined' && value != null)) value = ''; + var result = new String(value); + result.ecoSafe = true; + return result; + } + }; + if (!__escape) { + __escape = __obj.escape = function(value) { + return ('' + value) + .replace(/&/g, '&') + .replace(//g, '>') + .replace(/"/g, '"'); + }; + } + (function() { + (function() { + __out.push('
\n\t

'); + __out.push(__sanitize(t('Sign In'))); + __out.push('

\n\t
\n\t\t
\n\n\t\t\t
\n\t\t\t\t\n\t\t\t
\n\t\t\t
\n\t\t\t\t\n\t\t\t
\n\n\t\t\t
\n\n\t\t\t
\n\t\t\t\t\n\t\t\t
\n\t\t\t
\n\t\t\t\t\n\t\t\t
\n\n\t\t\t
\n\n
\n\n

'); + __out.push(__sanitize(t('Forgot Password?'))); + __out.push('

\n\n\t\t
\n\t
\n
\n\n
\n
\n'); + }).call(this); + + }).call(__obj); + __obj.safe = __objSafe, __obj.escape = __escape; + return __out.join(''); +}}, "templates/clients/modules/credit_card": function(exports, require, module) {module.exports = function(__obj) { + if (!__obj) __obj = {}; + var __out = [], __capture = function(callback) { + var out = __out, result; + __out = []; + callback.call(this); + result = __out.join(''); + __out = out; + return __safe(result); + }, __sanitize = function(value) { + if (value && value.ecoSafe) { + return value; + } else if (typeof value !== 'undefined' && value != null) { + return __escape(value); + } else { + return ''; + } + }, __safe, __objSafe = __obj.safe, __escape = __obj.escape; + __safe = __obj.safe = function(value) { + if (value && value.ecoSafe) { + return value; + } else { + if (!(typeof value !== 'undefined' && value != null)) value = ''; + var result = new String(value); + result.ecoSafe = true; + return result; + } + }; + if (!__escape) { + __escape = __obj.escape = function(value) { + return ('' + value) + .replace(/&/g, '&') + .replace(//g, '>') + .replace(/"/g, '"'); + }; + } + (function() { + (function() { + var printCard; + var __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }; + if (this.cards === "new") { + __out.push('\n
\n
\n
\n
\n
\n
\n \n \n
\n
\n
\n
\n \n \n
\n
\n \n \n
\n
\n
\n
\n \n \n
\n
\n
\n \n \n
\n
\n
\n \n \n
\n
\n
\n \n
\n
\n
\n'); + } else { + __out.push('\n '); + printCard = __bind(function(card, index) { + var exp, style; + __out.push('\n
\n '); + style = "background-position:-173px"; + __out.push('\n '); + if (card.get("card_type") === "Visa") { + style = "background-position:0px"; + } + __out.push('\n '); + if (card.get("card_type") === "MasterCard") { + style = "background-position:-42px"; + } + __out.push('\n '); + if (card.get("card_type") === "American Express") { + style = "background-position:-130px"; + } + __out.push('\n '); + if (card.get("card_type") === "Discover Card") { + style = "background-position:-85px"; + } + __out.push('\n
\n 		\n ****'); + __out.push(__sanitize(card.get("card_number"))); + __out.push('\n \n '); + if (card.get("card_expiration")) { + __out.push('\n '); + __out.push(__sanitize(t('Expiry'))); + __out.push('\n '); + exp = card.get('card_expiration').split('-'); + __out.push('\n '); + __out.push(__sanitize("" + exp[0] + "-" + exp[1])); + __out.push('\n '); + } + __out.push('\n \n \n \n '); + if (card.get("default")) { + __out.push('\n ('); + __out.push(__sanitize(t('default card'))); + __out.push(')\n '); + } + __out.push('\n '); + if (this.cards.length > 1 && !card.get("default")) { + __out.push('\n '); + __out.push(__sanitize(t('make default'))); + __out.push('\n '); + } + __out.push('\n \n '); + __out.push(__sanitize(t('Edit'))); + __out.push('\n \n '); + if (this.cards.length > 1) { + __out.push('\n '); + __out.push(__sanitize(t('Delete'))); + __out.push('\n '); + } + __out.push('\n
\n '); + _.each(this.cards.models, printCard); + __out.push('\n
\n
\n\n'); + } + __out.push('\n'); + }).call(this); + + }).call(__obj); + __obj.safe = __objSafe, __obj.escape = __escape; + return __out.join(''); +}}, "templates/clients/modules/sub_header": function(exports, require, module) {module.exports = function(__obj) { + if (!__obj) __obj = {}; + var __out = [], __capture = function(callback) { + var out = __out, result; + __out = []; + callback.call(this); + result = __out.join(''); + __out = out; + return __safe(result); + }, __sanitize = function(value) { + if (value && value.ecoSafe) { + return value; + } else if (typeof value !== 'undefined' && value != null) { + return __escape(value); + } else { + return ''; + } + }, __safe, __objSafe = __obj.safe, __escape = __obj.escape; + __safe = __obj.safe = function(value) { + if (value && value.ecoSafe) { + return value; + } else { + if (!(typeof value !== 'undefined' && value != null)) value = ''; + var result = new String(value); + result.ecoSafe = true; + return result; + } + }; + if (!__escape) { + __escape = __obj.escape = function(value) { + return ('' + value) + .replace(/&/g, '&') + .replace(//g, '>') + .replace(/"/g, '"'); + }; + } + (function() { + (function() { + __out.push('
\n
'); + __out.push(__sanitize(this.heading)); + __out.push('
\n
\n '); + if (window.USER.first_name) { + __out.push('\n '); + __out.push(__sanitize(t('Hello Greeting', { + name: USER.first_name + }))); + __out.push('\n '); + } + __out.push('\n
\n
\n
\n'); + }).call(this); + + }).call(__obj); + __obj.safe = __objSafe, __obj.escape = __escape; + return __out.join(''); +}}, "templates/clients/promotions": function(exports, require, module) {module.exports = function(__obj) { + if (!__obj) __obj = {}; + var __out = [], __capture = function(callback) { + var out = __out, result; + __out = []; + callback.call(this); + result = __out.join(''); + __out = out; + return __safe(result); + }, __sanitize = function(value) { + if (value && value.ecoSafe) { + return value; + } else if (typeof value !== 'undefined' && value != null) { + return __escape(value); + } else { + return ''; + } + }, __safe, __objSafe = __obj.safe, __escape = __obj.escape; + __safe = __obj.safe = function(value) { + if (value && value.ecoSafe) { + return value; + } else { + if (!(typeof value !== 'undefined' && value != null)) value = ''; + var result = new String(value); + result.ecoSafe = true; + return result; + } + }; + if (!__escape) { + __escape = __obj.escape = function(value) { + return ('' + value) + .replace(/&/g, '&') + .replace(//g, '>') + .replace(/"/g, '"'); + }; + } + (function() { + (function() { + var promo, _i, _len, _ref; + __out.push(require('templates/clients/modules/sub_header').call(this, { + heading: t("Promotions") + })); + __out.push('\n\n
\n
\n
\n \n \n
\n
\n \n \n\n \n
\n '); + if (this.promos.length > 0) { + __out.push('\n
\n

'); + __out.push(__sanitize(t('Your Available Promotions'))); + __out.push('

\n \n \n\n \n \n \n \n \n \n \n \n '); + _ref = this.promos; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + promo = _ref[_i]; + __out.push('\n \n \n \n \n \n \n '); + } + __out.push('\n \n
'); + __out.push(__sanitize(t('Code'))); + __out.push(''); + __out.push(__sanitize(t('Details'))); + __out.push(''); + __out.push(__sanitize(t('Starts'))); + __out.push(''); + __out.push(__sanitize(t('Expires'))); + __out.push('
'); + __out.push(__sanitize(promo.code)); + __out.push(''); + __out.push(__sanitize(promo.description)); + __out.push(''); + __out.push(__sanitize(app.helpers.formatDate(promo.starts_at, true, "America/Los_Angeles"))); + __out.push(''); + __out.push(__sanitize(app.helpers.formatDate(promo.ends_at, true, "America/Los_Angeles"))); + __out.push('
\n
\n '); + } else { + __out.push('\n\n

'); + __out.push(__sanitize(t('No Active Promotions'))); + __out.push('

\n '); + } + __out.push('\n\n
\n
\n
\n'); + }).call(this); + + }).call(__obj); + __obj.safe = __objSafe, __obj.escape = __escape; + return __out.join(''); +}}, "templates/clients/request": function(exports, require, module) {module.exports = function(__obj) { + if (!__obj) __obj = {}; + var __out = [], __capture = function(callback) { + var out = __out, result; + __out = []; + callback.call(this); + result = __out.join(''); + __out = out; + return __safe(result); + }, __sanitize = function(value) { + if (value && value.ecoSafe) { + return value; + } else if (typeof value !== 'undefined' && value != null) { + return __escape(value); + } else { + return ''; + } + }, __safe, __objSafe = __obj.safe, __escape = __obj.escape; + __safe = __obj.safe = function(value) { + if (value && value.ecoSafe) { + return value; + } else { + if (!(typeof value !== 'undefined' && value != null)) value = ''; + var result = new String(value); + result.ecoSafe = true; + return result; + } + }; + if (!__escape) { + __escape = __obj.escape = function(value) { + return ('' + value) + .replace(/&/g, '&') + .replace(//g, '>') + .replace(/"/g, '"'); + }; + } + (function() { + (function() { + var showFavoriteLocation; + showFavoriteLocation = function(location, index) { + var alphabet; + __out.push('\n '); + alphabet = "ABCDEFGHIJKLMNOPQRSTUVWXYZ"; + __out.push('\n
\n '); + __out.push(__sanitize(location.nickname)); + return __out.push('\n
\n \n \n \n \n \n \n \n \n \n \n \n \n \n
\n

'); + __out.push(__sanitize(t('Driver Name:'))); + __out.push('

\n

\n
\n

'); + __out.push(__sanitize(t('Driver #:'))); + __out.push('

\n

\n
\n

'); + __out.push(__sanitize(t('Pickup Address:'))); + __out.push('

\n

\n 		\n '); + __out.push(__sanitize(t('Add to Favorite Locations'))); + __out.push('\n
\n
\n

\n '); + __out.push(__sanitize(t('Nickname:'))); + __out.push('\n \n \n \n \n
\n
\n
\n
\n

'); + __out.push(__sanitize(t('Your last trip'))); + __out.push('

\n
\n \n '); + __out.push(__sanitize(t('Star'))); + __out.push('\n '); + __out.push(__sanitize(t('Star'))); + __out.push('\n '); + __out.push(__sanitize(t('Star'))); + __out.push('\n '); + __out.push(__sanitize(t('Star'))); + __out.push('\n '); + __out.push(__sanitize(t('Star'))); + __out.push('\n \n \n
\n \n
\n \n
\n \n
\n \n\n
\n'); + }).call(this); + + }).call(__obj); + __obj.safe = __objSafe, __obj.escape = __escape; + return __out.join(''); +}}, "templates/shared/menu": function(exports, require, module) {module.exports = function(__obj) { + if (!__obj) __obj = {}; + var __out = [], __capture = function(callback) { + var out = __out, result; + __out = []; + callback.call(this); + result = __out.join(''); + __out = out; + return __safe(result); + }, __sanitize = function(value) { + if (value && value.ecoSafe) { + return value; + } else if (typeof value !== 'undefined' && value != null) { + return __escape(value); + } else { + return ''; + } + }, __safe, __objSafe = __obj.safe, __escape = __obj.escape; + __safe = __obj.safe = function(value) { + if (value && value.ecoSafe) { + return value; + } else { + if (!(typeof value !== 'undefined' && value != null)) value = ''; + var result = new String(value); + result.ecoSafe = true; + return result; + } + }; + if (!__escape) { + __escape = __obj.escape = function(value) { + return ('' + value) + .replace(/&/g, '&') + .replace(//g, '>') + .replace(/"/g, '"'); + }; + } + (function() { + (function() { + __out.push('\n'); + }).call(this); + + }).call(__obj); + __obj.safe = __objSafe, __obj.escape = __escape; + return __out.join(''); +}}, "translations/en": function(exports, require, module) {(function() { + exports.translations = { + "Uber": "Uber", + "Sign Up": "Sign Up", + "Ride Request": "Ride Request", + "Invite Friends": "Invite Friends", + "Promotions": "Promotions", + "Billing": "Billing", + "Settings": "Settings", + "Forgot Password?": "Forgot Password?", + "Password Recovery": "Password Recovery", + "Login": "Login", + "Trip Detail": "Trip Detail", + "Password Reset": "Password Reset", + "Confirm Email": "Confirm Email", + "Request Ride": "Request Ride", + "Credit Card Number": "Credit Card Number", + "month": "month", + "01-Jan": "01-Jan", + "02-Feb": "02-Feb", + "03-Mar": "03-Mar", + "04-Apr": "04-Apr", + "05-May": "05-May", + "06-Jun": "06-Jun", + "07-Jul": "07-Jul", + "08-Aug": "08-Aug", + "09-Sep": "09-Sep", + "10-Oct": "10-Oct", + "11-Nov": "11-Nov", + "12-Dec": "12-Dec", + "year": "year", + "CVV": "CVV", + "Category": "Category", + "personal": "personal", + "business": "business", + "Default Credit Card": "Default Credit Card", + "Add Credit Card": "Add Credit Card", + "Expiry": "Expiry", + "default card": "default card", + "make default": "make default", + "Edit": "Edit", + "Delete": "Delete", + "Expiry Month": "Expiry Month", + "Expiry Year": "Expiry Year", + "Unable to Verify Card": "Unable to verify card at this time. Please try again later.", + "Credit Card Update Succeeded": "Your card has been successfully updated!", + "Credit Card Update Failed": "We couldn't save your changes. Please try again in a few minutes.", + "Credit Card Delete Succeeded": "Your card has been deleted!", + "Credit Card Delete Failed": "We were unable to delete your card. Please try again later.", + "Credit Card Update Category Succeeded": "Successfully changed card category!", + "Credit Card Update Category Failed": "We couldn't change your card category. Please try again in a few minutes.", + "Credit Card Update Default Succeeded": "Successfully changed default card!", + "Credit Card Update Default Failed": "We couldn't change your default card. Please try again in a few minutes.", + "Hello Greeting": "Hello, <%= name %>", + "Card Ending in": "Card Ending in", + "Trip Map": "Trip Map", + "Amount": "Amount: <%= amount %>", + "Last Attempt to Bill": "Last Attempt to Bill: <%= date %>", + "Charge": "Charge", + "Uber Credit Balance Note": "Your account has an UberCredit balance of <%= amount %>. When billing for trips, we'll deplete your UberCredit balance before applying charges to your credit card.", + "Please Add Credit Card": "Please add a credit card to bill your outstanding charges.", + "Credit Cards": "Credit Cards", + "add a new credit card": "add a new credit card", + "Account Balance": "Account Balance", + "Arrears": "Arrears", + "Billing Succeeded": "Your card was successfully billed.", + "Confirm Email Succeeded": "Successfully confirmed email token, redirecting to log in page...", + "Confirm Email Failed": "Unable to confirm email. Please contact support@uber.com if this problem persists.", + "Email Already Confirmed": "Your email address has already been confirmed, redirecting to log in page...", + "Credit Card Added": "Credit Card Added", + "No Credit Card": "No Credit Card", + "Mobile Number Confirmed": "Mobile Number Confirmed", + "No Confirmed Mobile": "No Confirmed Mobile", + "E-mail Address Confirmed": "E-mail Address Confirmed", + "No Confirmed E-mail": "No Confirmed E-mail", + 'Reply to sign up text': 'Reply "GO" to the text message you received at sign up.', + "Resend text message": "Resend text message", + "Click sign up link": "Click the link in the email you received at sign up.", + "Resend email": "Resend email", + "Add a credit card to ride": "Add a credit card and you'll be ready to ride Uber.", + "Your Most Recent Trip": "Your Most Recent Trip", + "details": "details", + "Your Trip History ": "Your Trip History ", + "Status": "Status", + "Here's how it works:": "Here's how it works:", + "Show all trips": "Show all trips", + "Set your location:": "Set your location:", + "App search for address": "iPhone/Android app: fix the pin or search for an address", + "SMS text address": "SMS: text your address to UBRCAB (827222)", + "Confirm pickup request": "Confirm your pickup request", + "Uber sends ETA": "Uber will send you an ETA (usually within 5-10 minutes)", + "Car arrives": "When your car is arriving, Uber will inform you again.", + "Ride to destination": "Hop in the car and tell the driver your destination.", + "Thank your driver": "That’s it! Please thank your driver but remember that your tip is included and no cash is necessary.", + "Trip started here": "Trip started here", + "Trip ended here": "Trip ended here", + "Sending Email": "Sending email...", + "Resend Email Succeeded": "We just sent the email. Please click on the confirmation link you recieve.", + "Resend Email Failed": "There was an error sending the email. Please contact support if the problem persists.", + "Resend Text Succeeded": 'We just sent the text message. Please reply "GO" to the message you recieve. It may take a few minutes for the message to reach you phone.', + "Resend Text Failed": "There was an error sending the text message. Please contact support if the problem persists.", + "Password Reset Error": "There was an error processing your password reset request.", + "New Password": "New Password", + "Forgot Password": "Forgot Password", + "Forgot Password Error": "Your email address could not be found. Please make sure to use the same email address you used when you signed up.", + "Forgot Password Success": "Please check your email for a link to reset your password.", + "Forgot Password Enter Email": 'Enter your email address and Uber will send you a link to reset your password. If you remember your password, you can sign in here.', + "Invite friends": "Invite friends", + "Give $ Get $": "Give $10, Get $10", + "Give $ Get $ Description": "Every friend you invite to Uber gets $10 of Uber credit. After someone you’ve invited takes his/her first ride, you get $10 of Uber credits too!", + "What are you waiting for?": "So, what are you waiting for? Invite away!", + "Tweet": "Tweet", + "Invite Link": "Email or IM this link to your friends:", + "Email Address": "Email Address", + "Reset Password": "Reset Password", + "Enter Promotion Code": "If you have a promotion code, enter it here:", + "Your Active Promotions": "Your Active Promotions", + "Code": "Code", + "Details": "Details", + "Trips Remaining": "Trips Remaining", + "Expires": "Expires", + "No Active Promotions": "There are no active promotions on your account.", + "Your Available Promotions": "Your Available Promotions", + "Where do you want us to pick you up?": "Where do you want us to pick you up?", + "Address to search": "Address to search", + "Search": "Search", + "Driver Name:": "Driver Name:", + "Driver #:": "Driver #:", + "Pickup Address:": "Pickup Address:", + "Add to Favorite Locations": "Add to Favorite Locations", + "Star": "Star", + "Nickname:": "Nickname:", + "Add": "Add", + "Your last trip": "Your last trip", + "Please rate your driver:": "Please rate your driver:", + "Comments: (optional)": "Comments: (optional)", + "Rate Trip": "Rate Trip", + "Pickup time:": "Pickup time:", + "Miles:": "Miles:", + "Trip time:": "Trip time:", + "Fare:": "Fare:", + "Favorite Locations": "Favorite Locations", + "Search Results": "Search Results", + "You have no favorite locations saved.": "You have no favorite locations saved.", + "Loading...": "Loading...", + "Request Pickup": "Request Pickup", + "Cancel Pickup": "Cancel Pickup", + "Requesting Closest Driver": "Requesting the closest driver to pick you up...", + "En Route": "You are currently en route...", + "Rate Last Trip": "Please rate your trip to make another request", + "Rate Before Submitting": "Please rate your trip before submitting the form", + "Address too short": "Address too short", + "or did you mean": "or did you mean", + "Search Address Failed": "Unable to find the given address. Please enter another address close to your location.", + "Sending pickup request...": "Sending pickup request...", + "Cancel Request Prompt": "Are you sure you want to cancel your request?", + "Cancel Request Arrived Prompt": 'Are you sure you want to cancel your request? Your driver has arrived so there is a $10 cancellation fee. It may help to call your driver now', + "Favorite Location Nickname Length Error": "Nickname has to be atleast 3 characters", + "Favorite Location Save Succeeded": "Location Saved!", + "Favorite Location Save Failed": "Unable to save your location. Please try again later.", + "Favorite Location Title": "Favorite Location <%= id %>", + "Search Location Title": "Search Location <%= id %>", + "ETA Message": "ETA: Around <%= minutes %> Minutes", + "Nearest Cab Message": "The closest driver is approximately <%= minutes %> minute(s) away", + "Arrival ETA Message": "Your Uber will arrive in about <%= minutes %> minute(s)", + "Arriving Now Message": "Your Uber is arriving now...", + "Rating Driver Failed": "Unable to contact server. Please try again later or email support if this issue persists.", + "Account Information": "Account Information", + "Mobile Phone Information": "Mobile Phone Information", + "settings": "settings", + "Information": "Information", + "Picture": "Picture", + "Change password": "Change password", + "Your current Picture": "Your current Picture", + "Your Favorite Locations": "Your Favorite Locations", + "You have no favorite locations saved.": "You have no favorite locations saved.", + "Purpose of Mobile": "We send text messages to your mobile phone to tell you when your driver is arriving. You can also request trips using text messages.", + "Country": "Country", + "Mobile Number": "Mobile Number", + "Submit": "Submit", + "Favorite Location": "Favorite Location", + "No Approximate Address": "Could not find an approximate address", + "Address:": "Address:", + "Information Update Succeeded": "Your information has been updated!", + "Information Update Failed": "We couldn't update your information. Please try again in few minutes or contact support if the problem persists.", + "Location Delete Succeeded": "Location deleted!", + "Location Delete Failed": "We were unable to delete your favorite location. Please try again later or contact support of the issue persists.", + "Location Edit Succeeded": "Changes Saved!", + "Location Edit Failed": "We couldn't save your changes. Please try again in a few minutes.", + "Picture Update Succeeded": "Your picture has been updated!", + "Picture Update Failed": "We couldn't change your picture. Please try again in a few minutes.", + "Personal Information": "Personal Information", + "Mobile Phone Number": "Mobile Phone Number", + "Payment Information": "Payment Information", + "Purpose of Credit Card": "We keep your credit card on file so that your trip go as fast as possible. You will not be charged until you take a trip.", + "Your card will not be charged until you take a trip.": "Your card will not be charged until you take a trip.", + "Credit Card Number": "Credit Card Number", + "Expiration Date": "Expiration Date", + "Promotion Code": "Promotion Code", + "Enter Promo Here": "If you have a code for a promotion, invitation or group deal, you can enter it here.", + "Promotion Code Input Label": "Promotion, Invite or Groupon Code (optional)", + "Terms and Conditions": "Terms and Conditions", + "HELP": "HELP", + "STOP": "STOP", + "Legal Information": "Legal Information", + "Sign Up Agreement": "By signing up, I agree to the Uber <%= terms_link %> and <%= privacy_link %> and understand that Uber is a request tool, not a transportation carrier.", + "Sign Up Agreement Error": "You must agree to the Uber Terms and Conditions and Privacy Policy to continue.", + "Message and Data Rates Disclosure": "Message and Data Rates May Apply. Reply <%= help_string %> to 827-222 for help. Reply <%= stop_string %> to 827-222 to stop texts. For additional assistance, visit support.uber.com or call (866) 576-1039. Supported Carriers: AT&T, Sprint, Verizon, and T-Mobile.", + "I Agree": "I agree to the Terms & Conditions and Privacy Policy", + "Security Code": "Security Code", + "Type of Card": "Type of Card", + "Personal": "Personal", + "Business": "Business", + "Code": "Code", + "Zip or Postal Code": "Zip or Postal Code", + "Your Trip": "Your Trip", + "Trip Info": "Trip Info", + "Request a fare review": "Request a fare review", + "Fare Review Submitted": "Your fare review has been submitted. We'll get back to you soon about your request. Sorry for any inconvenience this may have caused!", + "Fair Price Consideration": "We're committed to delivering Uber service at a fair price. Before requesting a fare review, please consider:", + "Your Fare Calculation": "Your Fare Calculation", + "Charges": "Charges", + "Discounts": "Discounts", + "Total Charge": "Total Charge", + "Uber pricing information": "Uber pricing information", + "Uber Pricing Information Message": "<%= learn_link %> is published on our website.", + "GPS Point Capture Disclosure": "Due to a finite number of GPS point captures, corners on your trip map may appear cut off or rounded. These minor inaccuracies result in a shorter measured distance, which always results in a cheaper trip.", + "Fare Review Note": "Please elaborate on why this trip requires a fare review. Your comments below will help us better establish the correct price for your trip:", + "Fare Review Error": "There was an error submitting the review. Please ensure that you have a message.", + "Sign In": "Sign In" + }; +}).call(this); +}, "translations/fr": function(exports, require, module) {(function() { + exports.translations = { + "Uber": "Uber", + "Sign Up": "Inscription", + "Ride Request": "Passer une Commande", + "Invite Friends": "Inviter vos Amis", + "Promotions": "Promotions", + "Billing": "Paiement", + "Settings": "Paramètres", + "Forgot Password?": "Mot de passe oublié ?", + "Password Recovery": "Récupération du mot de passe", + "Login": "Connexion", + "Trip Detail": "Détail de la Course", + "Password Reset": "Réinitialisation du mot de passe", + "Confirm Email": "Confirmation de l’e-mail", + "Request Ride": "Passer une Commande", + "Credit Card Number": "Numéro de Carte de Crédit", + "month": "mois", + "01-Jan": "01-Jan", + "02-Feb": "02-Fév", + "03-Mar": "03-Mar", + "04-Apr": "04-Avr", + "05-May": "05-Mai", + "06-Jun": "06-Juin", + "07-Jul": "07-Jui", + "08-Aug": "08-Aoû", + "09-Sep": "09-Sep", + "10-Oct": "10-Oct", + "11-Nov": "11-Nov", + "12-Dec": "12-Déc", + "year": "année", + "CVV": "Code de Sécurité", + "Category": "Type", + "personal": "personnel", + "business": "entreprise", + "Default Credit Card": "Carte par Défaut", + "Add Credit Card": "Ajouter une Carte", + "Expiry": "Expire", + "default card": "carte par défaut", + "make default": "choisir par défaut", + "Edit": "Modifier", + "Delete": "Supprimer", + "Expiry Month": "Mois d’Expiration", + "Expiry Year": "Année d’Expiration", + "Unable to Verify Card": "Impossible de vérifier la carte pour le moment. Merci de réessayer un peu plus tard.", + "Credit Card Update Succeeded": "Votre carte a été mise à jour avec succès !", + "Credit Card Update Failed": "Nous ne pouvons enregistrer vos changements. Merci de réessayer dans quelques minutes.", + "Credit Card Delete Succeeded": "Votre carte a été supprimée !", + "Credit Card Delete Failed": "Nous n’avons pas été en mesure de supprimer votre carte. Merci de réessayer plus tard.", + "Credit Card Update Category Succeeded": "Changement de catégorie de carte réussi !", + "Credit Card Update Category Failed": "Nous ne pouvons pas changer la catégorie de votre carte. Merci de réessayer dans quelques minutes.", + "Credit Card Update Default Succeeded": "Carte par défaut changée avec succès !", + "Credit Card Update Default Failed": "Nous ne pouvons pas changer votre carte par défaut. Merci de réessayer dans quelques minutes.", + "Hello Greeting": "Bonjour, <%= name %>", + "Card Ending in": "La carte expire dans", + "Trip Map": "Carte des Courses", + "Amount": "Montant: <%= amount %>", + "Last Attempt to Bill": "Dernière tentative de prélèvement : <%= date %>", + "Charge": "Débit", + "Uber Credit Balance Note": "Votre compte a un solde de <%= amount %> UberCredits. Lorsque nous facturons des courses, nous réduirons votre solde d’UberCredits avant de prélever votre carte de crédit.", + "Please Add Credit Card": "Merci d’ajouter une carte de crédit pour que nous puissions vous facturer.", + "Credit Cards": "Cartes de crédit", + "add a new credit card": "Ajouter une nouvelle carte de crédit", + "Account Balance": "Solde du compte", + "Arrears": "Arriérés", + "Billing Succeeded": "Votre carte a été correctement débitée.", + "Confirm Email Succeeded": "L’adresse e-mail a bien été validée, vous êtes redirigé vers le tableau de bord...", + "Confirm Email Failed": "Impossible de confirmer l’adresse e-mail. Merci de contacter support@uber.com si le problème persiste.", + "Credit Card Added": "Carte de crédit ajoutée", + "No Credit Card": "Pas de carte de crédit", + "Mobile Number Confirmed": "Numéro de téléphone confirmé", + "No Confirmed Mobile": "Pas de numéro de téléphone confirmé", + "E-mail Address Confirmed": "Adresse e-mail confirmée", + "No Confirmed E-mail": "Pas d’adresse e-mail confirmée", + 'Reply to sign up text': 'Répondre "GO" au SMS que vous avez reçu à l’inscription.', + "Resend text message": "Renvoyer le SMS", + "Click sign up link": "Cliquez sur le lien contenu dans l’e-mail reçu à l’inscription.", + "Resend email": "Renvoyer l’e-mail", + "Add a credit card to ride": "Ajouter une carte de crédit et vous serez prêt à voyager avec Uber.", + "Your Most Recent Trip": "Votre course la plus récente", + "details": "détails", + "Your Trip History": "Historique de votre trajet", + "Status": "Statut", + "Here's how it works:": "Voici comment ça marche :", + "Show all trips": "Montrer toutes les courses", + "Set your location:": "Définir votre position :", + "App search for address": "Application iPhone/Android : positionner la punaise ou rechercher une adresse", + "SMS text address": "SMS : envoyez votre adresse à UBRCAB (827222)", + "Confirm pickup request": "Validez la commande", + "Uber sends ETA": "Uber envoie un temps d’attente estimé (habituellement entre 5 et 10 minutes)", + "Car arrives": "Lorsque votre voiture arrive, Uber vous en informera encore..", + "Ride to destination": "Montez dans la voiture et donnez votre destination au chauffeur.", + "Thank your driver": "C’est tout ! Remerciez le chauffeur mais souvenez-vous que les pourboires sont compris et qu’il n’est pas nécessaire d’avoir du liquide sur soi.", + "Trip started here": "La course a commencé ici.", + "Trip ended here": "La course s’est terminée ici.", + "Sending Email": "Envoi de l’e-mail...", + "Resend Email Succeeded": "Nous venons d’envoyer l’e-mail. Merci de cliquer sur le lien de confirmation que vous avez reçu.", + "Resend Email Failed": "Il y a eu un problème lors de l’envoi de l’email. Merci de contacter le support si le problème persiste.", + "Resend Text Succeeded": 'Nous venons d’envoyer le SMS. Merci de répondre "GO" au message que vous avez reçu. Il se peut que cela prenne quelques minutes pour que le message arrive sur votre téléphone.', + "Resend Text Failed": "Il y a eu un problème lors de l’envoi du SMS. Merci de contacter le support si le problème persiste.", + "Password Reset Error": "Il y a eu une error lors de la réinitialisation de votre mot de passe.", + "New Password:": "Nouveau mot de passe:", + "Forgot Password Error": "Votre nom d’utilisateur / adresse email ne peut être trouvé. Merci d’utiliser la même qu’à l’inscription.", + "Forgot Password Success": "Merci de consulter votre boîte mail pour suivre la demande de ‘réinitialisation de mot de passe.", + "Forgot Password Enter Email": "Merci de saisir votre adresse email et nous vous enverrons un lien vous permettant de réinitialiser votre mot de passe :", + "Invite friends": "Inviter vos amis", + "Give $ Get $": "Donnez $10, Recevez $10", + "Give $ Get $ Description": "Chaque ami que vous invitez à Uber recevra $10 de crédits Uber. Dès lors qu’une personne que vous aurez invité aura utilisé Uber pour la première, vous recevrez $10 de crédits Uber également !", + "What are you waiting for?": "N’attendez plus ! Lancez les invitations !", + "Tweet": "Tweeter", + "Invite Link": "Envoyez ce lien par email ou messagerie instantanée à vos amis :", + "Enter Promotion Code": "Si vous avez un code promo, saisissez-le ici:", + "Your Active Promotions": "Vos Codes Promos Actifs", + "Code": "Code", + "Details": "Détails", + "Trips Remaining": "Courses restantes", + "Expires": "Expire", + "No Active Promotions": "Vous n’avez pas de code promo actif.", + "Your Available Promotions": "Votres Promos Disponibles", + "Where do you want us to pick you up?": "Où souhaitez-vous que nous vous prenions en charge ?", + "Address to search": "Adresse à rechercher", + "Search": "Chercher", + "Driver Name:": "Nom du chauffeur:", + "Driver #:": "# Chauffeur:", + "Pickup Address:": "Lieu de prise en charge:", + "Add to Favorite Locations": "Ajoutez aux Lieux Favoris", + "Star": "Étoiles", + "Nickname:": "Pseudo", + "Add": "Ajouter", + "Your last trip": "Votre dernière course", + "Please rate your driver:": "Merci de noter votre chauffeur :", + "Comments: (optional)": "Commentaires: (optionnel)", + "Rate Trip": "Notez votre course", + "Pickup time:": "Heure de Prise en Charge :", + "Miles:": "Kilomètres :", + "Trip time:": "Temps de course :", + "Fare:": "Tarif :", + "Favorite Locations": "Lieux Favoris", + "Search Results": "Résultats", + "You have no favorite locations saved.": "Vous n’avez pas de lieux de prise en charge favoris.", + "Loading...": "Chargement...", + "Request Pickup": "Commander ici", + "Cancel Pickup": "Annuler", + "Requesting Closest Driver": "Nous demandons au chauffeur le plus proche de vous prendre en charge...", + "En Route": "Vous êtes actuellement en route...", + "Rate Last Trip": "Merci de noter votre précédent trajet pour faire une autre course.", + "Rate Before Submitting": "Merci de noter votre trajet avant de le valider.", + "Address too short": "L’adresse est trop courte", + "or did you mean": "ou vouliez-vous dire", + "Search Address Failed": "Impossible de trouver l’adresse spécifiée. Merci de saisir une autre adresse proche de l’endroit où vous vous trouvez.", + "Sending pickup request...": "Envoi de la demande de prise en charge...", + "Cancel Request Prompt": "Voulez-vous vraiment annuler votre demande ?", + "Cancel Request Arrived Prompt": 'Voulez-vous vraiment annuler votre demande ? Votre chauffeur est arrivé, vous serez donc facturé de $10 de frais d’annulation. Il pourrait être utile que vous appeliez votre chauffeur maintenant.', + "Favorite Location Nickname Length Error": "Le pseudo doit faire au moins 3 caractères de long", + "Favorite Location Save Succeeded": "Adresse enregistrée !", + "Favorite Location Save Failed": "Impossible d’enregistrer votre adresse. Merci de réessayer ultérieurement.", + "Favorite Location Title": "Adresse favorie <%= id %>", + "Search Location Title": "Recherche d’adresse <%= id %>", + "ETA Message": "Temps d’attente estimé: environ <%= minutes %> minutes", + "Nearest Cab Message": "Le chauffeur le plus proche sera là dans <%= minutes %> minute(s)", + "Arrival ETA Message": "Votre chauffeur arrivera dans <%= minutes %> minute(s)", + "Arriving Now Message": "Votre chauffeur est en approche...", + "Rating Driver Failed": "Impossible de contacter le serveur. Merci de réessayer ultérieurement ou de contacter le support si le problème persiste.", + "settings": "Paramètres", + "Information": "Information", + "Picture": "Photo", + "Change password": "Modifier votre mot de passe", + "Your current Picture": "Votre photo", + "Your Favorite Locations": "Vos lieux favoris", + "You have no favorite locations saved.": "Vous n’avez pas de lieu favori", + "Account Information": "Informations Personnelles", + "Mobile Phone Information": "Informations de Mobile", + "Change Your Password": "Changez votre mot de passe.", + "Country": "Pays", + "Language": "Langue", + "Favorite Location": "Lieu favori", + "No Approximate Address": "Impossible de trouver une adresse même approximative", + "Address:": "Adresse :", + "Information Update Succeeded": "Vos informations ont été mises à jour !", + "Information Update Failed": "Nous n’avons pas pu mettre à jour vos informations. Merci de réessayer dans quelques instants ou de contacter le support si le problème persiste.", + "Location Delete Succeeded": "Adresse supprimée !", + "Location Delete Failed": "Nous n’avons pas pu supprimée votre adresse favorie. Merci de réessayer plus tard ou de contacter le support si le problème persiste.", + "Location Edit Succeeded": "Modifications sauvegardées !", + "Location Edit Failed": "Nous n’avons pas pu sauvegarder vos modifications. Merci de réessayer dans quelques minutes.", + "Picture Update Succeeded": "Votre photo a été mise à jour !", + "Picture Update Failed": "Nous n’avons pas pu mettre à jour votre photo. Merci de réessayer dans quelques instants.", + "Personal Information": "Informations Personnelles", + "Mobile Phone Number": "Numéro de Téléphone Portable", + "Payment Information": "Informations de Facturation", + "Your card will not be charged until you take a trip.": "Votre carte ne sera pas débitée avant votre premier trajet.", + "Card Number": "Numéro de Carte", + "Promotion Code Input Label": "Code promo, code d’invitation ou “deal” acheté en ligne (optionnel)", + "Terms and Conditions": "Conditions Générales", + "HELP": "HELP", + "STOP": "STOP", + "Sign Up Agreement": "En souscrivant, j’accepte les <%= terms_link %> et <%= privacy_link %> et comprends qu’Uber est un outil de commande de chauffeur, et non un transporteur.", + "Sign Up Agreement Error": "Vous devez accepter les Conditions Générales d’utilisation d’Uber Terms and Conditions et la Politique de Confidentialité pour continuer.", + "Message and Data Rates Disclosure": "Les frais d’envoi de SMS et de consommation de données peuvent s’appliquer. Répondez <%= help_string %> au 827-222 pour obtenir de l’aide. Répondez <%= stop_string %> au 827-222 pour ne plus recevoir de SMS. Pour plus d’aide, visitez support.uber.com ou appelez le (866) 576-1039. Opérateurs supportés: AT&T, Sprint, Verizon, T-Mobile, Orange, SFR et Bouygues Telecom.", + "Zip/Postal Code": "Code Postal", + "Expiration Date": "Date D'expiration", + "Security Code": "Code de Sécurité", + "Type of Card": "Type", + "Personal": "Personnel", + "Business": "Entreprise", + "Promotion Code": "Code Promo", + "Legal Information": "Mentions Légales", + "I Agree": "J'accepte.", + "Your Trip": "Votre Course", + "Trip Info": "Informations de la Course", + "Request a fare review": "Demander un contrôle du tarif", + "Fare Review Submitted": "Votre demande de contrôle du tarif a été soumis. Nous reviendrons vers vous rapidement concernant cette demande. Nous nous excusons pour les dérangements éventuellement occasionnés !", + "Fair Price Consideration": "Nous nous engageons à proposer Uber à un tarif juste. Avant de demander un contrôle du tarif, merci de prendre en compte :", + "Your Fare Calculation": "Calcul du Prix", + "Charges": "Coûts", + "Discounts": "Réductions", + "Total Charge": "Coût total", + "Uber pricing information": "Information sur les prix d’Uber", + "Uber Pricing Information Message": "<%= learn_link %> est disponible sur notre site web.", + "GPS Point Capture Disclosure": "A cause d’un nombre limité de coordonnées GPS sauvegardées, les angles de votre trajet sur la carte peuvent apparaître coupés ou arrondis. Ces légères incohérences débouchent sur des distances mesurées plus courtes, ce qui implique toujours un prix du trajet moins élevé.", + "Fare Review Note": "Merci de nous expliquer pourquoi le tarif de cette course nécessite d’être contrôlé. Vos commentaires ci-dessous nous aideront à établir un prix plus juste si nécessaire :", + "Fare Review Error": "Il y a eu une erreur lors de l’envoi de la demande. Assurez-vous d’avoir bien ajouté une description à votre demande." + }; +}).call(this); +}, "views/clients/billing": function(exports, require, module) {(function() { + var clientsBillingTemplate; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }, __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }; + clientsBillingTemplate = require('templates/clients/billing'); + exports.ClientsBillingView = (function() { + __extends(ClientsBillingView, UberView); + function ClientsBillingView() { + ClientsBillingView.__super__.constructor.apply(this, arguments); + } + ClientsBillingView.prototype.id = 'billing_view'; + ClientsBillingView.prototype.className = 'view_container'; + ClientsBillingView.prototype.events = { + 'click a#add_card': 'addCard', + 'click .charge_arrear': 'chargeArrear' + }; + ClientsBillingView.prototype.render = function() { + this.RefreshUserInfo(__bind(function() { + var cards, newForm; + this.HideSpinner(); + $(this.el).html(clientsBillingTemplate()); + if (USER.payment_gateway.payment_profiles.length === 0) { + newForm = new app.views.clients.modules.creditcard; + $(this.el).find("#add_card_wrapper").html(newForm.render(0).el); + } else { + cards = new app.views.clients.modules.creditcard; + $("#cards").html(cards.render("all").el); + } + return this.delegateEvents(); + }, this)); + return this; + }; + ClientsBillingView.prototype.addCard = function(e) { + var newCard; + e.preventDefault(); + newCard = new app.views.clients.modules.creditcard; + $('#cards').append(newCard.render("new").el); + return $("a#add_card").hide(); + }; + ClientsBillingView.prototype.chargeArrear = function(e) { + var $el, arrearId, attrs, cardId, options, tryCharge; + e.preventDefault(); + $(".error_message").text(""); + $el = $(e.currentTarget); + arrearId = $el.attr('id'); + cardId = $el.parent().find('#card_to_charge').val(); + this.ShowSpinner('submit'); + tryCharge = new app.models.clientbills({ + id: arrearId + }); + attrs = { + payment_profile_id: cardId, + dataType: 'json' + }; + options = { + success: __bind(function(data, textStatus, jqXHR) { + $el.parent().find(".success_message").text(t("Billing Succeeded")); + $el.hide(); + return $el.parent().find('#card_to_charge').hide(); + }, this), + error: __bind(function(jqXHR, status, errorThrown) { + return $el.parent().find(".error_message").text(JSON.parse(status.responseText).error); + }, this), + complete: __bind(function() { + return this.HideSpinner(); + }, this) + }; + return tryCharge.save(attrs, options); + }; + return ClientsBillingView; + })(); +}).call(this); +}, "views/clients/confirm_email": function(exports, require, module) {(function() { + var clientsConfirmEmailTemplate; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }, __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }; + clientsConfirmEmailTemplate = require('templates/clients/confirm_email'); + exports.ClientsConfirmEmailView = (function() { + __extends(ClientsConfirmEmailView, UberView); + function ClientsConfirmEmailView() { + ClientsConfirmEmailView.__super__.constructor.apply(this, arguments); + } + ClientsConfirmEmailView.prototype.id = 'confirm_email_view'; + ClientsConfirmEmailView.prototype.className = 'view_container'; + ClientsConfirmEmailView.prototype.render = function(token) { + var attrs; + $(this.el).html(clientsConfirmEmailTemplate()); + attrs = { + data: { + email_token: token + }, + success: __bind(function(data, textStatus, jqXHR) { + var show_dashboard; + this.HideSpinner(); + show_dashboard = function() { + return app.routers.clients.navigate('!/dashboard', true); + }; + if (data.status === 'OK') { + $('.success_message').show(); + return _.delay(show_dashboard, 3000); + } else if (data.status === 'ALREADY_COMFIRMED') { + $('.already_confirmed_message').show(); + return _.delay(show_dashboard, 3000); + } else { + return $('.error_message').show(); + } + }, this), + error: __bind(function(e) { + this.HideSpinner(); + return $('.error_message').show(); + }, this), + complete: function(status) { + return $('#attempt_text').hide(); + }, + dataType: 'json', + type: 'PUT', + url: "" + API + "/users/self" + }; + $.ajax(attrs); + this.ShowSpinner('submit'); + return this; + }; + return ClientsConfirmEmailView; + })(); +}).call(this); +}, "views/clients/dashboard": function(exports, require, module) {(function() { + var clientsDashboardTemplate; + var __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }, __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + clientsDashboardTemplate = require('templates/clients/dashboard'); + exports.ClientsDashboardView = (function() { + var displayFirstTrip; + __extends(ClientsDashboardView, UberView); + function ClientsDashboardView() { + this.showAllTrips = __bind(this.showAllTrips, this); + this.render = __bind(this.render, this); + ClientsDashboardView.__super__.constructor.apply(this, arguments); + } + ClientsDashboardView.prototype.id = 'dashboard_view'; + ClientsDashboardView.prototype.className = 'view_container'; + ClientsDashboardView.prototype.events = { + 'click a.confirmation': 'confirmationClick', + 'click #resend_email': 'resendEmail', + 'click #resend_mobile': 'resendMobile', + 'click #show_all_trips': 'showAllTrips' + }; + ClientsDashboardView.prototype.render = function() { + var displayPage, downloadTrips; + this.HideSpinner(); + displayPage = __bind(function() { + $(this.el).html(clientsDashboardTemplate()); + this.confirmationsSetup(); + return this.RequireMaps(__bind(function() { + if (USER.trips.models[0]) { + if (!USER.trips.models[0].get("points")) { + return USER.trips.models[0].fetch({ + data: { + relationships: 'points' + }, + success: __bind(function() { + this.CacheData("USERtrips", USER.trips); + return displayFirstTrip(); + }, this) + }); + } else { + return displayFirstTrip(); + } + } + }, this)); + }, this); + downloadTrips = __bind(function() { + return this.DownloadUserTrips(displayPage, false, 10); + }, this); + this.RefreshUserInfo(downloadTrips); + return this; + }; + displayFirstTrip = __bind(function() { + var bounds, endPos, map, myOptions, path, polyline, startPos; + myOptions = { + zoom: 12, + mapTypeId: google.maps.MapTypeId.ROADMAP, + zoomControl: false, + rotateControl: false, + panControl: false, + mapTypeControl: false, + scrollwheel: false + }; + if (USER.trips.length === 10) { + $("#show_all_trips").show(); + } + if (USER.trips.length > 0) { + map = new google.maps.Map(document.getElementById("trip_details_map"), myOptions); + bounds = new google.maps.LatLngBounds(); + path = []; + _.each(USER.trips.models[0].get('points'), __bind(function(point) { + path.push(new google.maps.LatLng(point.lat, point.lng)); + return bounds.extend(_.last(path)); + }, this)); + map.fitBounds(bounds); + startPos = new google.maps.Marker({ + position: _.first(path), + map: map, + title: t('Trip started here'), + icon: 'https://uber-static.s3.amazonaws.com/marker_start.png' + }); + endPos = new google.maps.Marker({ + position: _.last(path), + map: map, + title: t('Trip ended here'), + icon: 'https://uber-static.s3.amazonaws.com/marker_end.png' + }); + polyline = new google.maps.Polyline({ + path: path, + strokeColor: '#003F87', + strokeOpacity: 1, + strokeWeight: 5 + }); + return polyline.setMap(map); + } + }, ClientsDashboardView); + ClientsDashboardView.prototype.confirmationsSetup = function() { + var blink, cardForm, element, _ref, _ref2, _ref3, _ref4, _ref5; + blink = function(element) { + var opacity; + opacity = 0.5; + if (element.css('opacity') === "0.5") { + opacity = 1.0; + } + return element.fadeTo(2000, opacity, function() { + return blink(element); + }); + }; + if (((_ref = window.USER) != null ? (_ref2 = _ref.payment_gateway) != null ? (_ref3 = _ref2.payment_profiles) != null ? _ref3.length : void 0 : void 0 : void 0) === 0) { + element = $('#confirmed_credit_card'); + cardForm = new app.views.clients.modules.creditcard; + $('#card.info').append(cardForm.render().el); + blink(element); + } + if (((_ref4 = window.USER) != null ? _ref4.confirm_email : void 0) === false) { + element = $('#confirmed_email'); + blink(element); + } + if ((((_ref5 = window.USER) != null ? _ref5.confirm_mobile : void 0) != null) === false) { + element = $('#confirmed_mobile'); + return blink(element); + } + }; + ClientsDashboardView.prototype.confirmationClick = function(e) { + e.preventDefault(); + $('.info').hide(); + $('#more_info').show(); + switch (e.currentTarget.id) { + case "card": + return $('#card.info').slideToggle(); + case "mobile": + return $('#mobile.info').slideToggle(); + case "email": + return $('#email.info').slideToggle(); + } + }; + ClientsDashboardView.prototype.resendEmail = function(e) { + var $el; + e.preventDefault(); + $el = $(e.currentTarget); + $el.removeAttr('href').prop({ + disabled: true + }); + $el.html(t("Sending Email")); + return $.ajax({ + type: 'GET', + url: API + '/users/request_confirm_email', + data: { + token: USER.token + }, + dataType: 'json', + success: __bind(function(data, textStatus, jqXHR) { + return $el.html(t("Resend Email Succeeded")); + }, this), + error: __bind(function(jqXHR, textStatus, errorThrown) { + return $el.html(t("Resend Email Failed")); + }, this) + }); + }; + ClientsDashboardView.prototype.resendMobile = function(e) { + var $el; + e.preventDefault(); + $el = $(e.currentTarget); + $el.removeAttr('href').prop({ + disabled: true + }); + $el.html("Sending message..."); + return $.ajax({ + type: 'GET', + url: API + '/users/request_confirm_mobile', + data: { + token: USER.token + }, + dataType: 'json', + success: __bind(function(data, textStatus, jqXHR) { + return $el.html(t("Resend Text Succeeded")); + }, this), + error: __bind(function(jqXHR, textStatus, errorThrown) { + return $el.html(t("Resend Text Failed")); + }, this) + }); + }; + ClientsDashboardView.prototype.showAllTrips = function(e) { + e.preventDefault(); + $(e.currentTarget).hide(); + return this.DownloadUserTrips(this.render, true, 1000); + }; + return ClientsDashboardView; + }).call(this); +}).call(this); +}, "views/clients/forgot_password": function(exports, require, module) {(function() { + var clientsForgotPasswordTemplate; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }, __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }; + clientsForgotPasswordTemplate = require('templates/clients/forgot_password'); + exports.ClientsForgotPasswordView = (function() { + __extends(ClientsForgotPasswordView, UberView); + function ClientsForgotPasswordView() { + ClientsForgotPasswordView.__super__.constructor.apply(this, arguments); + } + ClientsForgotPasswordView.prototype.id = 'forgotpassword_view'; + ClientsForgotPasswordView.prototype.className = 'view_container modal_view_container'; + ClientsForgotPasswordView.prototype.events = { + "submit #password_reset": "passwordReset", + "click #password_reset_submit": "passwordReset", + "submit #forgot_password": "forgotPassword", + "click #forgot_password_submit": "forgotPassword" + }; + ClientsForgotPasswordView.prototype.render = function(token) { + this.HideSpinner(); + $(this.el).html(clientsForgotPasswordTemplate({ + token: token + })); + this.delegateEvents(); + return this; + }; + ClientsForgotPasswordView.prototype.forgotPassword = function(e) { + var attrs; + e.preventDefault(); + $('.success_message').hide(); + $(".error_message").hide(); + attrs = { + data: { + login: $("#login").val() + }, + success: __bind(function(data, textStatus, jqXHR) { + this.HideSpinner(); + $('.success_message').show(); + return $("#forgot_password").hide(); + }, this), + error: __bind(function(e) { + this.HideSpinner(); + return $('.error_message').show(); + }, this), + dataType: 'json', + type: 'PUT', + url: "" + API + "/users/forgot_password" + }; + $.ajax(attrs); + return this.ShowSpinner('submit'); + }; + ClientsForgotPasswordView.prototype.passwordReset = function(e) { + var attrs; + e.preventDefault(); + attrs = { + data: { + email_token: $("#token").val(), + password: $("#password").val() + }, + success: __bind(function(data, textStatus, jqXHR) { + this.HideSpinner(); + $.cookie('token', data.token); + amplify.store('USERjson', data); + app.refreshMenu(); + return location.hash = '!/dashboard'; + }, this), + error: __bind(function(e) { + this.HideSpinner(); + return $('#error_reset').show(); + }, this), + dataType: 'json', + type: 'PUT', + url: "" + API + "/users/self" + }; + $.ajax(attrs); + return this.ShowSpinner('submit'); + }; + return ClientsForgotPasswordView; + })(); +}).call(this); +}, "views/clients/invite": function(exports, require, module) {(function() { + var clientsInviteTemplate; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + clientsInviteTemplate = require('templates/clients/invite'); + exports.ClientsInviteView = (function() { + __extends(ClientsInviteView, UberView); + function ClientsInviteView() { + ClientsInviteView.__super__.constructor.apply(this, arguments); + } + ClientsInviteView.prototype.id = 'invite_view'; + ClientsInviteView.prototype.className = 'view_container'; + ClientsInviteView.prototype.render = function() { + this.ReadUserInfo(); + this.HideSpinner(); + $(this.el).html(clientsInviteTemplate()); + console.log(screen); + return this; + }; + return ClientsInviteView; + })(); +}).call(this); +}, "views/clients/login": function(exports, require, module) {(function() { + var clientsLoginTemplate; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + clientsLoginTemplate = require('templates/clients/login'); + exports.ClientsLoginView = (function() { + __extends(ClientsLoginView, UberView); + function ClientsLoginView() { + ClientsLoginView.__super__.constructor.apply(this, arguments); + } + ClientsLoginView.prototype.id = 'login_view'; + ClientsLoginView.prototype.className = 'view_container modal_view_container'; + ClientsLoginView.prototype.events = { + 'submit form': 'authenticate', + 'click button': 'authenticate' + }; + ClientsLoginView.prototype.initialize = function() { + _.bindAll(this, 'render'); + return this.render(); + }; + ClientsLoginView.prototype.render = function() { + this.HideSpinner(); + $(this.el).html(clientsLoginTemplate()); + this.delegateEvents(); + return this.place(); + }; + ClientsLoginView.prototype.authenticate = function(e) { + e.preventDefault(); + return $.ajax({ + type: 'POST', + url: API + '/auth/web_login/client', + data: { + login: $("#login").val(), + password: $("#password").val() + }, + dataType: 'json', + success: function(data, textStatus, jqXHR) { + $.cookie('user', JSON.stringify(data)); + $.cookie('token', data.token); + amplify.store('USERjson', data); + $('header').html(app.views.shared.menu.render().el); + return app.routers.clients.navigate('!/dashboard', true); + }, + error: function(jqXHR, textStatus, errorThrown) { + $.cookie('user', null); + $.cookie('token', null); + if (jqXHR.status === 403) { + $.cookie('redirected_user', JSON.stringify(JSON.parse(jqXHR.responseText).error_obj), { + domain: '.uber.com' + }); + window.location = 'http://partners.uber.com/'; + } + return $('.error_message').html(JSON.parse(jqXHR.responseText).error).hide().fadeIn(); + } + }); + }; + return ClientsLoginView; + })(); +}).call(this); +}, "views/clients/modules/credit_card": function(exports, require, module) {(function() { + var creditCardTemplate; + var __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }, __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }; + creditCardTemplate = require('templates/clients/modules/credit_card'); + exports.CreditCardView = (function() { + __extends(CreditCardView, UberView); + function CreditCardView() { + CreditCardView.__super__.constructor.apply(this, arguments); + } + CreditCardView.prototype.id = 'creditcard_view'; + CreditCardView.prototype.className = 'module_container'; + CreditCardView.prototype.events = { + 'submit #credit_card_form': 'processNewCard', + 'click #new_card': 'processNewCard', + 'change #card_number': 'showCardType', + 'click .edit_card_show': 'showEditCard', + 'click .edit_card': 'editCard', + 'click .delete_card': 'deleteCard', + 'click .make_default': 'makeDefault', + 'change .use_case': 'saveUseCase' + }; + CreditCardView.prototype.initialize = function() { + return app.collections.paymentprofiles.bind("refresh", __bind(function() { + return this.RefreshUserInfo(__bind(function() { + this.render("all"); + return this.HideSpinner(); + }, this)); + }, this)); + }; + CreditCardView.prototype.render = function(cards) { + if (cards == null) { + cards = "new"; + } + if (cards === "all") { + app.collections.paymentprofiles.reset(USER.payment_gateway.payment_profiles); + cards = app.collections.paymentprofiles; + } + $(this.el).html(creditCardTemplate({ + cards: cards + })); + return this; + }; + CreditCardView.prototype.processNewCard = function(e) { + var $el, attrs, model, options; + e.preventDefault(); + this.ClearGlobalStatus(); + $el = $("#credit_card_form"); + $el.find('.error_message').html(""); + attrs = { + card_number: $el.find('#card_number').val(), + card_code: $el.find('#card_code').val(), + card_expiration_month: $el.find('#card_expiration_month').val(), + card_expiration_year: $el.find('#card_expiration_year').val(), + use_case: $el.find('#use_case').val(), + "default": $el.find('#default_check').prop("checked") + }; + options = { + statusCode: { + 200: __bind(function(e) { + this.HideSpinner(); + $('#cc_form_wrapper').hide(); + app.collections.paymentprofiles.trigger("refresh"); + $(this.el).remove(); + $("a#add_card").show(); + return $('section').html(app.views.clients.billing.render().el); + }, this), + 406: __bind(function(e) { + var error, errors, _i, _len, _ref, _results; + this.HideSpinner(); + errors = JSON.parse(e.responseText); + _ref = _.keys(errors); + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + error = _ref[_i]; + _results.push(error === "top_of_form" ? $("#top_of_form").html(errors[error]) : $("#credit_card_form").find("#" + error).parent().find(".error_message").html(errors[error])); + } + return _results; + }, this), + 420: __bind(function(e) { + this.HideSpinner(); + return $("#top_of_form").html(t("Unable to Verify Card")); + }, this) + } + }; + this.ShowSpinner("submit"); + model = new app.models.paymentprofile; + model.save(attrs, options); + return app.collections.paymentprofiles.add(model); + }; + CreditCardView.prototype.showCardType = function(e) { + var $el, reAmerica, reDiscover, reMaster, reVisa, validCard; + reVisa = /^4\d{3}-?\d{4}-?\d{4}-?\d{4}$/; + reMaster = /^5[1-5]\d{2}-?\d{4}-?\d{4}-?\d{4}$/; + reAmerica = /^6011-?\d{4}-?\d{4}-?\d{4}$/; + reDiscover = /^3[4,7]\d{13}$/; + $el = $("#card_logos"); + validCard = false; + if (e.currentTarget.value.match(reVisa)) { + validCard = true; + } else if (e.currentTarget.value.match(reMaster)) { + $el.css('background-position', "-60px"); + validCard = true; + } else if (e.currentTarget.value.match(reAmerica)) { + $el.css('background-position', "-120px"); + validCard = true; + } else if (e.currentTarget.value.match(reDiscover)) { + $el.css('background-position', "-180px"); + validCard = true; + } + if (validCard) { + $el.css('width', "60px"); + return $el.css('margin-left', "180px"); + } else { + $el.css('width', "250px"); + return $el.css('margin-left', "80px"); + } + }; + CreditCardView.prototype.showEditCard = function(e) { + var $el, id; + e.preventDefault(); + $el = $(e.currentTarget); + if ($el.html() === t("Edit")) { + id = $el.html(t("Cancel")).parents("tr").attr("id").substring(1); + return $("#e" + id).show(); + } else { + id = $el.html(t("Edit")).parents("tr").attr("id").substring(1); + return $("#e" + id).hide(); + } + }; + CreditCardView.prototype.editCard = function(e) { + var $el, attrs, id, options; + e.preventDefault(); + this.ClearGlobalStatus(); + $el = $(e.currentTarget).parents("td"); + id = $el.parents("tr").attr("id").substring(1); + $el.attr('disabled', 'disabled'); + this.ShowSpinner('submit'); + attrs = { + card_expiration_month: $el.find('#card_expiration_month').val(), + card_expiration_year: $el.find('#card_expiration_year').val(), + card_code: $el.find('#card_code').val() + }; + options = { + success: __bind(function(response) { + this.HideSpinner(); + this.ShowSuccess(t("Credit Card Update Succeeded")); + $("#e" + id).hide(); + $("#d" + id).find(".edit_card_show").html(t("Edit")); + return app.collections.paymentprofiles.trigger("refresh"); + }, this), + error: __bind(function(e) { + this.HideSpinner(); + this.ShowError(t("Credit Card Update Failed")); + return $el.removeAttr('disabled'); + }, this) + }; + app.collections.paymentprofiles.models[id].set(attrs); + return app.collections.paymentprofiles.models[id].save({}, options); + }; + CreditCardView.prototype.deleteCard = function(e) { + var $el, id, options; + e.preventDefault(); + $el = $(e.currentTarget).parents("td"); + id = $el.parents("tr").attr("id").substring(1); + this.ClearGlobalStatus(); + this.ShowSpinner('submit'); + options = { + success: __bind(function(response) { + this.ShowSuccess(t("Credit Card Delete Succeeded")); + $("form").hide(); + app.collections.paymentprofiles.trigger("refresh"); + return $('section').html(app.views.clients.billing.render().el); + }, this), + error: __bind(function(xhr, e) { + this.HideSpinner(); + return this.ShowError(t("Credit Card Delete Failed")); + }, this) + }; + return app.collections.paymentprofiles.models[id].destroy(options); + }; + CreditCardView.prototype.saveUseCase = function(e) { + var $el, attrs, id, options, use_case; + this.ClearGlobalStatus(); + $el = $(e.currentTarget); + use_case = $el.val(); + id = $el.parents("tr").attr("id").substring(1); + attrs = { + use_case: use_case + }; + options = { + success: __bind(function(response) { + return this.ShowSuccess(t("Credit Card Update Category Succeeded")); + }, this), + error: __bind(function(e) { + return this.ShowError(t("Credit Card Update Category Failed")); + }, this) + }; + app.collections.paymentprofiles.models[id].set(attrs); + return app.collections.paymentprofiles.models[id].save({}, options); + }; + CreditCardView.prototype.makeDefault = function(e) { + var $el, attrs, id, options; + e.preventDefault(); + this.ClearGlobalStatus(); + $el = $(e.currentTarget).parents("td"); + id = $el.parents("tr").attr("id").substring(1); + attrs = { + "default": true + }; + options = { + success: __bind(function(response) { + this.ShowSuccess(t("Credit Card Update Default Succeeded")); + return app.collections.paymentprofiles.trigger("refresh"); + }, this), + error: __bind(function(e) { + return this.ShowError(t("Credit Card Update Default Failed")); + }, this) + }; + app.collections.paymentprofiles.models[id].set(attrs); + return app.collections.paymentprofiles.models[id].save({}, options); + }; + return CreditCardView; + })(); +}).call(this); +}, "views/clients/promotions": function(exports, require, module) {(function() { + var clientsPromotionsTemplate; + var __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }, __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + clientsPromotionsTemplate = require('templates/clients/promotions'); + exports.ClientsPromotionsView = (function() { + __extends(ClientsPromotionsView, UberView); + function ClientsPromotionsView() { + this.render = __bind(this.render, this); + ClientsPromotionsView.__super__.constructor.apply(this, arguments); + } + ClientsPromotionsView.prototype.id = 'promotions_view'; + ClientsPromotionsView.prototype.className = 'view_container'; + ClientsPromotionsView.prototype.events = { + 'submit form': 'submitPromo', + 'click button': 'submitPromo' + }; + ClientsPromotionsView.prototype.initialize = function() { + if (this.model) { + return this.RefreshUserInfo(this.render); + } + }; + ClientsPromotionsView.prototype.render = function() { + var renderTemplate; + this.ReadUserInfo(); + renderTemplate = __bind(function() { + $(this.el).html(clientsPromotionsTemplate({ + promos: window.USER.unexpired_client_promotions || [] + })); + return this.HideSpinner(); + }, this); + this.DownloadUserPromotions(renderTemplate); + return this; + }; + ClientsPromotionsView.prototype.submitPromo = function(e) { + var attrs, model, options, refreshTable; + e.preventDefault(); + this.ClearGlobalStatus(); + refreshTable = __bind(function() { + $('section').html(this.render().el); + return this.HideSpinner(); + }, this); + attrs = { + code: $('#code').val() + }; + options = { + success: __bind(function(response) { + this.HideSpinner(); + if (response.get('first_name')) { + return this.ShowSuccess("Your promotion has been applied in the form of an account credit. Click here to check your balance."); + } else { + this.ShowSuccess("Your promotion has successfully been applied"); + return this.RefreshUserInfo(this.render, true); + } + }, this), + statusCode: { + 400: __bind(function(e) { + this.ShowError(JSON.parse(e.responseText).error); + return this.HideSpinner(); + }, this) + } + }; + this.ShowSpinner("submit"); + model = new app.models.promotions; + return model.save(attrs, options); + }; + return ClientsPromotionsView; + })(); +}).call(this); +}, "views/clients/request": function(exports, require, module) {(function() { + var clientsRequestTemplate; + var __bind = function(fn, me){ return function(){ return fn.apply(me, arguments); }; }, __hasProp = Object.prototype.hasOwnProperty, __extends = function(child, parent) { + for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } + function ctor() { this.constructor = child; } + ctor.prototype = parent.prototype; + child.prototype = new ctor; + child.__super__ = parent.prototype; + return child; + }; + clientsRequestTemplate = require('templates/clients/request'); + exports.ClientsRequestView = (function() { + __extends(ClientsRequestView, UberView); + function ClientsRequestView() { + this.AjaxCall = __bind(this.AjaxCall, this); + this.AskDispatch = __bind(this.AskDispatch, this); + this.removeMarkers = __bind(this.removeMarkers, this); + this.displaySearchLoc = __bind(this.displaySearchLoc, this); + this.displayFavLoc = __bind(this.displayFavLoc, this); + this.showFavLoc = __bind(this.showFavLoc, this); + this.addToFavLoc = __bind(this.addToFavLoc, this); + this.removeCabs = __bind(this.removeCabs, this); + this.requestRide = __bind(this.requestRide, this); + this.rateTrip = __bind(this.rateTrip, this); + this.locationChange = __bind(this.locationChange, this); + this.panToLocation = __bind(this.panToLocation, this); + this.clickLocation = __bind(this.clickLocation, this); + this.searchLocation = __bind(this.searchLocation, this); + this.mouseoutLocation = __bind(this.mouseoutLocation, this); + this.mouseoverLocation = __bind(this.mouseoverLocation, this); + this.fetchTripDetails = __bind(this.fetchTripDetails, this); + this.submitRating = __bind(this.submitRating, this); + this.setStatus = __bind(this.setStatus, this); + this.initialize = __bind(this.initialize, this); + ClientsRequestView.__super__.constructor.apply(this, arguments); + } + ClientsRequestView.prototype.id = 'request_view'; + ClientsRequestView.prototype.className = 'view_container'; + ClientsRequestView.prototype.pollInterval = 2 * 1000; + ClientsRequestView.prototype.events = { + "submit #search_form": "searchAddress", + "click .locations_link": "locationLinkHandle", + "mouseover .location_row": "mouseoverLocation", + "mouseout .location_row": "mouseoutLocation", + "click .location_row": "clickLocation", + "click #search_location": "searchLocation", + "click #pickupHandle": "pickupHandle", + "click .stars": "rateTrip", + "submit #rating_form": "submitRating", + "click #addToFavButton": "showFavLoc", + "click #favLocNickname": "selectInputText", + "submit #favLoc_form": "addToFavLoc" + }; + ClientsRequestView.prototype.status = ""; + ClientsRequestView.prototype.pickupMarker = "https://uber-static.s3.amazonaws.com/pickup_marker.png"; + ClientsRequestView.prototype.cabMarker = "https://uber-static.s3.amazonaws.com/cab_marker.png"; + ClientsRequestView.prototype.initialize = function() { + var displayCabs; + displayCabs = __bind(function() { + return this.AskDispatch("NearestCab"); + }, this); + this.showCabs = _.throttle(displayCabs, this.pollInterval); + return this.numSearchToDisplay = 1; + }; + ClientsRequestView.prototype.setStatus = function(status) { + var autocomplete; + if (this.status === status) { + return; + } + try { + google.maps.event.trigger(this.map, 'resize'); + } catch (_e) {} + switch (status) { + case "init": + this.AskDispatch("StatusClient"); + this.status = "init"; + return this.ShowSpinner("load"); + case "ready": + this.HideSpinner(); + $(".panel").hide(); + $("#top_bar").fadeIn(); + $("#location_panel").fadeIn(); + $("#location_panel_control").fadeIn(); + $("#pickupHandle").attr("class", "button_green").fadeIn().find("span").html(t("Request Pickup")); + this.pickup_icon.setDraggable(true); + this.map.panTo(this.pickup_icon.getPosition()); + this.showCabs(); + try { + this.pickup_icon.setMap(this.map); + this.displayFavLoc(); + autocomplete = new google.maps.places.Autocomplete(document.getElementById('address'), { + types: ['geocode'] + }); + autocomplete.bindTo('bounds', this.map); + } catch (_e) {} + return this.status = "ready"; + case "searching": + this.HideSpinner(); + this.removeMarkers(); + $(".panel").hide(); + $("#top_bar").fadeOut(); + $("#status_message").html(t("Requesting Closest Driver")); + $("#pickupHandle").attr("class", "button_red").fadeIn().find("span").html(t("Cancel Pickup")); + this.pickup_icon.setDraggable(false); + this.pickup_icon.setMap(this.map); + return this.status = "searching"; + case "waiting": + this.HideSpinner(); + this.removeMarkers(); + $(".panel").hide(); + $("#top_bar").fadeOut(); + $("#pickupHandle").attr("class", "button_red").fadeIn().find("span").html(t("Cancel Pickup")); + $("#waiting_riding").fadeIn(); + this.pickup_icon.setDraggable(false); + this.pickup_icon.setMap(this.map); + return this.status = "waiting"; + case "arriving": + this.HideSpinner(); + this.removeMarkers(); + $(".panel").hide(); + $("#top_bar").fadeOut(); + $("#pickupHandle").attr("class", "button_red").fadeIn().find("span").html(t("Cancel Pickup")); + $("#waiting_riding").fadeIn(); + this.pickup_icon.setDraggable(false); + this.pickup_icon.setMap(this.map); + return this.status = "arriving"; + case "riding": + this.HideSpinner(); + this.removeMarkers(); + $(".panel").hide(); + $("#top_bar").fadeOut(); + $("#pickupHandle").fadeIn().attr("class", "button_red").find("span").html(t("Cancel Pickup")); + $("#waiting_riding").fadeIn(); + this.pickup_icon.setDraggable(false); + this.status = "riding"; + return $("#status_message").html(t("En Route")); + case "rate": + this.HideSpinner(); + $(".panel").hide(); + $("#pickupHandle").fadeOut(); + $("#trip_completed_panel").fadeIn(); + $('#status_message').html(t("Rate Last Trip")); + return this.status = "rate"; + } + }; + ClientsRequestView.prototype.render = function() { + this.ReadUserInfo(); + this.HideSpinner(); + this.ShowSpinner("load"); + $(this.el).html(clientsRequestTemplate()); + this.cabs = []; + this.RequireMaps(__bind(function() { + var center, myOptions, streetViewPano; + center = new google.maps.LatLng(37.7749295, -122.4194155); + this.markers = []; + this.pickup_icon = new google.maps.Marker({ + position: center, + draggable: true, + clickable: true, + icon: this.pickupMarker + }); + this.geocoder = new google.maps.Geocoder(); + myOptions = { + zoom: 12, + center: center, + mapTypeId: google.maps.MapTypeId.ROADMAP, + rotateControl: false, + rotateControl: false, + panControl: false + }; + this.map = new google.maps.Map($(this.el).find("#map_wrapper_right")[0], myOptions); + if (this.status === "ready") { + this.pickup_icon.setMap(this.map); + } + if (geo_position_js.init()) { + geo_position_js.getCurrentPosition(__bind(function(data) { + var location; + location = new google.maps.LatLng(data.coords.latitude, data.coords.longitude); + this.pickup_icon.setPosition(location); + this.map.panTo(location); + return this.map.setZoom(16); + }, this)); + } + this.setStatus("init"); + streetViewPano = this.map.getStreetView(); + google.maps.event.addListener(streetViewPano, 'visible_changed', __bind(function() { + if (streetViewPano.getVisible()) { + this.pickupMarker = "https://uber-static.s3.amazonaws.com/pickup_marker_large.png"; + this.cabMarker = "https://uber-static.s3.amazonaws.com/cab_marker_large.png"; + } else { + this.pickupMarker = "https://uber-static.s3.amazonaws.com/pickup_marker.png"; + this.cabMarker = "https://uber-static.s3.amazonaws.com/cab_marker.png"; + } + this.pickup_icon.setIcon(this.pickupMarker); + return _.each(this.cabs, __bind(function(cab) { + return cab.setIcon(this.cabMarker); + }, this)); + }, this)); + if (this.status === "ready") { + return this.displayFavLoc(); + } + }, this)); + return this; + }; + ClientsRequestView.prototype.submitRating = function(e) { + var $el, message, rating; + e.preventDefault(); + $el = $(e.currentTarget); + rating = 0; + _(5).times(function(num) { + if ($el.find(".stars#" + (num + 1)).attr("src") === "/web/img/star_active.png") { + return rating = num + 1; + } + }); + if (rating === 0) { + $("#status_message").html("").html(t("Rate Before Submitting")); + } else { + this.ShowSpinner("submit"); + this.AskDispatch("RatingDriver", { + rating: rating + }); + } + message = $el.find("#comments").val().toString(); + if (message.length > 5) { + return this.AskDispatch("Feedback", { + message: message + }); + } + }; + ClientsRequestView.prototype.fetchTripDetails = function(id) { + var trip; + trip = new app.models.trip({ + id: id + }); + return trip.fetch({ + data: { + relationships: 'points,driver,city' + }, + dataType: 'json', + success: __bind(function() { + var bounds, endPos, path, polyline, startPos; + bounds = new google.maps.LatLngBounds(); + path = []; + _.each(trip.get('points'), __bind(function(point) { + path.push(new google.maps.LatLng(point.lat, point.lng)); + return bounds.extend(_.last(path)); + }, this)); + startPos = new google.maps.Marker({ + position: _.first(path), + map: this.map, + title: t("Trip started here"), + icon: 'https://uber-static.s3.amazonaws.com/carstart.png' + }); + endPos = new google.maps.Marker({ + position: _.last(path), + map: this.map, + title: t("Trip ended here"), + icon: 'https://uber-static.s3.amazonaws.com/carstop.png' + }); + polyline = new google.maps.Polyline({ + path: path, + strokeColor: '#003F87', + strokeOpacity: 1, + strokeWeight: 5 + }); + polyline.setMap(this.map); + this.map.fitBounds(bounds); + $("#tripTime").html(app.helpers.parseDateTime(trip.get('pickup_local_time'), trip.get('city.timezone'))); + $("#tripDist").html(app.helpers.RoundNumber(trip.get('distance'), 2)); + $("#tripDur").html(app.helpers.FormatSeconds(trip.get('duration'))); + return $("#tripFare").html(app.helpers.FormatCurrency(trip.get('fare'))); + }, this) + }); + }; + ClientsRequestView.prototype.searchAddress = function(e) { + var $locationsDiv, address, alphabet, bounds, showResults; + alphabet = "ABCDEFGHIJKLMNOPQRSTUVWXYZ"; + try { + e.preventDefault(); + } catch (_e) {} + $('.error_message').html(""); + $locationsDiv = $("
"); + address = $('#address').val(); + bounds = new google.maps.LatLngBounds(); + if (address.length < 5) { + $('#status_message').html(t("Address too short")).fadeIn(); + return false; + } + showResults = __bind(function(address, index) { + var first_cell, row, second_cell; + if (index < this.numSearchToDisplay) { + first_cell = "		" + address.formatted_address + "
" + (t('or did you mean')) + "
" + address.formatted_address + "
a"; + + all = div.getElementsByTagName("*"); + a = div.getElementsByTagName("a")[ 0 ]; + a.style.cssText = "top:1px;float:left;opacity:.5"; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return {}; + } + + // First batch of supports tests + select = document.createElement("select"); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName("input")[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute("href") === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.5/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Tests for enctype support on a form(#6743) + enctype: !!document.createElement("form").enctype, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav>", + + // jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode + boxModel: ( document.compatMode === "CSS1Compat" ), + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true, + boxSizingReliable: true, + pixelPosition: false + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", clickFn = function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent("onclick"); + div.detachEvent( "onclick", clickFn ); + } + + // Check if a radio maintains its value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute( "type", "radio" ); + support.radioValue = input.value === "t"; + + input.setAttribute( "checked", "checked" ); + + // #11217 - WebKit loses check when the name is after the checked attribute + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.lastChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + fragment.removeChild( input ); + fragment.appendChild( div ); + + // Technique from Juriy Zaytsev + // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for ( i in { + submit: true, + change: true, + focusin: true + }) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + // Run tests that need a body at doc ready + jQuery(function() { + var container, div, tds, marginDiv, + divReset = "padding:0;margin:0;border:0;display:block;overflow:hidden;", + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + container = document.createElement("div"); + container.style.cssText = "visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px"; + body.insertBefore( container, body.firstChild ); + + // Construct the test element + div = document.createElement("div"); + container.appendChild( div ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + div.innerHTML = "
t
"; + tds = div.getElementsByTagName("td"); + tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none"; + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE <= 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Check box-sizing and margin behavior + div.innerHTML = ""; + div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;"; + support.boxSizing = ( div.offsetWidth === 4 ); + support.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== 1 ); + + // NOTE: To any future maintainer, window.getComputedStyle was used here + // instead of getComputedStyle because it gave a better gzip size. + // The difference between window.getComputedStyle and getComputedStyle is + // 7 bytes + if ( window.getComputedStyle ) { + support.pixelPosition = ( window.getComputedStyle( div, null ) || {} ).top !== "1%"; + support.boxSizingReliable = ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px"; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + marginDiv = document.createElement("div"); + marginDiv.style.cssText = div.style.cssText = divReset; + marginDiv.style.marginRight = marginDiv.style.width = "0"; + div.style.width = "1px"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + !parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight ); + } + + if ( typeof div.style.zoom !== "undefined" ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.innerHTML = ""; + div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1"; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = "block"; + div.style.overflow = "visible"; + div.innerHTML = "
"; + div.firstChild.style.width = "5px"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 3 ); + + container.style.zoom = 1; + } + + // Null elements to avoid leaks in IE + body.removeChild( container ); + container = div = tds = marginDiv = null; + }); + + // Null elements to avoid leaks in IE + fragment.removeChild( div ); + all = a = select = opt = input = fragment = div = null; + + return support; +})(); +var rbrace = /^(?:\{.*\}|\[.*\])$/, + rmultiDash = /([A-Z])/g; + +jQuery.extend({ + cache: {}, + + deletedIds: [], + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || !cache[id] || (!pvt && !cache[id].data)) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ internalKey ] = id = jQuery.deletedIds.pop() || ++jQuery.uuid; + } else { + id = internalKey; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // Avoids exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ] = jQuery.extend( cache[ id ], name ); + } else { + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); + } + } + + thisCache = cache[ id ]; + + // jQuery data() is stored in a separate object inside the object's internal data + // cache in order to avoid key collisions between internal data and user-defined + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; + } + + thisCache = thisCache.data; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, i, l, + + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ] : cache[ id ].data; + + if ( thisCache ) { + + // Support array or space separated string names for data keys + if ( !jQuery.isArray( name ) ) { + + // try the string as a key before any manipulation + if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces unless a key with the spaces exists + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split(" "); + } + } + } + + for ( i = 0, l = name.length; i < l; i++ ) { + delete thisCache[ name[i] ]; + } + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( !pvt ) { + delete cache[ id ].data; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject( cache[ id ] ) ) { + return; + } + } + + // Destroy the cache + if ( isNode ) { + jQuery.cleanData( [ elem ], true ); + + // Use delete when supported for expandos or `cache` is not a window per isWindow (#10080) + } else if ( jQuery.support.deleteExpando || cache != cache.window ) { + delete cache[ id ]; + + // When all else fails, null + } else { + cache[ id ] = null; + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + var noData = elem.nodeName && jQuery.noData[ elem.nodeName.toLowerCase() ]; + + // nodes accept data unless otherwise specified; rejection can be conditional + return !noData || noData !== true && elem.getAttribute("classid") === noData; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var parts, part, attr, name, l, + elem = this[0], + i = 0, + data = null; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = jQuery.data( elem ); + + if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) { + attr = elem.attributes; + for ( l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( elem, name, data[ name ] ); + } + } + jQuery._data( elem, "parsedAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + parts = key.split( ".", 2 ); + parts[1] = parts[1] ? "." + parts[1] : ""; + part = parts[1] + "!"; + + return jQuery.access( this, function( value ) { + + if ( value === undefined ) { + data = this.triggerHandler( "getData" + part, [ parts[0] ] ); + + // Try to fetch any internally stored data first + if ( data === undefined && elem ) { + data = jQuery.data( elem, key ); + data = dataAttr( elem, key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + } + + parts[1] = value; + this.each(function() { + var self = jQuery( this ); + + self.triggerHandler( "setData" + part, parts ); + jQuery.data( this, key, value ); + self.triggerHandler( "changeData" + part, parts ); + }); + }, null, value, arguments.length > 1, null, false ); + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + // Only convert to a number if it doesn't change the string + +data + "" === data ? +data : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// checks a cache object for emptiness +function isEmptyDataObject( obj ) { + var name; + for ( name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { + continue; + } + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} +jQuery.extend({ + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || jQuery.isArray(data) ) { + queue = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + if ( !queue.length && hooks ) { + hooks.empty.fire(); + } + }, + + // not intended for public consumption - generates a queueHooks object, or returns the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return jQuery._data( elem, key ) || jQuery._data( elem, key, { + empty: jQuery.Callbacks("once memory").add(function() { + jQuery.removeData( elem, type + "queue", true ); + jQuery.removeData( elem, key, true ); + }) + }); + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[0], type ); + } + + return data === undefined ? + this : + this.each(function() { + var queue = jQuery.queue( this, type, data ); + + // ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while( i-- ) { + if ( (tmp = jQuery._data( elements[ i ], type + "queueHooks" )) && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +}); +var nodeHook, boolHook, fixSpecified, + rclass = /[\t\r\n]/g, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea|)$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + getSetAttribute = jQuery.support.getSetAttribute; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( core_rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var removes, className, elem, c, cl, i, l; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + if ( (value && typeof value === "string") || value === undefined ) { + removes = ( value || "" ).split( core_rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + if ( elem.nodeType === 1 && elem.className ) { + + className = (" " + elem.className + " ").replace( rclass, " " ); + + // loop over each item in the removal list + for ( c = 0, cl = removes.length; c < cl; c++ ) { + // Remove until there is nothing to remove, + while ( className.indexOf(" " + removes[ c ] + " ") > -1 ) { + className = className.replace( " " + removes[ c ] + " " , " " ); + } + } + elem.className = value ? jQuery.trim( className ) : ""; + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( core_rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space separated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var val, + self = jQuery(this); + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, i, max, option, + index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + i = one ? index : 0; + max = one ? index + 1 : options.length; + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + // Unused in 1.8, left in so attrFn-stabbers won't die; remove in 1.9 + attrFn: {}, + + attr: function( elem, name, value, pass ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( pass && jQuery.isFunction( jQuery.fn[ name ] ) ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, "" + value ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var propName, attrNames, name, isBool, + i = 0; + + if ( value && elem.nodeType === 1 ) { + + attrNames = value.split( core_rspace ); + + for ( ; i < attrNames.length; i++ ) { + name = attrNames[ i ]; + + if ( name ) { + propName = jQuery.propFix[ name ] || name; + isBool = rboolean.test( name ); + + // See #9699 for explanation of this approach (setting first, then removal) + // Do not do this for boolean attributes (see #10870) + if ( !isBool ) { + jQuery.attr( elem, name, "" ); + } + elem.removeAttribute( getSetAttribute ? name : propName ); + + // Set corresponding property to false for boolean attributes + if ( isBool && propName in elem ) { + elem[ propName ] = false; + } + } + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + // Fall back to attribute presence where some booleans are not supported + var attrNode, + property = jQuery.prop( elem, name ); + return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !getSetAttribute ) { + + fixSpecified = { + name: true, + id: true, + coords: true + }; + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + return ret && ( fixSpecified[ name ] ? ret.value !== "" : ret.specified ) ? + ret.value : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); + } + return ( ret.value = value + "" ); + } + }; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); + + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + get: nodeHook.get, + set: function( elem, value, name ) { + if ( value === "" ) { + value = "false"; + } + nodeHook.set( elem, value, name ); + } + }; +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return ( elem.style.cssText = "" + value ); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// IE6/7 call enctype encoding +if ( !jQuery.support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); +var rformElems = /^(?:textarea|input|select)$/i, + rtypenamespace = /^([^\.]*|)(?:\.(.+)|)$/, + rhoverHack = /(?:^|\s)hover(\.\S+|)\b/, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + hoverHack = function( events ) { + return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); + }; + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + add: function( elem, types, handler, data, selector ) { + + var elemData, eventHandle, events, + t, tns, type, namespaces, handleObj, + handleObjIn, handlers, special; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + events = elemData.events; + if ( !events ) { + elemData.events = events = {}; + } + eventHandle = elemData.handle; + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = jQuery.trim( hoverHack(types) ).split( " " ); + for ( t = 0; t < types.length; t++ ) { + + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + namespace: namespaces.join(".") + }, handleObjIn ); + + // Init the event handler queue if we're the first + handlers = events[ type ]; + if ( !handlers ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener/attachEvent if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var t, tns, type, origType, namespaces, origCount, + j, events, special, eventType, handleObj, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ); + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = jQuery.trim( hoverHack( types || "" ) ).split(" "); + for ( t = 0; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = origType = tns[1]; + namespaces = tns[2]; + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + + // Remove matching events + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !namespaces || namespaces.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + eventType.splice( j--, 1 ); + + if ( handleObj.selector ) { + eventType.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + delete elemData.handle; + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery.removeData( elem, "events", true ); + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Don't do events on text and comment nodes + if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { + return; + } + + // Event object or event type + var cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType, + type = event.type || event, + namespaces = []; + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "!" ) >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf( "." ) >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.isTrigger = true; + event.exclusive = exclusive; + event.namespace = namespaces.join( "." ); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; + + // Handle a global trigger + if ( !elem ) { + + // TODO: Stop taunting the data cache; remove global events and always attach to document + cache = jQuery.cache; + for ( i in cache ) { + if ( cache[ i ].events && cache[ i ].events[ type ] ) { + jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); + } + } + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; + for ( old = elem; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old === (elem.ownerDocument || document) ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + // Note that this is a bare JS function and not a jQuery handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply( cur, data ) === false ) { + event.preventDefault(); + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction() check here because IE6/7 fails that test. + // Don't do default actions on window, that's where global variables be (#6170) + // IE<9 dies on focus/blur to hidden element (#1486) + if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event || window.event ); + + var i, j, cur, jqcur, ret, selMatch, matched, matches, handleObj, sel, related, + handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = [].slice.call( arguments ), + run_all = !event.exclusive && !event.namespace, + special = jQuery.event.special[ event.type ] || {}, + handlerQueue = []; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers that should run if there are delegated events + // Avoid non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !(event.button && event.type === "click") ) { + + // Pregenerate a single jQuery object for reuse with .is() + jqcur = jQuery(this); + jqcur.context = this; + + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + + // Don't process clicks (ONLY) on disabled elements (#6911, #8165, #xxxx) + if ( cur.disabled !== true || event.type !== "click" ) { + selMatch = {}; + matches = []; + jqcur[0] = cur; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + + if ( selMatch[ sel ] === undefined ) { + selMatch[ sel ] = jqcur.is( sel ); + } + if ( selMatch[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); + } + } + } + } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** + props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button, + fromElement = original.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && fromElement ) { + event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = jQuery.Event( originalEvent ); + + for ( i = copy.length; i; ) { + prop = copy[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) + if ( !event.target ) { + event.target = originalEvent.srcElement || document; + } + + // Target should not be a text node (#504, Safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // For mouse/key events, metaKey==false if it's undefined (#3368, #11328; IE6/7/8) + event.metaKey = !!event.metaKey; + + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; + }, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady + }, + + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + + focus: { + delegateType: "focusin" + }, + blur: { + delegateType: "focusout" + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + var name = "on" + type; + + if ( elem.detachEvent ) { + + // #8545, #7054, preventing memory leaks for custom events in IE6-8 – + // detachEvent needed property on element, by name of that event, to properly expose it to GC + if ( typeof elem[ name ] === "undefined" ) { + elem[ name ] = null; + } + + elem.detachEvent( name, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj, + selector = handleObj.selector; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +}); + +// IE submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Lazy-add a submit handler when a descendant form may potentially be submitted + jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) + var elem = e.target, + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; + if ( form && !jQuery._data( form, "_submit_attached" ) ) { + jQuery.event.add( form, "submit._submit", function( event ) { + event._submit_bubble = true; + }); + jQuery._data( form, "_submit_attached", true ); + } + }); + // return undefined since we don't need an event listener + }, + + postDispatch: function( event ) { + // If form was submitted by the user, bubble the event up the tree + if ( event._submit_bubble ) { + delete event._submit_bubble; + if ( this.parentNode && !event.isTrigger ) { + jQuery.event.simulate( "submit", this.parentNode, event, true ); + } + } + }, + + teardown: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Remove delegated handlers; cleanData eventually reaps submit handlers attached above + jQuery.event.remove( this, "._submit" ); + } + }; +} + +// IE change delegation and checkbox/radio fix +if ( !jQuery.support.changeBubbles ) { + + jQuery.event.special.change = { + + setup: function() { + + if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click + // after a propertychange. Eat the blur-change in special.change.handle. + // This still fires onchange a second time for check/radio after blur. + if ( this.type === "checkbox" || this.type === "radio" ) { + jQuery.event.add( this, "propertychange._change", function( event ) { + if ( event.originalEvent.propertyName === "checked" ) { + this._just_changed = true; + } + }); + jQuery.event.add( this, "click._change", function( event ) { + if ( this._just_changed && !event.isTrigger ) { + this._just_changed = false; + } + // Allow triggered, simulated change events (#11500) + jQuery.event.simulate( "change", this, event, true ); + }); + } + return false; + } + // Delegated event; lazy-add a change handler on descendant inputs + jQuery.event.add( this, "beforeactivate._change", function( e ) { + var elem = e.target; + + if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "_change_attached" ) ) { + jQuery.event.add( elem, "change._change", function( event ) { + if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { + jQuery.event.simulate( "change", this.parentNode, event, true ); + } + }); + jQuery._data( elem, "_change_attached", true ); + } + }); + }, + + handle: function( event ) { + var elem = event.target; + + // Swallow native change events from checkbox/radio, we already triggered them above + if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + return event.handleObj.handler.apply( this, arguments ); + } + }, + + teardown: function() { + jQuery.event.remove( this, "._change" ); + + return rformElems.test( this.nodeName ); + } + }; +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { // && selector != null + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on( types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + live: function( types, data, fn ) { + jQuery( this.context ).on( types, this.selector, data, fn ); + return this; + }, + die: function( types, fn ) { + jQuery( this.context ).off( types, this.selector || "**", fn ); + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector || "**", fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; + + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + } +}); +/*! + * Sizzle CSS Selector Engine + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://sizzlejs.com/ + */ +(function( window, undefined ) { + +var cachedruns, + dirruns, + sortOrder, + siblingCheck, + assertGetIdNotName, + + document = window.document, + docElem = document.documentElement, + + strundefined = "undefined", + hasDuplicate = false, + baseHasDuplicate = true, + done = 0, + slice = [].slice, + push = [].push, + + expando = ( "sizcache" + Math.random() ).replace( ".", "" ), + + // Regex + + // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + // http://www.w3.org/TR/css3-syntax/#characters + characterEncoding = "(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+", + + // Loosely modeled on CSS identifier characters + // An unquoted value should be a CSS identifier (http://www.w3.org/TR/css3-selectors/#attribute-selectors) + // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = characterEncoding.replace( "w", "w#" ), + + // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors + operators = "([*^$|!~]?=)", + attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace + + "*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]", + pseudos = ":(" + characterEncoding + ")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|((?:[^,]|\\\\,|(?:,(?=[^\\[]*\\]))|(?:,(?=[^\\(]*\\))))*))\\)|)", + pos = ":(nth|eq|gt|lt|first|last|even|odd)(?:\\((\\d*)\\)|)(?=[^-]|$)", + combinators = whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*", + groups = "(?=[^\\x20\\t\\r\\n\\f])(?:\\\\.|" + attributes + "|" + pseudos.replace( 2, 7 ) + "|[^\\\\(),])+", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcombinators = new RegExp( "^" + combinators ), + + // All simple (non-comma) selectors, excluding insignifant trailing whitespace + rgroups = new RegExp( groups + "?(?=" + whitespace + "*,|$)", "g" ), + + // A selector, or everything after leading whitespace + // Optionally followed in either case by a ")" for terminating sub-selectors + rselector = new RegExp( "^(?:(?!,)(?:(?:^|,)" + whitespace + "*" + groups + ")*?|" + whitespace + "*(.*?))(\\)|$)" ), + + // All combinators and selector components (attribute test, tag, pseudo, etc.), the latter appearing together when consecutive + rtokens = new RegExp( groups.slice( 19, -6 ) + "\\x20\\t\\r\\n\\f>+~])+|" + combinators, "g" ), + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/, + + rsibling = /[\x20\t\r\n\f]*[+~]/, + rendsWithNot = /:not\($/, + + rheader = /h\d/i, + rinputs = /input|select|textarea|button/i, + + rbackslash = /\\(?!\\)/g, + + matchExpr = { + "ID": new RegExp( "^#(" + characterEncoding + ")" ), + "CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ), + "NAME": new RegExp( "^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]" ), + "TAG": new RegExp( "^(" + characterEncoding.replace( "[-", "[-\\*" ) + ")" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|nth|last|first)-child(?:\\(" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + "POS": new RegExp( pos, "ig" ), + // For use in libraries implementing .is() + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|" + pos, "i" ) + }, + + classCache = {}, + cachedClasses = [], + compilerCache = {}, + cachedSelectors = [], + + // Mark a function for use in filtering + markFunction = function( fn ) { + fn.sizzleFilter = true; + return fn; + }, + + // Returns a function to use in pseudos for input types + createInputFunction = function( type ) { + return function( elem ) { + // Check the input's nodeName and type + return elem.nodeName.toLowerCase() === "input" && elem.type === type; + }; + }, + + // Returns a function to use in pseudos for buttons + createButtonFunction = function( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; + }, + + // Used for testing something on an element + assert = function( fn ) { + var pass = false, + div = document.createElement("div"); + try { + pass = fn( div ); + } catch (e) {} + // release memory in IE + div = null; + return pass; + }, + + // Check if attributes should be retrieved by attribute nodes + assertAttributes = assert(function( div ) { + div.innerHTML = ""; + var type = typeof div.lastChild.getAttribute("multiple"); + // IE8 returns a string for some attributes even when not present + return type !== "boolean" && type !== "string"; + }), + + // Check if getElementById returns elements by name + // Check if getElementsByName privileges form controls or returns elements by ID + assertUsableName = assert(function( div ) { + // Inject content + div.id = expando + 0; + div.innerHTML = "
"; + docElem.insertBefore( div, docElem.firstChild ); + + // Test + var pass = document.getElementsByName && + // buggy browsers will return fewer than the correct 2 + document.getElementsByName( expando ).length === + // buggy browsers will return more than the correct 0 + 2 + document.getElementsByName( expando + 0 ).length; + assertGetIdNotName = !document.getElementById( expando ); + + // Cleanup + docElem.removeChild( div ); + + return pass; + }), + + // Check if the browser returns only elements + // when doing getElementsByTagName("*") + assertTagNameNoComments = assert(function( div ) { + div.appendChild( document.createComment("") ); + return div.getElementsByTagName("*").length === 0; + }), + + // Check if getAttribute returns normalized href attributes + assertHrefNotNormalized = assert(function( div ) { + div.innerHTML = ""; + return div.firstChild && typeof div.firstChild.getAttribute !== strundefined && + div.firstChild.getAttribute("href") === "#"; + }), + + // Check if getElementsByClassName can be trusted + assertUsableClassName = assert(function( div ) { + // Opera can't find a second classname (in 9.6) + div.innerHTML = ""; + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return false; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + return div.getElementsByClassName("e").length !== 1; + }); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + var match, elem, xml, m, + nodeType = context.nodeType; + + if ( nodeType !== 1 && nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + xml = isXML( context ); + + if ( !xml && !seed ) { + if ( (match = rquickExpr.exec( selector )) ) { + // Speed-up: Sizzle("#ID") + if ( (m = match[1]) ) { + if ( nodeType === 9 ) { + elem = context.getElementById( m ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE, Opera, and Webkit return items + // by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + } else { + // Context is not a document + if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) && + contains( context, elem ) && elem.id === m ) { + results.push( elem ); + return results; + } + } + + // Speed-up: Sizzle("TAG") + } else if ( match[2] ) { + push.apply( results, slice.call(context.getElementsByTagName( selector ), 0) ); + return results; + + // Speed-up: Sizzle(".CLASS") + } else if ( (m = match[3]) && assertUsableClassName && context.getElementsByClassName ) { + push.apply( results, slice.call(context.getElementsByClassName( m ), 0) ); + return results; + } + } + } + + // All others + return select( selector, context, results, seed, xml ); +}; + +var Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + match: matchExpr, + + order: [ "ID", "TAG" ], + + attrHandle: {}, + + createPseudo: markFunction, + + find: { + "ID": assertGetIdNotName ? + function( id, context, xml ) { + if ( typeof context.getElementById !== strundefined && !xml ) { + var m = context.getElementById( id ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + } : + function( id, context, xml ) { + if ( typeof context.getElementById !== strundefined && !xml ) { + var m = context.getElementById( id ); + + return m ? + m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ? + [m] : + undefined : + []; + } + }, + + "TAG": assertTagNameNoComments ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== strundefined ) { + return context.getElementsByTagName( tag ); + } + } : + function( tag, context ) { + var results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + var elem, + tmp = [], + i = 0; + + for ( ; (elem = results[i]); i++ ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + } + }, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( rbackslash, "" ); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[4] || match[5] || "" ).replace( rbackslash, "" ); + + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + /* matches from matchExpr.CHILD + 1 type (only|nth|...) + 2 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 3 xn-component of xn+y argument ([+-]?\d*n|) + 4 sign of xn-component + 5 x of xn-component + 6 sign of y-component + 7 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1] === "nth" ) { + // nth-child requires argument + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[3] = +( match[3] ? match[4] + (match[5] || 1) : 2 * ( match[2] === "even" || match[2] === "odd" ) ); + match[4] = +( ( match[6] + match[7] ) || match[2] === "odd" ); + + // other types prohibit arguments + } else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var argument, + unquoted = match[4]; + + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } + + // Relinquish our claim on characters in `unquoted` from a closing parenthesis on + if ( unquoted && (argument = rselector.exec( unquoted )) && argument.pop() ) { + + match[0] = match[0].slice( 0, argument[0].length - unquoted.length - 1 ); + unquoted = argument[0].slice( 0, -1 ); + } + + // Quoted or unquoted, we have the full argument + // Return only captures needed by the pseudo filter method (type and argument) + match.splice( 2, 3, unquoted || match[3] ); + return match; + } + }, + + filter: { + "ID": assertGetIdNotName ? + function( id ) { + id = id.replace( rbackslash, "" ); + return function( elem ) { + return elem.getAttribute("id") === id; + }; + } : + function( id ) { + id = id.replace( rbackslash, "" ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id"); + return node && node.value === id; + }; + }, + + "TAG": function( nodeName ) { + if ( nodeName === "*" ) { + return function() { return true; }; + } + nodeName = nodeName.replace( rbackslash, "" ).toLowerCase(); + + return function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className ]; + if ( !pattern ) { + pattern = classCache[ className ] = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" ); + cachedClasses.push( className ); + // Avoid too large of a cache + if ( cachedClasses.length > Expr.cacheLength ) { + delete classCache[ cachedClasses.shift() ]; + } + } + return function( elem ) { + return pattern.test( elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "" ); + }; + }, + + "ATTR": function( name, operator, check ) { + if ( !operator ) { + return function( elem ) { + return Sizzle.attr( elem, name ) != null; + }; + } + + return function( elem ) { + var result = Sizzle.attr( elem, name ), + value = result + ""; + + if ( result == null ) { + return operator === "!="; + } + + switch ( operator ) { + case "=": + return value === check; + case "!=": + return value !== check; + case "^=": + return check && value.indexOf( check ) === 0; + case "*=": + return check && value.indexOf( check ) > -1; + case "$=": + return check && value.substr( value.length - check.length ) === check; + case "~=": + return ( " " + value + " " ).indexOf( check ) > -1; + case "|=": + return value === check || value.substr( 0, check.length + 1 ) === check + "-"; + } + }; + }, + + "CHILD": function( type, argument, first, last ) { + + if ( type === "nth" ) { + var doneName = done++; + + return function( elem ) { + var parent, diff, + count = 0, + node = elem; + + if ( first === 1 && last === 0 ) { + return true; + } + + parent = elem.parentNode; + + if ( parent && (parent[ expando ] !== doneName || !elem.sizset) ) { + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.sizset = ++count; + if ( node === elem ) { + break; + } + } + } + + parent[ expando ] = doneName; + } + + diff = elem.sizset - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + }; + } + + return function( elem ) { + var node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + /* falls through */ + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + } + }; + }, + + "PSEUDO": function( pseudo, argument, context, xml ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + var fn = Expr.pseudos[ pseudo ] || Expr.pseudos[ pseudo.toLowerCase() ]; + + if ( !fn ) { + Sizzle.error( "unsupported pseudo: " + pseudo ); + } + + // The user may set fn.sizzleFilter to indicate + // that arguments are needed to create the filter function + // just as Sizzle does + if ( !fn.sizzleFilter ) { + return fn; + } + + return fn( argument, context, xml ); + } + }, + + pseudos: { + "not": markFunction(function( selector, context, xml ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var matcher = compile( selector.replace( rtrim, "$1" ), context, xml ); + return function( elem ) { + return !matcher( elem ); + }; + }), + + "enabled": function( elem ) { + return elem.disabled === false; + }, + + "disabled": function( elem ) { + return elem.disabled === true; + }, + + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, + + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, + + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is only affected by element nodes and content nodes(including text(3), cdata(4)), + // not comment, processing instructions, or others + // Thanks to Diego Perini for the nodeName shortcut + // Greater than "@" means alpha characters (specifically not starting with "#" or "?") + var nodeType; + elem = elem.firstChild; + while ( elem ) { + if ( elem.nodeName > "@" || (nodeType = elem.nodeType) === 3 || nodeType === 4 ) { + return false; + } + elem = elem.nextSibling; + } + return true; + }, + + "contains": markFunction(function( text ) { + return function( elem ) { + return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), + + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "text": function( elem ) { + var type, attr; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && + (type = elem.type) === "text" && + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === type ); + }, + + // Input types + "radio": createInputFunction("radio"), + "checkbox": createInputFunction("checkbox"), + "file": createInputFunction("file"), + "password": createInputFunction("password"), + "image": createInputFunction("image"), + + "submit": createButtonFunction("submit"), + "reset": createButtonFunction("reset"), + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "focus": function( elem ) { + var doc = elem.ownerDocument; + return elem === doc.activeElement && (!doc.hasFocus || doc.hasFocus()) && !!(elem.type || elem.href); + }, + + "active": function( elem ) { + return elem === elem.ownerDocument.activeElement; + } + }, + + setFilters: { + "first": function( elements, argument, not ) { + return not ? elements.slice( 1 ) : [ elements[0] ]; + }, + + "last": function( elements, argument, not ) { + var elem = elements.pop(); + return not ? elements : [ elem ]; + }, + + "even": function( elements, argument, not ) { + var results = [], + i = not ? 1 : 0, + len = elements.length; + for ( ; i < len; i = i + 2 ) { + results.push( elements[i] ); + } + return results; + }, + + "odd": function( elements, argument, not ) { + var results = [], + i = not ? 0 : 1, + len = elements.length; + for ( ; i < len; i = i + 2 ) { + results.push( elements[i] ); + } + return results; + }, + + "lt": function( elements, argument, not ) { + return not ? elements.slice( +argument ) : elements.slice( 0, +argument ); + }, + + "gt": function( elements, argument, not ) { + return not ? elements.slice( 0, +argument + 1 ) : elements.slice( +argument + 1 ); + }, + + "eq": function( elements, argument, not ) { + var elem = elements.splice( +argument, 1 ); + return not ? elements : elem; + } + } +}; + +// Deprecated +Expr.setFilters["nth"] = Expr.setFilters["eq"]; + +// Back-compat +Expr.filters = Expr.pseudos; + +// IE6/7 return a modified href +if ( !assertHrefNotNormalized ) { + Expr.attrHandle = { + "href": function( elem ) { + return elem.getAttribute( "href", 2 ); + }, + "type": function( elem ) { + return elem.getAttribute("type"); + } + }; +} + +// Add getElementsByName if usable +if ( assertUsableName ) { + Expr.order.push("NAME"); + Expr.find["NAME"] = function( name, context ) { + if ( typeof context.getElementsByName !== strundefined ) { + return context.getElementsByName( name ); + } + }; +} + +// Add getElementsByClassName if usable +if ( assertUsableClassName ) { + Expr.order.splice( 1, 0, "CLASS" ); + Expr.find["CLASS"] = function( className, context, xml ) { + if ( typeof context.getElementsByClassName !== strundefined && !xml ) { + return context.getElementsByClassName( className ); + } + }; +} + +// If slice is not available, provide a backup +try { + slice.call( docElem.childNodes, 0 )[0].nodeType; +} catch ( e ) { + slice = function( i ) { + var elem, results = []; + for ( ; (elem = this[i]); i++ ) { + results.push( elem ); + } + return results; + }; +} + +var isXML = Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = elem && (elem.ownerDocument || elem).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +// Element contains another +var contains = Sizzle.contains = docElem.compareDocumentPosition ? + function( a, b ) { + return !!( a.compareDocumentPosition( b ) & 16 ); + } : + docElem.contains ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && adown.contains && adown.contains(bup) ); + } : + function( a, b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } + return false; + }; + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +var getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( nodeType ) { + if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (see #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + // Do not include comment or processing instruction nodes + } else { + + // If no nodeType, this is expected to be an array + for ( ; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } + return ret; +}; + +Sizzle.attr = function( elem, name ) { + var attr, + xml = isXML( elem ); + + if ( !xml ) { + name = name.toLowerCase(); + } + if ( Expr.attrHandle[ name ] ) { + return Expr.attrHandle[ name ]( elem ); + } + if ( assertAttributes || xml ) { + return elem.getAttribute( name ); + } + attr = elem.getAttributeNode( name ); + return attr ? + typeof elem[ name ] === "boolean" ? + elem[ name ] ? name : null : + attr.specified ? attr.value : null : + null; +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +// Check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + return (baseHasDuplicate = 0); +}); + + +if ( docElem.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + return ( !a.compareDocumentPosition || !b.compareDocumentPosition ? + a.compareDocumentPosition : + a.compareDocumentPosition(b) & 4 + ) ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Document sorting and removing duplicates +Sizzle.uniqueSort = function( results ) { + var elem, + i = 1; + + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( ; (elem = results[i]); i++ ) { + if ( elem === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +function multipleContexts( selector, contexts, results, seed ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results, seed ); + } +} + +function handlePOSGroup( selector, posfilter, argument, contexts, seed, not ) { + var results, + fn = Expr.setFilters[ posfilter.toLowerCase() ]; + + if ( !fn ) { + Sizzle.error( posfilter ); + } + + if ( selector || !(results = seed) ) { + multipleContexts( selector || "*", contexts, (results = []), seed ); + } + + return results.length > 0 ? fn( results, argument, not ) : []; +} + +function handlePOS( selector, context, results, seed, groups ) { + var match, not, anchor, ret, elements, currentContexts, part, lastIndex, + i = 0, + len = groups.length, + rpos = matchExpr["POS"], + // This is generated here in case matchExpr["POS"] is extended + rposgroups = new RegExp( "^" + rpos.source + "(?!" + whitespace + ")", "i" ), + // This is for making sure non-participating + // matching groups are represented cross-browser (IE6-8) + setUndefined = function() { + var i = 1, + len = arguments.length - 2; + for ( ; i < len; i++ ) { + if ( arguments[i] === undefined ) { + match[i] = undefined; + } + } + }; + + for ( ; i < len; i++ ) { + // Reset regex index to 0 + rpos.exec(""); + selector = groups[i]; + ret = []; + anchor = 0; + elements = seed; + while ( (match = rpos.exec( selector )) ) { + lastIndex = rpos.lastIndex = match.index + match[0].length; + if ( lastIndex > anchor ) { + part = selector.slice( anchor, match.index ); + anchor = lastIndex; + currentContexts = [ context ]; + + if ( rcombinators.test(part) ) { + if ( elements ) { + currentContexts = elements; + } + elements = seed; + } + + if ( (not = rendsWithNot.test( part )) ) { + part = part.slice( 0, -5 ).replace( rcombinators, "$&*" ); + } + + if ( match.length > 1 ) { + match[0].replace( rposgroups, setUndefined ); + } + elements = handlePOSGroup( part, match[1], match[2], currentContexts, elements, not ); + } + } + + if ( elements ) { + ret = ret.concat( elements ); + + if ( (part = selector.slice( anchor )) && part !== ")" ) { + if ( rcombinators.test(part) ) { + multipleContexts( part, ret, results, seed ); + } else { + Sizzle( part, context, results, seed ? seed.concat(elements) : elements ); + } + } else { + push.apply( results, ret ); + } + } else { + Sizzle( selector, context, results, seed ); + } + } + + // Do not sort if this is a single filter + return len === 1 ? results : Sizzle.uniqueSort( results ); +} + +function tokenize( selector, context, xml ) { + var tokens, soFar, type, + groups = [], + i = 0, + + // Catch obvious selector issues: terminal ")"; nonempty fallback match + // rselector never fails to match *something* + match = rselector.exec( selector ), + matched = !match.pop() && !match.pop(), + selectorGroups = matched && selector.match( rgroups ) || [""], + + preFilters = Expr.preFilter, + filters = Expr.filter, + checkContext = !xml && context !== document; + + for ( ; (soFar = selectorGroups[i]) != null && matched; i++ ) { + groups.push( tokens = [] ); + + // Need to make sure we're within a narrower context if necessary + // Adding a descendant combinator will generate what is needed + if ( checkContext ) { + soFar = " " + soFar; + } + + while ( soFar ) { + matched = false; + + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + soFar = soFar.slice( match[0].length ); + + // Cast descendant combinators to space + matched = tokens.push({ part: match.pop().replace( rtrim, " " ), captures: match }); + } + + // Filters + for ( type in filters ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + (match = preFilters[ type ]( match, context, xml )) ) ) { + + soFar = soFar.slice( match.shift().length ); + matched = tokens.push({ part: type, captures: match }); + } + } + + if ( !matched ) { + break; + } + } + } + + if ( !matched ) { + Sizzle.error( selector ); + } + + return groups; +} + +function addCombinator( matcher, combinator, context ) { + var dir = combinator.dir, + doneName = done++; + + if ( !matcher ) { + // If there is no matcher to check, check against the context + matcher = function( elem ) { + return elem === context; + }; + } + return combinator.first ? + function( elem, context ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 ) { + return matcher( elem, context ) && elem; + } + } + } : + function( elem, context ) { + var cache, + dirkey = doneName + "." + dirruns, + cachedkey = dirkey + "." + cachedruns; + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 ) { + if ( (cache = elem[ expando ]) === cachedkey ) { + return elem.sizset; + } else if ( typeof cache === "string" && cache.indexOf(dirkey) === 0 ) { + if ( elem.sizset ) { + return elem; + } + } else { + elem[ expando ] = cachedkey; + if ( matcher( elem, context ) ) { + elem.sizset = true; + return elem; + } + elem.sizset = false; + } + } + } + }; +} + +function addMatcher( higher, deeper ) { + return higher ? + function( elem, context ) { + var result = deeper( elem, context ); + return result && higher( result === true ? elem : result, context ); + } : + deeper; +} + +// ["TAG", ">", "ID", " ", "CLASS"] +function matcherFromTokens( tokens, context, xml ) { + var token, matcher, + i = 0; + + for ( ; (token = tokens[i]); i++ ) { + if ( Expr.relative[ token.part ] ) { + matcher = addCombinator( matcher, Expr.relative[ token.part ], context ); + } else { + token.captures.push( context, xml ); + matcher = addMatcher( matcher, Expr.filter[ token.part ].apply( null, token.captures ) ); + } + } + + return matcher; +} + +function matcherFromGroupMatchers( matchers ) { + return function( elem, context ) { + var matcher, + j = 0; + for ( ; (matcher = matchers[j]); j++ ) { + if ( matcher(elem, context) ) { + return true; + } + } + return false; + }; +} + +var compile = Sizzle.compile = function( selector, context, xml ) { + var tokens, group, i, + cached = compilerCache[ selector ]; + + // Return a cached group function if already generated (context dependent) + if ( cached && cached.context === context ) { + return cached; + } + + // Generate a function of recursive functions that can be used to check each element + group = tokenize( selector, context, xml ); + for ( i = 0; (tokens = group[i]); i++ ) { + group[i] = matcherFromTokens( tokens, context, xml ); + } + + // Cache the compiled function + cached = compilerCache[ selector ] = matcherFromGroupMatchers( group ); + cached.context = context; + cached.runs = cached.dirruns = 0; + cachedSelectors.push( selector ); + // Ensure only the most recent are cached + if ( cachedSelectors.length > Expr.cacheLength ) { + delete compilerCache[ cachedSelectors.shift() ]; + } + return cached; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + return Sizzle( expr, null, null, [ elem ] ).length > 0; +}; + +var select = function( selector, context, results, seed, xml ) { + // Remove excessive whitespace + selector = selector.replace( rtrim, "$1" ); + var elements, matcher, i, len, elem, token, + type, findContext, notTokens, + match = selector.match( rgroups ), + tokens = selector.match( rtokens ), + contextNodeType = context.nodeType; + + // POS handling + if ( matchExpr["POS"].test(selector) ) { + return handlePOS( selector, context, results, seed, match ); + } + + if ( seed ) { + elements = slice.call( seed, 0 ); + + // To maintain document order, only narrow the + // set if there is one group + } else if ( match && match.length === 1 ) { + + // Take a shortcut and set the context if the root selector is an ID + if ( tokens.length > 1 && contextNodeType === 9 && !xml && + (match = matchExpr["ID"].exec( tokens[0] )) ) { + + context = Expr.find["ID"]( match[1], context, xml )[0]; + if ( !context ) { + return results; + } + + selector = selector.slice( tokens.shift().length ); + } + + findContext = ( (match = rsibling.exec( tokens[0] )) && !match.index && context.parentNode ) || context; + + // Get the last token, excluding :not + notTokens = tokens.pop(); + token = notTokens.split(":not")[0]; + + for ( i = 0, len = Expr.order.length; i < len; i++ ) { + type = Expr.order[i]; + + if ( (match = matchExpr[ type ].exec( token )) ) { + elements = Expr.find[ type ]( (match[1] || "").replace( rbackslash, "" ), findContext, xml ); + + if ( elements == null ) { + continue; + } + + if ( token === notTokens ) { + selector = selector.slice( 0, selector.length - notTokens.length ) + + token.replace( matchExpr[ type ], "" ); + + if ( !selector ) { + push.apply( results, slice.call(elements, 0) ); + } + } + break; + } + } + } + + // Only loop over the given elements once + // If selector is empty, we're already done + if ( selector ) { + matcher = compile( selector, context, xml ); + dirruns = matcher.dirruns++; + + if ( elements == null ) { + elements = Expr.find["TAG"]( "*", (rsibling.test( selector ) && context.parentNode) || context ); + } + for ( i = 0; (elem = elements[i]); i++ ) { + cachedruns = matcher.runs++; + if ( matcher(elem, context) ) { + results.push( elem ); + } + } + } + + return results; +}; + +if ( document.querySelectorAll ) { + (function() { + var disconnectedMatch, + oldSelect = select, + rescape = /'|\\/g, + rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g, + rbuggyQSA = [], + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + // A support test would require too much code (would include document ready) + // just skip matchesSelector for :active + rbuggyMatches = [":active"], + matches = docElem.matchesSelector || + docElem.mozMatchesSelector || + docElem.webkitMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector; + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( div ) { + div.innerHTML = ""; + + // IE8 - Some boolean attributes are not treated correctly + if ( !div.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here (do not put tests after this one) + if ( !div.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } + }); + + assert(function( div ) { + + // Opera 10-12/IE9 - ^= $= *= and empty values + // Should not select anything + div.innerHTML = "

"; + if ( div.querySelectorAll("[test^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:\"\"|'')" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here (do not put tests after this one) + div.innerHTML = ""; + if ( !div.querySelectorAll(":enabled").length ) { + rbuggyQSA.push(":enabled", ":disabled"); + } + }); + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") ); + + select = function( selector, context, results, seed, xml ) { + // Only use querySelectorAll when not filtering, + // when this is not xml, + // and when no QSA bugs apply + if ( !seed && !xml && (!rbuggyQSA || !rbuggyQSA.test( selector )) ) { + if ( context.nodeType === 9 ) { + try { + push.apply( results, slice.call(context.querySelectorAll( selector ), 0) ); + return results; + } catch(qsaError) {} + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var old = context.getAttribute("id"), + nid = old || expando, + newContext = rsibling.test( selector ) && context.parentNode || context; + + if ( old ) { + nid = nid.replace( rescape, "\\$&" ); + } else { + context.setAttribute( "id", nid ); + } + + try { + push.apply( results, slice.call( newContext.querySelectorAll( + selector.replace( rgroups, "[id='" + nid + "'] $&" ) + ), 0 ) ); + return results; + } catch(qsaError) { + } finally { + if ( !old ) { + context.removeAttribute("id"); + } + } + } + } + + return oldSelect( selector, context, results, seed, xml ); + }; + + if ( matches ) { + assert(function( div ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + disconnectedMatch = matches.call( div, "div" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + try { + matches.call( div, "[test!='']:sizzle" ); + rbuggyMatches.push( Expr.match.PSEUDO ); + } catch ( e ) {} + }); + + // rbuggyMatches always contains :active, so no need for a length check + rbuggyMatches = /* rbuggyMatches.length && */ new RegExp( rbuggyMatches.join("|") ); + + Sizzle.matchesSelector = function( elem, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace( rattributeQuotes, "='$1']" ); + + // rbuggyMatches always contains :active, so no need for an existence check + if ( !isXML( elem ) && !rbuggyMatches.test( expr ) && (!rbuggyQSA || !rbuggyQSA.test( expr )) ) { + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch(e) {} + } + + return Sizzle( expr, null, null, [ elem ] ).length > 0; + }; + } + })(); +} + +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.pseudos; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})( window ); +var runtil = /Until$/, + rparentsprev = /^(?:parents|prev(?:Until|All))/, + isSimple = /^.[^:#\[\.,]*$/, + rneedsContext = jQuery.expr.match.needsContext, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var i, l, length, n, r, ret, + self = this; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + ret = this.pushStack( "", "find", selector ); + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var i, + targets = jQuery( target, this ), + len = targets.length; + + return this.filter(function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + rneedsContext.test( selector ) ? + jQuery( selector, this.context ).index( this[0] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + ret = [], + pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( ; i < l; i++ ) { + cur = this[i]; + + while ( cur && cur.ownerDocument && cur !== context && cur.nodeType !== 11 ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + } + cur = cur.parentNode; + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter(selector) + ); + } +}); + +jQuery.fn.andSelf = jQuery.fn.addBack; + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +function sibling( cur, dir ) { + do { + cur = cur[ dir ]; + } while ( cur && cur.nodeType !== 1 ); + + return cur; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( this.length > 1 && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, core_slice.call( arguments ).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return ( elem === qualifier ) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; + }); +} +function createSafeFragment( document ) { + var list = nodeNames.split( "|" ), + safeFrag = document.createDocumentFragment(); + + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} + +var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" + + "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", + rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi, + rtagName = /<([\w:]+)/, + rtbody = /
", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + col: [ 2, "", "
" ], + area: [ 1, "", "" ], + _default: [ 0, "", "" ] + }, + safeFragment = createSafeFragment( document ), + fragmentDiv = safeFragment.appendChild( document.createElement("div") ); + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags, +// unless wrapped in a div with non-breaking characters in front of it. +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "X
", "
" ]; +} + +jQuery.fn.extend({ + text: function( value ) { + return jQuery.access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) ); + }, null, value, arguments.length ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + var isFunction = jQuery.isFunction( html ); + + return this.each(function(i) { + jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( !isDisconnected( this[0] ) ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } + + if ( arguments.length ) { + var set = jQuery.clean( arguments ); + return this.pushStack( jQuery.merge( set, this ), "before", this.selector ); + } + }, + + after: function() { + if ( !isDisconnected( this[0] ) ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } + + if ( arguments.length ) { + var set = jQuery.clean( arguments ); + return this.pushStack( jQuery.merge( this, set ), "after", this.selector ); + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + var elem, + i = 0; + + for ( ; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + var elem, + i = 0; + + for ( ; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + return jQuery.access( this, function( value ) { + var elem = this[0] || {}, + i = 0, + l = this.length; + + if ( value === undefined ) { + return elem.nodeType === 1 ? + elem.innerHTML.replace( rinlinejQuery, "" ) : + undefined; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + ( jQuery.support.htmlSerialize || !rnoshimcache.test( value ) ) && + ( jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value ) ) && + !wrapMap[ ( rtagName.exec( value ) || ["", ""] )[1].toLowerCase() ] ) { + + value = value.replace( rxhtmlTag, "<$1>" ); + + try { + for (; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + elem = this[i] || {}; + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName( "*" ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch(e) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function( value ) { + if ( !isDisconnected( this[0] ) ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } + + return this.length ? + this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : + this; + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + + // Flatten any nested arrays + args = [].concat.apply( [], args ); + + var results, first, fragment, iNoClone, + i = 0, + value = args[0], + scripts = [], + l = this.length; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && l > 1 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call( this, i, table ? self.html() : undefined ); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + results = jQuery.buildFragment( args, this, scripts ); + fragment = results.fragment; + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + // Use the original fragment for the last item instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + // Fragments from the fragment cache must always be cloned and never used in place. + for ( iNoClone = results.cacheable || l - 1; i < l; i++ ) { + callback.call( + table && jQuery.nodeName( this[i], "table" ) ? + findOrAppend( this[i], "tbody" ) : + this[i], + i === iNoClone ? + fragment : + jQuery.clone( fragment, true, true ) + ); + } + } + + // Fix #11809: Avoid leaking memory + fragment = first = null; + + if ( scripts.length ) { + jQuery.each( scripts, function( i, elem ) { + if ( elem.src ) { + if ( jQuery.ajax ) { + jQuery.ajax({ + url: elem.src, + type: "GET", + dataType: "script", + async: false, + global: false, + "throws": true + }); + } else { + jQuery.error("no ajax"); + } + } else { + jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "" ) ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + }); + } + } + + return this; + } +}); + +function findOrAppend( elem, tag ) { + return elem.getElementsByTagName( tag )[0] || elem.appendChild( elem.ownerDocument.createElement( tag ) ); +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var type, i, l, + oldData = jQuery._data( src ), + curData = jQuery._data( dest, oldData ), + events = oldData.events; + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + + // make the cloned public data object a copy from the original + if ( curData.data ) { + curData.data = jQuery.extend( {}, curData.data ); + } +} + +function cloneFixAttributes( src, dest ) { + var nodeName; + + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + // clearAttributes removes the attributes, which we don't want, + // but also removes the attachEvent events, which we *do* want + if ( dest.clearAttributes ) { + dest.clearAttributes(); + } + + // mergeAttributes, in contrast, only merges back on the + // original attributes, not the events + if ( dest.mergeAttributes ) { + dest.mergeAttributes( src ); + } + + nodeName = dest.nodeName.toLowerCase(); + + if ( nodeName === "object" ) { + // IE6-10 improperly clones children of object elements using classid. + // IE10 throws NoModificationAllowedError if parent is null, #12132. + if ( dest.parentNode ) { + dest.outerHTML = src.outerHTML; + } + + // This path appears unavoidable for IE9. When cloning an object + // element in IE9, the outerHTML strategy above is not sufficient. + // If the src has innerHTML and the destination does not, + // copy the src.innerHTML into the dest.innerHTML. #10324 + if ( jQuery.support.html5Clone && (src.innerHTML && !jQuery.trim(dest.innerHTML)) ) { + dest.innerHTML = src.innerHTML; + } + + } else if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + + dest.defaultChecked = dest.checked = src.checked; + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + + // IE blanks contents when cloning scripts + } else if ( nodeName === "script" && dest.text !== src.text ) { + dest.text = src.text; + } + + // Event data gets referenced instead of copied if the expando + // gets copied too + dest.removeAttribute( jQuery.expando ); +} + +jQuery.buildFragment = function( args, context, scripts ) { + var fragment, cacheable, cachehit, + first = args[ 0 ]; + + // Set context from what may come in as undefined or a jQuery collection or a node + context = context || document; + context = (context[0] || context).ownerDocument || context[0] || context; + + // Ensure that an attr object doesn't incorrectly stand in as a document object + // Chrome and Firefox seem to allow this to occur and will throw exception + // Fixes #8950 + if ( typeof context.createDocumentFragment === "undefined" ) { + context = document; + } + + // Only cache "small" (1/2 KB) HTML strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put or elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501 + if ( args.length === 1 && typeof first === "string" && first.length < 512 && context === document && + first.charAt(0) === "<" && !rnocache.test( first ) && + (jQuery.support.checkClone || !rchecked.test( first )) && + (jQuery.support.html5Clone || !rnoshimcache.test( first )) ) { + + // Mark cacheable and look for a hit + cacheable = true; + fragment = jQuery.fragments[ first ]; + cachehit = fragment !== undefined; + } + + if ( !fragment ) { + fragment = context.createDocumentFragment(); + jQuery.clean( args, context, fragment, scripts ); + + // Update the cache, but only store false + // unless this is a second parsing of the same content + if ( cacheable ) { + jQuery.fragments[ first ] = cachehit && fragment; + } + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + i = 0, + ret = [], + insert = jQuery( selector ), + l = insert.length, + parent = this.length === 1 && this[0].parentNode; + + if ( (parent == null || parent && parent.nodeType === 11 && parent.childNodes.length === 1) && l === 1 ) { + insert[ original ]( this[0] ); + return this; + } else { + for ( ; i < l; i++ ) { + elems = ( i > 0 ? this.clone(true) : this ).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +function getAll( elem ) { + if ( typeof elem.getElementsByTagName !== "undefined" ) { + return elem.getElementsByTagName( "*" ); + + } else if ( typeof elem.querySelectorAll !== "undefined" ) { + return elem.querySelectorAll( "*" ); + + } else { + return []; + } +} + +// Used in clean, fixes the defaultChecked property +function fixDefaultChecked( elem ) { + if ( rcheckableType.test( elem.type ) ) { + elem.defaultChecked = elem.checked; + } +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var srcElements, + destElements, + i, + clone; + + if ( jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ) { + clone = elem.cloneNode( true ); + + // IE<=8 does not properly clone detached, unknown element nodes + } else { + fragmentDiv.innerHTML = elem.outerHTML; + fragmentDiv.removeChild( clone = fragmentDiv.firstChild ); + } + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + // IE copies events bound via attachEvent when using cloneNode. + // Calling detachEvent on the clone will also remove the events + // from the original. In order to get around this, we use some + // proprietary methods to clear the events. Thanks to MooTools + // guys for this hotness. + + cloneFixAttributes( elem, clone ); + + // Using Sizzle here is crazy slow, so we use getElementsByTagName instead + srcElements = getAll( elem ); + destElements = getAll( clone ); + + // Weird iteration because IE will replace the length property + // with an element if you are cloning the body and one of the + // elements on the page has a name or id of "length" + for ( i = 0; srcElements[i]; ++i ) { + // Ensure that the destination node is not null; Fixes #9587 + if ( destElements[i] ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + cloneCopyEvent( elem, clone ); + + if ( deepDataAndEvents ) { + srcElements = getAll( elem ); + destElements = getAll( clone ); + + for ( i = 0; srcElements[i]; ++i ) { + cloneCopyEvent( srcElements[i], destElements[i] ); + } + } + } + + srcElements = destElements = null; + + // Return the cloned set + return clone; + }, + + clean: function( elems, context, fragment, scripts ) { + var j, safe, elem, tag, wrap, depth, div, hasBody, tbody, len, handleScript, jsTags, + i = 0, + ret = []; + + // Ensure that context is a document + if ( !context || typeof context.createDocumentFragment === "undefined" ) { + context = document; + } + + // Use the already-created safe fragment if context permits + for ( safe = context === document && safeFragment; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + if ( !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + } else { + // Ensure a safe container in which to render the html + safe = safe || createSafeFragment( context ); + div = div || safe.appendChild( context.createElement("div") ); + + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1>"); + + // Go to html and back, then peel off extra wrappers + tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + depth = wrap[0]; + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted
, *may* have spurious + hasBody = rtbody.test(elem); + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare or + wrap[1] === "
" && !hasBody ? + div.childNodes : + []; + + for ( j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + + // Remember the top-level container for proper cleanup + div = safe.lastChild; + } + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + ret = jQuery.merge( ret, elem ); + } + } + + // Fix #11356: Clear elements from safeFragment + if ( div ) { + safe.removeChild( div ); + elem = div = safe = null; + } + + // Reset defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + if ( !jQuery.support.appendChecked ) { + for ( i = 0; (elem = ret[i]) != null; i++ ) { + if ( jQuery.nodeName( elem, "input" ) ) { + fixDefaultChecked( elem ); + } else if ( typeof elem.getElementsByTagName !== "undefined" ) { + jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); + } + } + } + + // Append elements to a provided document fragment + if ( fragment ) { + // Special handling of each script element + handleScript = function( elem ) { + // Check if we consider it executable + if ( !elem.type || rscriptType.test( elem.type ) ) { + // Detach the script and store it in the scripts array (if provided) or the fragment + // Return truthy to indicate that it has been handled + return scripts ? + scripts.push( elem.parentNode ? elem.parentNode.removeChild( elem ) : elem ) : + fragment.appendChild( elem ); + } + }; + + for ( i = 0; (elem = ret[i]) != null; i++ ) { + // Check if we're done after handling an executable script + if ( !( jQuery.nodeName( elem, "script" ) && handleScript( elem ) ) ) { + // Append to fragment and handle embedded scripts + fragment.appendChild( elem ); + if ( typeof elem.getElementsByTagName !== "undefined" ) { + // handleScript alters the DOM, so use jQuery.merge to ensure snapshot iteration + jsTags = jQuery.grep( jQuery.merge( [], elem.getElementsByTagName("script") ), handleScript ); + + // Splice the scripts into ret after their former ancestor and advance our index beyond them + ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); + i += jsTags.length; + } + } + } + } + + return ret; + }, + + cleanData: function( elems, /* internal */ acceptData ) { + var data, id, elem, type, + i = 0, + internalKey = jQuery.expando, + cache = jQuery.cache, + deleteExpando = jQuery.support.deleteExpando, + special = jQuery.event.special; + + for ( ; (elem = elems[i]) != null; i++ ) { + + if ( acceptData || jQuery.acceptData( elem ) ) { + + id = elem[ internalKey ]; + data = id && cache[ id ]; + + if ( data ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Remove cache only if it was not already removed by jQuery.event.remove + if ( cache[ id ] ) { + + delete cache[ id ]; + + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( deleteExpando ) { + delete elem[ internalKey ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( internalKey ); + + } else { + elem[ internalKey ] = null; + } + + jQuery.deletedIds.push( id ); + } + } + } + } + } +}); +// Limit scope pollution from any deprecated API +(function() { + +var matched, browser; + +// Use of jQuery.browser is frowned upon. +// More details: http://api.jquery.com/jQuery.browser +// jQuery.uaMatch maintained for back-compat +jQuery.uaMatch = function( ua ) { + ua = ua.toLowerCase(); + + var match = /(chrome)[ \/]([\w.]+)/.exec( ua ) || + /(webkit)[ \/]([\w.]+)/.exec( ua ) || + /(opera)(?:.*version|)[ \/]([\w.]+)/.exec( ua ) || + /(msie) ([\w.]+)/.exec( ua ) || + ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec( ua ) || + []; + + return { + browser: match[ 1 ] || "", + version: match[ 2 ] || "0" + }; +}; + +matched = jQuery.uaMatch( navigator.userAgent ); +browser = {}; + +if ( matched.browser ) { + browser[ matched.browser ] = true; + browser.version = matched.version; +} + +// Deprecated, use jQuery.browser.webkit instead +// Maintained for back-compat only +if ( browser.webkit ) { + browser.safari = true; +} + +jQuery.browser = browser; + +jQuery.sub = function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; +}; + +})(); +var curCSS, iframe, iframeDoc, + ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + rposition = /^(top|right|bottom|left)$/, + rmargin = /^margin/, + rnumsplit = new RegExp( "^(" + core_pnum + ")(.*)$", "i" ), + rnumnonpx = new RegExp( "^(" + core_pnum + ")(?!px)[a-z%]+$", "i" ), + rrelNum = new RegExp( "^([-+])=(" + core_pnum + ")", "i" ), + elemdisplay = {}, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: 0, + fontWeight: 400, + lineHeight: 1 + }, + + cssExpand = [ "Top", "Right", "Bottom", "Left" ], + cssPrefixes = [ "Webkit", "O", "Moz", "ms" ], + + eventsToggle = jQuery.fn.toggle; + +// return a css property mapped to a potentially vendor prefixed property +function vendorPropName( style, name ) { + + // shortcut for names that are not vendor prefixed + if ( name in style ) { + return name; + } + + // check for vendor prefixed names + var capName = name.charAt(0).toUpperCase() + name.slice(1), + origName = name, + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in style ) { + return name; + } + } + + return origName; +} + +function isHidden( elem, el ) { + elem = el || elem; + return jQuery.css( elem, "display" ) === "none" || !jQuery.contains( elem.ownerDocument, elem ); +} + +function showHide( elements, show ) { + var elem, display, + values = [], + index = 0, + length = elements.length; + + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + values[ index ] = jQuery._data( elem, "olddisplay" ); + if ( show ) { + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !values[ index ] && elem.style.display === "none" ) { + elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( elem.style.display === "" && isHidden( elem ) ) { + values[ index ] = jQuery._data( elem, "olddisplay", css_defaultDisplay(elem.nodeName) ); + } + } else { + display = curCSS( elem, "display" ); + + if ( !values[ index ] && display !== "none" ) { + jQuery._data( elem, "olddisplay", display ); + } + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( index = 0; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + if ( !show || elem.style.display === "none" || elem.style.display === "" ) { + elem.style.display = show ? values[ index ] || "" : "none"; + } + } + + return elements; +} + +jQuery.fn.extend({ + css: function( name, value ) { + return jQuery.access( this, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + }, + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state, fn2 ) { + var bool = typeof state === "boolean"; + + if ( jQuery.isFunction( state ) && jQuery.isFunction( fn2 ) ) { + return eventsToggle.apply( this, arguments ); + } + + return this.each(function() { + if ( bool ? state : isHidden( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + }); + } +}); + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "fillOpacity": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = jQuery.camelCase( name ), + style = elem.style; + + name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( style, origName ) ); + + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // convert relative number strings (+= or -=) to relative numbers. #7345 + if ( type === "string" && (ret = rrelNum.exec( value )) ) { + value = ( ret[1] + 1 ) * ret[2] + parseFloat( jQuery.css( elem, name ) ); + // Fixes bug #9237 + type = "number"; + } + + // Make sure that NaN and null values aren't set. See: #7116 + if ( value == null || type === "number" && isNaN( value ) ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( type === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value, extra )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, numeric, extra ) { + var val, num, hooks, + origName = jQuery.camelCase( name ); + + // Make sure that we're working with the right name + name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( elem.style, origName ) ); + + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name ); + } + + //convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Return, converting to number if forced or a qualifier was provided and val looks numeric + if ( numeric || extra !== undefined ) { + num = parseFloat( val ); + return numeric || jQuery.isNumeric( num ) ? num || 0 : val; + } + return val; + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; + } +}); + +// NOTE: To any future maintainer, we've used both window.getComputedStyle +// and getComputedStyle here to produce a better gzip size +if ( window.getComputedStyle ) { + curCSS = function( elem, name ) { + var ret, width, minWidth, maxWidth, + computed = getComputedStyle( elem, null ), + style = elem.style; + + if ( computed ) { + + ret = computed[ name ]; + if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Chrome < 17 and Safari 5.0 uses "computed value" instead of "used value" for margin-right + // Safari 5.1.7 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels + // this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values + if ( rnumnonpx.test( ret ) && rmargin.test( name ) ) { + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret; + }; +} else if ( document.documentElement.currentStyle ) { + curCSS = function( elem, name ) { + var left, rsLeft, + ret = elem.currentStyle && elem.currentStyle[ name ], + style = elem.style; + + // Avoid setting ret to empty string here + // so we don't default to auto + if ( ret == null && style && style[ name ] ) { + ret = style[ name ]; + } + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + // but not position css attributes, as those are proportional to the parent element instead + // and we can't measure the parent instead because it might trigger a "stacking dolls" problem + if ( rnumnonpx.test( ret ) && !rposition.test( name ) ) { + + // Remember the original values + left = style.left; + rsLeft = elem.runtimeStyle && elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + elem.runtimeStyle.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : ret; + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + elem.runtimeStyle.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +function setPositiveNumber( elem, value, subtract ) { + var matches = rnumsplit.exec( value ); + return matches ? + Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) : + value; +} + +function augmentWidthOrHeight( elem, name, extra, isBorderBox ) { + var i = extra === ( isBorderBox ? "border" : "content" ) ? + // If we already have the right measurement, avoid augmentation + 4 : + // Otherwise initialize for horizontal or vertical properties + name === "width" ? 1 : 0, + + val = 0; + + for ( ; i < 4; i += 2 ) { + // both box models exclude margin, so add it if we want it + if ( extra === "margin" ) { + // we use jQuery.css instead of curCSS here + // because of the reliableMarginRight CSS hook! + val += jQuery.css( elem, extra + cssExpand[ i ], true ); + } + + // From this point on we use curCSS for maximum performance (relevant in animations) + if ( isBorderBox ) { + // border-box includes padding, so remove it if we want content + if ( extra === "content" ) { + val -= parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0; + } + + // at this point, extra isn't border nor margin, so remove border + if ( extra !== "margin" ) { + val -= parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; + } + } else { + // at this point, extra isn't content, so add padding + val += parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0; + + // at this point, extra isn't content nor padding, so add border + if ( extra !== "padding" ) { + val += parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; + } + } + } + + return val; +} + +function getWidthOrHeight( elem, name, extra ) { + + // Start with offset property, which is equivalent to the border-box value + var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + valueIsBorderBox = true, + isBorderBox = jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box"; + + if ( val <= 0 ) { + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name ); + if ( val < 0 || val == null ) { + val = elem.style[ name ]; + } + + // Computed unit is not pixels. Stop here and return. + if ( rnumnonpx.test(val) ) { + return val; + } + + // we need the check for style in case a browser which returns unreliable values + // for getComputedStyle silently falls back to the reliable elem.style + valueIsBorderBox = isBorderBox && ( jQuery.support.boxSizingReliable || val === elem.style[ name ] ); + + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + } + + // use the active box-sizing model to add/subtract irrelevant styles + return ( val + + augmentWidthOrHeight( + elem, + name, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox + ) + ) + "px"; +} + + +// Try to determine the default display value of an element +function css_defaultDisplay( nodeName ) { + if ( elemdisplay[ nodeName ] ) { + return elemdisplay[ nodeName ]; + } + + var elem = jQuery( "<" + nodeName + ">" ).appendTo( document.body ), + display = elem.css("display"); + elem.remove(); + + // If the simple way fails, + // get element's real default display by attaching it to a temp iframe + if ( display === "none" || display === "" ) { + // Use the already-created iframe if possible + iframe = document.body.appendChild( + iframe || jQuery.extend( document.createElement("iframe"), { + frameBorder: 0, + width: 0, + height: 0 + }) + ); + + // Create a cacheable copy of the iframe document on first call. + // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML + // document to it; WebKit & Firefox won't allow reusing the iframe document. + if ( !iframeDoc || !iframe.createElement ) { + iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; + iframeDoc.write(""); + iframeDoc.close(); + } + + elem = iframeDoc.body.appendChild( iframeDoc.createElement(nodeName) ); + + display = curCSS( elem, "display" ); + document.body.removeChild( iframe ); + } + + // Store the correct default display + elemdisplay[ nodeName ] = display; + + return display; +} + +jQuery.each([ "height", "width" ], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + if ( elem.offsetWidth !== 0 || curCSS( elem, "display" ) !== "none" ) { + return getWidthOrHeight( elem, name, extra ); + } else { + return jQuery.swap( elem, cssShow, function() { + return getWidthOrHeight( elem, name, extra ); + }); + } + } + }, + + set: function( elem, value, extra ) { + return setPositiveNumber( elem, value, extra ? + augmentWidthOrHeight( + elem, + name, + extra, + jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box" + ) : 0 + ); + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? + ( 0.01 * parseFloat( RegExp.$1 ) ) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style, + currentStyle = elem.currentStyle, + opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "", + filter = currentStyle && currentStyle.filter || style.filter || ""; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 + if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" && + style.removeAttribute ) { + + // Setting style.filter to null, "" & " " still leave "filter:" in the cssText + // if "filter:" is present at all, clearType is disabled, we want to avoid this + // style.removeAttribute is IE Only, but so apparently is this code path... + style.removeAttribute( "filter" ); + + // if there there is no filter style applied in a css rule, we are done + if ( currentStyle && !currentStyle.filter ) { + return; + } + } + + // otherwise, set new filter values + style.filter = ralpha.test( filter ) ? + filter.replace( ralpha, opacity ) : + filter + " " + opacity; + } + }; +} + +// These hooks cannot be added until DOM ready because the support test +// for it is not run until after DOM ready +jQuery(function() { + if ( !jQuery.support.reliableMarginRight ) { + jQuery.cssHooks.marginRight = { + get: function( elem, computed ) { + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + // Work around by temporarily setting element display to inline-block + return jQuery.swap( elem, { "display": "inline-block" }, function() { + if ( computed ) { + return curCSS( elem, "marginRight" ); + } + }); + } + }; + } + + // Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084 + // getComputedStyle returns percent when specified for top/left/bottom/right + // rather than make the css module depend on the offset module, we just check for it here + if ( !jQuery.support.pixelPosition && jQuery.fn.position ) { + jQuery.each( [ "top", "left" ], function( i, prop ) { + jQuery.cssHooks[ prop ] = { + get: function( elem, computed ) { + if ( computed ) { + var ret = curCSS( elem, prop ); + // if curCSS returns percentage, fallback to offset + return rnumnonpx.test( ret ) ? jQuery( elem ).position()[ prop ] + "px" : ret; + } + } + }; + }); + } + +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + return ( elem.offsetWidth === 0 && elem.offsetHeight === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || curCSS( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + +// These hooks are used by animate to expand properties +jQuery.each({ + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i, + + // assumes a single number if not a string + parts = typeof value === "string" ? value.split(" ") : [ value ], + expanded = {}; + + for ( i = 0; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( !rmargin.test( prefix ) ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +}); +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + rselectTextarea = /^(?:select|textarea)/i; + +jQuery.fn.extend({ + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray( this.elements ) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + ( this.checked || rselectTextarea.test( this.nodeName ) || + rinput.test( this.type ) ); + }) + .map(function( i, elem ){ + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val, i ){ + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }).get(); + } +}); + +//Serialize an array of form elements or a set of +//key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : ( value == null ? "" : value ); + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); +}; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( jQuery.isArray( obj ) ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && jQuery.type( obj ) === "object" ) { + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} +var // Document location + ajaxLocation, + // Document location segments + ajaxLocParts, + + rhash = /#.*$/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + rquery = /\?/, + rscript = /)<[^<]*)*<\/script>/gi, + rts = /([?&])_=[^&]*/, + rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/, + + // Keep a copy of the old load method + _load = jQuery.fn.load, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = ["*/"] + ["*"]; + +// #8138, IE may throw an exception when accessing +// a field from window.location if document.domain has been set +try { + ajaxLocation = location.href; +} catch( e ) { + // Use the href attribute of an A element + // since IE will modify it given document.location + ajaxLocation = document.createElement( "a" ); + ajaxLocation.href = ""; + ajaxLocation = ajaxLocation.href; +} + +// Segment location into parts +ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, list, placeBefore, + dataTypes = dataTypeExpression.toLowerCase().split( core_rspace ), + i = 0, + length = dataTypes.length; + + if ( jQuery.isFunction( func ) ) { + // For each dataType in the dataTypeExpression + for ( ; i < length; i++ ) { + dataType = dataTypes[ i ]; + // We control if we're asked to add before + // any existing element + placeBefore = /^\+/.test( dataType ); + if ( placeBefore ) { + dataType = dataType.substr( 1 ) || "*"; + } + list = structure[ dataType ] = structure[ dataType ] || []; + // then we add to the structure accordingly + list[ placeBefore ? "unshift" : "push" ]( func ); + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, + dataType /* internal */, inspected /* internal */ ) { + + dataType = dataType || options.dataTypes[ 0 ]; + inspected = inspected || {}; + + inspected[ dataType ] = true; + + var selection, + list = structure[ dataType ], + i = 0, + length = list ? list.length : 0, + executeOnly = ( structure === prefilters ); + + for ( ; i < length && ( executeOnly || !selection ); i++ ) { + selection = list[ i ]( options, originalOptions, jqXHR ); + // If we got redirected to another dataType + // we try there if executing only and not done already + if ( typeof selection === "string" ) { + if ( !executeOnly || inspected[ selection ] ) { + selection = undefined; + } else { + options.dataTypes.unshift( selection ); + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, selection, inspected ); + } + } + } + // If we're only executing or nothing was selected + // we try the catchall dataType if not done already + if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, "*", inspected ); + } + // unnecessary when only executing (prefilters) + // but it'll be ignored by the caller in that case + return selection; +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } +} + +jQuery.fn.load = function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + } + + // Don't do a request if no elements are being requested + if ( !this.length ) { + return this; + } + + var selector, type, response, + self = this, + off = url.indexOf(" "); + + if ( off >= 0 ) { + selector = url.slice( off, url.length ); + url = url.slice( 0, off ); + } + + // If it's a function + if ( jQuery.isFunction( params ) ) { + + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( typeof params === "object" ) { + type = "POST"; + } + + // Request the remote document + jQuery.ajax({ + url: url, + + // if "type" variable is undefined, then "GET" method will be used + type: type, + dataType: "html", + data: params, + complete: function( jqXHR, status ) { + if ( callback ) { + self.each( callback, response || [ jqXHR.responseText, status, jqXHR ] ); + } + } + }).done(function( responseText ) { + + // Save response for use in complete callback + response = arguments; + + // See if a selector was specified + self.html( selector ? + + // Create a dummy div to hold the results + jQuery("
") + + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append( responseText.replace( rscript, "" ) ) + + // Locate the specified elements + .find( selector ) : + + // If not, just inject the full result + responseText ); + + }); + + return this; +}; + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ + jQuery.fn[ o ] = function( f ){ + return this.on( o, f ); + }; +}); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + return jQuery.ajax({ + type: method, + url: url, + data: data, + success: callback, + dataType: type + }); + }; +}); + +jQuery.extend({ + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + if ( settings ) { + // Building a settings object + ajaxExtend( target, jQuery.ajaxSettings ); + } else { + // Extending ajaxSettings + settings = target; + target = jQuery.ajaxSettings; + } + ajaxExtend( target, settings ); + return target; + }, + + ajaxSettings: { + url: ajaxLocation, + isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + processData: true, + async: true, + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + text: "text/plain", + json: "application/json, text/javascript", + "*": allTypes + }, + + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText" + }, + + // List of data converters + // 1) key format is "source_type destination_type" (a single space in-between) + // 2) the catchall symbol "*" can be used for source_type + converters: { + + // Convert anything to text + "* text": window.String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": jQuery.parseJSON, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + context: true, + url: true + } + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var // ifModified key + ifModifiedKey, + // Response headers + responseHeadersString, + responseHeaders, + // transport + transport, + // timeout handle + timeoutTimer, + // Cross-domain detection vars + parts, + // To know if global events are to be dispatched + fireGlobals, + // Loop variable + i, + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + // Callbacks context + callbackContext = s.context || s, + // Context for global events + // It's the callbackContext if one was provided in the options + // and if it's a DOM node or a jQuery collection + globalEventContext = callbackContext !== s && + ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? + jQuery( callbackContext ) : jQuery.event, + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + // Status-dependent callbacks + statusCode = s.statusCode || {}, + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + // The jqXHR state + state = 0, + // Default abort message + strAbort = "canceled", + // Fake xhr + jqXHR = { + + readyState: 0, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( !state ) { + var lname = name.toLowerCase(); + name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( state === 2 ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match === undefined ? null : match; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( !state ) { + s.mimeType = type; + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + statusText = statusText || strAbort; + if ( transport ) { + transport.abort( statusText ); + } + done( 0, statusText ); + return this; + } + }; + + // Callback for when everything is done + // It is defined here because jslint complains if it is declared + // at the end of the function (which would be more logical and readable) + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Called once + if ( state === 2 ) { + return; + } + + // State is "done" now + state = 2; + + // Clear timeout if it exists + if ( timeoutTimer ) { + clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // If successful, handle type chaining + if ( status >= 200 && status < 300 || status === 304 ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + + modified = jqXHR.getResponseHeader("Last-Modified"); + if ( modified ) { + jQuery.lastModified[ ifModifiedKey ] = modified; + } + modified = jqXHR.getResponseHeader("Etag"); + if ( modified ) { + jQuery.etag[ ifModifiedKey ] = modified; + } + } + + // If not modified + if ( status === 304 ) { + + statusText = "notmodified"; + isSuccess = true; + + // If we have data + } else { + + isSuccess = ajaxConvert( s, response ); + statusText = isSuccess.state; + success = isSuccess.data; + error = isSuccess.error; + isSuccess = !error; + } + } else { + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if ( !statusText || status ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = "" + ( nativeStatusText || statusText ); + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + // Attach deferreds + deferred.promise( jqXHR ); + jqXHR.success = jqXHR.done; + jqXHR.error = jqXHR.fail; + jqXHR.complete = completeDeferred.add; + + // Status-dependent callbacks + jqXHR.statusCode = function( map ) { + if ( map ) { + var tmp; + if ( state < 2 ) { + for ( tmp in map ) { + statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; + } + } else { + tmp = map[ jqXHR.status ]; + jqXHR.always( tmp ); + } + } + return this; + }; + + // Remove hash character (#7531: and string promotion) + // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // We also use the url parameter if available + s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Extract dataTypes list + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( core_rspace ); + + // Determine if a cross-domain request is in order + if ( s.crossDomain == null ) { + parts = rurl.exec( s.url.toLowerCase() ); + s.crossDomain = !!( parts && + ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] || + ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != + ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) + ); + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( state === 2 ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + fireGlobals = s.global; + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // If data is available, append data to url + if ( s.data ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Get ifModifiedKey before adding the anti-cache parameter + ifModifiedKey = s.url; + + // Add anti-cache in url if needed + if ( s.cache === false ) { + + var ts = jQuery.now(), + // try replacing _= if it is there + ret = s.url.replace( rts, "$1_=" + ts ); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + ifModifiedKey = ifModifiedKey || s.url; + if ( jQuery.lastModified[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); + } + if ( jQuery.etag[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); + } + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already and return + return jqXHR.abort(); + + } + + // aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + for ( i in { success: 1, error: 1, complete: 1 } ) { + jqXHR[ i ]( s[ i ] ); + } + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = setTimeout( function(){ + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + state = 1; + transport.send( requestHeaders, done ); + } catch (e) { + // Propagate exception as error if not done + if ( state < 2 ) { + done( -1, e ); + // Simply rethrow otherwise + } else { + throw e; + } + } + } + + return jqXHR; + }, + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {} + +}); + +/* Handles responses to an ajax request: + * - sets all responseXXX fields accordingly + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes, + responseFields = s.responseFields; + + // Fill responseXXX fields + for ( type in responseFields ) { + if ( type in responses ) { + jqXHR[ responseFields[type] ] = responses[ type ]; + } + } + + // Remove auto dataType and get content-type in the process + while( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +// Chain conversions given the request and the original response +function ajaxConvert( s, response ) { + + var conv, conv2, current, tmp, + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(), + prev = dataTypes[ 0 ], + converters = {}, + i = 0; + + // Apply the dataFilter if provided + if ( s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + // Convert to each sequential dataType, tolerating list modification + for ( ; (current = dataTypes[++i]); ) { + + // There's only work to do if current dataType is non-auto + if ( current !== "*" ) { + + // Convert response if prev dataType is non-auto and differs from current + if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split(" "); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.splice( i--, 0, current ); + } + + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s["throws"] ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { state: "parsererror", error: conv ? e : "No conversion from " + prev + " to " + current }; + } + } + } + } + + // Update prev for next iteration + prev = current; + } + } + + return { state: "success", data: response }; +} +var oldCallbacks = [], + rquestion = /\?/, + rjsonp = /(=)\?(?=&|$)|\?\?/, + nonce = jQuery.now(); + +// Default jsonp settings +jQuery.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) ); + this[ callback ] = true; + return callback; + } +}); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var callbackName, overwritten, responseContainer, + data = s.data, + url = s.url, + hasCallback = s.jsonp !== false, + replaceInUrl = hasCallback && rjsonp.test( url ), + replaceInData = hasCallback && !replaceInUrl && typeof data === "string" && + !( s.contentType || "" ).indexOf("application/x-www-form-urlencoded") && + rjsonp.test( data ); + + // Handle iff the expected data type is "jsonp" or we have a parameter to set + if ( s.dataTypes[ 0 ] === "jsonp" || replaceInUrl || replaceInData ) { + + // Get callback name, remembering preexisting value associated with it + callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ? + s.jsonpCallback() : + s.jsonpCallback; + overwritten = window[ callbackName ]; + + // Insert callback into url or form data + if ( replaceInUrl ) { + s.url = url.replace( rjsonp, "$1" + callbackName ); + } else if ( replaceInData ) { + s.data = data.replace( rjsonp, "$1" + callbackName ); + } else if ( hasCallback ) { + s.url += ( rquestion.test( url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName; + } + + // Use data converter to retrieve json after script execution + s.converters["script json"] = function() { + if ( !responseContainer ) { + jQuery.error( callbackName + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // force json dataType + s.dataTypes[ 0 ] = "json"; + + // Install callback + window[ callbackName ] = function() { + responseContainer = arguments; + }; + + // Clean-up function (fires after converters) + jqXHR.always(function() { + // Restore preexisting value + window[ callbackName ] = overwritten; + + // Save back as free + if ( s[ callbackName ] ) { + // make sure that re-using the options doesn't screw things around + s.jsonpCallback = originalSettings.jsonpCallback; + + // save the callback name for future use + oldCallbacks.push( callbackName ); + } + + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( overwritten ) ) { + overwritten( responseContainer[ 0 ] ); + } + + responseContainer = overwritten = undefined; + }); + + // Delegate to script + return "script"; + } +}); +// Install script dataType +jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /javascript|ecmascript/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +}); + +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +}); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function(s) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + + var script, + head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; + + return { + + send: function( _, callback ) { + + script = document.createElement( "script" ); + + script.async = "async"; + + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + + script.src = s.url; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { + + if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + + // Remove the script + if ( head && script.parentNode ) { + head.removeChild( script ); + } + + // Dereference the script + script = undefined; + + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + }, + + abort: function() { + if ( script ) { + script.onload( 0, 1 ); + } + } + }; + } +}); +var xhrCallbacks, + // #5280: Internet Explorer will keep connections alive if we don't abort on unload + xhrOnUnloadAbort = window.ActiveXObject ? function() { + // Abort all pending requests + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( 0, 1 ); + } + } : false, + xhrId = 0; + +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch( e ) {} +} + +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch( e ) {} +} + +// Create the request object +// (This is still attached to ajaxSettings for backward compatibility) +jQuery.ajaxSettings.xhr = window.ActiveXObject ? + /* Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ + function() { + return !this.isLocal && createStandardXHR() || createActiveXHR(); + } : + // For all other browsers, use the standard XMLHttpRequest object + createStandardXHR; + +// Determine support properties +(function( xhr ) { + jQuery.extend( jQuery.support, { + ajax: !!xhr, + cors: !!xhr && ( "withCredentials" in xhr ) + }); +})( jQuery.ajaxSettings.xhr() ); + +// Create transport if the browser can provide an xhr +if ( jQuery.support.ajax ) { + + jQuery.ajaxTransport(function( s ) { + // Cross domain only allowed if supported through XMLHttpRequest + if ( !s.crossDomain || jQuery.support.cors ) { + + var callback; + + return { + send: function( headers, complete ) { + + // Get a new xhr + var handle, i, + xhr = s.xhr(); + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open( s.type, s.url, s.async, s.username, s.password ); + } else { + xhr.open( s.type, s.url, s.async ); + } + + // Apply custom fields if provided + if ( s.xhrFields ) { + for ( i in s.xhrFields ) { + xhr[ i ] = s.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( s.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( s.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !s.crossDomain && !headers["X-Requested-With"] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + } catch( _ ) {} + + // Do send the request + // This may raise an exception which is actually + // handled in jQuery.ajax (so no try/catch here) + xhr.send( ( s.hasContent && s.data ) || null ); + + // Listener + callback = function( _, isAbort ) { + + var status, + statusText, + responseHeaders, + responses, + xml; + + // Firefox throws exceptions when accessing properties + // of an xhr when a network error occurred + // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) + try { + + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + + // Only called once + callback = undefined; + + // Do not keep as active anymore + if ( handle ) { + xhr.onreadystatechange = jQuery.noop; + if ( xhrOnUnloadAbort ) { + delete xhrCallbacks[ handle ]; + } + } + + // If it's an abort + if ( isAbort ) { + // Abort it manually if needed + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + status = xhr.status; + responseHeaders = xhr.getAllResponseHeaders(); + responses = {}; + xml = xhr.responseXML; + + // Construct response list + if ( xml && xml.documentElement /* #4958 */ ) { + responses.xml = xml; + } + + // When requesting binary data, IE6-9 will throw an exception + // on any attempt to access responseText (#11426) + try { + responses.text = xhr.responseText; + } catch( _ ) { + } + + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch( e ) { + // We normalize with Webkit giving an empty statusText + statusText = ""; + } + + // Filter status for non standard behaviors + + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && s.isLocal && !s.crossDomain ) { + status = responses.text ? 200 : 404; + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; + } + } + } + } catch( firefoxAccessException ) { + if ( !isAbort ) { + complete( -1, firefoxAccessException ); + } + } + + // Call complete if needed + if ( responses ) { + complete( status, statusText, responses, responseHeaders ); + } + }; + + if ( !s.async ) { + // if we're in sync mode we fire the callback + callback(); + } else if ( xhr.readyState === 4 ) { + // (IE6 & IE7) if it's in cache and has been + // retrieved directly we need to fire the callback + setTimeout( callback, 0 ); + } else { + handle = ++xhrId; + if ( xhrOnUnloadAbort ) { + // Create the active xhrs callbacks list if needed + // and attach the unload handler + if ( !xhrCallbacks ) { + xhrCallbacks = {}; + jQuery( window ).unload( xhrOnUnloadAbort ); + } + // Add to list of active xhrs callbacks + xhrCallbacks[ handle ] = callback; + } + xhr.onreadystatechange = callback; + } + }, + + abort: function() { + if ( callback ) { + callback(0,1); + } + } + }; + } + }); +} +var fxNow, timerId, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = new RegExp( "^(?:([-+])=|)(" + core_pnum + ")([a-z%]*)$", "i" ), + rrun = /queueHooks$/, + animationPrefilters = [ defaultPrefilter ], + tweeners = { + "*": [function( prop, value ) { + var end, unit, prevScale, + tween = this.createTween( prop, value ), + parts = rfxnum.exec( value ), + target = tween.cur(), + start = +target || 0, + scale = 1; + + if ( parts ) { + end = +parts[2]; + unit = parts[3] || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + + // We need to compute starting value + if ( unit !== "px" && start ) { + // Iteratively approximate from a nonzero starting point + // Prefer the current property, because this process will be trivial if it uses the same units + // Fallback to end or a simple constant + start = jQuery.css( tween.elem, prop, true ) || end || 1; + + do { + // If previous iteration zeroed out, double until we get *something* + // Use a string for doubling factor so we don't accidentally see scale as unchanged below + prevScale = scale = scale || ".5"; + + // Adjust and apply + start = start / scale; + jQuery.style( tween.elem, prop, start + unit ); + + // Update scale, tolerating zeroes from tween.cur() + scale = tween.cur() / target; + + // Stop looping if we've hit the mark or scale is unchanged + } while ( scale !== 1 && scale !== prevScale ); + } + + tween.unit = unit; + tween.start = start; + // If a +=/-= token was provided, we're doing a relative animation + tween.end = parts[1] ? start + ( parts[1] + 1 ) * end : end; + } + return tween; + }] + }; + +// Animations created synchronously will run synchronously +function createFxNow() { + setTimeout(function() { + fxNow = undefined; + }, 0 ); + return ( fxNow = jQuery.now() ); +} + +function createTweens( animation, props ) { + jQuery.each( props, function( prop, value ) { + var collection = ( tweeners[ prop ] || [] ).concat( tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( collection[ index ].call( animation, prop, value ) ) { + + // we're done with this property + return; + } + } + }); +} + +function Animation( elem, properties, options ) { + var result, + index = 0, + tweenerIndex = 0, + length = animationPrefilters.length, + deferred = jQuery.Deferred().always( function() { + // don't match elem in the :animated selector + delete tick.elem; + }), + tick = function() { + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + percent = 1 - ( remaining / animation.duration || 0 ), + index = 0, + length = animation.tweens.length; + + for ( ; index < length ; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ]); + + if ( percent < 1 && length ) { + return remaining; + } else { + deferred.resolveWith( elem, [ animation ] ); + return false; + } + }, + animation = deferred.promise({ + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { specialEasing: {} }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end, easing ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + // if we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + + for ( ; index < length ; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // resolve when we played the last frame + // otherwise, reject + if ( gotoEnd ) { + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + }), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length ; index++ ) { + result = animationPrefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + return result; + } + } + + createTweens( animation, props ); + + if ( jQuery.isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + jQuery.fx.timer( + jQuery.extend( tick, { + anim: animation, + queue: animation.opts.queue, + elem: elem + }) + ); + + // attach callbacks from options + return animation.progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = jQuery.camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( jQuery.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // not quite $.extend, this wont overwrite keys already present. + // also - reusing 'index' from above because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweener: function( props, callback ) { + if ( jQuery.isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.split(" "); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length ; index++ ) { + prop = props[ index ]; + tweeners[ prop ] = tweeners[ prop ] || []; + tweeners[ prop ].unshift( callback ); + } + }, + + prefilter: function( callback, prepend ) { + if ( prepend ) { + animationPrefilters.unshift( callback ); + } else { + animationPrefilters.push( callback ); + } + } +}); + +function defaultPrefilter( elem, props, opts ) { + var index, prop, value, length, dataShow, tween, hooks, oldfire, + anim = this, + style = elem.style, + orig = {}, + handled = [], + hidden = elem.nodeType && isHidden( elem ); + + // handle queue: false promises + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always(function() { + // doing this makes sure that the complete handler will be called + // before this completes + anim.always(function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + }); + }); + } + + // height/width overflow pass + if ( elem.nodeType === 1 && ( "height" in props || "width" in props ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height animated + if ( jQuery.css( elem, "display" ) === "inline" && + jQuery.css( elem, "float" ) === "none" ) { + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( !jQuery.support.inlineBlockNeedsLayout || css_defaultDisplay( elem.nodeName ) === "inline" ) { + style.display = "inline-block"; + + } else { + style.zoom = 1; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + if ( !jQuery.support.shrinkWrapBlocks ) { + anim.done(function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + }); + } + } + + + // show/hide pass + for ( index in props ) { + value = props[ index ]; + if ( rfxtypes.exec( value ) ) { + delete props[ index ]; + if ( value === ( hidden ? "hide" : "show" ) ) { + continue; + } + handled.push( index ); + } + } + + length = handled.length; + if ( length ) { + dataShow = jQuery._data( elem, "fxshow" ) || jQuery._data( elem, "fxshow", {} ); + if ( hidden ) { + jQuery( elem ).show(); + } else { + anim.done(function() { + jQuery( elem ).hide(); + }); + } + anim.done(function() { + var prop; + jQuery.removeData( elem, "fxshow", true ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + }); + for ( index = 0 ; index < length ; index++ ) { + prop = handled[ index ]; + tween = anim.createTween( prop, hidden ? dataShow[ prop ] : 0 ); + orig[ prop ] = dataShow[ prop ] || jQuery.style( elem, prop ); + + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = tween.start; + if ( hidden ) { + tween.end = tween.start; + tween.start = prop === "width" || prop === "height" ? 1 : 0; + } + } + } + } +} + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || "swing"; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + this.pos = eased = jQuery.easing[ this.easing ]( percent, this.options.duration * percent, 0, 1, this.options.duration ); + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + if ( tween.elem[ tween.prop ] != null && + (!tween.elem.style || tween.elem.style[ tween.prop ] == null) ) { + return tween.elem[ tween.prop ]; + } + + // passing any value as a 4th parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails + // so, simple values such as "10px" are parsed to Float. + // complex values such as "rotate(1rad)" are returned as is. + result = jQuery.css( tween.elem, tween.prop, false, "" ); + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + // use step hook for back compat - use cssHook if its there - use .style if its + // available and use plain properties where available + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.style && ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || jQuery.cssHooks[ tween.prop ] ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Remove in 2.0 - this supports IE8's panic based approach +// to setting things on disconnected nodes + +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.each([ "toggle", "show", "hide" ], function( i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" || + // special check for .toggle( handler, handler, ... ) + ( !i && jQuery.isFunction( speed ) && jQuery.isFunction( easing ) ) ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +}); + +jQuery.fn.extend({ + fadeTo: function( speed, to, easing, callback ) { + + // show any hidden elements after setting opacity to 0 + return this.filter( isHidden ).css( "opacity", 0 ).show() + + // animate to the value specified + .end().animate({ opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations resolve immediately + if ( empty ) { + anim.stop( true ); + } + }; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each(function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = jQuery._data( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) { + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // start the next in the queue if the last step wasn't forced + // timers currently will call their complete callbacks, which will dequeue + // but only if they were gotoEnd + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + }); + } +}); + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + attrs = { height: type }, + i = 0; + + // if we include width, step value is 1 to do all cssExpand values, + // if we don't include width, step value is 2 to skip over Left and Right + for( ; i < 4 ; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show"), + slideUp: genFx("hide"), + slideToggle: genFx("toggle"), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default; + + // normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p*Math.PI ) / 2; + } +}; + +jQuery.timers = []; +jQuery.fx = Tween.prototype.init; +jQuery.fx.tick = function() { + var timer, + timers = jQuery.timers, + i = 0; + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + // Checks the timer has not already been removed + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } +}; + +jQuery.fx.timer = function( timer ) { + if ( timer() && jQuery.timers.push( timer ) && !timerId ) { + timerId = setInterval( jQuery.fx.tick, jQuery.fx.interval ); + } +}; + +jQuery.fx.interval = 13; + +jQuery.fx.stop = function() { + clearInterval( timerId ); + timerId = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + // Default speed + _default: 400 +}; + +// Back Compat <1.8 extension point +jQuery.fx.step = {}; + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} +var rroot = /^(?:body|html)$/i; + +jQuery.fn.offset = function( options ) { + if ( arguments.length ) { + return options === undefined ? + this : + this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + var box, docElem, body, win, clientTop, clientLeft, scrollTop, scrollLeft, top, left, + elem = this[ 0 ], + doc = elem && elem.ownerDocument; + + if ( !doc ) { + return; + } + + if ( (body = doc.body) === elem ) { + return jQuery.offset.bodyOffset( elem ); + } + + docElem = doc.documentElement; + + // Make sure we're not dealing with a disconnected DOM node + if ( !jQuery.contains( docElem, elem ) ) { + return { top: 0, left: 0 }; + } + + box = elem.getBoundingClientRect(); + win = getWindow( doc ); + clientTop = docElem.clientTop || body.clientTop || 0; + clientLeft = docElem.clientLeft || body.clientLeft || 0; + scrollTop = win.pageYOffset || docElem.scrollTop; + scrollLeft = win.pageXOffset || docElem.scrollLeft; + top = box.top + scrollTop - clientTop; + left = box.left + scrollLeft - clientLeft; + + return { top: top, left: left }; +}; + +jQuery.offset = { + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if ( options.top != null ) { + props.top = ( options.top - curOffset.top ) + curTop; + } + if ( options.left != null ) { + props.left = ( options.left - curOffset.left ) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + + position: function() { + if ( !this[0] ) { + return; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent || document.body; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( method, prop ) { + var top = /Y/.test( prop ); + + jQuery.fn[ method ] = function( val ) { + return jQuery.access( this, function( elem, method, val ) { + var win = getWindow( elem ); + + if ( val === undefined ) { + return win ? (prop in win) ? win[ prop ] : + win.document.documentElement[ method ] : + elem[ method ]; + } + + if ( win ) { + win.scrollTo( + !top ? val : jQuery( win ).scrollLeft(), + top ? val : jQuery( win ).scrollTop() + ); + + } else { + elem[ method ] = val; + } + }, method, val, arguments.length, null ); + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} +// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods +jQuery.each( { Height: "height", Width: "width" }, function( name, type ) { + jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, function( defaultExtra, funcName ) { + // margin is only for outerHeight, outerWidth + jQuery.fn[ funcName ] = function( margin, value ) { + var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ), + extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" ); + + return jQuery.access( this, function( elem, type, value ) { + var doc; + + if ( jQuery.isWindow( elem ) ) { + // As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there + // isn't a whole lot we can do. See pull request at this URL for discussion: + // https://github.com/jquery/jquery/pull/764 + return elem.document.documentElement[ "client" + name ]; + } + + // Get document width or height + if ( elem.nodeType === 9 ) { + doc = elem.documentElement; + + // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], whichever is greatest + // unfortunately, this causes bug #3838 in IE6/8 only, but there is currently no good, small way to fix it. + return Math.max( + elem.body[ "scroll" + name ], doc[ "scroll" + name ], + elem.body[ "offset" + name ], doc[ "offset" + name ], + doc[ "client" + name ] + ); + } + + return value === undefined ? + // Get width or height on the element, requesting but not forcing parseFloat + jQuery.css( elem, type, value, extra ) : + + // Set width or height on the element + jQuery.style( elem, type, value, extra ); + }, type, chainable ? margin : undefined, chainable ); + }; + }); +}); +// Expose jQuery to the global object +window.jQuery = window.$ = jQuery; + +// Expose jQuery as an AMD module, but only for AMD loaders that +// understand the issues with loading multiple versions of jQuery +// in a page that all might call define(). The loader will indicate +// they have special allowances for multiple jQuery versions by +// specifying define.amd.jQuery = true. Register as a named module, +// since jQuery can be concatenated with other files that may use define, +// but not use a proper concatenation script that understands anonymous +// AMD modules. A named AMD is safest and most robust way to register. +// Lowercase jquery is used because AMD module names are derived from +// file names, and jQuery is normally delivered in a lowercase file name. +// Do this after creating the global so that if an AMD module wants to call +// noConflict to hide this version of jQuery, it will work. +if ( typeof define === "function" && define.amd && define.amd.jQuery ) { + define( "jquery", [], function () { return jQuery; } ); +} + +})( window ); diff --git a/static/js/jquery.mobile-1.2.0.js b/static/js/jquery.mobile-1.2.0.js new file mode 100644 index 0000000..4c1c616 --- /dev/null +++ b/static/js/jquery.mobile-1.2.0.js @@ -0,0 +1,9162 @@ +/* +* jQuery Mobile Framework Git Build: SHA1: b49cc06499abf8f987cf90f35349cfac0918c939 <> Date: Tue Oct 2 11:22:34 2012 -0700 +* http://jquerymobile.com +* +* Copyright 2012 jQuery Foundation and other contributors +* Released under the MIT license. +* http://jquery.org/license +* +*/ + + +(function ( root, doc, factory ) { + if ( typeof define === "function" && define.amd ) { + // AMD. Register as an anonymous module. + define( [ "jquery" ], function ( $ ) { + factory( $, root, doc ); + return $.mobile; + }); + } else { + // Browser globals + factory( root.jQuery, root, doc ); + } +}( this, document, function ( jQuery, window, document, undefined ) { +(function( $, window, undefined ) { + + var nsNormalizeDict = {}; + + // jQuery.mobile configurable options + $.mobile = $.extend( {}, { + + // Version of the jQuery Mobile Framework + version: "1.2.0", + + // Namespace used framework-wide for data-attrs. Default is no namespace + ns: "", + + // Define the url parameter used for referencing widget-generated sub-pages. + // Translates to to example.html&ui-page=subpageIdentifier + // hash segment before &ui-page= is used to make Ajax request + subPageUrlKey: "ui-page", + + // Class assigned to page currently in view, and during transitions + activePageClass: "ui-page-active", + + // Class used for "active" button state, from CSS framework + activeBtnClass: "ui-btn-active", + + // Class used for "focus" form element state, from CSS framework + focusClass: "ui-focus", + + // Automatically handle clicks and form submissions through Ajax, when same-domain + ajaxEnabled: true, + + // Automatically load and show pages based on location.hash + hashListeningEnabled: true, + + // disable to prevent jquery from bothering with links + linkBindingEnabled: true, + + // Set default page transition - 'none' for no transitions + defaultPageTransition: "slideup", + + // Set maximum window width for transitions to apply - 'false' for no limit + maxTransitionWidth: false, + + // Minimum scroll distance that will be remembered when returning to a page + minScrollBack: 250, + + // DEPRECATED: the following property is no longer in use, but defined until 2.0 to prevent conflicts + touchOverflowEnabled: false, + + // Set default dialog transition - 'none' for no transitions + defaultDialogTransition: "pop", + + // Error response message - appears when an Ajax page request fails + pageLoadErrorMessage: "Error Loading Page", + + // For error messages, which theme does the box uses? + pageLoadErrorMessageTheme: "e", + + // replace calls to window.history.back with phonegaps navigation helper + // where it is provided on the window object + phonegapNavigationEnabled: false, + + //automatically initialize the DOM when it's ready + autoInitializePage: true, + + pushStateEnabled: true, + + // allows users to opt in to ignoring content by marking a parent element as + // data-ignored + ignoreContentEnabled: false, + + // turn of binding to the native orientationchange due to android orientation behavior + orientationChangeEnabled: true, + + buttonMarkup: { + hoverDelay: 200 + }, + + // TODO might be useful upstream in jquery itself ? + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + }, + + // Scroll page vertically: scroll to 0 to hide iOS address bar, or pass a Y value + silentScroll: function( ypos ) { + if ( $.type( ypos ) !== "number" ) { + ypos = $.mobile.defaultHomeScroll; + } + + // prevent scrollstart and scrollstop events + $.event.special.scrollstart.enabled = false; + + setTimeout( function() { + window.scrollTo( 0, ypos ); + $( document ).trigger( "silentscroll", { x: 0, y: ypos }); + }, 20 ); + + setTimeout( function() { + $.event.special.scrollstart.enabled = true; + }, 150 ); + }, + + // Expose our cache for testing purposes. + nsNormalizeDict: nsNormalizeDict, + + // Take a data attribute property, prepend the namespace + // and then camel case the attribute string. Add the result + // to our nsNormalizeDict so we don't have to do this again. + nsNormalize: function( prop ) { + if ( !prop ) { + return; + } + + return nsNormalizeDict[ prop ] || ( nsNormalizeDict[ prop ] = $.camelCase( $.mobile.ns + prop ) ); + }, + + // Find the closest parent with a theme class on it. Note that + // we are not using $.fn.closest() on purpose here because this + // method gets called quite a bit and we need it to be as fast + // as possible. + getInheritedTheme: function( el, defaultTheme ) { + var e = el[ 0 ], + ltr = "", + re = /ui-(bar|body|overlay)-([a-z])\b/, + c, m; + + while ( e ) { + c = e.className || ""; + if ( c && ( m = re.exec( c ) ) && ( ltr = m[ 2 ] ) ) { + // We found a parent with a theme class + // on it so bail from this loop. + break; + } + + e = e.parentNode; + } + + // Return the theme letter we found, if none, return the + // specified default. + + return ltr || defaultTheme || "a"; + }, + + // TODO the following $ and $.fn extensions can/probably should be moved into jquery.mobile.core.helpers + // + // Find the closest javascript page element to gather settings data jsperf test + // http://jsperf.com/single-complex-selector-vs-many-complex-selectors/edit + // possibly naive, but it shows that the parsing overhead for *just* the page selector vs + // the page and dialog selector is negligable. This could probably be speed up by + // doing a similar parent node traversal to the one found in the inherited theme code above + closestPageData: function( $target ) { + return $target + .closest( ':jqmData(role="page"), :jqmData(role="dialog")' ) + .data( "page" ); + }, + + enhanceable: function( $set ) { + return this.haveParents( $set, "enhance" ); + }, + + hijackable: function( $set ) { + return this.haveParents( $set, "ajax" ); + }, + + haveParents: function( $set, attr ) { + if ( !$.mobile.ignoreContentEnabled ) { + return $set; + } + + var count = $set.length, + $newSet = $(), + e, $element, excluded; + + for ( var i = 0; i < count; i++ ) { + $element = $set.eq( i ); + excluded = false; + e = $set[ i ]; + + while ( e ) { + var c = e.getAttribute ? e.getAttribute( "data-" + $.mobile.ns + attr ) : ""; + + if ( c === "false" ) { + excluded = true; + break; + } + + e = e.parentNode; + } + + if ( !excluded ) { + $newSet = $newSet.add( $element ); + } + } + + return $newSet; + }, + + getScreenHeight: function() { + // Native innerHeight returns more accurate value for this across platforms, + // jQuery version is here as a normalized fallback for platforms like Symbian + return window.innerHeight || $( window ).height(); + } + }, $.mobile ); + + // Mobile version of data and removeData and hasData methods + // ensures all data is set and retrieved using jQuery Mobile's data namespace + $.fn.jqmData = function( prop, value ) { + var result; + if ( typeof prop !== "undefined" ) { + if ( prop ) { + prop = $.mobile.nsNormalize( prop ); + } + + // undefined is permitted as an explicit input for the second param + // in this case it returns the value and does not set it to undefined + if( arguments.length < 2 || value === undefined ){ + result = this.data( prop ); + } else { + result = this.data( prop, value ); + } + } + return result; + }; + + $.jqmData = function( elem, prop, value ) { + var result; + if ( typeof prop !== "undefined" ) { + result = $.data( elem, prop ? $.mobile.nsNormalize( prop ) : prop, value ); + } + return result; + }; + + $.fn.jqmRemoveData = function( prop ) { + return this.removeData( $.mobile.nsNormalize( prop ) ); + }; + + $.jqmRemoveData = function( elem, prop ) { + return $.removeData( elem, $.mobile.nsNormalize( prop ) ); + }; + + $.fn.removeWithDependents = function() { + $.removeWithDependents( this ); + }; + + $.removeWithDependents = function( elem ) { + var $elem = $( elem ); + + ( $elem.jqmData( 'dependents' ) || $() ).remove(); + $elem.remove(); + }; + + $.fn.addDependents = function( newDependents ) { + $.addDependents( $( this ), newDependents ); + }; + + $.addDependents = function( elem, newDependents ) { + var dependents = $( elem ).jqmData( 'dependents' ) || $(); + + $( elem ).jqmData( 'dependents', $.merge( dependents, newDependents ) ); + }; + + // note that this helper doesn't attempt to handle the callback + // or setting of an html elements text, its only purpose is + // to return the html encoded version of the text in all cases. (thus the name) + $.fn.getEncodedText = function() { + return $( "
" ).text( $( this ).text() ).html(); + }; + + // fluent helper function for the mobile namespaced equivalent + $.fn.jqmEnhanceable = function() { + return $.mobile.enhanceable( this ); + }; + + $.fn.jqmHijackable = function() { + return $.mobile.hijackable( this ); + }; + + // Monkey-patching Sizzle to filter the :jqmData selector + var oldFind = $.find, + jqmDataRE = /:jqmData\(([^)]*)\)/g; + + $.find = function( selector, context, ret, extra ) { + selector = selector.replace( jqmDataRE, "[data-" + ( $.mobile.ns || "" ) + "$1]" ); + + return oldFind.call( this, selector, context, ret, extra ); + }; + + $.extend( $.find, oldFind ); + + $.find.matches = function( expr, set ) { + return $.find( expr, null, null, set ); + }; + + $.find.matchesSelector = function( node, expr ) { + return $.find( expr, null, null, [ node ] ).length > 0; + }; +})( jQuery, this ); + + +/*! + * jQuery UI Widget v1.9.0-beta.1 + * + * Copyright 2012, https://github.com/jquery/jquery-ui/blob/1.9.0-beta.1/AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +var uuid = 0, + slice = Array.prototype.slice, + _cleanData = $.cleanData; +$.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); +}; + +$.widget = function( name, base, prototype ) { + var fullName, existingConstructor, constructor, basePrototype, + namespace = name.split( "." )[ 0 ]; + + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, fullName ); + }; + + $[ namespace ] = $[ namespace ] || {}; + existingConstructor = $[ namespace ][ name ]; + constructor = $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without "new" keyword + if ( !this._createWidget ) { + return new constructor( options, element ); + } + + // allow instantiation without initializing for simple inheritance + // must use "new" keyword (the code above always passes args) + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + // extend with the existing constructor to carry over any static properties + $.extend( constructor, existingConstructor, { + version: prototype.version, + // copy the object used to create the prototype in case we need to + // redefine the widget later + _proto: $.extend( {}, prototype ), + // track widgets that inherit from this widget in case this widget is + // redefined after a widget inherits from it + _childConstructors: [] + }); + + basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from + basePrototype.options = $.widget.extend( {}, basePrototype.options ); + $.each( prototype, function( prop, value ) { + if ( $.isFunction( value ) ) { + prototype[ prop ] = (function() { + var _super = function() { + return base.prototype[ prop ].apply( this, arguments ); + }, + _superApply = function( args ) { + return base.prototype[ prop ].apply( this, args ); + }; + return function() { + var __super = this._super, + __superApply = this._superApply, + returnValue; + + this._super = _super; + this._superApply = _superApply; + + returnValue = value.apply( this, arguments ); + + this._super = __super; + this._superApply = __superApply; + + return returnValue; + }; + })(); + } + }); + constructor.prototype = $.widget.extend( basePrototype, { + // TODO: remove support for widgetEventPrefix + // always use the name + a colon as the prefix, e.g., draggable:start + // don't prefix for widgets that aren't DOM-based + widgetEventPrefix: name + }, prototype, { + constructor: constructor, + namespace: namespace, + widgetName: name, + // TODO remove widgetBaseClass, see #8155 + widgetBaseClass: fullName, + widgetFullName: fullName + }); + + // If this widget is being redefined then we need to find all widgets that + // are inheriting from it and redefine all of them so that they inherit from + // the new version of this widget. We're essentially trying to replace one + // level in the prototype chain. + if ( existingConstructor ) { + $.each( existingConstructor._childConstructors, function( i, child ) { + var childPrototype = child.prototype; + + // redefine the child widget using the same prototype that was + // originally used, but inherit from the new version of the base + $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto ); + }); + // remove the list of existing child constructors from the old constructor + // so the old child constructors can be garbage collected + delete existingConstructor._childConstructors; + } else { + base._childConstructors.push( constructor ); + } + + $.widget.bridge( name, constructor ); +}; + +$.widget.extend = function( target ) { + var input = slice.call( arguments, 1 ), + inputIndex = 0, + inputLength = input.length, + key, + value; + for ( ; inputIndex < inputLength; inputIndex++ ) { + for ( key in input[ inputIndex ] ) { + value = input[ inputIndex ][ key ]; + if (input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) { + target[ key ] = $.isPlainObject( value ) ? $.widget.extend( {}, target[ key ], value ) : value; + } + } + } + return target; +}; + +$.widget.bridge = function( name, object ) { + var fullName = object.prototype.widgetFullName; + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.widget.extend.apply( null, [ options ].concat(args) ) : + options; + + if ( isMethodCall ) { + this.each(function() { + var methodValue, + instance = $.data( this, fullName ); + if ( !instance ) { + return $.error( "cannot call methods on " + name + " prior to initialization; " + + "attempted to call method '" + options + "'" ); + } + if ( !$.isFunction( instance[options] ) || options.charAt( 0 ) === "_" ) { + return $.error( "no such method '" + options + "' for " + name + " widget instance" ); + } + methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue && methodValue.jquery ? + returnValue.pushStack( methodValue.get() ) : + methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, fullName ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + new object( options, this ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) {}; +$.Widget._childConstructors = []; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + defaultElement: "
", + options: { + disabled: false, + + // callbacks + create: null + }, + _createWidget: function( options, element ) { + element = $( element || this.defaultElement || this )[ 0 ]; + this.element = $( element ); + this.uuid = uuid++; + this.eventNamespace = "." + this.widgetName + this.uuid; + this.options = $.widget.extend( {}, + this.options, + this._getCreateOptions(), + options ); + + this.bindings = $(); + this.hoverable = $(); + this.focusable = $(); + + if ( element !== this ) { + // 1.9 BC for #7810 + // TODO remove dual storage + $.data( element, this.widgetName, this ); + $.data( element, this.widgetFullName, this ); + this._on({ remove: "destroy" }); + this.document = $( element.style ? + // element within the document + element.ownerDocument : + // element is window or document + element.document || element ); + this.window = $( this.document[0].defaultView || this.document[0].parentWindow ); + } + + this._create(); + this._trigger( "create", null, this._getCreateEventData() ); + this._init(); + }, + _getCreateOptions: $.noop, + _getCreateEventData: $.noop, + _create: $.noop, + _init: $.noop, + + destroy: function() { + this._destroy(); + // we can probably remove the unbind calls in 2.0 + // all event bindings should go through this._on() + this.element + .unbind( this.eventNamespace ) + // 1.9 BC for #7810 + // TODO remove dual storage + .removeData( this.widgetName ) + .removeData( this.widgetFullName ) + // support: jquery <1.6.3 + // http://bugs.jquery.com/ticket/9413 + .removeData( $.camelCase( this.widgetFullName ) ); + this.widget() + .unbind( this.eventNamespace ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetFullName + "-disabled " + + "ui-state-disabled" ); + + // clean up events and states + this.bindings.unbind( this.eventNamespace ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + }, + _destroy: $.noop, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key, + parts, + curOption, + i; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.widget.extend( {}, this.options ); + } + + if ( typeof key === "string" ) { + // handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } } + options = {}; + parts = key.split( "." ); + key = parts.shift(); + if ( parts.length ) { + curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] ); + for ( i = 0; i < parts.length - 1; i++ ) { + curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {}; + curOption = curOption[ parts[ i ] ]; + } + key = parts.pop(); + if ( value === undefined ) { + return curOption[ key ] === undefined ? null : curOption[ key ]; + } + curOption[ key ] = value; + } else { + if ( value === undefined ) { + return this.options[ key ] === undefined ? null : this.options[ key ]; + } + options[ key ] = value; + } + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var key; + + for ( key in options ) { + this._setOption( key, options[ key ] ); + } + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + .toggleClass( this.widgetFullName + "-disabled ui-state-disabled", !!value ) + .attr( "aria-disabled", value ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _on: function( element, handlers ) { + // no element argument, shuffle and use this.element + if ( !handlers ) { + handlers = element; + element = this.element; + } else { + // accept selectors, DOM elements + element = $( element ); + this.bindings = this.bindings.add( element ); + } + + var instance = this; + $.each( handlers, function( event, handler ) { + function handlerProxy() { + // allow widgets to customize the disabled handling + // - disabled as an array instead of boolean + // - disabled class as method for disabling individual parts + if ( instance.options.disabled === true || + $( this ).hasClass( "ui-state-disabled" ) ) { + return; + } + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + + // copy the guid so direct unbinding works + if ( typeof handler !== "string" ) { + handlerProxy.guid = handler.guid = + handler.guid || handlerProxy.guid || $.guid++; + } + + var match = event.match( /^(\w+)\s*(.*)$/ ), + eventName = match[1] + instance.eventNamespace, + selector = match[2]; + if ( selector ) { + instance.widget().delegate( selector, eventName, handlerProxy ); + } else { + element.bind( eventName, handlerProxy ); + } + }); + }, + + _off: function( element, eventName ) { + eventName = (eventName || "").split( " " ).join( this.eventNamespace + " " ) + this.eventNamespace; + element.unbind( eventName ).undelegate( eventName ); + }, + + _delay: function( handler, delay ) { + function handlerProxy() { + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + var instance = this; + return setTimeout( handlerProxy, delay || 0 ); + }, + + _hoverable: function( element ) { + this.hoverable = this.hoverable.add( element ); + this._on( element, { + mouseenter: function( event ) { + $( event.currentTarget ).addClass( "ui-state-hover" ); + }, + mouseleave: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-hover" ); + } + }); + }, + + _focusable: function( element ) { + this.focusable = this.focusable.add( element ); + this._on( element, { + focusin: function( event ) { + $( event.currentTarget ).addClass( "ui-state-focus" ); + }, + focusout: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-focus" ); + } + }); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + return !( $.isFunction( callback ) && + callback.apply( this.element[0], [ event ].concat( data ) ) === false || + event.isDefaultPrevented() ); + } +}; + +$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) { + $.Widget.prototype[ "_" + method ] = function( element, options, callback ) { + if ( typeof options === "string" ) { + options = { effect: options }; + } + var hasOptions, + effectName = !options ? + method : + options === true || typeof options === "number" ? + defaultEffect : + options.effect || defaultEffect; + options = options || {}; + if ( typeof options === "number" ) { + options = { duration: options }; + } + hasOptions = !$.isEmptyObject( options ); + options.complete = callback; + if ( options.delay ) { + element.delay( options.delay ); + } + if ( hasOptions && $.effects && ( $.effects.effect[ effectName ] || $.uiBackCompat !== false && $.effects[ effectName ] ) ) { + element[ method ]( options ); + } else if ( effectName !== method && element[ effectName ] ) { + element[ effectName ]( options.duration, options.easing, callback ); + } else { + element.queue(function( next ) { + $( this )[ method ](); + if ( callback ) { + callback.call( element[ 0 ] ); + } + next(); + }); + } + }; +}); + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + $.Widget.prototype._getCreateOptions = function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }; +} + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.widget", { + // decorate the parent _createWidget to trigger `widgetinit` for users + // who wish to do post post `widgetcreate` alterations/additions + // + // TODO create a pull request for jquery ui to trigger this event + // in the original _createWidget + _createWidget: function() { + $.Widget.prototype._createWidget.apply( this, arguments ); + this._trigger( 'init' ); + }, + + _getCreateOptions: function() { + + var elem = this.element, + options = {}; + + $.each( this.options, function( option ) { + + var value = elem.jqmData( option.replace( /[A-Z]/g, function( c ) { + return "-" + c.toLowerCase(); + }) + ); + + if ( value !== undefined ) { + options[ option ] = value; + } + }); + + return options; + }, + + enhanceWithin: function( target, useKeepNative ) { + this.enhance( $( this.options.initSelector, $( target )), useKeepNative ); + }, + + enhance: function( targets, useKeepNative ) { + var page, keepNative, $widgetElements = $( targets ), self = this; + + // if ignoreContentEnabled is set to true the framework should + // only enhance the selected elements when they do NOT have a + // parent with the data-namespace-ignore attribute + $widgetElements = $.mobile.enhanceable( $widgetElements ); + + if ( useKeepNative && $widgetElements.length ) { + // TODO remove dependency on the page widget for the keepNative. + // Currently the keepNative value is defined on the page prototype so + // the method is as well + page = $.mobile.closestPageData( $widgetElements ); + keepNative = ( page && page.keepNativeSelector()) || ""; + + $widgetElements = $widgetElements.not( keepNative ); + } + + $widgetElements[ this.widgetName ](); + }, + + raise: function( msg ) { + throw "Widget [" + this.widgetName + "]: " + msg; + } +}); + +})( jQuery ); + + +(function( $, window ) { + // DEPRECATED + // NOTE global mobile object settings + $.extend( $.mobile, { + // DEPRECATED Should the text be visble in the loading message? + loadingMessageTextVisible: undefined, + + // DEPRECATED When the text is visible, what theme does the loading box use? + loadingMessageTheme: undefined, + + // DEPRECATED default message setting + loadingMessage: undefined, + + // DEPRECATED + // Turn on/off page loading message. Theme doubles as an object argument + // with the following shape: { theme: '', text: '', html: '', textVisible: '' } + // NOTE that the $.mobile.loading* settings and params past the first are deprecated + showPageLoadingMsg: function( theme, msgText, textonly ) { + $.mobile.loading( 'show', theme, msgText, textonly ); + }, + + // DEPRECATED + hidePageLoadingMsg: function() { + $.mobile.loading( 'hide' ); + }, + + loading: function() { + this.loaderWidget.loader.apply( this.loaderWidget, arguments ); + } + }); + + // TODO move loader class down into the widget settings + var loaderClass = "ui-loader", $html = $( "html" ), $window = $( window ); + + $.widget( "mobile.loader", { + // NOTE if the global config settings are defined they will override these + // options + options: { + // the theme for the loading message + theme: "a", + + // whether the text in the loading message is shown + textVisible: false, + + // custom html for the inner content of the loading message + html: "", + + // the text to be displayed when the popup is shown + text: "loading" + }, + + defaultHtml: "
" + + "" + + "

" + + "
", + + // For non-fixed supportin browsers. Position at y center (if scrollTop supported), above the activeBtn (if defined), or just 100px from top + fakeFixLoader: function() { + var activeBtn = $( "." + $.mobile.activeBtnClass ).first(); + + this.element + .css({ + top: $.support.scrollTop && $window.scrollTop() + $window.height() / 2 || + activeBtn.length && activeBtn.offset().top || 100 + }); + }, + + // check position of loader to see if it appears to be "fixed" to center + // if not, use abs positioning + checkLoaderPosition: function() { + var offset = this.element.offset(), + scrollTop = $window.scrollTop(), + screenHeight = $.mobile.getScreenHeight(); + + if ( offset.top < scrollTop || ( offset.top - scrollTop ) > screenHeight ) { + this.element.addClass( "ui-loader-fakefix" ); + this.fakeFixLoader(); + $window + .unbind( "scroll", this.checkLoaderPosition ) + .bind( "scroll", this.fakeFixLoader ); + } + }, + + resetHtml: function() { + this.element.html( $( this.defaultHtml ).html() ); + }, + + // Turn on/off page loading message. Theme doubles as an object argument + // with the following shape: { theme: '', text: '', html: '', textVisible: '' } + // NOTE that the $.mobile.loading* settings and params past the first are deprecated + // TODO sweet jesus we need to break some of this out + show: function( theme, msgText, textonly ) { + var textVisible, message, $header, loadSettings; + + this.resetHtml(); + + // use the prototype options so that people can set them globally at + // mobile init. Consistency, it's what's for dinner + if ( $.type(theme) === "object" ) { + loadSettings = $.extend( {}, this.options, theme ); + + // prefer object property from the param then the old theme setting + theme = loadSettings.theme || $.mobile.loadingMessageTheme; + } else { + loadSettings = this.options; + + // here we prefer the them value passed as a string argument, then + // we prefer the global option because we can't use undefined default + // prototype options, then the prototype option + theme = theme || $.mobile.loadingMessageTheme || loadSettings.theme; + } + + // set the message text, prefer the param, then the settings object + // then loading message + message = msgText || $.mobile.loadingMessage || loadSettings.text; + + // prepare the dom + $html.addClass( "ui-loading" ); + + if ( $.mobile.loadingMessage !== false || loadSettings.html ) { + // boolean values require a bit more work :P, supports object properties + // and old settings + if ( $.mobile.loadingMessageTextVisible !== undefined ) { + textVisible = $.mobile.loadingMessageTextVisible; + } else { + textVisible = loadSettings.textVisible; + } + + // add the proper css given the options (theme, text, etc) + // Force text visibility if the second argument was supplied, or + // if the text was explicitly set in the object args + this.element.attr("class", loaderClass + + " ui-corner-all ui-body-" + theme + + " ui-loader-" + ( textVisible || msgText || theme.text ? "verbose" : "default" ) + + ( loadSettings.textonly || textonly ? " ui-loader-textonly" : "" ) ); + + // TODO verify that jquery.fn.html is ok to use in both cases here + // this might be overly defensive in preventing unknowing xss + // if the html attribute is defined on the loading settings, use that + // otherwise use the fallbacks from above + if ( loadSettings.html ) { + this.element.html( loadSettings.html ); + } else { + this.element.find( "h1" ).text( message ); + } + + // attach the loader to the DOM + this.element.appendTo( $.mobile.pageContainer ); + + // check that the loader is visible + this.checkLoaderPosition(); + + // on scroll check the loader position + $window.bind( "scroll", $.proxy( this.checkLoaderPosition, this ) ); + } + }, + + hide: function() { + $html.removeClass( "ui-loading" ); + + if ( $.mobile.loadingMessage ) { + this.element.removeClass( "ui-loader-fakefix" ); + } + + $( window ).unbind( "scroll", $.proxy( this.fakeFixLoader, this) ); + $( window ).unbind( "scroll", $.proxy( this.checkLoaderPosition, this ) ); + } + }); + + $window.bind( 'pagecontainercreate', function() { + $.mobile.loaderWidget = $.mobile.loaderWidget || $( $.mobile.loader.prototype.defaultHtml ).loader(); + }); +})(jQuery, this); + + + +// This plugin is an experiment for abstracting away the touch and mouse +// events so that developers don't have to worry about which method of input +// the device their document is loaded on supports. +// +// The idea here is to allow the developer to register listeners for the +// basic mouse events, such as mousedown, mousemove, mouseup, and click, +// and the plugin will take care of registering the correct listeners +// behind the scenes to invoke the listener at the fastest possible time +// for that device, while still retaining the order of event firing in +// the traditional mouse environment, should multiple handlers be registered +// on the same element for different events. +// +// The current version exposes the following virtual events to jQuery bind methods: +// "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel" + +(function( $, window, document, undefined ) { + +var dataPropertyName = "virtualMouseBindings", + touchTargetPropertyName = "virtualTouchID", + virtualEventNames = "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split( " " ), + touchEventProps = "clientX clientY pageX pageY screenX screenY".split( " " ), + mouseHookProps = $.event.mouseHooks ? $.event.mouseHooks.props : [], + mouseEventProps = $.event.props.concat( mouseHookProps ), + activeDocHandlers = {}, + resetTimerID = 0, + startX = 0, + startY = 0, + didScroll = false, + clickBlockList = [], + blockMouseTriggers = false, + blockTouchTriggers = false, + eventCaptureSupported = "addEventListener" in document, + $document = $( document ), + nextTouchID = 1, + lastTouchID = 0, threshold; + +$.vmouse = { + moveDistanceThreshold: 10, + clickDistanceThreshold: 10, + resetTimerDuration: 1500 +}; + +function getNativeEvent( event ) { + + while ( event && typeof event.originalEvent !== "undefined" ) { + event = event.originalEvent; + } + return event; +} + +function createVirtualEvent( event, eventType ) { + + var t = event.type, + oe, props, ne, prop, ct, touch, i, j, len; + + event = $.Event( event ); + event.type = eventType; + + oe = event.originalEvent; + props = $.event.props; + + // addresses separation of $.event.props in to $.event.mouseHook.props and Issue 3280 + // https://github.com/jquery/jquery-mobile/issues/3280 + if ( t.search( /^(mouse|click)/ ) > -1 ) { + props = mouseEventProps; + } + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( oe ) { + for ( i = props.length, prop; i; ) { + prop = props[ --i ]; + event[ prop ] = oe[ prop ]; + } + } + + // make sure that if the mouse and click virtual events are generated + // without a .which one is defined + if ( t.search(/mouse(down|up)|click/) > -1 && !event.which ) { + event.which = 1; + } + + if ( t.search(/^touch/) !== -1 ) { + ne = getNativeEvent( oe ); + t = ne.touches; + ct = ne.changedTouches; + touch = ( t && t.length ) ? t[0] : ( ( ct && ct.length ) ? ct[ 0 ] : undefined ); + + if ( touch ) { + for ( j = 0, len = touchEventProps.length; j < len; j++) { + prop = touchEventProps[ j ]; + event[ prop ] = touch[ prop ]; + } + } + } + + return event; +} + +function getVirtualBindingFlags( element ) { + + var flags = {}, + b, k; + + while ( element ) { + + b = $.data( element, dataPropertyName ); + + for ( k in b ) { + if ( b[ k ] ) { + flags[ k ] = flags.hasVirtualBinding = true; + } + } + element = element.parentNode; + } + return flags; +} + +function getClosestElementWithVirtualBinding( element, eventType ) { + var b; + while ( element ) { + + b = $.data( element, dataPropertyName ); + + if ( b && ( !eventType || b[ eventType ] ) ) { + return element; + } + element = element.parentNode; + } + return null; +} + +function enableTouchBindings() { + blockTouchTriggers = false; +} + +function disableTouchBindings() { + blockTouchTriggers = true; +} + +function enableMouseBindings() { + lastTouchID = 0; + clickBlockList.length = 0; + blockMouseTriggers = false; + + // When mouse bindings are enabled, our + // touch bindings are disabled. + disableTouchBindings(); +} + +function disableMouseBindings() { + // When mouse bindings are disabled, our + // touch bindings are enabled. + enableTouchBindings(); +} + +function startResetTimer() { + clearResetTimer(); + resetTimerID = setTimeout( function() { + resetTimerID = 0; + enableMouseBindings(); + }, $.vmouse.resetTimerDuration ); +} + +function clearResetTimer() { + if ( resetTimerID ) { + clearTimeout( resetTimerID ); + resetTimerID = 0; + } +} + +function triggerVirtualEvent( eventType, event, flags ) { + var ve; + + if ( ( flags && flags[ eventType ] ) || + ( !flags && getClosestElementWithVirtualBinding( event.target, eventType ) ) ) { + + ve = createVirtualEvent( event, eventType ); + + $( event.target).trigger( ve ); + } + + return ve; +} + +function mouseEventCallback( event ) { + var touchID = $.data( event.target, touchTargetPropertyName ); + + if ( !blockMouseTriggers && ( !lastTouchID || lastTouchID !== touchID ) ) { + var ve = triggerVirtualEvent( "v" + event.type, event ); + if ( ve ) { + if ( ve.isDefaultPrevented() ) { + event.preventDefault(); + } + if ( ve.isPropagationStopped() ) { + event.stopPropagation(); + } + if ( ve.isImmediatePropagationStopped() ) { + event.stopImmediatePropagation(); + } + } + } +} + +function handleTouchStart( event ) { + + var touches = getNativeEvent( event ).touches, + target, flags; + + if ( touches && touches.length === 1 ) { + + target = event.target; + flags = getVirtualBindingFlags( target ); + + if ( flags.hasVirtualBinding ) { + + lastTouchID = nextTouchID++; + $.data( target, touchTargetPropertyName, lastTouchID ); + + clearResetTimer(); + + disableMouseBindings(); + didScroll = false; + + var t = getNativeEvent( event ).touches[ 0 ]; + startX = t.pageX; + startY = t.pageY; + + triggerVirtualEvent( "vmouseover", event, flags ); + triggerVirtualEvent( "vmousedown", event, flags ); + } + } +} + +function handleScroll( event ) { + if ( blockTouchTriggers ) { + return; + } + + if ( !didScroll ) { + triggerVirtualEvent( "vmousecancel", event, getVirtualBindingFlags( event.target ) ); + } + + didScroll = true; + startResetTimer(); +} + +function handleTouchMove( event ) { + if ( blockTouchTriggers ) { + return; + } + + var t = getNativeEvent( event ).touches[ 0 ], + didCancel = didScroll, + moveThreshold = $.vmouse.moveDistanceThreshold, + flags = getVirtualBindingFlags( event.target ); + + didScroll = didScroll || + ( Math.abs( t.pageX - startX ) > moveThreshold || + Math.abs( t.pageY - startY ) > moveThreshold ); + + + if ( didScroll && !didCancel ) { + triggerVirtualEvent( "vmousecancel", event, flags ); + } + + triggerVirtualEvent( "vmousemove", event, flags ); + startResetTimer(); +} + +function handleTouchEnd( event ) { + if ( blockTouchTriggers ) { + return; + } + + disableTouchBindings(); + + var flags = getVirtualBindingFlags( event.target ), + t; + triggerVirtualEvent( "vmouseup", event, flags ); + + if ( !didScroll ) { + var ve = triggerVirtualEvent( "vclick", event, flags ); + if ( ve && ve.isDefaultPrevented() ) { + // The target of the mouse events that follow the touchend + // event don't necessarily match the target used during the + // touch. This means we need to rely on coordinates for blocking + // any click that is generated. + t = getNativeEvent( event ).changedTouches[ 0 ]; + clickBlockList.push({ + touchID: lastTouchID, + x: t.clientX, + y: t.clientY + }); + + // Prevent any mouse events that follow from triggering + // virtual event notifications. + blockMouseTriggers = true; + } + } + triggerVirtualEvent( "vmouseout", event, flags); + didScroll = false; + + startResetTimer(); +} + +function hasVirtualBindings( ele ) { + var bindings = $.data( ele, dataPropertyName ), + k; + + if ( bindings ) { + for ( k in bindings ) { + if ( bindings[ k ] ) { + return true; + } + } + } + return false; +} + +function dummyMouseHandler() {} + +function getSpecialEventObject( eventType ) { + var realType = eventType.substr( 1 ); + + return { + setup: function( data, namespace ) { + // If this is the first virtual mouse binding for this element, + // add a bindings object to its data. + + if ( !hasVirtualBindings( this ) ) { + $.data( this, dataPropertyName, {} ); + } + + // If setup is called, we know it is the first binding for this + // eventType, so initialize the count for the eventType to zero. + var bindings = $.data( this, dataPropertyName ); + bindings[ eventType ] = true; + + // If this is the first virtual mouse event for this type, + // register a global handler on the document. + + activeDocHandlers[ eventType ] = ( activeDocHandlers[ eventType ] || 0 ) + 1; + + if ( activeDocHandlers[ eventType ] === 1 ) { + $document.bind( realType, mouseEventCallback ); + } + + // Some browsers, like Opera Mini, won't dispatch mouse/click events + // for elements unless they actually have handlers registered on them. + // To get around this, we register dummy handlers on the elements. + + $( this ).bind( realType, dummyMouseHandler ); + + // For now, if event capture is not supported, we rely on mouse handlers. + if ( eventCaptureSupported ) { + // If this is the first virtual mouse binding for the document, + // register our touchstart handler on the document. + + activeDocHandlers[ "touchstart" ] = ( activeDocHandlers[ "touchstart" ] || 0) + 1; + + if ( activeDocHandlers[ "touchstart" ] === 1 ) { + $document.bind( "touchstart", handleTouchStart ) + .bind( "touchend", handleTouchEnd ) + + // On touch platforms, touching the screen and then dragging your finger + // causes the window content to scroll after some distance threshold is + // exceeded. On these platforms, a scroll prevents a click event from being + // dispatched, and on some platforms, even the touchend is suppressed. To + // mimic the suppression of the click event, we need to watch for a scroll + // event. Unfortunately, some platforms like iOS don't dispatch scroll + // events until *AFTER* the user lifts their finger (touchend). This means + // we need to watch both scroll and touchmove events to figure out whether + // or not a scroll happenens before the touchend event is fired. + + .bind( "touchmove", handleTouchMove ) + .bind( "scroll", handleScroll ); + } + } + }, + + teardown: function( data, namespace ) { + // If this is the last virtual binding for this eventType, + // remove its global handler from the document. + + --activeDocHandlers[ eventType ]; + + if ( !activeDocHandlers[ eventType ] ) { + $document.unbind( realType, mouseEventCallback ); + } + + if ( eventCaptureSupported ) { + // If this is the last virtual mouse binding in existence, + // remove our document touchstart listener. + + --activeDocHandlers[ "touchstart" ]; + + if ( !activeDocHandlers[ "touchstart" ] ) { + $document.unbind( "touchstart", handleTouchStart ) + .unbind( "touchmove", handleTouchMove ) + .unbind( "touchend", handleTouchEnd ) + .unbind( "scroll", handleScroll ); + } + } + + var $this = $( this ), + bindings = $.data( this, dataPropertyName ); + + // teardown may be called when an element was + // removed from the DOM. If this is the case, + // jQuery core may have already stripped the element + // of any data bindings so we need to check it before + // using it. + if ( bindings ) { + bindings[ eventType ] = false; + } + + // Unregister the dummy event handler. + + $this.unbind( realType, dummyMouseHandler ); + + // If this is the last virtual mouse binding on the + // element, remove the binding data from the element. + + if ( !hasVirtualBindings( this ) ) { + $this.removeData( dataPropertyName ); + } + } + }; +} + +// Expose our custom events to the jQuery bind/unbind mechanism. + +for ( var i = 0; i < virtualEventNames.length; i++ ) { + $.event.special[ virtualEventNames[ i ] ] = getSpecialEventObject( virtualEventNames[ i ] ); +} + +// Add a capture click handler to block clicks. +// Note that we require event capture support for this so if the device +// doesn't support it, we punt for now and rely solely on mouse events. +if ( eventCaptureSupported ) { + document.addEventListener( "click", function( e ) { + var cnt = clickBlockList.length, + target = e.target, + x, y, ele, i, o, touchID; + + if ( cnt ) { + x = e.clientX; + y = e.clientY; + threshold = $.vmouse.clickDistanceThreshold; + + // The idea here is to run through the clickBlockList to see if + // the current click event is in the proximity of one of our + // vclick events that had preventDefault() called on it. If we find + // one, then we block the click. + // + // Why do we have to rely on proximity? + // + // Because the target of the touch event that triggered the vclick + // can be different from the target of the click event synthesized + // by the browser. The target of a mouse/click event that is syntehsized + // from a touch event seems to be implementation specific. For example, + // some browsers will fire mouse/click events for a link that is near + // a touch event, even though the target of the touchstart/touchend event + // says the user touched outside the link. Also, it seems that with most + // browsers, the target of the mouse/click event is not calculated until the + // time it is dispatched, so if you replace an element that you touched + // with another element, the target of the mouse/click will be the new + // element underneath that point. + // + // Aside from proximity, we also check to see if the target and any + // of its ancestors were the ones that blocked a click. This is necessary + // because of the strange mouse/click target calculation done in the + // Android 2.1 browser, where if you click on an element, and there is a + // mouse/click handler on one of its ancestors, the target will be the + // innermost child of the touched element, even if that child is no where + // near the point of touch. + + ele = target; + + while ( ele ) { + for ( i = 0; i < cnt; i++ ) { + o = clickBlockList[ i ]; + touchID = 0; + + if ( ( ele === target && Math.abs( o.x - x ) < threshold && Math.abs( o.y - y ) < threshold ) || + $.data( ele, touchTargetPropertyName ) === o.touchID ) { + // XXX: We may want to consider removing matches from the block list + // instead of waiting for the reset timer to fire. + e.preventDefault(); + e.stopPropagation(); + return; + } + } + ele = ele.parentNode; + } + } + }, true); +} +})( jQuery, window, document ); + + (function( $, undefined ) { + var support = { + touch: "ontouchend" in document + }; + + $.mobile = $.mobile || {}; + $.mobile.support = $.mobile.support || {}; + $.extend( $.support, support ); + $.extend( $.mobile.support, support ); + }( jQuery )); + + +(function( $, window, undefined ) { + // add new event shortcuts + $.each( ( "touchstart touchmove touchend " + + "tap taphold " + + "swipe swipeleft swiperight " + + "scrollstart scrollstop" ).split( " " ), function( i, name ) { + + $.fn[ name ] = function( fn ) { + return fn ? this.bind( name, fn ) : this.trigger( name ); + }; + + // jQuery < 1.8 + if ( $.attrFn ) { + $.attrFn[ name ] = true; + } + }); + + var supportTouch = $.mobile.support.touch, + scrollEvent = "touchmove scroll", + touchStartEvent = supportTouch ? "touchstart" : "mousedown", + touchStopEvent = supportTouch ? "touchend" : "mouseup", + touchMoveEvent = supportTouch ? "touchmove" : "mousemove"; + + function triggerCustomEvent( obj, eventType, event ) { + var originalType = event.type; + event.type = eventType; + $.event.handle.call( obj, event ); + event.type = originalType; + } + + // also handles scrollstop + $.event.special.scrollstart = { + + enabled: true, + + setup: function() { + + var thisObject = this, + $this = $( thisObject ), + scrolling, + timer; + + function trigger( event, state ) { + scrolling = state; + triggerCustomEvent( thisObject, scrolling ? "scrollstart" : "scrollstop", event ); + } + + // iPhone triggers scroll after a small delay; use touchmove instead + $this.bind( scrollEvent, function( event ) { + + if ( !$.event.special.scrollstart.enabled ) { + return; + } + + if ( !scrolling ) { + trigger( event, true ); + } + + clearTimeout( timer ); + timer = setTimeout( function() { + trigger( event, false ); + }, 50 ); + }); + } + }; + + // also handles taphold + $.event.special.tap = { + tapholdThreshold: 750, + + setup: function() { + var thisObject = this, + $this = $( thisObject ); + + $this.bind( "vmousedown", function( event ) { + + if ( event.which && event.which !== 1 ) { + return false; + } + + var origTarget = event.target, + origEvent = event.originalEvent, + timer; + + function clearTapTimer() { + clearTimeout( timer ); + } + + function clearTapHandlers() { + clearTapTimer(); + + $this.unbind( "vclick", clickHandler ) + .unbind( "vmouseup", clearTapTimer ); + $( document ).unbind( "vmousecancel", clearTapHandlers ); + } + + function clickHandler( event ) { + clearTapHandlers(); + + // ONLY trigger a 'tap' event if the start target is + // the same as the stop target. + if ( origTarget === event.target ) { + triggerCustomEvent( thisObject, "tap", event ); + } + } + + $this.bind( "vmouseup", clearTapTimer ) + .bind( "vclick", clickHandler ); + $( document ).bind( "vmousecancel", clearTapHandlers ); + + timer = setTimeout( function() { + triggerCustomEvent( thisObject, "taphold", $.Event( "taphold", { target: origTarget } ) ); + }, $.event.special.tap.tapholdThreshold ); + }); + } + }; + + // also handles swipeleft, swiperight + $.event.special.swipe = { + scrollSupressionThreshold: 30, // More than this horizontal displacement, and we will suppress scrolling. + + durationThreshold: 1000, // More time than this, and it isn't a swipe. + + horizontalDistanceThreshold: 30, // Swipe horizontal displacement must be more than this. + + verticalDistanceThreshold: 75, // Swipe vertical displacement must be less than this. + + setup: function() { + var thisObject = this, + $this = $( thisObject ); + + $this.bind( touchStartEvent, function( event ) { + var data = event.originalEvent.touches ? + event.originalEvent.touches[ 0 ] : event, + start = { + time: ( new Date() ).getTime(), + coords: [ data.pageX, data.pageY ], + origin: $( event.target ) + }, + stop; + + function moveHandler( event ) { + + if ( !start ) { + return; + } + + var data = event.originalEvent.touches ? + event.originalEvent.touches[ 0 ] : event; + + stop = { + time: ( new Date() ).getTime(), + coords: [ data.pageX, data.pageY ] + }; + + // prevent scrolling + if ( Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.scrollSupressionThreshold ) { + event.preventDefault(); + } + } + + $this.bind( touchMoveEvent, moveHandler ) + .one( touchStopEvent, function( event ) { + $this.unbind( touchMoveEvent, moveHandler ); + + if ( start && stop ) { + if ( stop.time - start.time < $.event.special.swipe.durationThreshold && + Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.horizontalDistanceThreshold && + Math.abs( start.coords[ 1 ] - stop.coords[ 1 ] ) < $.event.special.swipe.verticalDistanceThreshold ) { + + start.origin.trigger( "swipe" ) + .trigger( start.coords[0] > stop.coords[ 0 ] ? "swipeleft" : "swiperight" ); + } + } + start = stop = undefined; + }); + }); + } + }; + $.each({ + scrollstop: "scrollstart", + taphold: "tap", + swipeleft: "swipe", + swiperight: "swipe" + }, function( event, sourceEvent ) { + + $.event.special[ event ] = { + setup: function() { + $( this ).bind( sourceEvent, $.noop ); + } + }; + }); + +})( jQuery, this ); + + (function( $, undefined ) { + $.extend( $.support, { + orientation: "orientation" in window && "onorientationchange" in window + }); + }( jQuery )); + + + // throttled resize event + (function( $ ) { + $.event.special.throttledresize = { + setup: function() { + $( this ).bind( "resize", handler ); + }, + teardown: function() { + $( this ).unbind( "resize", handler ); + } + }; + + var throttle = 250, + handler = function() { + curr = ( new Date() ).getTime(); + diff = curr - lastCall; + + if ( diff >= throttle ) { + + lastCall = curr; + $( this ).trigger( "throttledresize" ); + + } else { + + if ( heldCall ) { + clearTimeout( heldCall ); + } + + // Promise a held call will still execute + heldCall = setTimeout( handler, throttle - diff ); + } + }, + lastCall = 0, + heldCall, + curr, + diff; + })( jQuery ); + +(function( $, window ) { + var win = $( window ), + event_name = "orientationchange", + special_event, + get_orientation, + last_orientation, + initial_orientation_is_landscape, + initial_orientation_is_default, + portrait_map = { "0": true, "180": true }; + + // It seems that some device/browser vendors use window.orientation values 0 and 180 to + // denote the "default" orientation. For iOS devices, and most other smart-phones tested, + // the default orientation is always "portrait", but in some Android and RIM based tablets, + // the default orientation is "landscape". The following code attempts to use the window + // dimensions to figure out what the current orientation is, and then makes adjustments + // to the to the portrait_map if necessary, so that we can properly decode the + // window.orientation value whenever get_orientation() is called. + // + // Note that we used to use a media query to figure out what the orientation the browser + // thinks it is in: + // + // initial_orientation_is_landscape = $.mobile.media("all and (orientation: landscape)"); + // + // but there was an iPhone/iPod Touch bug beginning with iOS 4.2, up through iOS 5.1, + // where the browser *ALWAYS* applied the landscape media query. This bug does not + // happen on iPad. + + if ( $.support.orientation ) { + + // Check the window width and height to figure out what the current orientation + // of the device is at this moment. Note that we've initialized the portrait map + // values to 0 and 180, *AND* we purposely check for landscape so that if we guess + // wrong, , we default to the assumption that portrait is the default orientation. + // We use a threshold check below because on some platforms like iOS, the iPhone + // form-factor can report a larger width than height if the user turns on the + // developer console. The actual threshold value is somewhat arbitrary, we just + // need to make sure it is large enough to exclude the developer console case. + + var ww = window.innerWidth || $( window ).width(), + wh = window.innerHeight || $( window ).height(), + landscape_threshold = 50; + + initial_orientation_is_landscape = ww > wh && ( ww - wh ) > landscape_threshold; + + + // Now check to see if the current window.orientation is 0 or 180. + initial_orientation_is_default = portrait_map[ window.orientation ]; + + // If the initial orientation is landscape, but window.orientation reports 0 or 180, *OR* + // if the initial orientation is portrait, but window.orientation reports 90 or -90, we + // need to flip our portrait_map values because landscape is the default orientation for + // this device/browser. + if ( ( initial_orientation_is_landscape && initial_orientation_is_default ) || ( !initial_orientation_is_landscape && !initial_orientation_is_default ) ) { + portrait_map = { "-90": true, "90": true }; + } + } + + $.event.special.orientationchange = $.extend( {}, $.event.special.orientationchange, { + setup: function() { + // If the event is supported natively, return false so that jQuery + // will bind to the event using DOM methods. + if ( $.support.orientation && !$.event.special.orientationchange.disabled ) { + return false; + } + + // Get the current orientation to avoid initial double-triggering. + last_orientation = get_orientation(); + + // Because the orientationchange event doesn't exist, simulate the + // event by testing window dimensions on resize. + win.bind( "throttledresize", handler ); + }, + teardown: function() { + // If the event is not supported natively, return false so that + // jQuery will unbind the event using DOM methods. + if ( $.support.orientation && !$.event.special.orientationchange.disabled ) { + return false; + } + + // Because the orientationchange event doesn't exist, unbind the + // resize event handler. + win.unbind( "throttledresize", handler ); + }, + add: function( handleObj ) { + // Save a reference to the bound event handler. + var old_handler = handleObj.handler; + + + handleObj.handler = function( event ) { + // Modify event object, adding the .orientation property. + event.orientation = get_orientation(); + + // Call the originally-bound event handler and return its result. + return old_handler.apply( this, arguments ); + }; + } + }); + + // If the event is not supported natively, this handler will be bound to + // the window resize event to simulate the orientationchange event. + function handler() { + // Get the current orientation. + var orientation = get_orientation(); + + if ( orientation !== last_orientation ) { + // The orientation has changed, so trigger the orientationchange event. + last_orientation = orientation; + win.trigger( event_name ); + } + } + + // Get the current page orientation. This method is exposed publicly, should it + // be needed, as jQuery.event.special.orientationchange.orientation() + $.event.special.orientationchange.orientation = get_orientation = function() { + var isPortrait = true, elem = document.documentElement; + + // prefer window orientation to the calculation based on screensize as + // the actual screen resize takes place before or after the orientation change event + // has been fired depending on implementation (eg android 2.3 is before, iphone after). + // More testing is required to determine if a more reliable method of determining the new screensize + // is possible when orientationchange is fired. (eg, use media queries + element + opacity) + if ( $.support.orientation ) { + // if the window orientation registers as 0 or 180 degrees report + // portrait, otherwise landscape + isPortrait = portrait_map[ window.orientation ]; + } else { + isPortrait = elem && elem.clientWidth / elem.clientHeight < 1.1; + } + + return isPortrait ? "portrait" : "landscape"; + }; + + $.fn[ event_name ] = function( fn ) { + return fn ? this.bind( event_name, fn ) : this.trigger( event_name ); + }; + + // jQuery < 1.8 + if ( $.attrFn ) { + $.attrFn[ event_name ] = true; + } + +}( jQuery, this )); + + +(function( $, undefined ) { + +var $window = $( window ), + $html = $( "html" ); + +/* $.mobile.media method: pass a CSS media type or query and get a bool return + note: this feature relies on actual media query support for media queries, though types will work most anywhere + examples: + $.mobile.media('screen') // tests for screen media type + $.mobile.media('screen and (min-width: 480px)') // tests for screen media type with window width > 480px + $.mobile.media('@media screen and (-webkit-min-device-pixel-ratio: 2)') // tests for webkit 2x pixel ratio (iPhone 4) +*/ +$.mobile.media = (function() { + // TODO: use window.matchMedia once at least one UA implements it + var cache = {}, + testDiv = $( "
" ), + fakeBody = $( "" ).append( testDiv ); + + return function( query ) { + if ( !( query in cache ) ) { + var styleBlock = document.createElement( "style" ), + cssrule = "@media " + query + " { #jquery-mediatest { position:absolute; } }"; + + //must set type for IE! + styleBlock.type = "text/css"; + + if ( styleBlock.styleSheet ) { + styleBlock.styleSheet.cssText = cssrule; + } else { + styleBlock.appendChild( document.createTextNode(cssrule) ); + } + + $html.prepend( fakeBody ).prepend( styleBlock ); + cache[ query ] = testDiv.css( "position" ) === "absolute"; + fakeBody.add( styleBlock ).remove(); + } + return cache[ query ]; + }; +})(); + +})(jQuery); + +(function( $, undefined ) { + +// thx Modernizr +function propExists( prop ) { + var uc_prop = prop.charAt( 0 ).toUpperCase() + prop.substr( 1 ), + props = ( prop + " " + vendors.join( uc_prop + " " ) + uc_prop ).split( " " ); + + for ( var v in props ) { + if ( fbCSS[ props[ v ] ] !== undefined ) { + return true; + } + } +} + +var fakeBody = $( "" ).prependTo( "html" ), + fbCSS = fakeBody[ 0 ].style, + vendors = [ "Webkit", "Moz", "O" ], + webos = "palmGetResource" in window, //only used to rule out scrollTop + opera = window.opera, + operamini = window.operamini && ({}).toString.call( window.operamini ) === "[object OperaMini]", + bb = window.blackberry && !propExists( "-webkit-transform" ); //only used to rule out box shadow, as it's filled opaque on BB 5 and lower + + +function validStyle( prop, value, check_vend ) { + var div = document.createElement( 'div' ), + uc = function( txt ) { + return txt.charAt( 0 ).toUpperCase() + txt.substr( 1 ); + }, + vend_pref = function( vend ) { + return "-" + vend.charAt( 0 ).toLowerCase() + vend.substr( 1 ) + "-"; + }, + check_style = function( vend ) { + var vend_prop = vend_pref( vend ) + prop + ": " + value + ";", + uc_vend = uc( vend ), + propStyle = uc_vend + uc( prop ); + + div.setAttribute( "style", vend_prop ); + + if ( !!div.style[ propStyle ] ) { + ret = true; + } + }, + check_vends = check_vend ? [ check_vend ] : vendors, + ret; + + for( var i = 0; i < check_vends.length; i++ ) { + check_style( check_vends[i] ); + } + return !!ret; +} + +// Thanks to Modernizr src for this test idea. `perspective` check is limited to Moz to prevent a false positive for 3D transforms on Android. +function transform3dTest() { + var prop = "transform-3d"; + return validStyle( 'perspective', '10px', 'moz' ) || $.mobile.media( "(-" + vendors.join( "-" + prop + "),(-" ) + "-" + prop + "),(" + prop + ")" ); +} + +// Test for dynamic-updating base tag support ( allows us to avoid href,src attr rewriting ) +function baseTagTest() { + var fauxBase = location.protocol + "//" + location.host + location.pathname + "ui-dir/", + base = $( "head base" ), + fauxEle = null, + href = "", + link, rebase; + + if ( !base.length ) { + base = fauxEle = $( "", { "href": fauxBase }).appendTo( "head" ); + } else { + href = base.attr( "href" ); + } + + link = $( "" ).prependTo( fakeBody ); + rebase = link[ 0 ].href; + base[ 0 ].href = href || location.pathname; + + if ( fauxEle ) { + fauxEle.remove(); + } + return rebase.indexOf( fauxBase ) === 0; +} + +// Thanks Modernizr +function cssPointerEventsTest() { + var element = document.createElement( 'x' ), + documentElement = document.documentElement, + getComputedStyle = window.getComputedStyle, + supports; + + if ( !( 'pointerEvents' in element.style ) ) { + return false; + } + + element.style.pointerEvents = 'auto'; + element.style.pointerEvents = 'x'; + documentElement.appendChild( element ); + supports = getComputedStyle && + getComputedStyle( element, '' ).pointerEvents === 'auto'; + documentElement.removeChild( element ); + return !!supports; +} + +function boundingRect() { + var div = document.createElement( "div" ); + return typeof div.getBoundingClientRect !== "undefined"; +} + +// non-UA-based IE version check by James Padolsey, modified by jdalton - from http://gist.github.com/527683 +// allows for inclusion of IE 6+, including Windows Mobile 7 +$.extend( $.mobile, { browser: {} } ); +$.mobile.browser.ie = (function() { + var v = 3, + div = document.createElement( "div" ), + a = div.all || []; + + do { + div.innerHTML = ""; + } while( a[0] ); + + return v > 4 ? v : !v; +})(); + + +$.extend( $.support, { + cssTransitions: "WebKitTransitionEvent" in window || validStyle( 'transition', 'height 100ms linear' ) && !opera, + pushState: "pushState" in history && "replaceState" in history, + mediaquery: $.mobile.media( "only all" ), + cssPseudoElement: !!propExists( "content" ), + touchOverflow: !!propExists( "overflowScrolling" ), + cssTransform3d: transform3dTest(), + boxShadow: !!propExists( "boxShadow" ) && !bb, + scrollTop: ( "pageXOffset" in window || "scrollTop" in document.documentElement || "scrollTop" in fakeBody[ 0 ] ) && !webos && !operamini, + dynamicBaseTag: baseTagTest(), + cssPointerEvents: cssPointerEventsTest(), + boundingRect: boundingRect() +}); + +fakeBody.remove(); + + +// $.mobile.ajaxBlacklist is used to override ajaxEnabled on platforms that have known conflicts with hash history updates (BB5, Symbian) +// or that generally work better browsing in regular http for full page refreshes (Opera Mini) +// Note: This detection below is used as a last resort. +// We recommend only using these detection methods when all other more reliable/forward-looking approaches are not possible +var nokiaLTE7_3 = (function() { + + var ua = window.navigator.userAgent; + + //The following is an attempt to match Nokia browsers that are running Symbian/s60, with webkit, version 7.3 or older + return ua.indexOf( "Nokia" ) > -1 && + ( ua.indexOf( "Symbian/3" ) > -1 || ua.indexOf( "Series60/5" ) > -1 ) && + ua.indexOf( "AppleWebKit" ) > -1 && + ua.match( /(BrowserNG|NokiaBrowser)\/7\.[0-3]/ ); +})(); + +// Support conditions that must be met in order to proceed +// default enhanced qualifications are media query support OR IE 7+ + +$.mobile.gradeA = function() { + return ( $.support.mediaquery || $.mobile.browser.ie && $.mobile.browser.ie >= 7 ) && ( $.support.boundingRect || $.fn.jquery.match(/1\.[0-7+]\.[0-9+]?/) !== null ); +}; + +$.mobile.ajaxBlacklist = + // BlackBerry browsers, pre-webkit + window.blackberry && !window.WebKitPoint || + // Opera Mini + operamini || + // Symbian webkits pre 7.3 + nokiaLTE7_3; + +// Lastly, this workaround is the only way we've found so far to get pre 7.3 Symbian webkit devices +// to render the stylesheets when they're referenced before this script, as we'd recommend doing. +// This simply reappends the CSS in place, which for some reason makes it apply +if ( nokiaLTE7_3 ) { + $(function() { + $( "head link[rel='stylesheet']" ).attr( "rel", "alternate stylesheet" ).attr( "rel", "stylesheet" ); + }); +} + +// For ruling out shadows via css +if ( !$.support.boxShadow ) { + $( "html" ).addClass( "ui-mobile-nosupport-boxshadow" ); +} + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.page", $.mobile.widget, { + options: { + theme: "c", + domCache: false, + keepNativeDefault: ":jqmData(role='none'), :jqmData(role='nojs')" + }, + + _create: function() { + + var self = this; + + // if false is returned by the callbacks do not create the page + if ( self._trigger( "beforecreate" ) === false ) { + return false; + } + + self.element + .attr( "tabindex", "0" ) + .addClass( "ui-page ui-body-" + self.options.theme ) + .bind( "pagebeforehide", function() { + self.removeContainerBackground(); + } ) + .bind( "pagebeforeshow", function() { + self.setContainerBackground(); + } ); + + }, + + removeContainerBackground: function() { + $.mobile.pageContainer.removeClass( "ui-overlay-" + $.mobile.getInheritedTheme( this.element.parent() ) ); + }, + + // set the page container background to the page theme + setContainerBackground: function( theme ) { + if ( this.options.theme ) { + $.mobile.pageContainer.addClass( "ui-overlay-" + ( theme || this.options.theme ) ); + } + }, + + keepNativeSelector: function() { + var options = this.options, + keepNativeDefined = options.keepNative && $.trim( options.keepNative ); + + if ( keepNativeDefined && options.keepNative !== options.keepNativeDefault ) { + return [options.keepNative, options.keepNativeDefault].join( ", " ); + } + + return options.keepNativeDefault; + } +}); +})( jQuery ); + +// Script: jQuery hashchange event +// +// *Version: 1.3, Last updated: 7/21/2010* +// +// Project Home - http://benalman.com/projects/jquery-hashchange-plugin/ +// GitHub - http://github.com/cowboy/jquery-hashchange/ +// Source - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.js +// (Minified) - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.min.js (0.8kb gzipped) +// +// About: License +// +// Copyright (c) 2010 "Cowboy" Ben Alman, +// Dual licensed under the MIT and GPL licenses. +// http://benalman.com/about/license/ +// +// About: Examples +// +// These working examples, complete with fully commented code, illustrate a few +// ways in which this plugin can be used. +// +// hashchange event - http://benalman.com/code/projects/jquery-hashchange/examples/hashchange/ +// document.domain - http://benalman.com/code/projects/jquery-hashchange/examples/document_domain/ +// +// About: Support and Testing +// +// Information about what version or versions of jQuery this plugin has been +// tested with, what browsers it has been tested in, and where the unit tests +// reside (so you can test it yourself). +// +// jQuery Versions - 1.2.6, 1.3.2, 1.4.1, 1.4.2 +// Browsers Tested - Internet Explorer 6-8, Firefox 2-4, Chrome 5-6, Safari 3.2-5, +// Opera 9.6-10.60, iPhone 3.1, Android 1.6-2.2, BlackBerry 4.6-5. +// Unit Tests - http://benalman.com/code/projects/jquery-hashchange/unit/ +// +// About: Known issues +// +// While this jQuery hashchange event implementation is quite stable and +// robust, there are a few unfortunate browser bugs surrounding expected +// hashchange event-based behaviors, independent of any JavaScript +// window.onhashchange abstraction. See the following examples for more +// information: +// +// Chrome: Back Button - http://benalman.com/code/projects/jquery-hashchange/examples/bug-chrome-back-button/ +// Firefox: Remote XMLHttpRequest - http://benalman.com/code/projects/jquery-hashchange/examples/bug-firefox-remote-xhr/ +// WebKit: Back Button in an Iframe - http://benalman.com/code/projects/jquery-hashchange/examples/bug-webkit-hash-iframe/ +// Safari: Back Button from a different domain - http://benalman.com/code/projects/jquery-hashchange/examples/bug-safari-back-from-diff-domain/ +// +// Also note that should a browser natively support the window.onhashchange +// event, but not report that it does, the fallback polling loop will be used. +// +// About: Release History +// +// 1.3 - (7/21/2010) Reorganized IE6/7 Iframe code to make it more +// "removable" for mobile-only development. Added IE6/7 document.title +// support. Attempted to make Iframe as hidden as possible by using +// techniques from http://www.paciellogroup.com/blog/?p=604. Added +// support for the "shortcut" format $(window).hashchange( fn ) and +// $(window).hashchange() like jQuery provides for built-in events. +// Renamed jQuery.hashchangeDelay to and +// lowered its default value to 50. Added +// and properties plus document-domain.html +// file to address access denied issues when setting document.domain in +// IE6/7. +// 1.2 - (2/11/2010) Fixed a bug where coming back to a page using this plugin +// from a page on another domain would cause an error in Safari 4. Also, +// IE6/7 Iframe is now inserted after the body (this actually works), +// which prevents the page from scrolling when the event is first bound. +// Event can also now be bound before DOM ready, but it won't be usable +// before then in IE6/7. +// 1.1 - (1/21/2010) Incorporated document.documentMode test to fix IE8 bug +// where browser version is incorrectly reported as 8.0, despite +// inclusion of the X-UA-Compatible IE=EmulateIE7 meta tag. +// 1.0 - (1/9/2010) Initial Release. Broke out the jQuery BBQ event.special +// window.onhashchange functionality into a separate plugin for users +// who want just the basic event & back button support, without all the +// extra awesomeness that BBQ provides. This plugin will be included as +// part of jQuery BBQ, but also be available separately. + +(function( $, window, undefined ) { + // Reused string. + var str_hashchange = 'hashchange', + + // Method / object references. + doc = document, + fake_onhashchange, + special = $.event.special, + + // Does the browser support window.onhashchange? Note that IE8 running in + // IE7 compatibility mode reports true for 'onhashchange' in window, even + // though the event isn't supported, so also test document.documentMode. + doc_mode = doc.documentMode, + supports_onhashchange = 'on' + str_hashchange in window && ( doc_mode === undefined || doc_mode > 7 ); + + // Get location.hash (or what you'd expect location.hash to be) sans any + // leading #. Thanks for making this necessary, Firefox! + function get_fragment( url ) { + url = url || location.href; + return '#' + url.replace( /^[^#]*#?(.*)$/, '$1' ); + }; + + // Method: jQuery.fn.hashchange + // + // Bind a handler to the window.onhashchange event or trigger all bound + // window.onhashchange event handlers. This behavior is consistent with + // jQuery's built-in event handlers. + // + // Usage: + // + // > jQuery(window).hashchange( [ handler ] ); + // + // Arguments: + // + // handler - (Function) Optional handler to be bound to the hashchange + // event. This is a "shortcut" for the more verbose form: + // jQuery(window).bind( 'hashchange', handler ). If handler is omitted, + // all bound window.onhashchange event handlers will be triggered. This + // is a shortcut for the more verbose + // jQuery(window).trigger( 'hashchange' ). These forms are described in + // the section. + // + // Returns: + // + // (jQuery) The initial jQuery collection of elements. + + // Allow the "shortcut" format $(elem).hashchange( fn ) for binding and + // $(elem).hashchange() for triggering, like jQuery does for built-in events. + $.fn[ str_hashchange ] = function( fn ) { + return fn ? this.bind( str_hashchange, fn ) : this.trigger( str_hashchange ); + }; + + // Property: jQuery.fn.hashchange.delay + // + // The numeric interval (in milliseconds) at which the + // polling loop executes. Defaults to 50. + + // Property: jQuery.fn.hashchange.domain + // + // If you're setting document.domain in your JavaScript, and you want hash + // history to work in IE6/7, not only must this property be set, but you must + // also set document.domain BEFORE jQuery is loaded into the page. This + // property is only applicable if you are supporting IE6/7 (or IE8 operating + // in "IE7 compatibility" mode). + // + // In addition, the property must be set to the + // path of the included "document-domain.html" file, which can be renamed or + // modified if necessary (note that the document.domain specified must be the + // same in both your main JavaScript as well as in this file). + // + // Usage: + // + // jQuery.fn.hashchange.domain = document.domain; + + // Property: jQuery.fn.hashchange.src + // + // If, for some reason, you need to specify an Iframe src file (for example, + // when setting document.domain as in ), you can + // do so using this property. Note that when using this property, history + // won't be recorded in IE6/7 until the Iframe src file loads. This property + // is only applicable if you are supporting IE6/7 (or IE8 operating in "IE7 + // compatibility" mode). + // + // Usage: + // + // jQuery.fn.hashchange.src = 'path/to/file.html'; + + $.fn[ str_hashchange ].delay = 50; + /* + $.fn[ str_hashchange ].domain = null; + $.fn[ str_hashchange ].src = null; + */ + + // Event: hashchange event + // + // Fired when location.hash changes. In browsers that support it, the native + // HTML5 window.onhashchange event is used, otherwise a polling loop is + // initialized, running every milliseconds to + // see if the hash has changed. In IE6/7 (and IE8 operating in "IE7 + // compatibility" mode), a hidden Iframe is created to allow the back button + // and hash-based history to work. + // + // Usage as described in : + // + // > // Bind an event handler. + // > jQuery(window).hashchange( function(e) { + // > var hash = location.hash; + // > ... + // > }); + // > + // > // Manually trigger the event handler. + // > jQuery(window).hashchange(); + // + // A more verbose usage that allows for event namespacing: + // + // > // Bind an event handler. + // > jQuery(window).bind( 'hashchange', function(e) { + // > var hash = location.hash; + // > ... + // > }); + // > + // > // Manually trigger the event handler. + // > jQuery(window).trigger( 'hashchange' ); + // + // Additional Notes: + // + // * The polling loop and Iframe are not created until at least one handler + // is actually bound to the 'hashchange' event. + // * If you need the bound handler(s) to execute immediately, in cases where + // a location.hash exists on page load, via bookmark or page refresh for + // example, use jQuery(window).hashchange() or the more verbose + // jQuery(window).trigger( 'hashchange' ). + // * The event can be bound before DOM ready, but since it won't be usable + // before then in IE6/7 (due to the necessary Iframe), recommended usage is + // to bind it inside a DOM ready handler. + + // Override existing $.event.special.hashchange methods (allowing this plugin + // to be defined after jQuery BBQ in BBQ's source code). + special[ str_hashchange ] = $.extend( special[ str_hashchange ], { + + // Called only when the first 'hashchange' event is bound to window. + setup: function() { + // If window.onhashchange is supported natively, there's nothing to do.. + if ( supports_onhashchange ) { return false; } + + // Otherwise, we need to create our own. And we don't want to call this + // until the user binds to the event, just in case they never do, since it + // will create a polling loop and possibly even a hidden Iframe. + $( fake_onhashchange.start ); + }, + + // Called only when the last 'hashchange' event is unbound from window. + teardown: function() { + // If window.onhashchange is supported natively, there's nothing to do.. + if ( supports_onhashchange ) { return false; } + + // Otherwise, we need to stop ours (if possible). + $( fake_onhashchange.stop ); + } + + }); + + // fake_onhashchange does all the work of triggering the window.onhashchange + // event for browsers that don't natively support it, including creating a + // polling loop to watch for hash changes and in IE 6/7 creating a hidden + // Iframe to enable back and forward. + fake_onhashchange = (function() { + var self = {}, + timeout_id, + + // Remember the initial hash so it doesn't get triggered immediately. + last_hash = get_fragment(), + + fn_retval = function( val ) { return val; }, + history_set = fn_retval, + history_get = fn_retval; + + // Start the polling loop. + self.start = function() { + timeout_id || poll(); + }; + + // Stop the polling loop. + self.stop = function() { + timeout_id && clearTimeout( timeout_id ); + timeout_id = undefined; + }; + + // This polling loop checks every $.fn.hashchange.delay milliseconds to see + // if location.hash has changed, and triggers the 'hashchange' event on + // window when necessary. + function poll() { + var hash = get_fragment(), + history_hash = history_get( last_hash ); + + if ( hash !== last_hash ) { + history_set( last_hash = hash, history_hash ); + + $(window).trigger( str_hashchange ); + + } else if ( history_hash !== last_hash ) { + location.href = location.href.replace( /#.*/, '' ) + history_hash; + } + + timeout_id = setTimeout( poll, $.fn[ str_hashchange ].delay ); + }; + + // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv + // vvvvvvvvvvvvvvvvvvv REMOVE IF NOT SUPPORTING IE6/7/8 vvvvvvvvvvvvvvvvvvv + // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv + $.browser.msie && !supports_onhashchange && (function() { + // Not only do IE6/7 need the "magical" Iframe treatment, but so does IE8 + // when running in "IE7 compatibility" mode. + + var iframe, + iframe_src; + + // When the event is bound and polling starts in IE 6/7, create a hidden + // Iframe for history handling. + self.start = function() { + if ( !iframe ) { + iframe_src = $.fn[ str_hashchange ].src; + iframe_src = iframe_src && iframe_src + get_fragment(); + + // Create hidden Iframe. Attempt to make Iframe as hidden as possible + // by using techniques from http://www.paciellogroup.com/blog/?p=604. + iframe = $('